Jelajahi Sumber

配置文件新增

bobo04052021@163.com 9 bulan lalu
induk
melakukan
25ba2e0471
100 mengubah file dengan 26715 tambahan dan 1 penghapusan
  1. 1 1
      manifest.json
  2. 15 0
      node_modules/echarts/node_modules/tslib/CopyrightNotice.txt
  3. 12 0
      node_modules/echarts/node_modules/tslib/LICENSE.txt
  4. 164 0
      node_modules/echarts/node_modules/tslib/README.md
  5. 53 0
      node_modules/echarts/node_modules/tslib/modules/index.js
  6. 3 0
      node_modules/echarts/node_modules/tslib/modules/package.json
  7. 65 0
      node_modules/echarts/node_modules/tslib/package.json
  8. 130 0
      node_modules/echarts/node_modules/tslib/tslib.d.ts
  9. 1 0
      node_modules/echarts/node_modules/tslib/tslib.es6.html
  10. 239 0
      node_modules/echarts/node_modules/tslib/tslib.es6.js
  11. 1 0
      node_modules/echarts/node_modules/tslib/tslib.html
  12. 306 0
      node_modules/echarts/node_modules/tslib/tslib.js
  13. 4 0
      node_modules/echarts/node_modules/zrender/.eslintignore
  14. 29 0
      node_modules/echarts/node_modules/zrender/LICENSE
  15. 47 0
      node_modules/echarts/node_modules/zrender/README.md
  16. 118 0
      node_modules/echarts/node_modules/zrender/build/build.js
  17. 3 0
      node_modules/echarts/node_modules/zrender/build/package.json
  18. 48 0
      node_modules/echarts/node_modules/zrender/build/prepareNightly.js
  19. 88 0
      node_modules/echarts/node_modules/zrender/build/prepublish.js
  20. 67 0
      node_modules/echarts/node_modules/zrender/build/processLib.js
  21. 65 0
      node_modules/echarts/node_modules/zrender/build/progress.js
  22. 115 0
      node_modules/echarts/node_modules/zrender/build/transformImport.js
  23. 3 0
      node_modules/echarts/node_modules/zrender/dist/package.json
  24. 17458 0
      node_modules/echarts/node_modules/zrender/dist/zrender.js
  25. 0 0
      node_modules/echarts/node_modules/zrender/dist/zrender.js.map
  26. 0 0
      node_modules/echarts/node_modules/zrender/dist/zrender.min.js
  27. 2 0
      node_modules/echarts/node_modules/zrender/index.d.ts
  28. 1 0
      node_modules/echarts/node_modules/zrender/index.js
  29. 1 0
      node_modules/echarts/node_modules/zrender/index.ts
  30. 206 0
      node_modules/echarts/node_modules/zrender/lib/Element.d.ts
  31. 1050 0
      node_modules/echarts/node_modules/zrender/lib/Element.js
  32. 49 0
      node_modules/echarts/node_modules/zrender/lib/Handler.d.ts
  33. 295 0
      node_modules/echarts/node_modules/zrender/lib/Handler.js
  34. 24 0
      node_modules/echarts/node_modules/zrender/lib/PainterBase.d.ts
  35. 1 0
      node_modules/echarts/node_modules/zrender/lib/PainterBase.js
  36. 19 0
      node_modules/echarts/node_modules/zrender/lib/Storage.d.ts
  37. 158 0
      node_modules/echarts/node_modules/zrender/lib/Storage.js
  38. 2 0
      node_modules/echarts/node_modules/zrender/lib/all.d.ts
  39. 7 0
      node_modules/echarts/node_modules/zrender/lib/all.js
  40. 37 0
      node_modules/echarts/node_modules/zrender/lib/animation/Animation.d.ts
  41. 147 0
      node_modules/echarts/node_modules/zrender/lib/animation/Animation.js
  42. 95 0
      node_modules/echarts/node_modules/zrender/lib/animation/Animator.d.ts
  43. 737 0
      node_modules/echarts/node_modules/zrender/lib/animation/Animator.js
  44. 38 0
      node_modules/echarts/node_modules/zrender/lib/animation/Clip.d.ts
  45. 64 0
      node_modules/echarts/node_modules/zrender/lib/animation/Clip.js
  46. 1 0
      node_modules/echarts/node_modules/zrender/lib/animation/cubicEasing.d.ts
  47. 23 0
      node_modules/echarts/node_modules/zrender/lib/animation/cubicEasing.js
  48. 36 0
      node_modules/echarts/node_modules/zrender/lib/animation/easing.d.ts
  49. 195 0
      node_modules/echarts/node_modules/zrender/lib/animation/easing.js
  50. 3 0
      node_modules/echarts/node_modules/zrender/lib/animation/requestAnimationFrame.d.ts
  51. 10 0
      node_modules/echarts/node_modules/zrender/lib/animation/requestAnimationFrame.js
  52. 67 0
      node_modules/echarts/node_modules/zrender/lib/canvas/Layer.d.ts
  53. 297 0
      node_modules/echarts/node_modules/zrender/lib/canvas/Layer.js
  54. 72 0
      node_modules/echarts/node_modules/zrender/lib/canvas/Painter.d.ts
  55. 641 0
      node_modules/echarts/node_modules/zrender/lib/canvas/Painter.js
  56. 1 0
      node_modules/echarts/node_modules/zrender/lib/canvas/canvas.d.ts
  57. 3 0
      node_modules/echarts/node_modules/zrender/lib/canvas/canvas.js
  58. 4 0
      node_modules/echarts/node_modules/zrender/lib/canvas/dashStyle.d.ts
  59. 27 0
      node_modules/echarts/node_modules/zrender/lib/canvas/dashStyle.js
  60. 19 0
      node_modules/echarts/node_modules/zrender/lib/canvas/graphic.d.ts
  61. 558 0
      node_modules/echarts/node_modules/zrender/lib/canvas/graphic.js
  62. 13 0
      node_modules/echarts/node_modules/zrender/lib/canvas/helper.d.ts
  63. 79 0
      node_modules/echarts/node_modules/zrender/lib/canvas/helper.js
  64. 6 0
      node_modules/echarts/node_modules/zrender/lib/config.d.ts
  65. 13 0
      node_modules/echarts/node_modules/zrender/lib/config.js
  66. 1 0
      node_modules/echarts/node_modules/zrender/lib/contain/arc.d.ts
  67. 35 0
      node_modules/echarts/node_modules/zrender/lib/contain/arc.js
  68. 1 0
      node_modules/echarts/node_modules/zrender/lib/contain/cubic.d.ts
  69. 15 0
      node_modules/echarts/node_modules/zrender/lib/contain/cubic.js
  70. 1 0
      node_modules/echarts/node_modules/zrender/lib/contain/line.d.ts
  71. 24 0
      node_modules/echarts/node_modules/zrender/lib/contain/line.js
  72. 3 0
      node_modules/echarts/node_modules/zrender/lib/contain/path.d.ts
  73. 307 0
      node_modules/echarts/node_modules/zrender/lib/contain/path.js
  74. 2 0
      node_modules/echarts/node_modules/zrender/lib/contain/polygon.d.ts
  75. 22 0
      node_modules/echarts/node_modules/zrender/lib/contain/polygon.js
  76. 1 0
      node_modules/echarts/node_modules/zrender/lib/contain/quadratic.d.ts
  77. 15 0
      node_modules/echarts/node_modules/zrender/lib/contain/quadratic.js
  78. 23 0
      node_modules/echarts/node_modules/zrender/lib/contain/text.d.ts
  79. 170 0
      node_modules/echarts/node_modules/zrender/lib/contain/text.js
  80. 1 0
      node_modules/echarts/node_modules/zrender/lib/contain/util.d.ts
  81. 8 0
      node_modules/echarts/node_modules/zrender/lib/contain/util.js
  82. 1 0
      node_modules/echarts/node_modules/zrender/lib/contain/windingLine.d.ts
  83. 15 0
      node_modules/echarts/node_modules/zrender/lib/contain/windingLine.js
  84. 29 0
      node_modules/echarts/node_modules/zrender/lib/core/BoundingRect.d.ts
  85. 215 0
      node_modules/echarts/node_modules/zrender/lib/core/BoundingRect.js
  86. 23 0
      node_modules/echarts/node_modules/zrender/lib/core/Eventful.d.ts
  87. 162 0
      node_modules/echarts/node_modules/zrender/lib/core/Eventful.js
  88. 18 0
      node_modules/echarts/node_modules/zrender/lib/core/GestureMgr.d.ts
  89. 82 0
      node_modules/echarts/node_modules/zrender/lib/core/GestureMgr.js
  90. 28 0
      node_modules/echarts/node_modules/zrender/lib/core/LRU.d.ts
  91. 110 0
      node_modules/echarts/node_modules/zrender/lib/core/LRU.js
  92. 14 0
      node_modules/echarts/node_modules/zrender/lib/core/OrientedBoundingRect.d.ts
  93. 120 0
      node_modules/echarts/node_modules/zrender/lib/core/OrientedBoundingRect.js
  94. 75 0
      node_modules/echarts/node_modules/zrender/lib/core/PathProxy.d.ts
  95. 697 0
      node_modules/echarts/node_modules/zrender/lib/core/PathProxy.js
  96. 38 0
      node_modules/echarts/node_modules/zrender/lib/core/Point.d.ts
  97. 129 0
      node_modules/echarts/node_modules/zrender/lib/core/Point.js
  98. 41 0
      node_modules/echarts/node_modules/zrender/lib/core/Transformable.d.ts
  99. 244 0
      node_modules/echarts/node_modules/zrender/lib/core/Transformable.js
  100. 9 0
      node_modules/echarts/node_modules/zrender/lib/core/WeakMap.d.ts

+ 1 - 1
manifest.json

@@ -20,7 +20,6 @@
         ],
         /* 5+App特有相关 */
         "modules" : {
-            "Maps" : {},
             "Push" : {},
             "VideoPlayer" : {}
         },
@@ -62,6 +61,7 @@
                 "ad" : {},
                 "maps" : {
                     "amap" : {
+                        "name" : "",
                         "appkey_ios" : "87f4d2a4a0c42e0c86cf312c8b8154e8",
                         "appkey_android" : "87f4d2a4a0c42e0c86cf312c8b8154e8"
                     }

+ 15 - 0
node_modules/echarts/node_modules/tslib/CopyrightNotice.txt

@@ -0,0 +1,15 @@
+/*! *****************************************************************************
+Copyright (c) Microsoft Corporation.
+
+Permission to use, copy, modify, and/or distribute this software for any
+purpose with or without fee is hereby granted.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+PERFORMANCE OF THIS SOFTWARE.
+***************************************************************************** */
+

+ 12 - 0
node_modules/echarts/node_modules/tslib/LICENSE.txt

@@ -0,0 +1,12 @@
+Copyright (c) Microsoft Corporation.
+
+Permission to use, copy, modify, and/or distribute this software for any
+purpose with or without fee is hereby granted.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+PERFORMANCE OF THIS SOFTWARE.

+ 164 - 0
node_modules/echarts/node_modules/tslib/README.md

@@ -0,0 +1,164 @@
+# tslib
+
+This is a runtime library for [TypeScript](http://www.typescriptlang.org/) that contains all of the TypeScript helper functions.
+
+This library is primarily used by the `--importHelpers` flag in TypeScript.
+When using `--importHelpers`, a module that uses helper functions like `__extends` and `__assign` in the following emitted file:
+
+```ts
+var __assign = (this && this.__assign) || Object.assign || function(t) {
+    for (var s, i = 1, n = arguments.length; i < n; i++) {
+        s = arguments[i];
+        for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p))
+            t[p] = s[p];
+    }
+    return t;
+};
+exports.x = {};
+exports.y = __assign({}, exports.x);
+
+```
+
+will instead be emitted as something like the following:
+
+```ts
+var tslib_1 = require("tslib");
+exports.x = {};
+exports.y = tslib_1.__assign({}, exports.x);
+```
+
+Because this can avoid duplicate declarations of things like `__extends`, `__assign`, etc., this means delivering users smaller files on average, as well as less runtime overhead.
+For optimized bundles with TypeScript, you should absolutely consider using `tslib` and `--importHelpers`.
+
+# Installing
+
+For the latest stable version, run:
+
+## npm
+
+```sh
+# TypeScript 3.9.2 or later
+npm install tslib
+
+# TypeScript 3.8.4 or earlier
+npm install tslib@^1
+
+# TypeScript 2.3.2 or earlier
+npm install tslib@1.6.1
+```
+
+## yarn
+
+```sh
+# TypeScript 3.9.2 or later
+yarn add tslib
+
+# TypeScript 3.8.4 or earlier
+yarn add tslib@^1
+
+# TypeScript 2.3.2 or earlier
+yarn add tslib@1.6.1
+```
+
+## bower
+
+```sh
+# TypeScript 3.9.2 or later
+bower install tslib
+
+# TypeScript 3.8.4 or earlier
+bower install tslib@^1
+
+# TypeScript 2.3.2 or earlier
+bower install tslib@1.6.1
+```
+
+## JSPM
+
+```sh
+# TypeScript 3.9.2 or later
+jspm install tslib
+
+# TypeScript 3.8.4 or earlier
+jspm install tslib@^1
+
+# TypeScript 2.3.2 or earlier
+jspm install tslib@1.6.1
+```
+
+# Usage
+
+Set the `importHelpers` compiler option on the command line:
+
+```
+tsc --importHelpers file.ts
+```
+
+or in your tsconfig.json:
+
+```json
+{
+    "compilerOptions": {
+        "importHelpers": true
+    }
+}
+```
+
+#### For bower and JSPM users
+
+You will need to add a `paths` mapping for `tslib`, e.g. For Bower users:
+
+```json
+{
+    "compilerOptions": {
+        "module": "amd",
+        "importHelpers": true,
+        "baseUrl": "./",
+        "paths": {
+            "tslib" : ["bower_components/tslib/tslib.d.ts"]
+        }
+    }
+}
+```
+
+For JSPM users:
+
+```json
+{
+    "compilerOptions": {
+        "module": "system",
+        "importHelpers": true,
+        "baseUrl": "./",
+        "paths": {
+            "tslib" : ["jspm_packages/npm/tslib@2.x.y/tslib.d.ts"]
+        }
+    }
+}
+```
+
+## Deployment
+
+- Choose your new version number
+- Set it in `package.json` and `bower.json`
+- Create a tag: `git tag [version]`
+- Push the tag: `git push --tags`
+- Create a [release in GitHub](https://github.com/microsoft/tslib/releases)
+- Run the [publish to npm](https://github.com/microsoft/tslib/actions?query=workflow%3A%22Publish+to+NPM%22) workflow
+
+Done.
+
+# Contribute
+
+There are many ways to [contribute](https://github.com/Microsoft/TypeScript/blob/master/CONTRIBUTING.md) to TypeScript.
+
+* [Submit bugs](https://github.com/Microsoft/TypeScript/issues) and help us verify fixes as they are checked in.
+* Review the [source code changes](https://github.com/Microsoft/TypeScript/pulls).
+* Engage with other TypeScript users and developers on [StackOverflow](http://stackoverflow.com/questions/tagged/typescript).
+* Join the [#typescript](http://twitter.com/#!/search/realtime/%23typescript) discussion on Twitter.
+* [Contribute bug fixes](https://github.com/Microsoft/TypeScript/blob/master/CONTRIBUTING.md).
+
+# Documentation
+
+* [Quick tutorial](http://www.typescriptlang.org/Tutorial)
+* [Programming handbook](http://www.typescriptlang.org/Handbook)
+* [Homepage](http://www.typescriptlang.org/)

+ 53 - 0
node_modules/echarts/node_modules/tslib/modules/index.js

@@ -0,0 +1,53 @@
+import tslib from '../tslib.js';
+const {
+    __extends,
+    __assign,
+    __rest,
+    __decorate,
+    __param,
+    __metadata,
+    __awaiter,
+    __generator,
+    __exportStar,
+    __createBinding,
+    __values,
+    __read,
+    __spread,
+    __spreadArrays,
+    __spreadArray,
+    __await,
+    __asyncGenerator,
+    __asyncDelegator,
+    __asyncValues,
+    __makeTemplateObject,
+    __importStar,
+    __importDefault,
+    __classPrivateFieldGet,
+    __classPrivateFieldSet,
+} = tslib;
+export {
+    __extends,
+    __assign,
+    __rest,
+    __decorate,
+    __param,
+    __metadata,
+    __awaiter,
+    __generator,
+    __exportStar,
+    __createBinding,
+    __values,
+    __read,
+    __spread,
+    __spreadArrays,
+    __spreadArray,
+    __await,
+    __asyncGenerator,
+    __asyncDelegator,
+    __asyncValues,
+    __makeTemplateObject,
+    __importStar,
+    __importDefault,
+    __classPrivateFieldGet,
+    __classPrivateFieldSet,
+};

+ 3 - 0
node_modules/echarts/node_modules/tslib/modules/package.json

@@ -0,0 +1,3 @@
+{
+    "type": "module"
+}

+ 65 - 0
node_modules/echarts/node_modules/tslib/package.json

@@ -0,0 +1,65 @@
+{
+  "_from": "tslib@2.3.0",
+  "_id": "tslib@2.3.0",
+  "_inBundle": false,
+  "_integrity": "sha512-N82ooyxVNm6h1riLCoyS9e3fuJ3AMG2zIZs2Gd1ATcSFjSA23Q0fzjjZeh0jbJvWVDZ0cJT8yaNNaaXHzueNjg==",
+  "_location": "/echarts/tslib",
+  "_phantomChildren": {},
+  "_requested": {
+    "type": "version",
+    "registry": true,
+    "raw": "tslib@2.3.0",
+    "name": "tslib",
+    "escapedName": "tslib",
+    "rawSpec": "2.3.0",
+    "saveSpec": null,
+    "fetchSpec": "2.3.0"
+  },
+  "_requiredBy": [
+    "/echarts",
+    "/echarts/zrender"
+  ],
+  "_resolved": "https://registry.npmmirror.com/tslib/-/tslib-2.3.0.tgz",
+  "_shasum": "803b8cdab3e12ba581a4ca41c8839bbb0dacb09e",
+  "_spec": "tslib@2.3.0",
+  "_where": "D:\\通防技术部\\jeecg-uniapp\\node_modules\\echarts",
+  "author": {
+    "name": "Microsoft Corp."
+  },
+  "bugs": {
+    "url": "https://github.com/Microsoft/TypeScript/issues"
+  },
+  "bundleDependencies": false,
+  "deprecated": false,
+  "description": "Runtime library for TypeScript helper functions",
+  "exports": {
+    ".": {
+      "module": "./tslib.es6.js",
+      "import": "./modules/index.js",
+      "default": "./tslib.js"
+    },
+    "./": "./"
+  },
+  "homepage": "https://www.typescriptlang.org/",
+  "jsnext:main": "tslib.es6.js",
+  "keywords": [
+    "TypeScript",
+    "Microsoft",
+    "compiler",
+    "language",
+    "javascript",
+    "tslib",
+    "runtime"
+  ],
+  "license": "0BSD",
+  "main": "tslib.js",
+  "module": "tslib.es6.js",
+  "name": "tslib",
+  "repository": {
+    "type": "git",
+    "url": "git+https://github.com/Microsoft/tslib.git"
+  },
+  "sideEffects": false,
+  "typings": "tslib.d.ts",
+  "version": "2.3.0"
+}

+ 130 - 0
node_modules/echarts/node_modules/tslib/tslib.d.ts

@@ -0,0 +1,130 @@
+/*! *****************************************************************************
+Copyright (c) Microsoft Corporation.
+
+Permission to use, copy, modify, and/or distribute this software for any
+purpose with or without fee is hereby granted.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+PERFORMANCE OF THIS SOFTWARE.
+***************************************************************************** */
+export declare function __extends(d: Function, b: Function): void;
+export declare function __assign(t: any, ...sources: any[]): any;
+export declare function __rest(t: any, propertyNames: (string | symbol)[]): any;
+export declare function __decorate(decorators: Function[], target: any, key?: string | symbol, desc?: any): any;
+export declare function __param(paramIndex: number, decorator: Function): Function;
+export declare function __metadata(metadataKey: any, metadataValue: any): Function;
+export declare function __awaiter(thisArg: any, _arguments: any, P: Function, generator: Function): any;
+export declare function __generator(thisArg: any, body: Function): any;
+export declare function __exportStar(m: any, o: any): void;
+export declare function __values(o: any): any;
+export declare function __read(o: any, n?: number): any[];
+/** @deprecated since TypeScript 4.2 */
+export declare function __spread(...args: any[][]): any[];
+/** @deprecated since TypeScript 4.2 */
+export declare function __spreadArrays(...args: any[][]): any[];
+export declare function __spreadArray(to: any[], from: any[], pack?: boolean): any[];
+export declare function __await(v: any): any;
+export declare function __asyncGenerator(thisArg: any, _arguments: any, generator: Function): any;
+export declare function __asyncDelegator(o: any): any;
+export declare function __asyncValues(o: any): any;
+export declare function __makeTemplateObject(cooked: string[], raw: string[]): TemplateStringsArray;
+export declare function __importStar<T>(mod: T): T;
+export declare function __importDefault<T>(mod: T): T | { default: T };
+/**
+ * Reading from a private instance field
+ */
+export declare function __classPrivateFieldGet<T extends object, V>(
+    receiver: T,
+    state: { has(o: T): boolean, get(o: T): V | undefined },
+    kind?: "f"
+): V;
+/**
+ * Reading from a private static field
+ */
+export declare function __classPrivateFieldGet<T extends new (...args: any[]) => unknown, V>(
+    receiver: T,
+    state: T,
+    kind: "f",
+    f: { value: V }
+): V;
+/**
+ * Reading from a private instance get accessor
+ */
+export declare function __classPrivateFieldGet<T extends object, V>(
+    receiver: T,
+    state: { has(o: T): boolean },
+    kind: "a",
+    f: () => V
+): V;
+/**
+ * Reading from a private static get accessor
+ */
+export declare function __classPrivateFieldGet<T extends new (...args: any[]) => unknown, V>(
+    receiver: T,
+    state: T,
+    kind: "a",
+    f: () => V
+): V;
+/**
+ * Reading from a private instance method
+ */
+export declare function __classPrivateFieldGet<T extends object, V extends (...args: any[]) => unknown>(
+    receiver: T,
+    state: { has(o: T): boolean },
+    kind: "m",
+    f: V
+): V;
+/**
+ * Reading from a private static method
+ */
+export declare function __classPrivateFieldGet<T extends new (...args: any[]) => unknown, V extends (...args: any[]) => unknown>(
+    receiver: T,
+    state: T,
+    kind: "m",
+    f: V
+): V;
+/**
+ * Writing to a private instance field
+ */
+ export declare function __classPrivateFieldSet<T extends object, V>(
+    receiver: T,
+    state: { has(o: T): boolean, set(o: T, value: V): unknown },
+    value: V,
+    kind?: "f"
+): V;
+/**
+ * Writing to a private static field
+ */
+export declare function __classPrivateFieldSet<T extends new (...args: any[]) => unknown, V>(
+    receiver: T,
+    state: T,
+    value: V,
+    kind: "f",
+    f: { value: V }
+): V;
+/**
+ * Writing to a private instance set accessor
+ */
+export declare function __classPrivateFieldSet<T extends object, V>(
+    receiver: T,
+    state: { has(o: T): boolean },
+    value: V,
+    kind: "a",
+    f: (v: V) => void
+): V;
+/**
+ * Writing to a private static set accessor
+ */
+export declare function __classPrivateFieldSet<T extends new (...args: any[]) => unknown, V>(
+    receiver: T,
+    state: T,
+    value: V,
+    kind: "a",
+    f: (v: V) => void
+): V;
+export declare function __createBinding(object: object, target: object, key: PropertyKey, objectKey?: PropertyKey): void;

+ 1 - 0
node_modules/echarts/node_modules/tslib/tslib.es6.html

@@ -0,0 +1 @@
+<script src="tslib.es6.js"></script>

+ 239 - 0
node_modules/echarts/node_modules/tslib/tslib.es6.js

@@ -0,0 +1,239 @@
+/*! *****************************************************************************
+Copyright (c) Microsoft Corporation.
+
+Permission to use, copy, modify, and/or distribute this software for any
+purpose with or without fee is hereby granted.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+PERFORMANCE OF THIS SOFTWARE.
+***************************************************************************** */
+/* global Reflect, Promise */
+
+var extendStatics = function(d, b) {
+    extendStatics = Object.setPrototypeOf ||
+        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
+        function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };
+    return extendStatics(d, b);
+};
+
+export function __extends(d, b) {
+    if (typeof b !== "function" && b !== null)
+        throw new TypeError("Class extends value " + String(b) + " is not a constructor or null");
+    extendStatics(d, b);
+    function __() { this.constructor = d; }
+    d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
+}
+
+export var __assign = function() {
+    __assign = Object.assign || function __assign(t) {
+        for (var s, i = 1, n = arguments.length; i < n; i++) {
+            s = arguments[i];
+            for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];
+        }
+        return t;
+    }
+    return __assign.apply(this, arguments);
+}
+
+export function __rest(s, e) {
+    var t = {};
+    for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)
+        t[p] = s[p];
+    if (s != null && typeof Object.getOwnPropertySymbols === "function")
+        for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {
+            if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))
+                t[p[i]] = s[p[i]];
+        }
+    return t;
+}
+
+export function __decorate(decorators, target, key, desc) {
+    var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;
+    if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc);
+    else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;
+    return c > 3 && r && Object.defineProperty(target, key, r), r;
+}
+
+export function __param(paramIndex, decorator) {
+    return function (target, key) { decorator(target, key, paramIndex); }
+}
+
+export function __metadata(metadataKey, metadataValue) {
+    if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue);
+}
+
+export function __awaiter(thisArg, _arguments, P, generator) {
+    function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }
+    return new (P || (P = Promise))(function (resolve, reject) {
+        function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
+        function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
+        function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }
+        step((generator = generator.apply(thisArg, _arguments || [])).next());
+    });
+}
+
+export function __generator(thisArg, body) {
+    var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;
+    return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g;
+    function verb(n) { return function (v) { return step([n, v]); }; }
+    function step(op) {
+        if (f) throw new TypeError("Generator is already executing.");
+        while (_) try {
+            if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;
+            if (y = 0, t) op = [op[0] & 2, t.value];
+            switch (op[0]) {
+                case 0: case 1: t = op; break;
+                case 4: _.label++; return { value: op[1], done: false };
+                case 5: _.label++; y = op[1]; op = [0]; continue;
+                case 7: op = _.ops.pop(); _.trys.pop(); continue;
+                default:
+                    if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }
+                    if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }
+                    if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }
+                    if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }
+                    if (t[2]) _.ops.pop();
+                    _.trys.pop(); continue;
+            }
+            op = body.call(thisArg, _);
+        } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }
+        if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };
+    }
+}
+
+export var __createBinding = Object.create ? (function(o, m, k, k2) {
+    if (k2 === undefined) k2 = k;
+    Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });
+}) : (function(o, m, k, k2) {
+    if (k2 === undefined) k2 = k;
+    o[k2] = m[k];
+});
+
+export function __exportStar(m, o) {
+    for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p);
+}
+
+export function __values(o) {
+    var s = typeof Symbol === "function" && Symbol.iterator, m = s && o[s], i = 0;
+    if (m) return m.call(o);
+    if (o && typeof o.length === "number") return {
+        next: function () {
+            if (o && i >= o.length) o = void 0;
+            return { value: o && o[i++], done: !o };
+        }
+    };
+    throw new TypeError(s ? "Object is not iterable." : "Symbol.iterator is not defined.");
+}
+
+export function __read(o, n) {
+    var m = typeof Symbol === "function" && o[Symbol.iterator];
+    if (!m) return o;
+    var i = m.call(o), r, ar = [], e;
+    try {
+        while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);
+    }
+    catch (error) { e = { error: error }; }
+    finally {
+        try {
+            if (r && !r.done && (m = i["return"])) m.call(i);
+        }
+        finally { if (e) throw e.error; }
+    }
+    return ar;
+}
+
+/** @deprecated */
+export function __spread() {
+    for (var ar = [], i = 0; i < arguments.length; i++)
+        ar = ar.concat(__read(arguments[i]));
+    return ar;
+}
+
+/** @deprecated */
+export function __spreadArrays() {
+    for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;
+    for (var r = Array(s), k = 0, i = 0; i < il; i++)
+        for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)
+            r[k] = a[j];
+    return r;
+}
+
+export function __spreadArray(to, from, pack) {
+    if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) {
+        if (ar || !(i in from)) {
+            if (!ar) ar = Array.prototype.slice.call(from, 0, i);
+            ar[i] = from[i];
+        }
+    }
+    return to.concat(ar || from);
+}
+
+export function __await(v) {
+    return this instanceof __await ? (this.v = v, this) : new __await(v);
+}
+
+export function __asyncGenerator(thisArg, _arguments, generator) {
+    if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
+    var g = generator.apply(thisArg, _arguments || []), i, q = [];
+    return i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i;
+    function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }
+    function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }
+    function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); }
+    function fulfill(value) { resume("next", value); }
+    function reject(value) { resume("throw", value); }
+    function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }
+}
+
+export function __asyncDelegator(o) {
+    var i, p;
+    return i = {}, verb("next"), verb("throw", function (e) { throw e; }), verb("return"), i[Symbol.iterator] = function () { return this; }, i;
+    function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === "return" } : f ? f(v) : v; } : f; }
+}
+
+export function __asyncValues(o) {
+    if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
+    var m = o[Symbol.asyncIterator], i;
+    return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i);
+    function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }
+    function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }
+}
+
+export function __makeTemplateObject(cooked, raw) {
+    if (Object.defineProperty) { Object.defineProperty(cooked, "raw", { value: raw }); } else { cooked.raw = raw; }
+    return cooked;
+};
+
+var __setModuleDefault = Object.create ? (function(o, v) {
+    Object.defineProperty(o, "default", { enumerable: true, value: v });
+}) : function(o, v) {
+    o["default"] = v;
+};
+
+export function __importStar(mod) {
+    if (mod && mod.__esModule) return mod;
+    var result = {};
+    if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);
+    __setModuleDefault(result, mod);
+    return result;
+}
+
+export function __importDefault(mod) {
+    return (mod && mod.__esModule) ? mod : { default: mod };
+}
+
+export function __classPrivateFieldGet(receiver, state, kind, f) {
+    if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a getter");
+    if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot read private member from an object whose class did not declare it");
+    return kind === "m" ? f : kind === "a" ? f.call(receiver) : f ? f.value : state.get(receiver);
+}
+
+export function __classPrivateFieldSet(receiver, state, value, kind, f) {
+    if (kind === "m") throw new TypeError("Private method is not writable");
+    if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a setter");
+    if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot write private member to an object whose class did not declare it");
+    return (kind === "a" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value)), value;
+}

+ 1 - 0
node_modules/echarts/node_modules/tslib/tslib.html

@@ -0,0 +1 @@
+<script src="tslib.js"></script>

+ 306 - 0
node_modules/echarts/node_modules/tslib/tslib.js

@@ -0,0 +1,306 @@
+/*! *****************************************************************************
+Copyright (c) Microsoft Corporation.
+
+Permission to use, copy, modify, and/or distribute this software for any
+purpose with or without fee is hereby granted.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+PERFORMANCE OF THIS SOFTWARE.
+***************************************************************************** */
+/* global global, define, System, Reflect, Promise */
+var __extends;
+var __assign;
+var __rest;
+var __decorate;
+var __param;
+var __metadata;
+var __awaiter;
+var __generator;
+var __exportStar;
+var __values;
+var __read;
+var __spread;
+var __spreadArrays;
+var __spreadArray;
+var __await;
+var __asyncGenerator;
+var __asyncDelegator;
+var __asyncValues;
+var __makeTemplateObject;
+var __importStar;
+var __importDefault;
+var __classPrivateFieldGet;
+var __classPrivateFieldSet;
+var __createBinding;
+(function (factory) {
+    var root = typeof global === "object" ? global : typeof self === "object" ? self : typeof this === "object" ? this : {};
+    if (typeof define === "function" && define.amd) {
+        define("tslib", ["exports"], function (exports) { factory(createExporter(root, createExporter(exports))); });
+    }
+    else if (typeof module === "object" && typeof module.exports === "object") {
+        factory(createExporter(root, createExporter(module.exports)));
+    }
+    else {
+        factory(createExporter(root));
+    }
+    function createExporter(exports, previous) {
+        if (exports !== root) {
+            if (typeof Object.create === "function") {
+                Object.defineProperty(exports, "__esModule", { value: true });
+            }
+            else {
+                exports.__esModule = true;
+            }
+        }
+        return function (id, v) { return exports[id] = previous ? previous(id, v) : v; };
+    }
+})
+(function (exporter) {
+    var extendStatics = Object.setPrototypeOf ||
+        ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
+        function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };
+
+    __extends = function (d, b) {
+        if (typeof b !== "function" && b !== null)
+            throw new TypeError("Class extends value " + String(b) + " is not a constructor or null");
+        extendStatics(d, b);
+        function __() { this.constructor = d; }
+        d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
+    };
+
+    __assign = Object.assign || function (t) {
+        for (var s, i = 1, n = arguments.length; i < n; i++) {
+            s = arguments[i];
+            for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];
+        }
+        return t;
+    };
+
+    __rest = function (s, e) {
+        var t = {};
+        for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0)
+            t[p] = s[p];
+        if (s != null && typeof Object.getOwnPropertySymbols === "function")
+            for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {
+                if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i]))
+                    t[p[i]] = s[p[i]];
+            }
+        return t;
+    };
+
+    __decorate = function (decorators, target, key, desc) {
+        var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d;
+        if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc);
+        else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r;
+        return c > 3 && r && Object.defineProperty(target, key, r), r;
+    };
+
+    __param = function (paramIndex, decorator) {
+        return function (target, key) { decorator(target, key, paramIndex); }
+    };
+
+    __metadata = function (metadataKey, metadataValue) {
+        if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue);
+    };
+
+    __awaiter = function (thisArg, _arguments, P, generator) {
+        function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); }
+        return new (P || (P = Promise))(function (resolve, reject) {
+            function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } }
+            function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } }
+            function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); }
+            step((generator = generator.apply(thisArg, _arguments || [])).next());
+        });
+    };
+
+    __generator = function (thisArg, body) {
+        var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g;
+        return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g;
+        function verb(n) { return function (v) { return step([n, v]); }; }
+        function step(op) {
+            if (f) throw new TypeError("Generator is already executing.");
+            while (_) try {
+                if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t;
+                if (y = 0, t) op = [op[0] & 2, t.value];
+                switch (op[0]) {
+                    case 0: case 1: t = op; break;
+                    case 4: _.label++; return { value: op[1], done: false };
+                    case 5: _.label++; y = op[1]; op = [0]; continue;
+                    case 7: op = _.ops.pop(); _.trys.pop(); continue;
+                    default:
+                        if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; }
+                        if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; }
+                        if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; }
+                        if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; }
+                        if (t[2]) _.ops.pop();
+                        _.trys.pop(); continue;
+                }
+                op = body.call(thisArg, _);
+            } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; }
+            if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true };
+        }
+    };
+
+    __exportStar = function(m, o) {
+        for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p);
+    };
+
+    __createBinding = Object.create ? (function(o, m, k, k2) {
+        if (k2 === undefined) k2 = k;
+        Object.defineProperty(o, k2, { enumerable: true, get: function() { return m[k]; } });
+    }) : (function(o, m, k, k2) {
+        if (k2 === undefined) k2 = k;
+        o[k2] = m[k];
+    });
+
+    __values = function (o) {
+        var s = typeof Symbol === "function" && Symbol.iterator, m = s && o[s], i = 0;
+        if (m) return m.call(o);
+        if (o && typeof o.length === "number") return {
+            next: function () {
+                if (o && i >= o.length) o = void 0;
+                return { value: o && o[i++], done: !o };
+            }
+        };
+        throw new TypeError(s ? "Object is not iterable." : "Symbol.iterator is not defined.");
+    };
+
+    __read = function (o, n) {
+        var m = typeof Symbol === "function" && o[Symbol.iterator];
+        if (!m) return o;
+        var i = m.call(o), r, ar = [], e;
+        try {
+            while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value);
+        }
+        catch (error) { e = { error: error }; }
+        finally {
+            try {
+                if (r && !r.done && (m = i["return"])) m.call(i);
+            }
+            finally { if (e) throw e.error; }
+        }
+        return ar;
+    };
+
+    /** @deprecated */
+    __spread = function () {
+        for (var ar = [], i = 0; i < arguments.length; i++)
+            ar = ar.concat(__read(arguments[i]));
+        return ar;
+    };
+
+    /** @deprecated */
+    __spreadArrays = function () {
+        for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length;
+        for (var r = Array(s), k = 0, i = 0; i < il; i++)
+            for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++)
+                r[k] = a[j];
+        return r;
+    };
+
+    __spreadArray = function (to, from, pack) {
+        if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) {
+            if (ar || !(i in from)) {
+                if (!ar) ar = Array.prototype.slice.call(from, 0, i);
+                ar[i] = from[i];
+            }
+        }
+        return to.concat(ar || from);
+    };
+
+    __await = function (v) {
+        return this instanceof __await ? (this.v = v, this) : new __await(v);
+    };
+
+    __asyncGenerator = function (thisArg, _arguments, generator) {
+        if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
+        var g = generator.apply(thisArg, _arguments || []), i, q = [];
+        return i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i;
+        function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; }
+        function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } }
+        function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r);  }
+        function fulfill(value) { resume("next", value); }
+        function reject(value) { resume("throw", value); }
+        function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); }
+    };
+
+    __asyncDelegator = function (o) {
+        var i, p;
+        return i = {}, verb("next"), verb("throw", function (e) { throw e; }), verb("return"), i[Symbol.iterator] = function () { return this; }, i;
+        function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === "return" } : f ? f(v) : v; } : f; }
+    };
+
+    __asyncValues = function (o) {
+        if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
+        var m = o[Symbol.asyncIterator], i;
+        return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i);
+        function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; }
+        function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); }
+    };
+
+    __makeTemplateObject = function (cooked, raw) {
+        if (Object.defineProperty) { Object.defineProperty(cooked, "raw", { value: raw }); } else { cooked.raw = raw; }
+        return cooked;
+    };
+
+    var __setModuleDefault = Object.create ? (function(o, v) {
+        Object.defineProperty(o, "default", { enumerable: true, value: v });
+    }) : function(o, v) {
+        o["default"] = v;
+    };
+
+    __importStar = function (mod) {
+        if (mod && mod.__esModule) return mod;
+        var result = {};
+        if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k);
+        __setModuleDefault(result, mod);
+        return result;
+    };
+
+    __importDefault = function (mod) {
+        return (mod && mod.__esModule) ? mod : { "default": mod };
+    };
+
+    __classPrivateFieldGet = function (receiver, state, kind, f) {
+        if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a getter");
+        if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot read private member from an object whose class did not declare it");
+        return kind === "m" ? f : kind === "a" ? f.call(receiver) : f ? f.value : state.get(receiver);
+    };
+
+    __classPrivateFieldSet = function (receiver, state, value, kind, f) {
+        if (kind === "m") throw new TypeError("Private method is not writable");
+        if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a setter");
+        if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot write private member to an object whose class did not declare it");
+        return (kind === "a" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value)), value;
+    };
+
+    exporter("__extends", __extends);
+    exporter("__assign", __assign);
+    exporter("__rest", __rest);
+    exporter("__decorate", __decorate);
+    exporter("__param", __param);
+    exporter("__metadata", __metadata);
+    exporter("__awaiter", __awaiter);
+    exporter("__generator", __generator);
+    exporter("__exportStar", __exportStar);
+    exporter("__createBinding", __createBinding);
+    exporter("__values", __values);
+    exporter("__read", __read);
+    exporter("__spread", __spread);
+    exporter("__spreadArrays", __spreadArrays);
+    exporter("__spreadArray", __spreadArray);
+    exporter("__await", __await);
+    exporter("__asyncGenerator", __asyncGenerator);
+    exporter("__asyncDelegator", __asyncDelegator);
+    exporter("__asyncValues", __asyncValues);
+    exporter("__makeTemplateObject", __makeTemplateObject);
+    exporter("__importStar", __importStar);
+    exporter("__importDefault", __importDefault);
+    exporter("__classPrivateFieldGet", __classPrivateFieldGet);
+    exporter("__classPrivateFieldSet", __classPrivateFieldSet);
+});

+ 4 - 0
node_modules/echarts/node_modules/zrender/.eslintignore

@@ -0,0 +1,4 @@
+/dist
+/node_modules
+/esm
+/lib

+ 29 - 0
node_modules/echarts/node_modules/zrender/LICENSE

@@ -0,0 +1,29 @@
+BSD 3-Clause License
+
+Copyright (c) 2017, Baidu Inc.
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above copyright notice, this
+  list of conditions and the following disclaimer.
+
+* Redistributions in binary form must reproduce the above copyright notice,
+  this list of conditions and the following disclaimer in the documentation
+  and/or other materials provided with the distribution.
+
+* Neither the name of the copyright holder nor the names of its
+  contributors may be used to endorse or promote products derived from
+  this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
+AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
+FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
+SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
+CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
+OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.

+ 47 - 0
node_modules/echarts/node_modules/zrender/README.md

@@ -0,0 +1,47 @@
+ZRender
+=======
+
+A lightweight graphic library which provides 2d draw for [Apache ECharts](https://github.com/apache/echarts).
+
+[![](https://img.shields.io/github/actions/workflow/status/ecomfe/zrender/ci.yml)]() [![](https://img.shields.io/npm/dw/zrender.svg?label=npm%20downloads&style=flat)](https://www.npmjs.com/package/zrender) ![Commits Since 4.0.0](https://img.shields.io/github/commits-since/ecomfe/zrender/4.0.0.svg?colorB=%234c1&style=flat)
+
+## Documentation
+
+[https://ecomfe.github.io/zrender-doc/public/](https://ecomfe.github.io/zrender-doc/public/)
+
+
+## License
+
+BSD 3-Clause License
+
+Copyright (c) 2017, Baidu Inc.
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above copyright notice, this
+  list of conditions and the following disclaimer.
+
+* Redistributions in binary form must reproduce the above copyright notice,
+  this list of conditions and the following disclaimer in the documentation
+  and/or other materials provided with the distribution.
+
+* Neither the name of the copyright holder nor the names of its
+  contributors may be used to endorse or promote products derived from
+  this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
+AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE
+FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
+SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
+CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY,
+OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE
+OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+## Notice
+
+The Apache Software Foundation [Apache ECharts, ECharts](https://echarts.apache.org/), Apache, the Apache feather, and the Apache ECharts project logo are either registered trademarks or trademarks of the [Apache Software Foundation](https://www.apache.org/).

+ 118 - 0
node_modules/echarts/node_modules/zrender/build/build.js

@@ -0,0 +1,118 @@
+// const typescript = require('@rollup/plugin-typescript');
+const typescript = require('rollup-plugin-typescript2');
+const replace = require('@rollup/plugin-replace');
+const rollup = require('rollup');
+const path = require('path');
+const processs = require('process');
+const chalk = require('chalk');
+const progress = require('./progress');
+const UglifyJS = require('uglify-js');
+const fs = require('fs');
+
+function current() {
+    return (new Date()).toLocaleString();
+}
+
+function createInputOption(env, isWatch) {
+    return {
+        input: path.resolve(__dirname, '../index.ts'),
+        plugins: [
+            typescript({
+                clean: !isWatch,
+                tsconfigOverride: {
+                    compilerOptions: {
+                        // Rollup don't use CommonJS by default.
+                        module: 'ES2015',
+                        sourceMap: true,
+                        // Use the esm d.ts
+                        declaration: false
+                    }
+                }
+            }),
+            replace({
+                preventAssignment: true,
+                'process.env.NODE_ENV': JSON.stringify(env)
+            }),
+            progress({
+                scope: {
+                    total: 0
+                }
+            })
+        ]
+    };
+}
+
+const outputOption = {
+    format: 'umd',
+    file: path.resolve(__dirname, '../dist/zrender.js'),
+    sourcemap: true,
+    name: 'zrender'
+};
+
+function minify(outPath) {
+    const code = fs.readFileSync(outPath, 'utf-8');
+    const uglifyResult = UglifyJS.minify(code);
+    if (uglifyResult.error) {
+        throw new Error(uglifyResult.error);
+    }
+    fs.writeFileSync(outPath, uglifyResult.code, 'utf-8');
+}
+
+if (processs.argv.includes('--watch')) {
+    const watcher = rollup.watch({
+        ...createInputOption('development', true),
+        output: [outputOption],
+        watch: {
+            clearScreen: true
+        }
+    });
+    watcher.on('event', event => {
+        switch(event.code) {
+            // case 'START':
+            //     console.log(chalk.green('Begin to watch'));
+            //     break;
+            case 'BUNDLE_START':
+                console.log(
+                    chalk.gray(current()),
+                    chalk.blue('File changed. Begin to bundle')
+                );
+                break;
+            case 'BUNDLE_END':
+                console.log(
+                    chalk.gray(current()),
+                    chalk.green('Finished bundle')
+                );
+                break;
+            case 'ERROR':
+                console.log(
+                    chalk.gray(current()),
+                    chalk.red(event.error)
+                );
+                break;
+        }
+    });
+}
+else {
+    // Unminified
+    rollup.rollup({
+        ...createInputOption('development', false)
+    }).then(bundle => {
+        bundle.write(outputOption)
+            .then(() => {
+                // Minified
+                if (process.argv.indexOf('--minify') >= 0) {
+                    rollup.rollup({
+                        ...createInputOption('production', false)
+                    }).then(bundle => {
+                        const file = outputOption.file.replace(/.js$/, '.min.js');
+                        bundle.write(Object.assign(outputOption, {
+                            file,
+                            sourcemap: false
+                        })).then(function () {
+                            minify(file);
+                        });
+                    });
+                }
+            });
+    });
+}

+ 3 - 0
node_modules/echarts/node_modules/zrender/build/package.json

@@ -0,0 +1,3 @@
+{
+    "type": "commonjs"
+}

+ 48 - 0
node_modules/echarts/node_modules/zrender/build/prepareNightly.js

@@ -0,0 +1,48 @@
+const fs = require('fs');
+const { execSync } = require('child_process');
+
+const packageJsonPath = __dirname + '/../package.json';
+const nightlyPackageName = 'zrender-nightly';
+
+function updateVersion(version) {
+    const isNext = process.argv.includes('--next');
+    const parts = /(\d+)\.(\d+)\.(\d+)($|\-)/.exec(version);
+    if (!parts) {
+        throw new Error(`Invalid version number ${version}`);
+    }
+    // Add date to version.
+    const major = +parts[1];
+    let minor = +parts[2];
+    let patch = +parts[3];
+    const isStable = !parts[4];
+    if (isStable) {
+        // It's previous stable version. Dev version should be higher.
+        if (isNext) {
+            // Increase minor version for next branch.
+            minor++;
+            patch = 0;
+        }
+        else {
+            // Increase main version for master branch.
+            patch++;
+        }
+    }
+
+    const date = new Date().toISOString().replace(/:|T|\.|-/g, '').slice(0, 8);
+    return `${major}.${minor}.${patch}-dev.${date}`;
+}
+
+
+const packageJson = JSON.parse(fs.readFileSync(packageJsonPath, 'utf-8'));
+packageJson.name = nightlyPackageName;
+const version = updateVersion(packageJson.version);
+
+fs.writeFileSync(packageJsonPath, JSON.stringify(packageJson, null, 2), 'utf-8');
+
+// Update version in package.json and package-lock.json
+execSync(`npm version ${version} --git-tag-version=false`);
+
+const entryPath = __dirname + '/../src/zrender.ts';
+const entryFile = fs.readFileSync(entryPath, 'utf-8')
+    .replace(/export const version = '\S+'/, `export const version = '${version}'`);
+fs.writeFileSync(entryPath, entryFile, 'utf-8');

+ 88 - 0
node_modules/echarts/node_modules/zrender/build/prepublish.js

@@ -0,0 +1,88 @@
+const fs = require('fs-extra');
+const chalk = require('chalk');
+const ignore = require('ignore');
+const { execSync } = require('node:child_process');
+
+console.log();
+console.log(chalk.yellowBright(`⚠️ You should have run ${chalk.bold('`npm run release`')} before running this script!`));
+console.log();
+
+// check versions in key dist files
+
+console.log(chalk.yellow('🔎 Checking versions in dist files...'));
+
+const fileVersions = [
+    'package.json',
+    'package-lock.json',
+    'dist/zrender.js',
+    'dist/zrender.min.js'
+].map(filePath => ({
+    file: filePath,
+    version: require('../' + filePath).version
+}));
+
+['lib/zrender.js', 'src/zrender.ts'].forEach(filePath => {
+    const version = fs.readFileSync(filePath, 'utf-8').match(/export (?:var|const) version = '(\S+)'/)[1];
+    fileVersions.push({
+        file: filePath,
+        version: version
+    });
+});
+
+const versions = fileVersions.map(({ file, version }) => {
+    console.log(`  ∟ The version in [${chalk.blueBright(file)}] is ${chalk.cyanBright.bold(version)}`);
+    return version;
+});
+
+if (new Set(versions).size !== 1) {
+    console.log();
+    console.error(chalk.red('❌ Version does not match! Please check and rerun the release script via:'));
+    console.log();
+    console.error(chalk.yellow('     npm run release'));
+    console.log();
+    process.exit(-1);
+}
+
+console.log();
+console.log(chalk.green('✔️ Versions are all the same.'));
+console.log();
+
+console.log(chalk.yellow('🔎 Checking unexpected files that probably shouldn\'t be published...\n'));
+
+// check if there are unexpected files that not in .npmignore
+const npmignore = fs.readFileSync('.npmignore', 'utf-8');
+const npmignorePatterns = npmignore
+    .split(/\r?\n/)
+    .filter(item => item && !item.startsWith('#'));
+
+const untrackedFiles = execSync('git ls-files --others --exclude-standard', { encoding: 'utf-8' })
+    .trim()
+    .split('\n')
+    .map(escapeOctal);
+
+if (untrackedFiles.length) {
+    const maybeUnexpectedFiles = ignore().add(npmignorePatterns).filter(untrackedFiles);
+    if (maybeUnexpectedFiles.length) {
+        console.error(chalk.red(`❌ Found ${maybeUnexpectedFiles.length} file(s) that are neither tracked by git nor ignored by .npmignore! Please double-check before publishing them to npm.`));
+        maybeUnexpectedFiles.forEach(filePath => {
+            console.log('  ∟ ' + filePath);
+        });
+        console.log();
+        process.exit(-1);
+    }
+}
+
+console.log(chalk.green('✔️ No unexpected files found.'));
+console.log();
+
+function escapeOctal(str) {
+    const matches = str.match(/(\\\d{3}){3}/g);
+    if (matches) {
+        matches.forEach(match => {
+            let encoded = '';
+            match.split('\\').forEach(code => !code || (encoded += '%' + parseInt(code, 8).toString(16)));
+            str = str.replace(match, decodeURI(encoded));
+        });
+    }
+    return str;
+}

+ 67 - 0
node_modules/echarts/node_modules/zrender/build/processLib.js

@@ -0,0 +1,67 @@
+// Porcess generated lib files.
+// Like adding js extension in the import statement.
+
+const { transformImport } = require('./transformImport');
+const globby = require('globby');
+const path = require('path');
+const fs = require('fs');
+const chalk = require('chalk');
+const rollup = require('rollup');
+const nodeResolve = require('@rollup/plugin-node-resolve').default;
+
+function addJsExtension(moduleName) {
+    // Ignore 'tslib'
+    if (!(moduleName.startsWith('.'))) {
+        return moduleName;
+    }
+    if (moduleName.endsWith('.ts')) {
+        // Replace ts with js
+        return moduleName.replace(/\.ts$/, '.js');
+    }
+    else if (moduleName.endsWith('.js')) {
+        return moduleName;
+    }
+    else {
+        return moduleName + '.js'
+    }
+}
+
+async function transform() {
+    const libFiles = await globby([
+        '**/*.js'
+    ], {
+        cwd: path.join(__dirname, '../lib'),
+        absolute: true
+    });
+
+    if (libFiles.length === 0) {
+        throw new Error('No lib files found.')
+    }
+
+    for (let file of libFiles) {
+        const code = fs.readFileSync(file, 'utf-8');
+        fs.writeFileSync(file, transformImport(code, addJsExtension), 'utf-8');
+    }
+
+    // Transform index;
+    const indexFile = path.join(__dirname, '../index.js');
+    fs.writeFileSync(
+        indexFile,
+        transformImport(
+            fs.readFileSync(indexFile, 'utf-8'),
+            (mduleName) => addJsExtension(mduleName).replace('./src', './lib')
+        )
+    )
+}
+
+transform().then(() => {
+    console.log(chalk.green('Added .js extensions.'));
+    console.log(chalk.gray('Start testing generated libs...'));
+}).then(() => {
+    return rollup.rollup({
+        input: path.resolve(__dirname, '../index.js'),
+        plugins: [nodeResolve()]
+    });
+}).then(() => {
+    console.log(chalk.green('Libs can be bundled!'));
+});

+ 65 - 0
node_modules/echarts/node_modules/zrender/build/progress.js

@@ -0,0 +1,65 @@
+/*
+* Licensed to the Apache Software Foundation (ASF) under one
+* or more contributor license agreements.  See the NOTICE file
+* distributed with this work for additional information
+* regarding copyright ownership.  The ASF licenses this file
+* to you under the Apache License, Version 2.0 (the
+* "License"); you may not use this file except in compliance
+* with the License.  You may obtain a copy of the License at
+*
+*   http://www.apache.org/licenses/LICENSE-2.0
+*
+* Unless required by applicable law or agreed to in writing,
+* software distributed under the License is distributed on an
+* "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+* KIND, either express or implied.  See the License for the
+* specific language governing permissions and limitations
+* under the License.
+*/
+const chalk = require('chalk');
+const path = require('path');
+
+module.exports = function progress(options = {}) {
+    const scope = options.scope || {};
+    scope.finished = scope.finished || 0;
+    scope.total = scope.total || 0;
+
+    return {
+        name: 'progress',
+
+        buildStart() {
+            scope.finished = 0;
+            scope.total = 0;
+        },
+
+        load() {
+            // TODO More accurate total number
+            scope.total++;
+        },
+
+        transform(code, id) {
+            scope.finished++;
+            const filePath = path.relative(process.cwd(), id).split(path.sep).join('/');
+
+            const output = `[${scope.finished}/${scope.total}]: ${chalk.grey(filePath)}`;
+            if (process.stdout.isTTY) {
+                process.stdout.clearLine();
+                process.stdout.cursorTo(0);
+                process.stdout.write(output);
+            }
+            else {
+                console.log(output);
+            }
+        },
+
+        buildEnd() {
+            if (process.stdout.isTTY) {
+                process.stdout.clearLine();
+                process.stdout.cursorTo(0);
+            }
+            else {
+                console.log('');
+            }
+        }
+    };
+};

+ 115 - 0
node_modules/echarts/node_modules/zrender/build/transformImport.js

@@ -0,0 +1,115 @@
+// adding js extension in the import statement.
+
+// Reference:
+// https://regexr.com/47jlq
+// https://gist.github.com/manekinekko/7e58a17bc62a9be47172
+const regexp = /((?:(?:import)|(?:export))\s+?(?:(?:(?:[\w*\s{},\/]*)\s+from\s+?)|))(?:(?:"(.*?)")|(?:'(.*?)'))([\s]*?(?:;|$|))/g;
+
+module.exports.transformImport = function (code, processModuleName) {
+    return code.replace(regexp, (str, prefix, moduleNameA, moduleNameB, postfix) => {
+        let moduleName = (moduleNameA === undefined ? moduleNameB : moduleNameA).trim();
+        const quote = moduleNameA === undefined ? "'" : '"';
+        return prefix + quote + processModuleName(moduleName) + quote + postfix;
+        // Not support other extensions.
+    });
+}
+
+
+const testCases = `import videos from './videos/index.js'
+
+export default (socket, context) => {
+    // dynamically importing all the socket.io handler (it's dynamic import that happen at run time)
+  import {
+	something
+} from "./test/okbb"
+
+const f = 2;
+
+import test from 'obb'
+
+
+import {
+  Component
+} from '@angular2/core';
+
+import defaultMember from "module-0";
+
+import   *    as name from "module-1  ";
+
+import   {  member }   from "  module-2";
+
+import { member as alias } from "module-3";
+
+import { member1 , member2 } from "module-4";
+
+import { member1 , member2 as alias2 , member3 as alias3 } from "module-5";
+
+import defaultMember, { member, member } from "module-6";
+
+import defaultMember, * as name from "module-7";
+
+import "module-8";
+
+import "module-9"    // comment no problem
+
+import {
+    AAAA,
+    // BBB
+} from 'module-10';
+
+import "module-b' // doesn't match -> the opening and closing quation mark are different
+
+importing hya from 'ttt'
+
+import fbsfrom ''
+
+
+// Export expressions.
+export { aaa };
+
+export * from "module-11";
+
+export { aaa } from "module-12";
+
+// Should not be parsed
+export default aaa;
+
+export function bbb () {
+};
+`
+
+module.exports.runTest = function () {
+    const expected = [
+        './videos/index.js',
+        './test/okbb',
+        'obb',
+        '@angular2/core',
+        'module-0',
+        'module-1',
+        'module-2',
+        'module-3',
+        'module-4',
+        'module-5',
+        'module-6',
+        'module-7',
+        'module-8',
+        'module-9',
+        'module-10',
+        'module-11',
+        'module-12'
+    ]
+    let cursor = 0;
+    module.exports.transformImport(testCases, (moduleName) => {
+        if (expected[cursor] !== moduleName) {
+            throw new Error(`Expected ${expected[cursor]}. Actual ${moduleName}`);
+        }
+        cursor++;
+        return moduleName;
+    })
+    if (cursor !== expected.length) {
+        throw new Error('Test failed');
+    }
+    console.log('All test passed!')
+}
+
+// module.exports.runTest();

+ 3 - 0
node_modules/echarts/node_modules/zrender/dist/package.json

@@ -0,0 +1,3 @@
+{
+    "type": "commonjs"
+}

+ 17458 - 0
node_modules/echarts/node_modules/zrender/dist/zrender.js

@@ -0,0 +1,17458 @@
+(function (global, factory) {
+    typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports) :
+    typeof define === 'function' && define.amd ? define(['exports'], factory) :
+    (global = global || self, factory(global.zrender = {}));
+}(this, (function (exports) { 'use strict';
+
+    var Browser = (function () {
+        function Browser() {
+            this.firefox = false;
+            this.ie = false;
+            this.edge = false;
+            this.newEdge = false;
+            this.weChat = false;
+        }
+        return Browser;
+    }());
+    var Env = (function () {
+        function Env() {
+            this.browser = new Browser();
+            this.node = false;
+            this.wxa = false;
+            this.worker = false;
+            this.svgSupported = false;
+            this.touchEventsSupported = false;
+            this.pointerEventsSupported = false;
+            this.domSupported = false;
+            this.transformSupported = false;
+            this.transform3dSupported = false;
+            this.hasGlobalWindow = typeof window !== 'undefined';
+        }
+        return Env;
+    }());
+    var env = new Env();
+    if (typeof wx === 'object' && typeof wx.getSystemInfoSync === 'function') {
+        env.wxa = true;
+        env.touchEventsSupported = true;
+    }
+    else if (typeof document === 'undefined' && typeof self !== 'undefined') {
+        env.worker = true;
+    }
+    else if (typeof navigator === 'undefined'
+        || navigator.userAgent.indexOf('Node.js') === 0) {
+        env.node = true;
+        env.svgSupported = true;
+    }
+    else {
+        detect(navigator.userAgent, env);
+    }
+    function detect(ua, env) {
+        var browser = env.browser;
+        var firefox = ua.match(/Firefox\/([\d.]+)/);
+        var ie = ua.match(/MSIE\s([\d.]+)/)
+            || ua.match(/Trident\/.+?rv:(([\d.]+))/);
+        var edge = ua.match(/Edge?\/([\d.]+)/);
+        var weChat = (/micromessenger/i).test(ua);
+        if (firefox) {
+            browser.firefox = true;
+            browser.version = firefox[1];
+        }
+        if (ie) {
+            browser.ie = true;
+            browser.version = ie[1];
+        }
+        if (edge) {
+            browser.edge = true;
+            browser.version = edge[1];
+            browser.newEdge = +edge[1].split('.')[0] > 18;
+        }
+        if (weChat) {
+            browser.weChat = true;
+        }
+        env.svgSupported = typeof SVGRect !== 'undefined';
+        env.touchEventsSupported = 'ontouchstart' in window && !browser.ie && !browser.edge;
+        env.pointerEventsSupported = 'onpointerdown' in window
+            && (browser.edge || (browser.ie && +browser.version >= 11));
+        env.domSupported = typeof document !== 'undefined';
+        var style = document.documentElement.style;
+        env.transform3dSupported = ((browser.ie && 'transition' in style)
+            || browser.edge
+            || (('WebKitCSSMatrix' in window) && ('m11' in new WebKitCSSMatrix()))
+            || 'MozPerspective' in style)
+            && !('OTransition' in style);
+        env.transformSupported = env.transform3dSupported
+            || (browser.ie && +browser.version >= 9);
+    }
+
+    var DEFAULT_FONT_SIZE = 12;
+    var DEFAULT_FONT_FAMILY = 'sans-serif';
+    var DEFAULT_FONT = DEFAULT_FONT_SIZE + "px " + DEFAULT_FONT_FAMILY;
+    var OFFSET = 20;
+    var SCALE = 100;
+    var defaultWidthMapStr = "007LLmW'55;N0500LLLLLLLLLL00NNNLzWW\\\\WQb\\0FWLg\\bWb\\WQ\\WrWWQ000CL5LLFLL0LL**F*gLLLL5F0LF\\FFF5.5N";
+    function getTextWidthMap(mapStr) {
+        var map = {};
+        if (typeof JSON === 'undefined') {
+            return map;
+        }
+        for (var i = 0; i < mapStr.length; i++) {
+            var char = String.fromCharCode(i + 32);
+            var size = (mapStr.charCodeAt(i) - OFFSET) / SCALE;
+            map[char] = size;
+        }
+        return map;
+    }
+    var DEFAULT_TEXT_WIDTH_MAP = getTextWidthMap(defaultWidthMapStr);
+    var platformApi = {
+        createCanvas: function () {
+            return typeof document !== 'undefined'
+                && document.createElement('canvas');
+        },
+        measureText: (function () {
+            var _ctx;
+            var _cachedFont;
+            return function (text, font) {
+                if (!_ctx) {
+                    var canvas = platformApi.createCanvas();
+                    _ctx = canvas && canvas.getContext('2d');
+                }
+                if (_ctx) {
+                    if (_cachedFont !== font) {
+                        _cachedFont = _ctx.font = font || DEFAULT_FONT;
+                    }
+                    return _ctx.measureText(text);
+                }
+                else {
+                    text = text || '';
+                    font = font || DEFAULT_FONT;
+                    var res = /((?:\d+)?\.?\d*)px/.exec(font);
+                    var fontSize = res && +res[1] || DEFAULT_FONT_SIZE;
+                    var width = 0;
+                    if (font.indexOf('mono') >= 0) {
+                        width = fontSize * text.length;
+                    }
+                    else {
+                        for (var i = 0; i < text.length; i++) {
+                            var preCalcWidth = DEFAULT_TEXT_WIDTH_MAP[text[i]];
+                            width += preCalcWidth == null ? fontSize : (preCalcWidth * fontSize);
+                        }
+                    }
+                    return { width: width };
+                }
+            };
+        })(),
+        loadImage: function (src, onload, onerror) {
+            var image = new Image();
+            image.onload = onload;
+            image.onerror = onerror;
+            image.src = src;
+            return image;
+        }
+    };
+    function setPlatformAPI(newPlatformApis) {
+        for (var key in platformApi) {
+            if (newPlatformApis[key]) {
+                platformApi[key] = newPlatformApis[key];
+            }
+        }
+    }
+
+    var BUILTIN_OBJECT = reduce([
+        'Function',
+        'RegExp',
+        'Date',
+        'Error',
+        'CanvasGradient',
+        'CanvasPattern',
+        'Image',
+        'Canvas'
+    ], function (obj, val) {
+        obj['[object ' + val + ']'] = true;
+        return obj;
+    }, {});
+    var TYPED_ARRAY = reduce([
+        'Int8',
+        'Uint8',
+        'Uint8Clamped',
+        'Int16',
+        'Uint16',
+        'Int32',
+        'Uint32',
+        'Float32',
+        'Float64'
+    ], function (obj, val) {
+        obj['[object ' + val + 'Array]'] = true;
+        return obj;
+    }, {});
+    var objToString = Object.prototype.toString;
+    var arrayProto = Array.prototype;
+    var nativeForEach = arrayProto.forEach;
+    var nativeFilter = arrayProto.filter;
+    var nativeSlice = arrayProto.slice;
+    var nativeMap = arrayProto.map;
+    var ctorFunction = function () { }.constructor;
+    var protoFunction = ctorFunction ? ctorFunction.prototype : null;
+    var protoKey = '__proto__';
+    var idStart = 0x0907;
+    function guid() {
+        return idStart++;
+    }
+    function logError() {
+        var args = [];
+        for (var _i = 0; _i < arguments.length; _i++) {
+            args[_i] = arguments[_i];
+        }
+        if (typeof console !== 'undefined') {
+            console.error.apply(console, args);
+        }
+    }
+    function clone(source) {
+        if (source == null || typeof source !== 'object') {
+            return source;
+        }
+        var result = source;
+        var typeStr = objToString.call(source);
+        if (typeStr === '[object Array]') {
+            if (!isPrimitive(source)) {
+                result = [];
+                for (var i = 0, len = source.length; i < len; i++) {
+                    result[i] = clone(source[i]);
+                }
+            }
+        }
+        else if (TYPED_ARRAY[typeStr]) {
+            if (!isPrimitive(source)) {
+                var Ctor = source.constructor;
+                if (Ctor.from) {
+                    result = Ctor.from(source);
+                }
+                else {
+                    result = new Ctor(source.length);
+                    for (var i = 0, len = source.length; i < len; i++) {
+                        result[i] = source[i];
+                    }
+                }
+            }
+        }
+        else if (!BUILTIN_OBJECT[typeStr] && !isPrimitive(source) && !isDom(source)) {
+            result = {};
+            for (var key in source) {
+                if (source.hasOwnProperty(key) && key !== protoKey) {
+                    result[key] = clone(source[key]);
+                }
+            }
+        }
+        return result;
+    }
+    function merge(target, source, overwrite) {
+        if (!isObject(source) || !isObject(target)) {
+            return overwrite ? clone(source) : target;
+        }
+        for (var key in source) {
+            if (source.hasOwnProperty(key) && key !== protoKey) {
+                var targetProp = target[key];
+                var sourceProp = source[key];
+                if (isObject(sourceProp)
+                    && isObject(targetProp)
+                    && !isArray(sourceProp)
+                    && !isArray(targetProp)
+                    && !isDom(sourceProp)
+                    && !isDom(targetProp)
+                    && !isBuiltInObject(sourceProp)
+                    && !isBuiltInObject(targetProp)
+                    && !isPrimitive(sourceProp)
+                    && !isPrimitive(targetProp)) {
+                    merge(targetProp, sourceProp, overwrite);
+                }
+                else if (overwrite || !(key in target)) {
+                    target[key] = clone(source[key]);
+                }
+            }
+        }
+        return target;
+    }
+    function mergeAll(targetAndSources, overwrite) {
+        var result = targetAndSources[0];
+        for (var i = 1, len = targetAndSources.length; i < len; i++) {
+            result = merge(result, targetAndSources[i], overwrite);
+        }
+        return result;
+    }
+    function extend(target, source) {
+        if (Object.assign) {
+            Object.assign(target, source);
+        }
+        else {
+            for (var key in source) {
+                if (source.hasOwnProperty(key) && key !== protoKey) {
+                    target[key] = source[key];
+                }
+            }
+        }
+        return target;
+    }
+    function defaults(target, source, overlay) {
+        var keysArr = keys(source);
+        for (var i = 0; i < keysArr.length; i++) {
+            var key = keysArr[i];
+            if ((overlay ? source[key] != null : target[key] == null)) {
+                target[key] = source[key];
+            }
+        }
+        return target;
+    }
+    var createCanvas = platformApi.createCanvas;
+    function indexOf(array, value) {
+        if (array) {
+            if (array.indexOf) {
+                return array.indexOf(value);
+            }
+            for (var i = 0, len = array.length; i < len; i++) {
+                if (array[i] === value) {
+                    return i;
+                }
+            }
+        }
+        return -1;
+    }
+    function inherits(clazz, baseClazz) {
+        var clazzPrototype = clazz.prototype;
+        function F() { }
+        F.prototype = baseClazz.prototype;
+        clazz.prototype = new F();
+        for (var prop in clazzPrototype) {
+            if (clazzPrototype.hasOwnProperty(prop)) {
+                clazz.prototype[prop] = clazzPrototype[prop];
+            }
+        }
+        clazz.prototype.constructor = clazz;
+        clazz.superClass = baseClazz;
+    }
+    function mixin(target, source, override) {
+        target = 'prototype' in target ? target.prototype : target;
+        source = 'prototype' in source ? source.prototype : source;
+        if (Object.getOwnPropertyNames) {
+            var keyList = Object.getOwnPropertyNames(source);
+            for (var i = 0; i < keyList.length; i++) {
+                var key = keyList[i];
+                if (key !== 'constructor') {
+                    if ((override ? source[key] != null : target[key] == null)) {
+                        target[key] = source[key];
+                    }
+                }
+            }
+        }
+        else {
+            defaults(target, source, override);
+        }
+    }
+    function isArrayLike(data) {
+        if (!data) {
+            return false;
+        }
+        if (typeof data === 'string') {
+            return false;
+        }
+        return typeof data.length === 'number';
+    }
+    function each(arr, cb, context) {
+        if (!(arr && cb)) {
+            return;
+        }
+        if (arr.forEach && arr.forEach === nativeForEach) {
+            arr.forEach(cb, context);
+        }
+        else if (arr.length === +arr.length) {
+            for (var i = 0, len = arr.length; i < len; i++) {
+                cb.call(context, arr[i], i, arr);
+            }
+        }
+        else {
+            for (var key in arr) {
+                if (arr.hasOwnProperty(key)) {
+                    cb.call(context, arr[key], key, arr);
+                }
+            }
+        }
+    }
+    function map(arr, cb, context) {
+        if (!arr) {
+            return [];
+        }
+        if (!cb) {
+            return slice(arr);
+        }
+        if (arr.map && arr.map === nativeMap) {
+            return arr.map(cb, context);
+        }
+        else {
+            var result = [];
+            for (var i = 0, len = arr.length; i < len; i++) {
+                result.push(cb.call(context, arr[i], i, arr));
+            }
+            return result;
+        }
+    }
+    function reduce(arr, cb, memo, context) {
+        if (!(arr && cb)) {
+            return;
+        }
+        for (var i = 0, len = arr.length; i < len; i++) {
+            memo = cb.call(context, memo, arr[i], i, arr);
+        }
+        return memo;
+    }
+    function filter(arr, cb, context) {
+        if (!arr) {
+            return [];
+        }
+        if (!cb) {
+            return slice(arr);
+        }
+        if (arr.filter && arr.filter === nativeFilter) {
+            return arr.filter(cb, context);
+        }
+        else {
+            var result = [];
+            for (var i = 0, len = arr.length; i < len; i++) {
+                if (cb.call(context, arr[i], i, arr)) {
+                    result.push(arr[i]);
+                }
+            }
+            return result;
+        }
+    }
+    function find(arr, cb, context) {
+        if (!(arr && cb)) {
+            return;
+        }
+        for (var i = 0, len = arr.length; i < len; i++) {
+            if (cb.call(context, arr[i], i, arr)) {
+                return arr[i];
+            }
+        }
+    }
+    function keys(obj) {
+        if (!obj) {
+            return [];
+        }
+        if (Object.keys) {
+            return Object.keys(obj);
+        }
+        var keyList = [];
+        for (var key in obj) {
+            if (obj.hasOwnProperty(key)) {
+                keyList.push(key);
+            }
+        }
+        return keyList;
+    }
+    function bindPolyfill(func, context) {
+        var args = [];
+        for (var _i = 2; _i < arguments.length; _i++) {
+            args[_i - 2] = arguments[_i];
+        }
+        return function () {
+            return func.apply(context, args.concat(nativeSlice.call(arguments)));
+        };
+    }
+    var bind = (protoFunction && isFunction(protoFunction.bind))
+        ? protoFunction.call.bind(protoFunction.bind)
+        : bindPolyfill;
+    function curry(func) {
+        var args = [];
+        for (var _i = 1; _i < arguments.length; _i++) {
+            args[_i - 1] = arguments[_i];
+        }
+        return function () {
+            return func.apply(this, args.concat(nativeSlice.call(arguments)));
+        };
+    }
+    function isArray(value) {
+        if (Array.isArray) {
+            return Array.isArray(value);
+        }
+        return objToString.call(value) === '[object Array]';
+    }
+    function isFunction(value) {
+        return typeof value === 'function';
+    }
+    function isString(value) {
+        return typeof value === 'string';
+    }
+    function isStringSafe(value) {
+        return objToString.call(value) === '[object String]';
+    }
+    function isNumber(value) {
+        return typeof value === 'number';
+    }
+    function isObject(value) {
+        var type = typeof value;
+        return type === 'function' || (!!value && type === 'object');
+    }
+    function isBuiltInObject(value) {
+        return !!BUILTIN_OBJECT[objToString.call(value)];
+    }
+    function isTypedArray(value) {
+        return !!TYPED_ARRAY[objToString.call(value)];
+    }
+    function isDom(value) {
+        return typeof value === 'object'
+            && typeof value.nodeType === 'number'
+            && typeof value.ownerDocument === 'object';
+    }
+    function isGradientObject(value) {
+        return value.colorStops != null;
+    }
+    function isImagePatternObject(value) {
+        return value.image != null;
+    }
+    function isRegExp(value) {
+        return objToString.call(value) === '[object RegExp]';
+    }
+    function eqNaN(value) {
+        return value !== value;
+    }
+    function retrieve() {
+        var args = [];
+        for (var _i = 0; _i < arguments.length; _i++) {
+            args[_i] = arguments[_i];
+        }
+        for (var i = 0, len = args.length; i < len; i++) {
+            if (args[i] != null) {
+                return args[i];
+            }
+        }
+    }
+    function retrieve2(value0, value1) {
+        return value0 != null
+            ? value0
+            : value1;
+    }
+    function retrieve3(value0, value1, value2) {
+        return value0 != null
+            ? value0
+            : value1 != null
+                ? value1
+                : value2;
+    }
+    function slice(arr) {
+        var args = [];
+        for (var _i = 1; _i < arguments.length; _i++) {
+            args[_i - 1] = arguments[_i];
+        }
+        return nativeSlice.apply(arr, args);
+    }
+    function normalizeCssArray(val) {
+        if (typeof (val) === 'number') {
+            return [val, val, val, val];
+        }
+        var len = val.length;
+        if (len === 2) {
+            return [val[0], val[1], val[0], val[1]];
+        }
+        else if (len === 3) {
+            return [val[0], val[1], val[2], val[1]];
+        }
+        return val;
+    }
+    function assert(condition, message) {
+        if (!condition) {
+            throw new Error(message);
+        }
+    }
+    function trim(str) {
+        if (str == null) {
+            return null;
+        }
+        else if (typeof str.trim === 'function') {
+            return str.trim();
+        }
+        else {
+            return str.replace(/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g, '');
+        }
+    }
+    var primitiveKey = '__ec_primitive__';
+    function setAsPrimitive(obj) {
+        obj[primitiveKey] = true;
+    }
+    function isPrimitive(obj) {
+        return obj[primitiveKey];
+    }
+    var MapPolyfill = (function () {
+        function MapPolyfill() {
+            this.data = {};
+        }
+        MapPolyfill.prototype["delete"] = function (key) {
+            var existed = this.has(key);
+            if (existed) {
+                delete this.data[key];
+            }
+            return existed;
+        };
+        MapPolyfill.prototype.has = function (key) {
+            return this.data.hasOwnProperty(key);
+        };
+        MapPolyfill.prototype.get = function (key) {
+            return this.data[key];
+        };
+        MapPolyfill.prototype.set = function (key, value) {
+            this.data[key] = value;
+            return this;
+        };
+        MapPolyfill.prototype.keys = function () {
+            return keys(this.data);
+        };
+        MapPolyfill.prototype.forEach = function (callback) {
+            var data = this.data;
+            for (var key in data) {
+                if (data.hasOwnProperty(key)) {
+                    callback(data[key], key);
+                }
+            }
+        };
+        return MapPolyfill;
+    }());
+    var isNativeMapSupported = typeof Map === 'function';
+    function maybeNativeMap() {
+        return (isNativeMapSupported ? new Map() : new MapPolyfill());
+    }
+    var HashMap = (function () {
+        function HashMap(obj) {
+            var isArr = isArray(obj);
+            this.data = maybeNativeMap();
+            var thisMap = this;
+            (obj instanceof HashMap)
+                ? obj.each(visit)
+                : (obj && each(obj, visit));
+            function visit(value, key) {
+                isArr ? thisMap.set(value, key) : thisMap.set(key, value);
+            }
+        }
+        HashMap.prototype.hasKey = function (key) {
+            return this.data.has(key);
+        };
+        HashMap.prototype.get = function (key) {
+            return this.data.get(key);
+        };
+        HashMap.prototype.set = function (key, value) {
+            this.data.set(key, value);
+            return value;
+        };
+        HashMap.prototype.each = function (cb, context) {
+            this.data.forEach(function (value, key) {
+                cb.call(context, value, key);
+            });
+        };
+        HashMap.prototype.keys = function () {
+            var keys = this.data.keys();
+            return isNativeMapSupported
+                ? Array.from(keys)
+                : keys;
+        };
+        HashMap.prototype.removeKey = function (key) {
+            this.data["delete"](key);
+        };
+        return HashMap;
+    }());
+    function createHashMap(obj) {
+        return new HashMap(obj);
+    }
+    function concatArray(a, b) {
+        var newArray = new a.constructor(a.length + b.length);
+        for (var i = 0; i < a.length; i++) {
+            newArray[i] = a[i];
+        }
+        var offset = a.length;
+        for (var i = 0; i < b.length; i++) {
+            newArray[i + offset] = b[i];
+        }
+        return newArray;
+    }
+    function createObject(proto, properties) {
+        var obj;
+        if (Object.create) {
+            obj = Object.create(proto);
+        }
+        else {
+            var StyleCtor = function () { };
+            StyleCtor.prototype = proto;
+            obj = new StyleCtor();
+        }
+        if (properties) {
+            extend(obj, properties);
+        }
+        return obj;
+    }
+    function disableUserSelect(dom) {
+        var domStyle = dom.style;
+        domStyle.webkitUserSelect = 'none';
+        domStyle.userSelect = 'none';
+        domStyle.webkitTapHighlightColor = 'rgba(0,0,0,0)';
+        domStyle['-webkit-touch-callout'] = 'none';
+    }
+    function hasOwn(own, prop) {
+        return own.hasOwnProperty(prop);
+    }
+    function noop() { }
+    var RADIAN_TO_DEGREE = 180 / Math.PI;
+
+    var util = /*#__PURE__*/Object.freeze({
+        __proto__: null,
+        guid: guid,
+        logError: logError,
+        clone: clone,
+        merge: merge,
+        mergeAll: mergeAll,
+        extend: extend,
+        defaults: defaults,
+        createCanvas: createCanvas,
+        indexOf: indexOf,
+        inherits: inherits,
+        mixin: mixin,
+        isArrayLike: isArrayLike,
+        each: each,
+        map: map,
+        reduce: reduce,
+        filter: filter,
+        find: find,
+        keys: keys,
+        bind: bind,
+        curry: curry,
+        isArray: isArray,
+        isFunction: isFunction,
+        isString: isString,
+        isStringSafe: isStringSafe,
+        isNumber: isNumber,
+        isObject: isObject,
+        isBuiltInObject: isBuiltInObject,
+        isTypedArray: isTypedArray,
+        isDom: isDom,
+        isGradientObject: isGradientObject,
+        isImagePatternObject: isImagePatternObject,
+        isRegExp: isRegExp,
+        eqNaN: eqNaN,
+        retrieve: retrieve,
+        retrieve2: retrieve2,
+        retrieve3: retrieve3,
+        slice: slice,
+        normalizeCssArray: normalizeCssArray,
+        assert: assert,
+        trim: trim,
+        setAsPrimitive: setAsPrimitive,
+        isPrimitive: isPrimitive,
+        HashMap: HashMap,
+        createHashMap: createHashMap,
+        concatArray: concatArray,
+        createObject: createObject,
+        disableUserSelect: disableUserSelect,
+        hasOwn: hasOwn,
+        noop: noop,
+        RADIAN_TO_DEGREE: RADIAN_TO_DEGREE
+    });
+
+    /*! *****************************************************************************
+    Copyright (c) Microsoft Corporation. All rights reserved.
+    Licensed under the Apache License, Version 2.0 (the "License"); you may not use
+    this file except in compliance with the License. You may obtain a copy of the
+    License at http://www.apache.org/licenses/LICENSE-2.0
+
+    THIS CODE IS PROVIDED ON AN *AS IS* BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+    KIND, EITHER EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION ANY IMPLIED
+    WARRANTIES OR CONDITIONS OF TITLE, FITNESS FOR A PARTICULAR PURPOSE,
+    MERCHANTABLITY OR NON-INFRINGEMENT.
+
+    See the Apache Version 2.0 License for specific language governing permissions
+    and limitations under the License.
+    ***************************************************************************** */
+    /* global Reflect, Promise */
+
+    var extendStatics = function(d, b) {
+        extendStatics = Object.setPrototypeOf ||
+            ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
+            function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; };
+        return extendStatics(d, b);
+    };
+
+    function __extends(d, b) {
+        extendStatics(d, b);
+        function __() { this.constructor = d; }
+        d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
+    }
+
+    function create(x, y) {
+        if (x == null) {
+            x = 0;
+        }
+        if (y == null) {
+            y = 0;
+        }
+        return [x, y];
+    }
+    function copy(out, v) {
+        out[0] = v[0];
+        out[1] = v[1];
+        return out;
+    }
+    function clone$1(v) {
+        return [v[0], v[1]];
+    }
+    function set(out, a, b) {
+        out[0] = a;
+        out[1] = b;
+        return out;
+    }
+    function add(out, v1, v2) {
+        out[0] = v1[0] + v2[0];
+        out[1] = v1[1] + v2[1];
+        return out;
+    }
+    function scaleAndAdd(out, v1, v2, a) {
+        out[0] = v1[0] + v2[0] * a;
+        out[1] = v1[1] + v2[1] * a;
+        return out;
+    }
+    function sub(out, v1, v2) {
+        out[0] = v1[0] - v2[0];
+        out[1] = v1[1] - v2[1];
+        return out;
+    }
+    function len(v) {
+        return Math.sqrt(lenSquare(v));
+    }
+    var length = len;
+    function lenSquare(v) {
+        return v[0] * v[0] + v[1] * v[1];
+    }
+    var lengthSquare = lenSquare;
+    function mul(out, v1, v2) {
+        out[0] = v1[0] * v2[0];
+        out[1] = v1[1] * v2[1];
+        return out;
+    }
+    function div(out, v1, v2) {
+        out[0] = v1[0] / v2[0];
+        out[1] = v1[1] / v2[1];
+        return out;
+    }
+    function dot(v1, v2) {
+        return v1[0] * v2[0] + v1[1] * v2[1];
+    }
+    function scale(out, v, s) {
+        out[0] = v[0] * s;
+        out[1] = v[1] * s;
+        return out;
+    }
+    function normalize(out, v) {
+        var d = len(v);
+        if (d === 0) {
+            out[0] = 0;
+            out[1] = 0;
+        }
+        else {
+            out[0] = v[0] / d;
+            out[1] = v[1] / d;
+        }
+        return out;
+    }
+    function distance(v1, v2) {
+        return Math.sqrt((v1[0] - v2[0]) * (v1[0] - v2[0])
+            + (v1[1] - v2[1]) * (v1[1] - v2[1]));
+    }
+    var dist = distance;
+    function distanceSquare(v1, v2) {
+        return (v1[0] - v2[0]) * (v1[0] - v2[0])
+            + (v1[1] - v2[1]) * (v1[1] - v2[1]);
+    }
+    var distSquare = distanceSquare;
+    function negate(out, v) {
+        out[0] = -v[0];
+        out[1] = -v[1];
+        return out;
+    }
+    function lerp(out, v1, v2, t) {
+        out[0] = v1[0] + t * (v2[0] - v1[0]);
+        out[1] = v1[1] + t * (v2[1] - v1[1]);
+        return out;
+    }
+    function applyTransform(out, v, m) {
+        var x = v[0];
+        var y = v[1];
+        out[0] = m[0] * x + m[2] * y + m[4];
+        out[1] = m[1] * x + m[3] * y + m[5];
+        return out;
+    }
+    function min(out, v1, v2) {
+        out[0] = Math.min(v1[0], v2[0]);
+        out[1] = Math.min(v1[1], v2[1]);
+        return out;
+    }
+    function max(out, v1, v2) {
+        out[0] = Math.max(v1[0], v2[0]);
+        out[1] = Math.max(v1[1], v2[1]);
+        return out;
+    }
+
+    var vector = /*#__PURE__*/Object.freeze({
+        __proto__: null,
+        create: create,
+        copy: copy,
+        clone: clone$1,
+        set: set,
+        add: add,
+        scaleAndAdd: scaleAndAdd,
+        sub: sub,
+        len: len,
+        length: length,
+        lenSquare: lenSquare,
+        lengthSquare: lengthSquare,
+        mul: mul,
+        div: div,
+        dot: dot,
+        scale: scale,
+        normalize: normalize,
+        distance: distance,
+        dist: dist,
+        distanceSquare: distanceSquare,
+        distSquare: distSquare,
+        negate: negate,
+        lerp: lerp,
+        applyTransform: applyTransform,
+        min: min,
+        max: max
+    });
+
+    var Param = (function () {
+        function Param(target, e) {
+            this.target = target;
+            this.topTarget = e && e.topTarget;
+        }
+        return Param;
+    }());
+    var Draggable = (function () {
+        function Draggable(handler) {
+            this.handler = handler;
+            handler.on('mousedown', this._dragStart, this);
+            handler.on('mousemove', this._drag, this);
+            handler.on('mouseup', this._dragEnd, this);
+        }
+        Draggable.prototype._dragStart = function (e) {
+            var draggingTarget = e.target;
+            while (draggingTarget && !draggingTarget.draggable) {
+                draggingTarget = draggingTarget.parent || draggingTarget.__hostTarget;
+            }
+            if (draggingTarget) {
+                this._draggingTarget = draggingTarget;
+                draggingTarget.dragging = true;
+                this._x = e.offsetX;
+                this._y = e.offsetY;
+                this.handler.dispatchToElement(new Param(draggingTarget, e), 'dragstart', e.event);
+            }
+        };
+        Draggable.prototype._drag = function (e) {
+            var draggingTarget = this._draggingTarget;
+            if (draggingTarget) {
+                var x = e.offsetX;
+                var y = e.offsetY;
+                var dx = x - this._x;
+                var dy = y - this._y;
+                this._x = x;
+                this._y = y;
+                draggingTarget.drift(dx, dy, e);
+                this.handler.dispatchToElement(new Param(draggingTarget, e), 'drag', e.event);
+                var dropTarget = this.handler.findHover(x, y, draggingTarget).target;
+                var lastDropTarget = this._dropTarget;
+                this._dropTarget = dropTarget;
+                if (draggingTarget !== dropTarget) {
+                    if (lastDropTarget && dropTarget !== lastDropTarget) {
+                        this.handler.dispatchToElement(new Param(lastDropTarget, e), 'dragleave', e.event);
+                    }
+                    if (dropTarget && dropTarget !== lastDropTarget) {
+                        this.handler.dispatchToElement(new Param(dropTarget, e), 'dragenter', e.event);
+                    }
+                }
+            }
+        };
+        Draggable.prototype._dragEnd = function (e) {
+            var draggingTarget = this._draggingTarget;
+            if (draggingTarget) {
+                draggingTarget.dragging = false;
+            }
+            this.handler.dispatchToElement(new Param(draggingTarget, e), 'dragend', e.event);
+            if (this._dropTarget) {
+                this.handler.dispatchToElement(new Param(this._dropTarget, e), 'drop', e.event);
+            }
+            this._draggingTarget = null;
+            this._dropTarget = null;
+        };
+        return Draggable;
+    }());
+
+    var Eventful = (function () {
+        function Eventful(eventProcessors) {
+            if (eventProcessors) {
+                this._$eventProcessor = eventProcessors;
+            }
+        }
+        Eventful.prototype.on = function (event, query, handler, context) {
+            if (!this._$handlers) {
+                this._$handlers = {};
+            }
+            var _h = this._$handlers;
+            if (typeof query === 'function') {
+                context = handler;
+                handler = query;
+                query = null;
+            }
+            if (!handler || !event) {
+                return this;
+            }
+            var eventProcessor = this._$eventProcessor;
+            if (query != null && eventProcessor && eventProcessor.normalizeQuery) {
+                query = eventProcessor.normalizeQuery(query);
+            }
+            if (!_h[event]) {
+                _h[event] = [];
+            }
+            for (var i = 0; i < _h[event].length; i++) {
+                if (_h[event][i].h === handler) {
+                    return this;
+                }
+            }
+            var wrap = {
+                h: handler,
+                query: query,
+                ctx: (context || this),
+                callAtLast: handler.zrEventfulCallAtLast
+            };
+            var lastIndex = _h[event].length - 1;
+            var lastWrap = _h[event][lastIndex];
+            (lastWrap && lastWrap.callAtLast)
+                ? _h[event].splice(lastIndex, 0, wrap)
+                : _h[event].push(wrap);
+            return this;
+        };
+        Eventful.prototype.isSilent = function (eventName) {
+            var _h = this._$handlers;
+            return !_h || !_h[eventName] || !_h[eventName].length;
+        };
+        Eventful.prototype.off = function (eventType, handler) {
+            var _h = this._$handlers;
+            if (!_h) {
+                return this;
+            }
+            if (!eventType) {
+                this._$handlers = {};
+                return this;
+            }
+            if (handler) {
+                if (_h[eventType]) {
+                    var newList = [];
+                    for (var i = 0, l = _h[eventType].length; i < l; i++) {
+                        if (_h[eventType][i].h !== handler) {
+                            newList.push(_h[eventType][i]);
+                        }
+                    }
+                    _h[eventType] = newList;
+                }
+                if (_h[eventType] && _h[eventType].length === 0) {
+                    delete _h[eventType];
+                }
+            }
+            else {
+                delete _h[eventType];
+            }
+            return this;
+        };
+        Eventful.prototype.trigger = function (eventType) {
+            var args = [];
+            for (var _i = 1; _i < arguments.length; _i++) {
+                args[_i - 1] = arguments[_i];
+            }
+            if (!this._$handlers) {
+                return this;
+            }
+            var _h = this._$handlers[eventType];
+            var eventProcessor = this._$eventProcessor;
+            if (_h) {
+                var argLen = args.length;
+                var len = _h.length;
+                for (var i = 0; i < len; i++) {
+                    var hItem = _h[i];
+                    if (eventProcessor
+                        && eventProcessor.filter
+                        && hItem.query != null
+                        && !eventProcessor.filter(eventType, hItem.query)) {
+                        continue;
+                    }
+                    switch (argLen) {
+                        case 0:
+                            hItem.h.call(hItem.ctx);
+                            break;
+                        case 1:
+                            hItem.h.call(hItem.ctx, args[0]);
+                            break;
+                        case 2:
+                            hItem.h.call(hItem.ctx, args[0], args[1]);
+                            break;
+                        default:
+                            hItem.h.apply(hItem.ctx, args);
+                            break;
+                    }
+                }
+            }
+            eventProcessor && eventProcessor.afterTrigger
+                && eventProcessor.afterTrigger(eventType);
+            return this;
+        };
+        Eventful.prototype.triggerWithContext = function (type) {
+            var args = [];
+            for (var _i = 1; _i < arguments.length; _i++) {
+                args[_i - 1] = arguments[_i];
+            }
+            if (!this._$handlers) {
+                return this;
+            }
+            var _h = this._$handlers[type];
+            var eventProcessor = this._$eventProcessor;
+            if (_h) {
+                var argLen = args.length;
+                var ctx = args[argLen - 1];
+                var len = _h.length;
+                for (var i = 0; i < len; i++) {
+                    var hItem = _h[i];
+                    if (eventProcessor
+                        && eventProcessor.filter
+                        && hItem.query != null
+                        && !eventProcessor.filter(type, hItem.query)) {
+                        continue;
+                    }
+                    switch (argLen) {
+                        case 0:
+                            hItem.h.call(ctx);
+                            break;
+                        case 1:
+                            hItem.h.call(ctx, args[0]);
+                            break;
+                        case 2:
+                            hItem.h.call(ctx, args[0], args[1]);
+                            break;
+                        default:
+                            hItem.h.apply(ctx, args.slice(1, argLen - 1));
+                            break;
+                    }
+                }
+            }
+            eventProcessor && eventProcessor.afterTrigger
+                && eventProcessor.afterTrigger(type);
+            return this;
+        };
+        return Eventful;
+    }());
+
+    var LN2 = Math.log(2);
+    function determinant(rows, rank, rowStart, rowMask, colMask, detCache) {
+        var cacheKey = rowMask + '-' + colMask;
+        var fullRank = rows.length;
+        if (detCache.hasOwnProperty(cacheKey)) {
+            return detCache[cacheKey];
+        }
+        if (rank === 1) {
+            var colStart = Math.round(Math.log(((1 << fullRank) - 1) & ~colMask) / LN2);
+            return rows[rowStart][colStart];
+        }
+        var subRowMask = rowMask | (1 << rowStart);
+        var subRowStart = rowStart + 1;
+        while (rowMask & (1 << subRowStart)) {
+            subRowStart++;
+        }
+        var sum = 0;
+        for (var j = 0, colLocalIdx = 0; j < fullRank; j++) {
+            var colTag = 1 << j;
+            if (!(colTag & colMask)) {
+                sum += (colLocalIdx % 2 ? -1 : 1) * rows[rowStart][j]
+                    * determinant(rows, rank - 1, subRowStart, subRowMask, colMask | colTag, detCache);
+                colLocalIdx++;
+            }
+        }
+        detCache[cacheKey] = sum;
+        return sum;
+    }
+    function buildTransformer(src, dest) {
+        var mA = [
+            [src[0], src[1], 1, 0, 0, 0, -dest[0] * src[0], -dest[0] * src[1]],
+            [0, 0, 0, src[0], src[1], 1, -dest[1] * src[0], -dest[1] * src[1]],
+            [src[2], src[3], 1, 0, 0, 0, -dest[2] * src[2], -dest[2] * src[3]],
+            [0, 0, 0, src[2], src[3], 1, -dest[3] * src[2], -dest[3] * src[3]],
+            [src[4], src[5], 1, 0, 0, 0, -dest[4] * src[4], -dest[4] * src[5]],
+            [0, 0, 0, src[4], src[5], 1, -dest[5] * src[4], -dest[5] * src[5]],
+            [src[6], src[7], 1, 0, 0, 0, -dest[6] * src[6], -dest[6] * src[7]],
+            [0, 0, 0, src[6], src[7], 1, -dest[7] * src[6], -dest[7] * src[7]]
+        ];
+        var detCache = {};
+        var det = determinant(mA, 8, 0, 0, 0, detCache);
+        if (det === 0) {
+            return;
+        }
+        var vh = [];
+        for (var i = 0; i < 8; i++) {
+            for (var j = 0; j < 8; j++) {
+                vh[j] == null && (vh[j] = 0);
+                vh[j] += ((i + j) % 2 ? -1 : 1)
+                    * determinant(mA, 7, i === 0 ? 1 : 0, 1 << i, 1 << j, detCache)
+                    / det * dest[i];
+            }
+        }
+        return function (out, srcPointX, srcPointY) {
+            var pk = srcPointX * vh[6] + srcPointY * vh[7] + 1;
+            out[0] = (srcPointX * vh[0] + srcPointY * vh[1] + vh[2]) / pk;
+            out[1] = (srcPointX * vh[3] + srcPointY * vh[4] + vh[5]) / pk;
+        };
+    }
+
+    var EVENT_SAVED_PROP = '___zrEVENTSAVED';
+    function transformCoordWithViewport(out, el, inX, inY, inverse) {
+        if (el.getBoundingClientRect && env.domSupported && !isCanvasEl(el)) {
+            var saved = el[EVENT_SAVED_PROP] || (el[EVENT_SAVED_PROP] = {});
+            var markers = prepareCoordMarkers(el, saved);
+            var transformer = preparePointerTransformer(markers, saved, inverse);
+            if (transformer) {
+                transformer(out, inX, inY);
+                return true;
+            }
+        }
+        return false;
+    }
+    function prepareCoordMarkers(el, saved) {
+        var markers = saved.markers;
+        if (markers) {
+            return markers;
+        }
+        markers = saved.markers = [];
+        var propLR = ['left', 'right'];
+        var propTB = ['top', 'bottom'];
+        for (var i = 0; i < 4; i++) {
+            var marker = document.createElement('div');
+            var stl = marker.style;
+            var idxLR = i % 2;
+            var idxTB = (i >> 1) % 2;
+            stl.cssText = [
+                'position: absolute',
+                'visibility: hidden',
+                'padding: 0',
+                'margin: 0',
+                'border-width: 0',
+                'user-select: none',
+                'width:0',
+                'height:0',
+                propLR[idxLR] + ':0',
+                propTB[idxTB] + ':0',
+                propLR[1 - idxLR] + ':auto',
+                propTB[1 - idxTB] + ':auto',
+                ''
+            ].join('!important;');
+            el.appendChild(marker);
+            markers.push(marker);
+        }
+        return markers;
+    }
+    function preparePointerTransformer(markers, saved, inverse) {
+        var transformerName = inverse ? 'invTrans' : 'trans';
+        var transformer = saved[transformerName];
+        var oldSrcCoords = saved.srcCoords;
+        var srcCoords = [];
+        var destCoords = [];
+        var oldCoordTheSame = true;
+        for (var i = 0; i < 4; i++) {
+            var rect = markers[i].getBoundingClientRect();
+            var ii = 2 * i;
+            var x = rect.left;
+            var y = rect.top;
+            srcCoords.push(x, y);
+            oldCoordTheSame = oldCoordTheSame && oldSrcCoords && x === oldSrcCoords[ii] && y === oldSrcCoords[ii + 1];
+            destCoords.push(markers[i].offsetLeft, markers[i].offsetTop);
+        }
+        return (oldCoordTheSame && transformer)
+            ? transformer
+            : (saved.srcCoords = srcCoords,
+                saved[transformerName] = inverse
+                    ? buildTransformer(destCoords, srcCoords)
+                    : buildTransformer(srcCoords, destCoords));
+    }
+    function isCanvasEl(el) {
+        return el.nodeName.toUpperCase() === 'CANVAS';
+    }
+    var replaceReg = /([&<>"'])/g;
+    var replaceMap = {
+        '&': '&amp;',
+        '<': '&lt;',
+        '>': '&gt;',
+        '"': '&quot;',
+        '\'': '&#39;'
+    };
+    function encodeHTML(source) {
+        return source == null
+            ? ''
+            : (source + '').replace(replaceReg, function (str, c) {
+                return replaceMap[c];
+            });
+    }
+
+    var MOUSE_EVENT_REG = /^(?:mouse|pointer|contextmenu|drag|drop)|click/;
+    var _calcOut = [];
+    var firefoxNotSupportOffsetXY = env.browser.firefox
+        && +env.browser.version.split('.')[0] < 39;
+    function clientToLocal(el, e, out, calculate) {
+        out = out || {};
+        if (calculate) {
+            calculateZrXY(el, e, out);
+        }
+        else if (firefoxNotSupportOffsetXY
+            && e.layerX != null
+            && e.layerX !== e.offsetX) {
+            out.zrX = e.layerX;
+            out.zrY = e.layerY;
+        }
+        else if (e.offsetX != null) {
+            out.zrX = e.offsetX;
+            out.zrY = e.offsetY;
+        }
+        else {
+            calculateZrXY(el, e, out);
+        }
+        return out;
+    }
+    function calculateZrXY(el, e, out) {
+        if (env.domSupported && el.getBoundingClientRect) {
+            var ex = e.clientX;
+            var ey = e.clientY;
+            if (isCanvasEl(el)) {
+                var box = el.getBoundingClientRect();
+                out.zrX = ex - box.left;
+                out.zrY = ey - box.top;
+                return;
+            }
+            else {
+                if (transformCoordWithViewport(_calcOut, el, ex, ey)) {
+                    out.zrX = _calcOut[0];
+                    out.zrY = _calcOut[1];
+                    return;
+                }
+            }
+        }
+        out.zrX = out.zrY = 0;
+    }
+    function getNativeEvent(e) {
+        return e
+            || window.event;
+    }
+    function normalizeEvent(el, e, calculate) {
+        e = getNativeEvent(e);
+        if (e.zrX != null) {
+            return e;
+        }
+        var eventType = e.type;
+        var isTouch = eventType && eventType.indexOf('touch') >= 0;
+        if (!isTouch) {
+            clientToLocal(el, e, e, calculate);
+            var wheelDelta = getWheelDeltaMayPolyfill(e);
+            e.zrDelta = wheelDelta ? wheelDelta / 120 : -(e.detail || 0) / 3;
+        }
+        else {
+            var touch = eventType !== 'touchend'
+                ? e.targetTouches[0]
+                : e.changedTouches[0];
+            touch && clientToLocal(el, touch, e, calculate);
+        }
+        var button = e.button;
+        if (e.which == null && button !== undefined && MOUSE_EVENT_REG.test(e.type)) {
+            e.which = (button & 1 ? 1 : (button & 2 ? 3 : (button & 4 ? 2 : 0)));
+        }
+        return e;
+    }
+    function getWheelDeltaMayPolyfill(e) {
+        var rawWheelDelta = e.wheelDelta;
+        if (rawWheelDelta) {
+            return rawWheelDelta;
+        }
+        var deltaX = e.deltaX;
+        var deltaY = e.deltaY;
+        if (deltaX == null || deltaY == null) {
+            return rawWheelDelta;
+        }
+        var delta = deltaY !== 0 ? Math.abs(deltaY) : Math.abs(deltaX);
+        var sign = deltaY > 0 ? -1
+            : deltaY < 0 ? 1
+                : deltaX > 0 ? -1
+                    : 1;
+        return 3 * delta * sign;
+    }
+    function addEventListener(el, name, handler, opt) {
+        el.addEventListener(name, handler, opt);
+    }
+    function removeEventListener(el, name, handler, opt) {
+        el.removeEventListener(name, handler, opt);
+    }
+    var stop = function (e) {
+        e.preventDefault();
+        e.stopPropagation();
+        e.cancelBubble = true;
+    };
+
+    var GestureMgr = (function () {
+        function GestureMgr() {
+            this._track = [];
+        }
+        GestureMgr.prototype.recognize = function (event, target, root) {
+            this._doTrack(event, target, root);
+            return this._recognize(event);
+        };
+        GestureMgr.prototype.clear = function () {
+            this._track.length = 0;
+            return this;
+        };
+        GestureMgr.prototype._doTrack = function (event, target, root) {
+            var touches = event.touches;
+            if (!touches) {
+                return;
+            }
+            var trackItem = {
+                points: [],
+                touches: [],
+                target: target,
+                event: event
+            };
+            for (var i = 0, len = touches.length; i < len; i++) {
+                var touch = touches[i];
+                var pos = clientToLocal(root, touch, {});
+                trackItem.points.push([pos.zrX, pos.zrY]);
+                trackItem.touches.push(touch);
+            }
+            this._track.push(trackItem);
+        };
+        GestureMgr.prototype._recognize = function (event) {
+            for (var eventName in recognizers) {
+                if (recognizers.hasOwnProperty(eventName)) {
+                    var gestureInfo = recognizers[eventName](this._track, event);
+                    if (gestureInfo) {
+                        return gestureInfo;
+                    }
+                }
+            }
+        };
+        return GestureMgr;
+    }());
+    function dist$1(pointPair) {
+        var dx = pointPair[1][0] - pointPair[0][0];
+        var dy = pointPair[1][1] - pointPair[0][1];
+        return Math.sqrt(dx * dx + dy * dy);
+    }
+    function center(pointPair) {
+        return [
+            (pointPair[0][0] + pointPair[1][0]) / 2,
+            (pointPair[0][1] + pointPair[1][1]) / 2
+        ];
+    }
+    var recognizers = {
+        pinch: function (tracks, event) {
+            var trackLen = tracks.length;
+            if (!trackLen) {
+                return;
+            }
+            var pinchEnd = (tracks[trackLen - 1] || {}).points;
+            var pinchPre = (tracks[trackLen - 2] || {}).points || pinchEnd;
+            if (pinchPre
+                && pinchPre.length > 1
+                && pinchEnd
+                && pinchEnd.length > 1) {
+                var pinchScale = dist$1(pinchEnd) / dist$1(pinchPre);
+                !isFinite(pinchScale) && (pinchScale = 1);
+                event.pinchScale = pinchScale;
+                var pinchCenter = center(pinchEnd);
+                event.pinchX = pinchCenter[0];
+                event.pinchY = pinchCenter[1];
+                return {
+                    type: 'pinch',
+                    target: tracks[0].target,
+                    event: event
+                };
+            }
+        }
+    };
+
+    function create$1() {
+        return [1, 0, 0, 1, 0, 0];
+    }
+    function identity(out) {
+        out[0] = 1;
+        out[1] = 0;
+        out[2] = 0;
+        out[3] = 1;
+        out[4] = 0;
+        out[5] = 0;
+        return out;
+    }
+    function copy$1(out, m) {
+        out[0] = m[0];
+        out[1] = m[1];
+        out[2] = m[2];
+        out[3] = m[3];
+        out[4] = m[4];
+        out[5] = m[5];
+        return out;
+    }
+    function mul$1(out, m1, m2) {
+        var out0 = m1[0] * m2[0] + m1[2] * m2[1];
+        var out1 = m1[1] * m2[0] + m1[3] * m2[1];
+        var out2 = m1[0] * m2[2] + m1[2] * m2[3];
+        var out3 = m1[1] * m2[2] + m1[3] * m2[3];
+        var out4 = m1[0] * m2[4] + m1[2] * m2[5] + m1[4];
+        var out5 = m1[1] * m2[4] + m1[3] * m2[5] + m1[5];
+        out[0] = out0;
+        out[1] = out1;
+        out[2] = out2;
+        out[3] = out3;
+        out[4] = out4;
+        out[5] = out5;
+        return out;
+    }
+    function translate(out, a, v) {
+        out[0] = a[0];
+        out[1] = a[1];
+        out[2] = a[2];
+        out[3] = a[3];
+        out[4] = a[4] + v[0];
+        out[5] = a[5] + v[1];
+        return out;
+    }
+    function rotate(out, a, rad, pivot) {
+        if (pivot === void 0) { pivot = [0, 0]; }
+        var aa = a[0];
+        var ac = a[2];
+        var atx = a[4];
+        var ab = a[1];
+        var ad = a[3];
+        var aty = a[5];
+        var st = Math.sin(rad);
+        var ct = Math.cos(rad);
+        out[0] = aa * ct + ab * st;
+        out[1] = -aa * st + ab * ct;
+        out[2] = ac * ct + ad * st;
+        out[3] = -ac * st + ct * ad;
+        out[4] = ct * (atx - pivot[0]) + st * (aty - pivot[1]) + pivot[0];
+        out[5] = ct * (aty - pivot[1]) - st * (atx - pivot[0]) + pivot[1];
+        return out;
+    }
+    function scale$1(out, a, v) {
+        var vx = v[0];
+        var vy = v[1];
+        out[0] = a[0] * vx;
+        out[1] = a[1] * vy;
+        out[2] = a[2] * vx;
+        out[3] = a[3] * vy;
+        out[4] = a[4] * vx;
+        out[5] = a[5] * vy;
+        return out;
+    }
+    function invert(out, a) {
+        var aa = a[0];
+        var ac = a[2];
+        var atx = a[4];
+        var ab = a[1];
+        var ad = a[3];
+        var aty = a[5];
+        var det = aa * ad - ab * ac;
+        if (!det) {
+            return null;
+        }
+        det = 1.0 / det;
+        out[0] = ad * det;
+        out[1] = -ab * det;
+        out[2] = -ac * det;
+        out[3] = aa * det;
+        out[4] = (ac * aty - ad * atx) * det;
+        out[5] = (ab * atx - aa * aty) * det;
+        return out;
+    }
+    function clone$2(a) {
+        var b = create$1();
+        copy$1(b, a);
+        return b;
+    }
+
+    var matrix = /*#__PURE__*/Object.freeze({
+        __proto__: null,
+        create: create$1,
+        identity: identity,
+        copy: copy$1,
+        mul: mul$1,
+        translate: translate,
+        rotate: rotate,
+        scale: scale$1,
+        invert: invert,
+        clone: clone$2
+    });
+
+    var Point = (function () {
+        function Point(x, y) {
+            this.x = x || 0;
+            this.y = y || 0;
+        }
+        Point.prototype.copy = function (other) {
+            this.x = other.x;
+            this.y = other.y;
+            return this;
+        };
+        Point.prototype.clone = function () {
+            return new Point(this.x, this.y);
+        };
+        Point.prototype.set = function (x, y) {
+            this.x = x;
+            this.y = y;
+            return this;
+        };
+        Point.prototype.equal = function (other) {
+            return other.x === this.x && other.y === this.y;
+        };
+        Point.prototype.add = function (other) {
+            this.x += other.x;
+            this.y += other.y;
+            return this;
+        };
+        Point.prototype.scale = function (scalar) {
+            this.x *= scalar;
+            this.y *= scalar;
+        };
+        Point.prototype.scaleAndAdd = function (other, scalar) {
+            this.x += other.x * scalar;
+            this.y += other.y * scalar;
+        };
+        Point.prototype.sub = function (other) {
+            this.x -= other.x;
+            this.y -= other.y;
+            return this;
+        };
+        Point.prototype.dot = function (other) {
+            return this.x * other.x + this.y * other.y;
+        };
+        Point.prototype.len = function () {
+            return Math.sqrt(this.x * this.x + this.y * this.y);
+        };
+        Point.prototype.lenSquare = function () {
+            return this.x * this.x + this.y * this.y;
+        };
+        Point.prototype.normalize = function () {
+            var len = this.len();
+            this.x /= len;
+            this.y /= len;
+            return this;
+        };
+        Point.prototype.distance = function (other) {
+            var dx = this.x - other.x;
+            var dy = this.y - other.y;
+            return Math.sqrt(dx * dx + dy * dy);
+        };
+        Point.prototype.distanceSquare = function (other) {
+            var dx = this.x - other.x;
+            var dy = this.y - other.y;
+            return dx * dx + dy * dy;
+        };
+        Point.prototype.negate = function () {
+            this.x = -this.x;
+            this.y = -this.y;
+            return this;
+        };
+        Point.prototype.transform = function (m) {
+            if (!m) {
+                return;
+            }
+            var x = this.x;
+            var y = this.y;
+            this.x = m[0] * x + m[2] * y + m[4];
+            this.y = m[1] * x + m[3] * y + m[5];
+            return this;
+        };
+        Point.prototype.toArray = function (out) {
+            out[0] = this.x;
+            out[1] = this.y;
+            return out;
+        };
+        Point.prototype.fromArray = function (input) {
+            this.x = input[0];
+            this.y = input[1];
+        };
+        Point.set = function (p, x, y) {
+            p.x = x;
+            p.y = y;
+        };
+        Point.copy = function (p, p2) {
+            p.x = p2.x;
+            p.y = p2.y;
+        };
+        Point.len = function (p) {
+            return Math.sqrt(p.x * p.x + p.y * p.y);
+        };
+        Point.lenSquare = function (p) {
+            return p.x * p.x + p.y * p.y;
+        };
+        Point.dot = function (p0, p1) {
+            return p0.x * p1.x + p0.y * p1.y;
+        };
+        Point.add = function (out, p0, p1) {
+            out.x = p0.x + p1.x;
+            out.y = p0.y + p1.y;
+        };
+        Point.sub = function (out, p0, p1) {
+            out.x = p0.x - p1.x;
+            out.y = p0.y - p1.y;
+        };
+        Point.scale = function (out, p0, scalar) {
+            out.x = p0.x * scalar;
+            out.y = p0.y * scalar;
+        };
+        Point.scaleAndAdd = function (out, p0, p1, scalar) {
+            out.x = p0.x + p1.x * scalar;
+            out.y = p0.y + p1.y * scalar;
+        };
+        Point.lerp = function (out, p0, p1, t) {
+            var onet = 1 - t;
+            out.x = onet * p0.x + t * p1.x;
+            out.y = onet * p0.y + t * p1.y;
+        };
+        return Point;
+    }());
+
+    var mathMin = Math.min;
+    var mathMax = Math.max;
+    var lt = new Point();
+    var rb = new Point();
+    var lb = new Point();
+    var rt = new Point();
+    var minTv = new Point();
+    var maxTv = new Point();
+    var BoundingRect = (function () {
+        function BoundingRect(x, y, width, height) {
+            if (width < 0) {
+                x = x + width;
+                width = -width;
+            }
+            if (height < 0) {
+                y = y + height;
+                height = -height;
+            }
+            this.x = x;
+            this.y = y;
+            this.width = width;
+            this.height = height;
+        }
+        BoundingRect.prototype.union = function (other) {
+            var x = mathMin(other.x, this.x);
+            var y = mathMin(other.y, this.y);
+            if (isFinite(this.x) && isFinite(this.width)) {
+                this.width = mathMax(other.x + other.width, this.x + this.width) - x;
+            }
+            else {
+                this.width = other.width;
+            }
+            if (isFinite(this.y) && isFinite(this.height)) {
+                this.height = mathMax(other.y + other.height, this.y + this.height) - y;
+            }
+            else {
+                this.height = other.height;
+            }
+            this.x = x;
+            this.y = y;
+        };
+        BoundingRect.prototype.applyTransform = function (m) {
+            BoundingRect.applyTransform(this, this, m);
+        };
+        BoundingRect.prototype.calculateTransform = function (b) {
+            var a = this;
+            var sx = b.width / a.width;
+            var sy = b.height / a.height;
+            var m = create$1();
+            translate(m, m, [-a.x, -a.y]);
+            scale$1(m, m, [sx, sy]);
+            translate(m, m, [b.x, b.y]);
+            return m;
+        };
+        BoundingRect.prototype.intersect = function (b, mtv) {
+            if (!b) {
+                return false;
+            }
+            if (!(b instanceof BoundingRect)) {
+                b = BoundingRect.create(b);
+            }
+            var a = this;
+            var ax0 = a.x;
+            var ax1 = a.x + a.width;
+            var ay0 = a.y;
+            var ay1 = a.y + a.height;
+            var bx0 = b.x;
+            var bx1 = b.x + b.width;
+            var by0 = b.y;
+            var by1 = b.y + b.height;
+            var overlap = !(ax1 < bx0 || bx1 < ax0 || ay1 < by0 || by1 < ay0);
+            if (mtv) {
+                var dMin = Infinity;
+                var dMax = 0;
+                var d0 = Math.abs(ax1 - bx0);
+                var d1 = Math.abs(bx1 - ax0);
+                var d2 = Math.abs(ay1 - by0);
+                var d3 = Math.abs(by1 - ay0);
+                var dx = Math.min(d0, d1);
+                var dy = Math.min(d2, d3);
+                if (ax1 < bx0 || bx1 < ax0) {
+                    if (dx > dMax) {
+                        dMax = dx;
+                        if (d0 < d1) {
+                            Point.set(maxTv, -d0, 0);
+                        }
+                        else {
+                            Point.set(maxTv, d1, 0);
+                        }
+                    }
+                }
+                else {
+                    if (dx < dMin) {
+                        dMin = dx;
+                        if (d0 < d1) {
+                            Point.set(minTv, d0, 0);
+                        }
+                        else {
+                            Point.set(minTv, -d1, 0);
+                        }
+                    }
+                }
+                if (ay1 < by0 || by1 < ay0) {
+                    if (dy > dMax) {
+                        dMax = dy;
+                        if (d2 < d3) {
+                            Point.set(maxTv, 0, -d2);
+                        }
+                        else {
+                            Point.set(maxTv, 0, d3);
+                        }
+                    }
+                }
+                else {
+                    if (dx < dMin) {
+                        dMin = dx;
+                        if (d2 < d3) {
+                            Point.set(minTv, 0, d2);
+                        }
+                        else {
+                            Point.set(minTv, 0, -d3);
+                        }
+                    }
+                }
+            }
+            if (mtv) {
+                Point.copy(mtv, overlap ? minTv : maxTv);
+            }
+            return overlap;
+        };
+        BoundingRect.prototype.contain = function (x, y) {
+            var rect = this;
+            return x >= rect.x
+                && x <= (rect.x + rect.width)
+                && y >= rect.y
+                && y <= (rect.y + rect.height);
+        };
+        BoundingRect.prototype.clone = function () {
+            return new BoundingRect(this.x, this.y, this.width, this.height);
+        };
+        BoundingRect.prototype.copy = function (other) {
+            BoundingRect.copy(this, other);
+        };
+        BoundingRect.prototype.plain = function () {
+            return {
+                x: this.x,
+                y: this.y,
+                width: this.width,
+                height: this.height
+            };
+        };
+        BoundingRect.prototype.isFinite = function () {
+            return isFinite(this.x)
+                && isFinite(this.y)
+                && isFinite(this.width)
+                && isFinite(this.height);
+        };
+        BoundingRect.prototype.isZero = function () {
+            return this.width === 0 || this.height === 0;
+        };
+        BoundingRect.create = function (rect) {
+            return new BoundingRect(rect.x, rect.y, rect.width, rect.height);
+        };
+        BoundingRect.copy = function (target, source) {
+            target.x = source.x;
+            target.y = source.y;
+            target.width = source.width;
+            target.height = source.height;
+        };
+        BoundingRect.applyTransform = function (target, source, m) {
+            if (!m) {
+                if (target !== source) {
+                    BoundingRect.copy(target, source);
+                }
+                return;
+            }
+            if (m[1] < 1e-5 && m[1] > -1e-5 && m[2] < 1e-5 && m[2] > -1e-5) {
+                var sx = m[0];
+                var sy = m[3];
+                var tx = m[4];
+                var ty = m[5];
+                target.x = source.x * sx + tx;
+                target.y = source.y * sy + ty;
+                target.width = source.width * sx;
+                target.height = source.height * sy;
+                if (target.width < 0) {
+                    target.x += target.width;
+                    target.width = -target.width;
+                }
+                if (target.height < 0) {
+                    target.y += target.height;
+                    target.height = -target.height;
+                }
+                return;
+            }
+            lt.x = lb.x = source.x;
+            lt.y = rt.y = source.y;
+            rb.x = rt.x = source.x + source.width;
+            rb.y = lb.y = source.y + source.height;
+            lt.transform(m);
+            rt.transform(m);
+            rb.transform(m);
+            lb.transform(m);
+            target.x = mathMin(lt.x, rb.x, lb.x, rt.x);
+            target.y = mathMin(lt.y, rb.y, lb.y, rt.y);
+            var maxX = mathMax(lt.x, rb.x, lb.x, rt.x);
+            var maxY = mathMax(lt.y, rb.y, lb.y, rt.y);
+            target.width = maxX - target.x;
+            target.height = maxY - target.y;
+        };
+        return BoundingRect;
+    }());
+
+    var SILENT = 'silent';
+    function makeEventPacket(eveType, targetInfo, event) {
+        return {
+            type: eveType,
+            event: event,
+            target: targetInfo.target,
+            topTarget: targetInfo.topTarget,
+            cancelBubble: false,
+            offsetX: event.zrX,
+            offsetY: event.zrY,
+            gestureEvent: event.gestureEvent,
+            pinchX: event.pinchX,
+            pinchY: event.pinchY,
+            pinchScale: event.pinchScale,
+            wheelDelta: event.zrDelta,
+            zrByTouch: event.zrByTouch,
+            which: event.which,
+            stop: stopEvent
+        };
+    }
+    function stopEvent() {
+        stop(this.event);
+    }
+    var EmptyProxy = (function (_super) {
+        __extends(EmptyProxy, _super);
+        function EmptyProxy() {
+            var _this = _super !== null && _super.apply(this, arguments) || this;
+            _this.handler = null;
+            return _this;
+        }
+        EmptyProxy.prototype.dispose = function () { };
+        EmptyProxy.prototype.setCursor = function () { };
+        return EmptyProxy;
+    }(Eventful));
+    var HoveredResult = (function () {
+        function HoveredResult(x, y) {
+            this.x = x;
+            this.y = y;
+        }
+        return HoveredResult;
+    }());
+    var handlerNames = [
+        'click', 'dblclick', 'mousewheel', 'mouseout',
+        'mouseup', 'mousedown', 'mousemove', 'contextmenu'
+    ];
+    var tmpRect = new BoundingRect(0, 0, 0, 0);
+    var Handler = (function (_super) {
+        __extends(Handler, _super);
+        function Handler(storage, painter, proxy, painterRoot, pointerSize) {
+            var _this = _super.call(this) || this;
+            _this._hovered = new HoveredResult(0, 0);
+            _this.storage = storage;
+            _this.painter = painter;
+            _this.painterRoot = painterRoot;
+            _this._pointerSize = pointerSize;
+            proxy = proxy || new EmptyProxy();
+            _this.proxy = null;
+            _this.setHandlerProxy(proxy);
+            _this._draggingMgr = new Draggable(_this);
+            return _this;
+        }
+        Handler.prototype.setHandlerProxy = function (proxy) {
+            if (this.proxy) {
+                this.proxy.dispose();
+            }
+            if (proxy) {
+                each(handlerNames, function (name) {
+                    proxy.on && proxy.on(name, this[name], this);
+                }, this);
+                proxy.handler = this;
+            }
+            this.proxy = proxy;
+        };
+        Handler.prototype.mousemove = function (event) {
+            var x = event.zrX;
+            var y = event.zrY;
+            var isOutside = isOutsideBoundary(this, x, y);
+            var lastHovered = this._hovered;
+            var lastHoveredTarget = lastHovered.target;
+            if (lastHoveredTarget && !lastHoveredTarget.__zr) {
+                lastHovered = this.findHover(lastHovered.x, lastHovered.y);
+                lastHoveredTarget = lastHovered.target;
+            }
+            var hovered = this._hovered = isOutside ? new HoveredResult(x, y) : this.findHover(x, y);
+            var hoveredTarget = hovered.target;
+            var proxy = this.proxy;
+            proxy.setCursor && proxy.setCursor(hoveredTarget ? hoveredTarget.cursor : 'default');
+            if (lastHoveredTarget && hoveredTarget !== lastHoveredTarget) {
+                this.dispatchToElement(lastHovered, 'mouseout', event);
+            }
+            this.dispatchToElement(hovered, 'mousemove', event);
+            if (hoveredTarget && hoveredTarget !== lastHoveredTarget) {
+                this.dispatchToElement(hovered, 'mouseover', event);
+            }
+        };
+        Handler.prototype.mouseout = function (event) {
+            var eventControl = event.zrEventControl;
+            if (eventControl !== 'only_globalout') {
+                this.dispatchToElement(this._hovered, 'mouseout', event);
+            }
+            if (eventControl !== 'no_globalout') {
+                this.trigger('globalout', { type: 'globalout', event: event });
+            }
+        };
+        Handler.prototype.resize = function () {
+            this._hovered = new HoveredResult(0, 0);
+        };
+        Handler.prototype.dispatch = function (eventName, eventArgs) {
+            var handler = this[eventName];
+            handler && handler.call(this, eventArgs);
+        };
+        Handler.prototype.dispose = function () {
+            this.proxy.dispose();
+            this.storage = null;
+            this.proxy = null;
+            this.painter = null;
+        };
+        Handler.prototype.setCursorStyle = function (cursorStyle) {
+            var proxy = this.proxy;
+            proxy.setCursor && proxy.setCursor(cursorStyle);
+        };
+        Handler.prototype.dispatchToElement = function (targetInfo, eventName, event) {
+            targetInfo = targetInfo || {};
+            var el = targetInfo.target;
+            if (el && el.silent) {
+                return;
+            }
+            var eventKey = ('on' + eventName);
+            var eventPacket = makeEventPacket(eventName, targetInfo, event);
+            while (el) {
+                el[eventKey]
+                    && (eventPacket.cancelBubble = !!el[eventKey].call(el, eventPacket));
+                el.trigger(eventName, eventPacket);
+                el = el.__hostTarget ? el.__hostTarget : el.parent;
+                if (eventPacket.cancelBubble) {
+                    break;
+                }
+            }
+            if (!eventPacket.cancelBubble) {
+                this.trigger(eventName, eventPacket);
+                if (this.painter && this.painter.eachOtherLayer) {
+                    this.painter.eachOtherLayer(function (layer) {
+                        if (typeof (layer[eventKey]) === 'function') {
+                            layer[eventKey].call(layer, eventPacket);
+                        }
+                        if (layer.trigger) {
+                            layer.trigger(eventName, eventPacket);
+                        }
+                    });
+                }
+            }
+        };
+        Handler.prototype.findHover = function (x, y, exclude) {
+            var list = this.storage.getDisplayList();
+            var out = new HoveredResult(x, y);
+            setHoverTarget(list, out, x, y, exclude);
+            if (this._pointerSize && !out.target) {
+                var candidates = [];
+                var pointerSize = this._pointerSize;
+                var targetSizeHalf = pointerSize / 2;
+                var pointerRect = new BoundingRect(x - targetSizeHalf, y - targetSizeHalf, pointerSize, pointerSize);
+                for (var i = list.length - 1; i >= 0; i--) {
+                    var el = list[i];
+                    if (el !== exclude
+                        && !el.ignore
+                        && !el.ignoreCoarsePointer
+                        && (!el.parent || !el.parent.ignoreCoarsePointer)) {
+                        tmpRect.copy(el.getBoundingRect());
+                        if (el.transform) {
+                            tmpRect.applyTransform(el.transform);
+                        }
+                        if (tmpRect.intersect(pointerRect)) {
+                            candidates.push(el);
+                        }
+                    }
+                }
+                if (candidates.length) {
+                    var rStep = 4;
+                    var thetaStep = Math.PI / 12;
+                    var PI2 = Math.PI * 2;
+                    for (var r = 0; r < targetSizeHalf; r += rStep) {
+                        for (var theta = 0; theta < PI2; theta += thetaStep) {
+                            var x1 = x + r * Math.cos(theta);
+                            var y1 = y + r * Math.sin(theta);
+                            setHoverTarget(candidates, out, x1, y1, exclude);
+                            if (out.target) {
+                                return out;
+                            }
+                        }
+                    }
+                }
+            }
+            return out;
+        };
+        Handler.prototype.processGesture = function (event, stage) {
+            if (!this._gestureMgr) {
+                this._gestureMgr = new GestureMgr();
+            }
+            var gestureMgr = this._gestureMgr;
+            stage === 'start' && gestureMgr.clear();
+            var gestureInfo = gestureMgr.recognize(event, this.findHover(event.zrX, event.zrY, null).target, this.proxy.dom);
+            stage === 'end' && gestureMgr.clear();
+            if (gestureInfo) {
+                var type = gestureInfo.type;
+                event.gestureEvent = type;
+                var res = new HoveredResult();
+                res.target = gestureInfo.target;
+                this.dispatchToElement(res, type, gestureInfo.event);
+            }
+        };
+        return Handler;
+    }(Eventful));
+    each(['click', 'mousedown', 'mouseup', 'mousewheel', 'dblclick', 'contextmenu'], function (name) {
+        Handler.prototype[name] = function (event) {
+            var x = event.zrX;
+            var y = event.zrY;
+            var isOutside = isOutsideBoundary(this, x, y);
+            var hovered;
+            var hoveredTarget;
+            if (name !== 'mouseup' || !isOutside) {
+                hovered = this.findHover(x, y);
+                hoveredTarget = hovered.target;
+            }
+            if (name === 'mousedown') {
+                this._downEl = hoveredTarget;
+                this._downPoint = [event.zrX, event.zrY];
+                this._upEl = hoveredTarget;
+            }
+            else if (name === 'mouseup') {
+                this._upEl = hoveredTarget;
+            }
+            else if (name === 'click') {
+                if (this._downEl !== this._upEl
+                    || !this._downPoint
+                    || dist(this._downPoint, [event.zrX, event.zrY]) > 4) {
+                    return;
+                }
+                this._downPoint = null;
+            }
+            this.dispatchToElement(hovered, name, event);
+        };
+    });
+    function isHover(displayable, x, y) {
+        if (displayable[displayable.rectHover ? 'rectContain' : 'contain'](x, y)) {
+            var el = displayable;
+            var isSilent = void 0;
+            var ignoreClip = false;
+            while (el) {
+                if (el.ignoreClip) {
+                    ignoreClip = true;
+                }
+                if (!ignoreClip) {
+                    var clipPath = el.getClipPath();
+                    if (clipPath && !clipPath.contain(x, y)) {
+                        return false;
+                    }
+                }
+                if (el.silent) {
+                    isSilent = true;
+                }
+                var hostEl = el.__hostTarget;
+                el = hostEl ? hostEl : el.parent;
+            }
+            return isSilent ? SILENT : true;
+        }
+        return false;
+    }
+    function setHoverTarget(list, out, x, y, exclude) {
+        for (var i = list.length - 1; i >= 0; i--) {
+            var el = list[i];
+            var hoverCheckResult = void 0;
+            if (el !== exclude
+                && !el.ignore
+                && (hoverCheckResult = isHover(el, x, y))) {
+                !out.topTarget && (out.topTarget = el);
+                if (hoverCheckResult !== SILENT) {
+                    out.target = el;
+                    break;
+                }
+            }
+        }
+    }
+    function isOutsideBoundary(handlerInstance, x, y) {
+        var painter = handlerInstance.painter;
+        return x < 0 || x > painter.getWidth() || y < 0 || y > painter.getHeight();
+    }
+
+    var DEFAULT_MIN_MERGE = 32;
+    var DEFAULT_MIN_GALLOPING = 7;
+    function minRunLength(n) {
+        var r = 0;
+        while (n >= DEFAULT_MIN_MERGE) {
+            r |= n & 1;
+            n >>= 1;
+        }
+        return n + r;
+    }
+    function makeAscendingRun(array, lo, hi, compare) {
+        var runHi = lo + 1;
+        if (runHi === hi) {
+            return 1;
+        }
+        if (compare(array[runHi++], array[lo]) < 0) {
+            while (runHi < hi && compare(array[runHi], array[runHi - 1]) < 0) {
+                runHi++;
+            }
+            reverseRun(array, lo, runHi);
+        }
+        else {
+            while (runHi < hi && compare(array[runHi], array[runHi - 1]) >= 0) {
+                runHi++;
+            }
+        }
+        return runHi - lo;
+    }
+    function reverseRun(array, lo, hi) {
+        hi--;
+        while (lo < hi) {
+            var t = array[lo];
+            array[lo++] = array[hi];
+            array[hi--] = t;
+        }
+    }
+    function binaryInsertionSort(array, lo, hi, start, compare) {
+        if (start === lo) {
+            start++;
+        }
+        for (; start < hi; start++) {
+            var pivot = array[start];
+            var left = lo;
+            var right = start;
+            var mid;
+            while (left < right) {
+                mid = left + right >>> 1;
+                if (compare(pivot, array[mid]) < 0) {
+                    right = mid;
+                }
+                else {
+                    left = mid + 1;
+                }
+            }
+            var n = start - left;
+            switch (n) {
+                case 3:
+                    array[left + 3] = array[left + 2];
+                case 2:
+                    array[left + 2] = array[left + 1];
+                case 1:
+                    array[left + 1] = array[left];
+                    break;
+                default:
+                    while (n > 0) {
+                        array[left + n] = array[left + n - 1];
+                        n--;
+                    }
+            }
+            array[left] = pivot;
+        }
+    }
+    function gallopLeft(value, array, start, length, hint, compare) {
+        var lastOffset = 0;
+        var maxOffset = 0;
+        var offset = 1;
+        if (compare(value, array[start + hint]) > 0) {
+            maxOffset = length - hint;
+            while (offset < maxOffset && compare(value, array[start + hint + offset]) > 0) {
+                lastOffset = offset;
+                offset = (offset << 1) + 1;
+                if (offset <= 0) {
+                    offset = maxOffset;
+                }
+            }
+            if (offset > maxOffset) {
+                offset = maxOffset;
+            }
+            lastOffset += hint;
+            offset += hint;
+        }
+        else {
+            maxOffset = hint + 1;
+            while (offset < maxOffset && compare(value, array[start + hint - offset]) <= 0) {
+                lastOffset = offset;
+                offset = (offset << 1) + 1;
+                if (offset <= 0) {
+                    offset = maxOffset;
+                }
+            }
+            if (offset > maxOffset) {
+                offset = maxOffset;
+            }
+            var tmp = lastOffset;
+            lastOffset = hint - offset;
+            offset = hint - tmp;
+        }
+        lastOffset++;
+        while (lastOffset < offset) {
+            var m = lastOffset + (offset - lastOffset >>> 1);
+            if (compare(value, array[start + m]) > 0) {
+                lastOffset = m + 1;
+            }
+            else {
+                offset = m;
+            }
+        }
+        return offset;
+    }
+    function gallopRight(value, array, start, length, hint, compare) {
+        var lastOffset = 0;
+        var maxOffset = 0;
+        var offset = 1;
+        if (compare(value, array[start + hint]) < 0) {
+            maxOffset = hint + 1;
+            while (offset < maxOffset && compare(value, array[start + hint - offset]) < 0) {
+                lastOffset = offset;
+                offset = (offset << 1) + 1;
+                if (offset <= 0) {
+                    offset = maxOffset;
+                }
+            }
+            if (offset > maxOffset) {
+                offset = maxOffset;
+            }
+            var tmp = lastOffset;
+            lastOffset = hint - offset;
+            offset = hint - tmp;
+        }
+        else {
+            maxOffset = length - hint;
+            while (offset < maxOffset && compare(value, array[start + hint + offset]) >= 0) {
+                lastOffset = offset;
+                offset = (offset << 1) + 1;
+                if (offset <= 0) {
+                    offset = maxOffset;
+                }
+            }
+            if (offset > maxOffset) {
+                offset = maxOffset;
+            }
+            lastOffset += hint;
+            offset += hint;
+        }
+        lastOffset++;
+        while (lastOffset < offset) {
+            var m = lastOffset + (offset - lastOffset >>> 1);
+            if (compare(value, array[start + m]) < 0) {
+                offset = m;
+            }
+            else {
+                lastOffset = m + 1;
+            }
+        }
+        return offset;
+    }
+    function TimSort(array, compare) {
+        var minGallop = DEFAULT_MIN_GALLOPING;
+        var runStart;
+        var runLength;
+        var stackSize = 0;
+        var tmp = [];
+        runStart = [];
+        runLength = [];
+        function pushRun(_runStart, _runLength) {
+            runStart[stackSize] = _runStart;
+            runLength[stackSize] = _runLength;
+            stackSize += 1;
+        }
+        function mergeRuns() {
+            while (stackSize > 1) {
+                var n = stackSize - 2;
+                if ((n >= 1 && runLength[n - 1] <= runLength[n] + runLength[n + 1])
+                    || (n >= 2 && runLength[n - 2] <= runLength[n] + runLength[n - 1])) {
+                    if (runLength[n - 1] < runLength[n + 1]) {
+                        n--;
+                    }
+                }
+                else if (runLength[n] > runLength[n + 1]) {
+                    break;
+                }
+                mergeAt(n);
+            }
+        }
+        function forceMergeRuns() {
+            while (stackSize > 1) {
+                var n = stackSize - 2;
+                if (n > 0 && runLength[n - 1] < runLength[n + 1]) {
+                    n--;
+                }
+                mergeAt(n);
+            }
+        }
+        function mergeAt(i) {
+            var start1 = runStart[i];
+            var length1 = runLength[i];
+            var start2 = runStart[i + 1];
+            var length2 = runLength[i + 1];
+            runLength[i] = length1 + length2;
+            if (i === stackSize - 3) {
+                runStart[i + 1] = runStart[i + 2];
+                runLength[i + 1] = runLength[i + 2];
+            }
+            stackSize--;
+            var k = gallopRight(array[start2], array, start1, length1, 0, compare);
+            start1 += k;
+            length1 -= k;
+            if (length1 === 0) {
+                return;
+            }
+            length2 = gallopLeft(array[start1 + length1 - 1], array, start2, length2, length2 - 1, compare);
+            if (length2 === 0) {
+                return;
+            }
+            if (length1 <= length2) {
+                mergeLow(start1, length1, start2, length2);
+            }
+            else {
+                mergeHigh(start1, length1, start2, length2);
+            }
+        }
+        function mergeLow(start1, length1, start2, length2) {
+            var i = 0;
+            for (i = 0; i < length1; i++) {
+                tmp[i] = array[start1 + i];
+            }
+            var cursor1 = 0;
+            var cursor2 = start2;
+            var dest = start1;
+            array[dest++] = array[cursor2++];
+            if (--length2 === 0) {
+                for (i = 0; i < length1; i++) {
+                    array[dest + i] = tmp[cursor1 + i];
+                }
+                return;
+            }
+            if (length1 === 1) {
+                for (i = 0; i < length2; i++) {
+                    array[dest + i] = array[cursor2 + i];
+                }
+                array[dest + length2] = tmp[cursor1];
+                return;
+            }
+            var _minGallop = minGallop;
+            var count1;
+            var count2;
+            var exit;
+            while (1) {
+                count1 = 0;
+                count2 = 0;
+                exit = false;
+                do {
+                    if (compare(array[cursor2], tmp[cursor1]) < 0) {
+                        array[dest++] = array[cursor2++];
+                        count2++;
+                        count1 = 0;
+                        if (--length2 === 0) {
+                            exit = true;
+                            break;
+                        }
+                    }
+                    else {
+                        array[dest++] = tmp[cursor1++];
+                        count1++;
+                        count2 = 0;
+                        if (--length1 === 1) {
+                            exit = true;
+                            break;
+                        }
+                    }
+                } while ((count1 | count2) < _minGallop);
+                if (exit) {
+                    break;
+                }
+                do {
+                    count1 = gallopRight(array[cursor2], tmp, cursor1, length1, 0, compare);
+                    if (count1 !== 0) {
+                        for (i = 0; i < count1; i++) {
+                            array[dest + i] = tmp[cursor1 + i];
+                        }
+                        dest += count1;
+                        cursor1 += count1;
+                        length1 -= count1;
+                        if (length1 <= 1) {
+                            exit = true;
+                            break;
+                        }
+                    }
+                    array[dest++] = array[cursor2++];
+                    if (--length2 === 0) {
+                        exit = true;
+                        break;
+                    }
+                    count2 = gallopLeft(tmp[cursor1], array, cursor2, length2, 0, compare);
+                    if (count2 !== 0) {
+                        for (i = 0; i < count2; i++) {
+                            array[dest + i] = array[cursor2 + i];
+                        }
+                        dest += count2;
+                        cursor2 += count2;
+                        length2 -= count2;
+                        if (length2 === 0) {
+                            exit = true;
+                            break;
+                        }
+                    }
+                    array[dest++] = tmp[cursor1++];
+                    if (--length1 === 1) {
+                        exit = true;
+                        break;
+                    }
+                    _minGallop--;
+                } while (count1 >= DEFAULT_MIN_GALLOPING || count2 >= DEFAULT_MIN_GALLOPING);
+                if (exit) {
+                    break;
+                }
+                if (_minGallop < 0) {
+                    _minGallop = 0;
+                }
+                _minGallop += 2;
+            }
+            minGallop = _minGallop;
+            minGallop < 1 && (minGallop = 1);
+            if (length1 === 1) {
+                for (i = 0; i < length2; i++) {
+                    array[dest + i] = array[cursor2 + i];
+                }
+                array[dest + length2] = tmp[cursor1];
+            }
+            else if (length1 === 0) {
+                throw new Error();
+            }
+            else {
+                for (i = 0; i < length1; i++) {
+                    array[dest + i] = tmp[cursor1 + i];
+                }
+            }
+        }
+        function mergeHigh(start1, length1, start2, length2) {
+            var i = 0;
+            for (i = 0; i < length2; i++) {
+                tmp[i] = array[start2 + i];
+            }
+            var cursor1 = start1 + length1 - 1;
+            var cursor2 = length2 - 1;
+            var dest = start2 + length2 - 1;
+            var customCursor = 0;
+            var customDest = 0;
+            array[dest--] = array[cursor1--];
+            if (--length1 === 0) {
+                customCursor = dest - (length2 - 1);
+                for (i = 0; i < length2; i++) {
+                    array[customCursor + i] = tmp[i];
+                }
+                return;
+            }
+            if (length2 === 1) {
+                dest -= length1;
+                cursor1 -= length1;
+                customDest = dest + 1;
+                customCursor = cursor1 + 1;
+                for (i = length1 - 1; i >= 0; i--) {
+                    array[customDest + i] = array[customCursor + i];
+                }
+                array[dest] = tmp[cursor2];
+                return;
+            }
+            var _minGallop = minGallop;
+            while (true) {
+                var count1 = 0;
+                var count2 = 0;
+                var exit = false;
+                do {
+                    if (compare(tmp[cursor2], array[cursor1]) < 0) {
+                        array[dest--] = array[cursor1--];
+                        count1++;
+                        count2 = 0;
+                        if (--length1 === 0) {
+                            exit = true;
+                            break;
+                        }
+                    }
+                    else {
+                        array[dest--] = tmp[cursor2--];
+                        count2++;
+                        count1 = 0;
+                        if (--length2 === 1) {
+                            exit = true;
+                            break;
+                        }
+                    }
+                } while ((count1 | count2) < _minGallop);
+                if (exit) {
+                    break;
+                }
+                do {
+                    count1 = length1 - gallopRight(tmp[cursor2], array, start1, length1, length1 - 1, compare);
+                    if (count1 !== 0) {
+                        dest -= count1;
+                        cursor1 -= count1;
+                        length1 -= count1;
+                        customDest = dest + 1;
+                        customCursor = cursor1 + 1;
+                        for (i = count1 - 1; i >= 0; i--) {
+                            array[customDest + i] = array[customCursor + i];
+                        }
+                        if (length1 === 0) {
+                            exit = true;
+                            break;
+                        }
+                    }
+                    array[dest--] = tmp[cursor2--];
+                    if (--length2 === 1) {
+                        exit = true;
+                        break;
+                    }
+                    count2 = length2 - gallopLeft(array[cursor1], tmp, 0, length2, length2 - 1, compare);
+                    if (count2 !== 0) {
+                        dest -= count2;
+                        cursor2 -= count2;
+                        length2 -= count2;
+                        customDest = dest + 1;
+                        customCursor = cursor2 + 1;
+                        for (i = 0; i < count2; i++) {
+                            array[customDest + i] = tmp[customCursor + i];
+                        }
+                        if (length2 <= 1) {
+                            exit = true;
+                            break;
+                        }
+                    }
+                    array[dest--] = array[cursor1--];
+                    if (--length1 === 0) {
+                        exit = true;
+                        break;
+                    }
+                    _minGallop--;
+                } while (count1 >= DEFAULT_MIN_GALLOPING || count2 >= DEFAULT_MIN_GALLOPING);
+                if (exit) {
+                    break;
+                }
+                if (_minGallop < 0) {
+                    _minGallop = 0;
+                }
+                _minGallop += 2;
+            }
+            minGallop = _minGallop;
+            if (minGallop < 1) {
+                minGallop = 1;
+            }
+            if (length2 === 1) {
+                dest -= length1;
+                cursor1 -= length1;
+                customDest = dest + 1;
+                customCursor = cursor1 + 1;
+                for (i = length1 - 1; i >= 0; i--) {
+                    array[customDest + i] = array[customCursor + i];
+                }
+                array[dest] = tmp[cursor2];
+            }
+            else if (length2 === 0) {
+                throw new Error();
+            }
+            else {
+                customCursor = dest - (length2 - 1);
+                for (i = 0; i < length2; i++) {
+                    array[customCursor + i] = tmp[i];
+                }
+            }
+        }
+        return {
+            mergeRuns: mergeRuns,
+            forceMergeRuns: forceMergeRuns,
+            pushRun: pushRun
+        };
+    }
+    function sort(array, compare, lo, hi) {
+        if (!lo) {
+            lo = 0;
+        }
+        if (!hi) {
+            hi = array.length;
+        }
+        var remaining = hi - lo;
+        if (remaining < 2) {
+            return;
+        }
+        var runLength = 0;
+        if (remaining < DEFAULT_MIN_MERGE) {
+            runLength = makeAscendingRun(array, lo, hi, compare);
+            binaryInsertionSort(array, lo, hi, lo + runLength, compare);
+            return;
+        }
+        var ts = TimSort(array, compare);
+        var minRun = minRunLength(remaining);
+        do {
+            runLength = makeAscendingRun(array, lo, hi, compare);
+            if (runLength < minRun) {
+                var force = remaining;
+                if (force > minRun) {
+                    force = minRun;
+                }
+                binaryInsertionSort(array, lo, lo + force, lo + runLength, compare);
+                runLength = force;
+            }
+            ts.pushRun(lo, runLength);
+            ts.mergeRuns();
+            remaining -= runLength;
+            lo += runLength;
+        } while (remaining !== 0);
+        ts.forceMergeRuns();
+    }
+
+    var REDRAW_BIT = 1;
+    var STYLE_CHANGED_BIT = 2;
+    var SHAPE_CHANGED_BIT = 4;
+
+    var invalidZErrorLogged = false;
+    function logInvalidZError() {
+        if (invalidZErrorLogged) {
+            return;
+        }
+        invalidZErrorLogged = true;
+        console.warn('z / z2 / zlevel of displayable is invalid, which may cause unexpected errors');
+    }
+    function shapeCompareFunc(a, b) {
+        if (a.zlevel === b.zlevel) {
+            if (a.z === b.z) {
+                return a.z2 - b.z2;
+            }
+            return a.z - b.z;
+        }
+        return a.zlevel - b.zlevel;
+    }
+    var Storage = (function () {
+        function Storage() {
+            this._roots = [];
+            this._displayList = [];
+            this._displayListLen = 0;
+            this.displayableSortFunc = shapeCompareFunc;
+        }
+        Storage.prototype.traverse = function (cb, context) {
+            for (var i = 0; i < this._roots.length; i++) {
+                this._roots[i].traverse(cb, context);
+            }
+        };
+        Storage.prototype.getDisplayList = function (update, includeIgnore) {
+            includeIgnore = includeIgnore || false;
+            var displayList = this._displayList;
+            if (update || !displayList.length) {
+                this.updateDisplayList(includeIgnore);
+            }
+            return displayList;
+        };
+        Storage.prototype.updateDisplayList = function (includeIgnore) {
+            this._displayListLen = 0;
+            var roots = this._roots;
+            var displayList = this._displayList;
+            for (var i = 0, len = roots.length; i < len; i++) {
+                this._updateAndAddDisplayable(roots[i], null, includeIgnore);
+            }
+            displayList.length = this._displayListLen;
+            sort(displayList, shapeCompareFunc);
+        };
+        Storage.prototype._updateAndAddDisplayable = function (el, clipPaths, includeIgnore) {
+            if (el.ignore && !includeIgnore) {
+                return;
+            }
+            el.beforeUpdate();
+            el.update();
+            el.afterUpdate();
+            var userSetClipPath = el.getClipPath();
+            if (el.ignoreClip) {
+                clipPaths = null;
+            }
+            else if (userSetClipPath) {
+                if (clipPaths) {
+                    clipPaths = clipPaths.slice();
+                }
+                else {
+                    clipPaths = [];
+                }
+                var currentClipPath = userSetClipPath;
+                var parentClipPath = el;
+                while (currentClipPath) {
+                    currentClipPath.parent = parentClipPath;
+                    currentClipPath.updateTransform();
+                    clipPaths.push(currentClipPath);
+                    parentClipPath = currentClipPath;
+                    currentClipPath = currentClipPath.getClipPath();
+                }
+            }
+            if (el.childrenRef) {
+                var children = el.childrenRef();
+                for (var i = 0; i < children.length; i++) {
+                    var child = children[i];
+                    if (el.__dirty) {
+                        child.__dirty |= REDRAW_BIT;
+                    }
+                    this._updateAndAddDisplayable(child, clipPaths, includeIgnore);
+                }
+                el.__dirty = 0;
+            }
+            else {
+                var disp = el;
+                if (clipPaths && clipPaths.length) {
+                    disp.__clipPaths = clipPaths;
+                }
+                else if (disp.__clipPaths && disp.__clipPaths.length > 0) {
+                    disp.__clipPaths = [];
+                }
+                if (isNaN(disp.z)) {
+                    logInvalidZError();
+                    disp.z = 0;
+                }
+                if (isNaN(disp.z2)) {
+                    logInvalidZError();
+                    disp.z2 = 0;
+                }
+                if (isNaN(disp.zlevel)) {
+                    logInvalidZError();
+                    disp.zlevel = 0;
+                }
+                this._displayList[this._displayListLen++] = disp;
+            }
+            var decalEl = el.getDecalElement && el.getDecalElement();
+            if (decalEl) {
+                this._updateAndAddDisplayable(decalEl, clipPaths, includeIgnore);
+            }
+            var textGuide = el.getTextGuideLine();
+            if (textGuide) {
+                this._updateAndAddDisplayable(textGuide, clipPaths, includeIgnore);
+            }
+            var textEl = el.getTextContent();
+            if (textEl) {
+                this._updateAndAddDisplayable(textEl, clipPaths, includeIgnore);
+            }
+        };
+        Storage.prototype.addRoot = function (el) {
+            if (el.__zr && el.__zr.storage === this) {
+                return;
+            }
+            this._roots.push(el);
+        };
+        Storage.prototype.delRoot = function (el) {
+            if (el instanceof Array) {
+                for (var i = 0, l = el.length; i < l; i++) {
+                    this.delRoot(el[i]);
+                }
+                return;
+            }
+            var idx = indexOf(this._roots, el);
+            if (idx >= 0) {
+                this._roots.splice(idx, 1);
+            }
+        };
+        Storage.prototype.delAllRoots = function () {
+            this._roots = [];
+            this._displayList = [];
+            this._displayListLen = 0;
+            return;
+        };
+        Storage.prototype.getRoots = function () {
+            return this._roots;
+        };
+        Storage.prototype.dispose = function () {
+            this._displayList = null;
+            this._roots = null;
+        };
+        return Storage;
+    }());
+
+    var requestAnimationFrame;
+    requestAnimationFrame = (env.hasGlobalWindow
+        && ((window.requestAnimationFrame && window.requestAnimationFrame.bind(window))
+            || (window.msRequestAnimationFrame && window.msRequestAnimationFrame.bind(window))
+            || window.mozRequestAnimationFrame
+            || window.webkitRequestAnimationFrame)) || function (func) {
+        return setTimeout(func, 16);
+    };
+    var requestAnimationFrame$1 = requestAnimationFrame;
+
+    var easingFuncs = {
+        linear: function (k) {
+            return k;
+        },
+        quadraticIn: function (k) {
+            return k * k;
+        },
+        quadraticOut: function (k) {
+            return k * (2 - k);
+        },
+        quadraticInOut: function (k) {
+            if ((k *= 2) < 1) {
+                return 0.5 * k * k;
+            }
+            return -0.5 * (--k * (k - 2) - 1);
+        },
+        cubicIn: function (k) {
+            return k * k * k;
+        },
+        cubicOut: function (k) {
+            return --k * k * k + 1;
+        },
+        cubicInOut: function (k) {
+            if ((k *= 2) < 1) {
+                return 0.5 * k * k * k;
+            }
+            return 0.5 * ((k -= 2) * k * k + 2);
+        },
+        quarticIn: function (k) {
+            return k * k * k * k;
+        },
+        quarticOut: function (k) {
+            return 1 - (--k * k * k * k);
+        },
+        quarticInOut: function (k) {
+            if ((k *= 2) < 1) {
+                return 0.5 * k * k * k * k;
+            }
+            return -0.5 * ((k -= 2) * k * k * k - 2);
+        },
+        quinticIn: function (k) {
+            return k * k * k * k * k;
+        },
+        quinticOut: function (k) {
+            return --k * k * k * k * k + 1;
+        },
+        quinticInOut: function (k) {
+            if ((k *= 2) < 1) {
+                return 0.5 * k * k * k * k * k;
+            }
+            return 0.5 * ((k -= 2) * k * k * k * k + 2);
+        },
+        sinusoidalIn: function (k) {
+            return 1 - Math.cos(k * Math.PI / 2);
+        },
+        sinusoidalOut: function (k) {
+            return Math.sin(k * Math.PI / 2);
+        },
+        sinusoidalInOut: function (k) {
+            return 0.5 * (1 - Math.cos(Math.PI * k));
+        },
+        exponentialIn: function (k) {
+            return k === 0 ? 0 : Math.pow(1024, k - 1);
+        },
+        exponentialOut: function (k) {
+            return k === 1 ? 1 : 1 - Math.pow(2, -10 * k);
+        },
+        exponentialInOut: function (k) {
+            if (k === 0) {
+                return 0;
+            }
+            if (k === 1) {
+                return 1;
+            }
+            if ((k *= 2) < 1) {
+                return 0.5 * Math.pow(1024, k - 1);
+            }
+            return 0.5 * (-Math.pow(2, -10 * (k - 1)) + 2);
+        },
+        circularIn: function (k) {
+            return 1 - Math.sqrt(1 - k * k);
+        },
+        circularOut: function (k) {
+            return Math.sqrt(1 - (--k * k));
+        },
+        circularInOut: function (k) {
+            if ((k *= 2) < 1) {
+                return -0.5 * (Math.sqrt(1 - k * k) - 1);
+            }
+            return 0.5 * (Math.sqrt(1 - (k -= 2) * k) + 1);
+        },
+        elasticIn: function (k) {
+            var s;
+            var a = 0.1;
+            var p = 0.4;
+            if (k === 0) {
+                return 0;
+            }
+            if (k === 1) {
+                return 1;
+            }
+            if (!a || a < 1) {
+                a = 1;
+                s = p / 4;
+            }
+            else {
+                s = p * Math.asin(1 / a) / (2 * Math.PI);
+            }
+            return -(a * Math.pow(2, 10 * (k -= 1))
+                * Math.sin((k - s) * (2 * Math.PI) / p));
+        },
+        elasticOut: function (k) {
+            var s;
+            var a = 0.1;
+            var p = 0.4;
+            if (k === 0) {
+                return 0;
+            }
+            if (k === 1) {
+                return 1;
+            }
+            if (!a || a < 1) {
+                a = 1;
+                s = p / 4;
+            }
+            else {
+                s = p * Math.asin(1 / a) / (2 * Math.PI);
+            }
+            return (a * Math.pow(2, -10 * k)
+                * Math.sin((k - s) * (2 * Math.PI) / p) + 1);
+        },
+        elasticInOut: function (k) {
+            var s;
+            var a = 0.1;
+            var p = 0.4;
+            if (k === 0) {
+                return 0;
+            }
+            if (k === 1) {
+                return 1;
+            }
+            if (!a || a < 1) {
+                a = 1;
+                s = p / 4;
+            }
+            else {
+                s = p * Math.asin(1 / a) / (2 * Math.PI);
+            }
+            if ((k *= 2) < 1) {
+                return -0.5 * (a * Math.pow(2, 10 * (k -= 1))
+                    * Math.sin((k - s) * (2 * Math.PI) / p));
+            }
+            return a * Math.pow(2, -10 * (k -= 1))
+                * Math.sin((k - s) * (2 * Math.PI) / p) * 0.5 + 1;
+        },
+        backIn: function (k) {
+            var s = 1.70158;
+            return k * k * ((s + 1) * k - s);
+        },
+        backOut: function (k) {
+            var s = 1.70158;
+            return --k * k * ((s + 1) * k + s) + 1;
+        },
+        backInOut: function (k) {
+            var s = 1.70158 * 1.525;
+            if ((k *= 2) < 1) {
+                return 0.5 * (k * k * ((s + 1) * k - s));
+            }
+            return 0.5 * ((k -= 2) * k * ((s + 1) * k + s) + 2);
+        },
+        bounceIn: function (k) {
+            return 1 - easingFuncs.bounceOut(1 - k);
+        },
+        bounceOut: function (k) {
+            if (k < (1 / 2.75)) {
+                return 7.5625 * k * k;
+            }
+            else if (k < (2 / 2.75)) {
+                return 7.5625 * (k -= (1.5 / 2.75)) * k + 0.75;
+            }
+            else if (k < (2.5 / 2.75)) {
+                return 7.5625 * (k -= (2.25 / 2.75)) * k + 0.9375;
+            }
+            else {
+                return 7.5625 * (k -= (2.625 / 2.75)) * k + 0.984375;
+            }
+        },
+        bounceInOut: function (k) {
+            if (k < 0.5) {
+                return easingFuncs.bounceIn(k * 2) * 0.5;
+            }
+            return easingFuncs.bounceOut(k * 2 - 1) * 0.5 + 0.5;
+        }
+    };
+
+    var mathPow = Math.pow;
+    var mathSqrt = Math.sqrt;
+    var EPSILON = 1e-8;
+    var EPSILON_NUMERIC = 1e-4;
+    var THREE_SQRT = mathSqrt(3);
+    var ONE_THIRD = 1 / 3;
+    var _v0 = create();
+    var _v1 = create();
+    var _v2 = create();
+    function isAroundZero(val) {
+        return val > -EPSILON && val < EPSILON;
+    }
+    function isNotAroundZero(val) {
+        return val > EPSILON || val < -EPSILON;
+    }
+    function cubicAt(p0, p1, p2, p3, t) {
+        var onet = 1 - t;
+        return onet * onet * (onet * p0 + 3 * t * p1)
+            + t * t * (t * p3 + 3 * onet * p2);
+    }
+    function cubicDerivativeAt(p0, p1, p2, p3, t) {
+        var onet = 1 - t;
+        return 3 * (((p1 - p0) * onet + 2 * (p2 - p1) * t) * onet
+            + (p3 - p2) * t * t);
+    }
+    function cubicRootAt(p0, p1, p2, p3, val, roots) {
+        var a = p3 + 3 * (p1 - p2) - p0;
+        var b = 3 * (p2 - p1 * 2 + p0);
+        var c = 3 * (p1 - p0);
+        var d = p0 - val;
+        var A = b * b - 3 * a * c;
+        var B = b * c - 9 * a * d;
+        var C = c * c - 3 * b * d;
+        var n = 0;
+        if (isAroundZero(A) && isAroundZero(B)) {
+            if (isAroundZero(b)) {
+                roots[0] = 0;
+            }
+            else {
+                var t1 = -c / b;
+                if (t1 >= 0 && t1 <= 1) {
+                    roots[n++] = t1;
+                }
+            }
+        }
+        else {
+            var disc = B * B - 4 * A * C;
+            if (isAroundZero(disc)) {
+                var K = B / A;
+                var t1 = -b / a + K;
+                var t2 = -K / 2;
+                if (t1 >= 0 && t1 <= 1) {
+                    roots[n++] = t1;
+                }
+                if (t2 >= 0 && t2 <= 1) {
+                    roots[n++] = t2;
+                }
+            }
+            else if (disc > 0) {
+                var discSqrt = mathSqrt(disc);
+                var Y1 = A * b + 1.5 * a * (-B + discSqrt);
+                var Y2 = A * b + 1.5 * a * (-B - discSqrt);
+                if (Y1 < 0) {
+                    Y1 = -mathPow(-Y1, ONE_THIRD);
+                }
+                else {
+                    Y1 = mathPow(Y1, ONE_THIRD);
+                }
+                if (Y2 < 0) {
+                    Y2 = -mathPow(-Y2, ONE_THIRD);
+                }
+                else {
+                    Y2 = mathPow(Y2, ONE_THIRD);
+                }
+                var t1 = (-b - (Y1 + Y2)) / (3 * a);
+                if (t1 >= 0 && t1 <= 1) {
+                    roots[n++] = t1;
+                }
+            }
+            else {
+                var T = (2 * A * b - 3 * a * B) / (2 * mathSqrt(A * A * A));
+                var theta = Math.acos(T) / 3;
+                var ASqrt = mathSqrt(A);
+                var tmp = Math.cos(theta);
+                var t1 = (-b - 2 * ASqrt * tmp) / (3 * a);
+                var t2 = (-b + ASqrt * (tmp + THREE_SQRT * Math.sin(theta))) / (3 * a);
+                var t3 = (-b + ASqrt * (tmp - THREE_SQRT * Math.sin(theta))) / (3 * a);
+                if (t1 >= 0 && t1 <= 1) {
+                    roots[n++] = t1;
+                }
+                if (t2 >= 0 && t2 <= 1) {
+                    roots[n++] = t2;
+                }
+                if (t3 >= 0 && t3 <= 1) {
+                    roots[n++] = t3;
+                }
+            }
+        }
+        return n;
+    }
+    function cubicExtrema(p0, p1, p2, p3, extrema) {
+        var b = 6 * p2 - 12 * p1 + 6 * p0;
+        var a = 9 * p1 + 3 * p3 - 3 * p0 - 9 * p2;
+        var c = 3 * p1 - 3 * p0;
+        var n = 0;
+        if (isAroundZero(a)) {
+            if (isNotAroundZero(b)) {
+                var t1 = -c / b;
+                if (t1 >= 0 && t1 <= 1) {
+                    extrema[n++] = t1;
+                }
+            }
+        }
+        else {
+            var disc = b * b - 4 * a * c;
+            if (isAroundZero(disc)) {
+                extrema[0] = -b / (2 * a);
+            }
+            else if (disc > 0) {
+                var discSqrt = mathSqrt(disc);
+                var t1 = (-b + discSqrt) / (2 * a);
+                var t2 = (-b - discSqrt) / (2 * a);
+                if (t1 >= 0 && t1 <= 1) {
+                    extrema[n++] = t1;
+                }
+                if (t2 >= 0 && t2 <= 1) {
+                    extrema[n++] = t2;
+                }
+            }
+        }
+        return n;
+    }
+    function cubicSubdivide(p0, p1, p2, p3, t, out) {
+        var p01 = (p1 - p0) * t + p0;
+        var p12 = (p2 - p1) * t + p1;
+        var p23 = (p3 - p2) * t + p2;
+        var p012 = (p12 - p01) * t + p01;
+        var p123 = (p23 - p12) * t + p12;
+        var p0123 = (p123 - p012) * t + p012;
+        out[0] = p0;
+        out[1] = p01;
+        out[2] = p012;
+        out[3] = p0123;
+        out[4] = p0123;
+        out[5] = p123;
+        out[6] = p23;
+        out[7] = p3;
+    }
+    function cubicProjectPoint(x0, y0, x1, y1, x2, y2, x3, y3, x, y, out) {
+        var t;
+        var interval = 0.005;
+        var d = Infinity;
+        var prev;
+        var next;
+        var d1;
+        var d2;
+        _v0[0] = x;
+        _v0[1] = y;
+        for (var _t = 0; _t < 1; _t += 0.05) {
+            _v1[0] = cubicAt(x0, x1, x2, x3, _t);
+            _v1[1] = cubicAt(y0, y1, y2, y3, _t);
+            d1 = distSquare(_v0, _v1);
+            if (d1 < d) {
+                t = _t;
+                d = d1;
+            }
+        }
+        d = Infinity;
+        for (var i = 0; i < 32; i++) {
+            if (interval < EPSILON_NUMERIC) {
+                break;
+            }
+            prev = t - interval;
+            next = t + interval;
+            _v1[0] = cubicAt(x0, x1, x2, x3, prev);
+            _v1[1] = cubicAt(y0, y1, y2, y3, prev);
+            d1 = distSquare(_v1, _v0);
+            if (prev >= 0 && d1 < d) {
+                t = prev;
+                d = d1;
+            }
+            else {
+                _v2[0] = cubicAt(x0, x1, x2, x3, next);
+                _v2[1] = cubicAt(y0, y1, y2, y3, next);
+                d2 = distSquare(_v2, _v0);
+                if (next <= 1 && d2 < d) {
+                    t = next;
+                    d = d2;
+                }
+                else {
+                    interval *= 0.5;
+                }
+            }
+        }
+        if (out) {
+            out[0] = cubicAt(x0, x1, x2, x3, t);
+            out[1] = cubicAt(y0, y1, y2, y3, t);
+        }
+        return mathSqrt(d);
+    }
+    function cubicLength(x0, y0, x1, y1, x2, y2, x3, y3, iteration) {
+        var px = x0;
+        var py = y0;
+        var d = 0;
+        var step = 1 / iteration;
+        for (var i = 1; i <= iteration; i++) {
+            var t = i * step;
+            var x = cubicAt(x0, x1, x2, x3, t);
+            var y = cubicAt(y0, y1, y2, y3, t);
+            var dx = x - px;
+            var dy = y - py;
+            d += Math.sqrt(dx * dx + dy * dy);
+            px = x;
+            py = y;
+        }
+        return d;
+    }
+    function quadraticAt(p0, p1, p2, t) {
+        var onet = 1 - t;
+        return onet * (onet * p0 + 2 * t * p1) + t * t * p2;
+    }
+    function quadraticDerivativeAt(p0, p1, p2, t) {
+        return 2 * ((1 - t) * (p1 - p0) + t * (p2 - p1));
+    }
+    function quadraticRootAt(p0, p1, p2, val, roots) {
+        var a = p0 - 2 * p1 + p2;
+        var b = 2 * (p1 - p0);
+        var c = p0 - val;
+        var n = 0;
+        if (isAroundZero(a)) {
+            if (isNotAroundZero(b)) {
+                var t1 = -c / b;
+                if (t1 >= 0 && t1 <= 1) {
+                    roots[n++] = t1;
+                }
+            }
+        }
+        else {
+            var disc = b * b - 4 * a * c;
+            if (isAroundZero(disc)) {
+                var t1 = -b / (2 * a);
+                if (t1 >= 0 && t1 <= 1) {
+                    roots[n++] = t1;
+                }
+            }
+            else if (disc > 0) {
+                var discSqrt = mathSqrt(disc);
+                var t1 = (-b + discSqrt) / (2 * a);
+                var t2 = (-b - discSqrt) / (2 * a);
+                if (t1 >= 0 && t1 <= 1) {
+                    roots[n++] = t1;
+                }
+                if (t2 >= 0 && t2 <= 1) {
+                    roots[n++] = t2;
+                }
+            }
+        }
+        return n;
+    }
+    function quadraticExtremum(p0, p1, p2) {
+        var divider = p0 + p2 - 2 * p1;
+        if (divider === 0) {
+            return 0.5;
+        }
+        else {
+            return (p0 - p1) / divider;
+        }
+    }
+    function quadraticSubdivide(p0, p1, p2, t, out) {
+        var p01 = (p1 - p0) * t + p0;
+        var p12 = (p2 - p1) * t + p1;
+        var p012 = (p12 - p01) * t + p01;
+        out[0] = p0;
+        out[1] = p01;
+        out[2] = p012;
+        out[3] = p012;
+        out[4] = p12;
+        out[5] = p2;
+    }
+    function quadraticProjectPoint(x0, y0, x1, y1, x2, y2, x, y, out) {
+        var t;
+        var interval = 0.005;
+        var d = Infinity;
+        _v0[0] = x;
+        _v0[1] = y;
+        for (var _t = 0; _t < 1; _t += 0.05) {
+            _v1[0] = quadraticAt(x0, x1, x2, _t);
+            _v1[1] = quadraticAt(y0, y1, y2, _t);
+            var d1 = distSquare(_v0, _v1);
+            if (d1 < d) {
+                t = _t;
+                d = d1;
+            }
+        }
+        d = Infinity;
+        for (var i = 0; i < 32; i++) {
+            if (interval < EPSILON_NUMERIC) {
+                break;
+            }
+            var prev = t - interval;
+            var next = t + interval;
+            _v1[0] = quadraticAt(x0, x1, x2, prev);
+            _v1[1] = quadraticAt(y0, y1, y2, prev);
+            var d1 = distSquare(_v1, _v0);
+            if (prev >= 0 && d1 < d) {
+                t = prev;
+                d = d1;
+            }
+            else {
+                _v2[0] = quadraticAt(x0, x1, x2, next);
+                _v2[1] = quadraticAt(y0, y1, y2, next);
+                var d2 = distSquare(_v2, _v0);
+                if (next <= 1 && d2 < d) {
+                    t = next;
+                    d = d2;
+                }
+                else {
+                    interval *= 0.5;
+                }
+            }
+        }
+        if (out) {
+            out[0] = quadraticAt(x0, x1, x2, t);
+            out[1] = quadraticAt(y0, y1, y2, t);
+        }
+        return mathSqrt(d);
+    }
+    function quadraticLength(x0, y0, x1, y1, x2, y2, iteration) {
+        var px = x0;
+        var py = y0;
+        var d = 0;
+        var step = 1 / iteration;
+        for (var i = 1; i <= iteration; i++) {
+            var t = i * step;
+            var x = quadraticAt(x0, x1, x2, t);
+            var y = quadraticAt(y0, y1, y2, t);
+            var dx = x - px;
+            var dy = y - py;
+            d += Math.sqrt(dx * dx + dy * dy);
+            px = x;
+            py = y;
+        }
+        return d;
+    }
+
+    var regexp = /cubic-bezier\(([0-9,\.e ]+)\)/;
+    function createCubicEasingFunc(cubicEasingStr) {
+        var cubic = cubicEasingStr && regexp.exec(cubicEasingStr);
+        if (cubic) {
+            var points = cubic[1].split(',');
+            var a_1 = +trim(points[0]);
+            var b_1 = +trim(points[1]);
+            var c_1 = +trim(points[2]);
+            var d_1 = +trim(points[3]);
+            if (isNaN(a_1 + b_1 + c_1 + d_1)) {
+                return;
+            }
+            var roots_1 = [];
+            return function (p) {
+                return p <= 0
+                    ? 0 : p >= 1
+                    ? 1
+                    : cubicRootAt(0, a_1, c_1, 1, p, roots_1) && cubicAt(0, b_1, d_1, 1, roots_1[0]);
+            };
+        }
+    }
+
+    var Clip = (function () {
+        function Clip(opts) {
+            this._inited = false;
+            this._startTime = 0;
+            this._pausedTime = 0;
+            this._paused = false;
+            this._life = opts.life || 1000;
+            this._delay = opts.delay || 0;
+            this.loop = opts.loop || false;
+            this.onframe = opts.onframe || noop;
+            this.ondestroy = opts.ondestroy || noop;
+            this.onrestart = opts.onrestart || noop;
+            opts.easing && this.setEasing(opts.easing);
+        }
+        Clip.prototype.step = function (globalTime, deltaTime) {
+            if (!this._inited) {
+                this._startTime = globalTime + this._delay;
+                this._inited = true;
+            }
+            if (this._paused) {
+                this._pausedTime += deltaTime;
+                return;
+            }
+            var life = this._life;
+            var elapsedTime = globalTime - this._startTime - this._pausedTime;
+            var percent = elapsedTime / life;
+            if (percent < 0) {
+                percent = 0;
+            }
+            percent = Math.min(percent, 1);
+            var easingFunc = this.easingFunc;
+            var schedule = easingFunc ? easingFunc(percent) : percent;
+            this.onframe(schedule);
+            if (percent === 1) {
+                if (this.loop) {
+                    var remainder = elapsedTime % life;
+                    this._startTime = globalTime - remainder;
+                    this._pausedTime = 0;
+                    this.onrestart();
+                }
+                else {
+                    return true;
+                }
+            }
+            return false;
+        };
+        Clip.prototype.pause = function () {
+            this._paused = true;
+        };
+        Clip.prototype.resume = function () {
+            this._paused = false;
+        };
+        Clip.prototype.setEasing = function (easing) {
+            this.easing = easing;
+            this.easingFunc = isFunction(easing)
+                ? easing
+                : easingFuncs[easing] || createCubicEasingFunc(easing);
+        };
+        return Clip;
+    }());
+
+    var Entry = (function () {
+        function Entry(val) {
+            this.value = val;
+        }
+        return Entry;
+    }());
+    var LinkedList = (function () {
+        function LinkedList() {
+            this._len = 0;
+        }
+        LinkedList.prototype.insert = function (val) {
+            var entry = new Entry(val);
+            this.insertEntry(entry);
+            return entry;
+        };
+        LinkedList.prototype.insertEntry = function (entry) {
+            if (!this.head) {
+                this.head = this.tail = entry;
+            }
+            else {
+                this.tail.next = entry;
+                entry.prev = this.tail;
+                entry.next = null;
+                this.tail = entry;
+            }
+            this._len++;
+        };
+        LinkedList.prototype.remove = function (entry) {
+            var prev = entry.prev;
+            var next = entry.next;
+            if (prev) {
+                prev.next = next;
+            }
+            else {
+                this.head = next;
+            }
+            if (next) {
+                next.prev = prev;
+            }
+            else {
+                this.tail = prev;
+            }
+            entry.next = entry.prev = null;
+            this._len--;
+        };
+        LinkedList.prototype.len = function () {
+            return this._len;
+        };
+        LinkedList.prototype.clear = function () {
+            this.head = this.tail = null;
+            this._len = 0;
+        };
+        return LinkedList;
+    }());
+    var LRU = (function () {
+        function LRU(maxSize) {
+            this._list = new LinkedList();
+            this._maxSize = 10;
+            this._map = {};
+            this._maxSize = maxSize;
+        }
+        LRU.prototype.put = function (key, value) {
+            var list = this._list;
+            var map = this._map;
+            var removed = null;
+            if (map[key] == null) {
+                var len = list.len();
+                var entry = this._lastRemovedEntry;
+                if (len >= this._maxSize && len > 0) {
+                    var leastUsedEntry = list.head;
+                    list.remove(leastUsedEntry);
+                    delete map[leastUsedEntry.key];
+                    removed = leastUsedEntry.value;
+                    this._lastRemovedEntry = leastUsedEntry;
+                }
+                if (entry) {
+                    entry.value = value;
+                }
+                else {
+                    entry = new Entry(value);
+                }
+                entry.key = key;
+                list.insertEntry(entry);
+                map[key] = entry;
+            }
+            return removed;
+        };
+        LRU.prototype.get = function (key) {
+            var entry = this._map[key];
+            var list = this._list;
+            if (entry != null) {
+                if (entry !== list.tail) {
+                    list.remove(entry);
+                    list.insertEntry(entry);
+                }
+                return entry.value;
+            }
+        };
+        LRU.prototype.clear = function () {
+            this._list.clear();
+            this._map = {};
+        };
+        LRU.prototype.len = function () {
+            return this._list.len();
+        };
+        return LRU;
+    }());
+
+    var kCSSColorTable = {
+        'transparent': [0, 0, 0, 0], 'aliceblue': [240, 248, 255, 1],
+        'antiquewhite': [250, 235, 215, 1], 'aqua': [0, 255, 255, 1],
+        'aquamarine': [127, 255, 212, 1], 'azure': [240, 255, 255, 1],
+        'beige': [245, 245, 220, 1], 'bisque': [255, 228, 196, 1],
+        'black': [0, 0, 0, 1], 'blanchedalmond': [255, 235, 205, 1],
+        'blue': [0, 0, 255, 1], 'blueviolet': [138, 43, 226, 1],
+        'brown': [165, 42, 42, 1], 'burlywood': [222, 184, 135, 1],
+        'cadetblue': [95, 158, 160, 1], 'chartreuse': [127, 255, 0, 1],
+        'chocolate': [210, 105, 30, 1], 'coral': [255, 127, 80, 1],
+        'cornflowerblue': [100, 149, 237, 1], 'cornsilk': [255, 248, 220, 1],
+        'crimson': [220, 20, 60, 1], 'cyan': [0, 255, 255, 1],
+        'darkblue': [0, 0, 139, 1], 'darkcyan': [0, 139, 139, 1],
+        'darkgoldenrod': [184, 134, 11, 1], 'darkgray': [169, 169, 169, 1],
+        'darkgreen': [0, 100, 0, 1], 'darkgrey': [169, 169, 169, 1],
+        'darkkhaki': [189, 183, 107, 1], 'darkmagenta': [139, 0, 139, 1],
+        'darkolivegreen': [85, 107, 47, 1], 'darkorange': [255, 140, 0, 1],
+        'darkorchid': [153, 50, 204, 1], 'darkred': [139, 0, 0, 1],
+        'darksalmon': [233, 150, 122, 1], 'darkseagreen': [143, 188, 143, 1],
+        'darkslateblue': [72, 61, 139, 1], 'darkslategray': [47, 79, 79, 1],
+        'darkslategrey': [47, 79, 79, 1], 'darkturquoise': [0, 206, 209, 1],
+        'darkviolet': [148, 0, 211, 1], 'deeppink': [255, 20, 147, 1],
+        'deepskyblue': [0, 191, 255, 1], 'dimgray': [105, 105, 105, 1],
+        'dimgrey': [105, 105, 105, 1], 'dodgerblue': [30, 144, 255, 1],
+        'firebrick': [178, 34, 34, 1], 'floralwhite': [255, 250, 240, 1],
+        'forestgreen': [34, 139, 34, 1], 'fuchsia': [255, 0, 255, 1],
+        'gainsboro': [220, 220, 220, 1], 'ghostwhite': [248, 248, 255, 1],
+        'gold': [255, 215, 0, 1], 'goldenrod': [218, 165, 32, 1],
+        'gray': [128, 128, 128, 1], 'green': [0, 128, 0, 1],
+        'greenyellow': [173, 255, 47, 1], 'grey': [128, 128, 128, 1],
+        'honeydew': [240, 255, 240, 1], 'hotpink': [255, 105, 180, 1],
+        'indianred': [205, 92, 92, 1], 'indigo': [75, 0, 130, 1],
+        'ivory': [255, 255, 240, 1], 'khaki': [240, 230, 140, 1],
+        'lavender': [230, 230, 250, 1], 'lavenderblush': [255, 240, 245, 1],
+        'lawngreen': [124, 252, 0, 1], 'lemonchiffon': [255, 250, 205, 1],
+        'lightblue': [173, 216, 230, 1], 'lightcoral': [240, 128, 128, 1],
+        'lightcyan': [224, 255, 255, 1], 'lightgoldenrodyellow': [250, 250, 210, 1],
+        'lightgray': [211, 211, 211, 1], 'lightgreen': [144, 238, 144, 1],
+        'lightgrey': [211, 211, 211, 1], 'lightpink': [255, 182, 193, 1],
+        'lightsalmon': [255, 160, 122, 1], 'lightseagreen': [32, 178, 170, 1],
+        'lightskyblue': [135, 206, 250, 1], 'lightslategray': [119, 136, 153, 1],
+        'lightslategrey': [119, 136, 153, 1], 'lightsteelblue': [176, 196, 222, 1],
+        'lightyellow': [255, 255, 224, 1], 'lime': [0, 255, 0, 1],
+        'limegreen': [50, 205, 50, 1], 'linen': [250, 240, 230, 1],
+        'magenta': [255, 0, 255, 1], 'maroon': [128, 0, 0, 1],
+        'mediumaquamarine': [102, 205, 170, 1], 'mediumblue': [0, 0, 205, 1],
+        'mediumorchid': [186, 85, 211, 1], 'mediumpurple': [147, 112, 219, 1],
+        'mediumseagreen': [60, 179, 113, 1], 'mediumslateblue': [123, 104, 238, 1],
+        'mediumspringgreen': [0, 250, 154, 1], 'mediumturquoise': [72, 209, 204, 1],
+        'mediumvioletred': [199, 21, 133, 1], 'midnightblue': [25, 25, 112, 1],
+        'mintcream': [245, 255, 250, 1], 'mistyrose': [255, 228, 225, 1],
+        'moccasin': [255, 228, 181, 1], 'navajowhite': [255, 222, 173, 1],
+        'navy': [0, 0, 128, 1], 'oldlace': [253, 245, 230, 1],
+        'olive': [128, 128, 0, 1], 'olivedrab': [107, 142, 35, 1],
+        'orange': [255, 165, 0, 1], 'orangered': [255, 69, 0, 1],
+        'orchid': [218, 112, 214, 1], 'palegoldenrod': [238, 232, 170, 1],
+        'palegreen': [152, 251, 152, 1], 'paleturquoise': [175, 238, 238, 1],
+        'palevioletred': [219, 112, 147, 1], 'papayawhip': [255, 239, 213, 1],
+        'peachpuff': [255, 218, 185, 1], 'peru': [205, 133, 63, 1],
+        'pink': [255, 192, 203, 1], 'plum': [221, 160, 221, 1],
+        'powderblue': [176, 224, 230, 1], 'purple': [128, 0, 128, 1],
+        'red': [255, 0, 0, 1], 'rosybrown': [188, 143, 143, 1],
+        'royalblue': [65, 105, 225, 1], 'saddlebrown': [139, 69, 19, 1],
+        'salmon': [250, 128, 114, 1], 'sandybrown': [244, 164, 96, 1],
+        'seagreen': [46, 139, 87, 1], 'seashell': [255, 245, 238, 1],
+        'sienna': [160, 82, 45, 1], 'silver': [192, 192, 192, 1],
+        'skyblue': [135, 206, 235, 1], 'slateblue': [106, 90, 205, 1],
+        'slategray': [112, 128, 144, 1], 'slategrey': [112, 128, 144, 1],
+        'snow': [255, 250, 250, 1], 'springgreen': [0, 255, 127, 1],
+        'steelblue': [70, 130, 180, 1], 'tan': [210, 180, 140, 1],
+        'teal': [0, 128, 128, 1], 'thistle': [216, 191, 216, 1],
+        'tomato': [255, 99, 71, 1], 'turquoise': [64, 224, 208, 1],
+        'violet': [238, 130, 238, 1], 'wheat': [245, 222, 179, 1],
+        'white': [255, 255, 255, 1], 'whitesmoke': [245, 245, 245, 1],
+        'yellow': [255, 255, 0, 1], 'yellowgreen': [154, 205, 50, 1]
+    };
+    function clampCssByte(i) {
+        i = Math.round(i);
+        return i < 0 ? 0 : i > 255 ? 255 : i;
+    }
+    function clampCssAngle(i) {
+        i = Math.round(i);
+        return i < 0 ? 0 : i > 360 ? 360 : i;
+    }
+    function clampCssFloat(f) {
+        return f < 0 ? 0 : f > 1 ? 1 : f;
+    }
+    function parseCssInt(val) {
+        var str = val;
+        if (str.length && str.charAt(str.length - 1) === '%') {
+            return clampCssByte(parseFloat(str) / 100 * 255);
+        }
+        return clampCssByte(parseInt(str, 10));
+    }
+    function parseCssFloat(val) {
+        var str = val;
+        if (str.length && str.charAt(str.length - 1) === '%') {
+            return clampCssFloat(parseFloat(str) / 100);
+        }
+        return clampCssFloat(parseFloat(str));
+    }
+    function cssHueToRgb(m1, m2, h) {
+        if (h < 0) {
+            h += 1;
+        }
+        else if (h > 1) {
+            h -= 1;
+        }
+        if (h * 6 < 1) {
+            return m1 + (m2 - m1) * h * 6;
+        }
+        if (h * 2 < 1) {
+            return m2;
+        }
+        if (h * 3 < 2) {
+            return m1 + (m2 - m1) * (2 / 3 - h) * 6;
+        }
+        return m1;
+    }
+    function lerpNumber(a, b, p) {
+        return a + (b - a) * p;
+    }
+    function setRgba(out, r, g, b, a) {
+        out[0] = r;
+        out[1] = g;
+        out[2] = b;
+        out[3] = a;
+        return out;
+    }
+    function copyRgba(out, a) {
+        out[0] = a[0];
+        out[1] = a[1];
+        out[2] = a[2];
+        out[3] = a[3];
+        return out;
+    }
+    var colorCache = new LRU(20);
+    var lastRemovedArr = null;
+    function putToCache(colorStr, rgbaArr) {
+        if (lastRemovedArr) {
+            copyRgba(lastRemovedArr, rgbaArr);
+        }
+        lastRemovedArr = colorCache.put(colorStr, lastRemovedArr || (rgbaArr.slice()));
+    }
+    function parse(colorStr, rgbaArr) {
+        if (!colorStr) {
+            return;
+        }
+        rgbaArr = rgbaArr || [];
+        var cached = colorCache.get(colorStr);
+        if (cached) {
+            return copyRgba(rgbaArr, cached);
+        }
+        colorStr = colorStr + '';
+        var str = colorStr.replace(/ /g, '').toLowerCase();
+        if (str in kCSSColorTable) {
+            copyRgba(rgbaArr, kCSSColorTable[str]);
+            putToCache(colorStr, rgbaArr);
+            return rgbaArr;
+        }
+        var strLen = str.length;
+        if (str.charAt(0) === '#') {
+            if (strLen === 4 || strLen === 5) {
+                var iv = parseInt(str.slice(1, 4), 16);
+                if (!(iv >= 0 && iv <= 0xfff)) {
+                    setRgba(rgbaArr, 0, 0, 0, 1);
+                    return;
+                }
+                setRgba(rgbaArr, ((iv & 0xf00) >> 4) | ((iv & 0xf00) >> 8), (iv & 0xf0) | ((iv & 0xf0) >> 4), (iv & 0xf) | ((iv & 0xf) << 4), strLen === 5 ? parseInt(str.slice(4), 16) / 0xf : 1);
+                putToCache(colorStr, rgbaArr);
+                return rgbaArr;
+            }
+            else if (strLen === 7 || strLen === 9) {
+                var iv = parseInt(str.slice(1, 7), 16);
+                if (!(iv >= 0 && iv <= 0xffffff)) {
+                    setRgba(rgbaArr, 0, 0, 0, 1);
+                    return;
+                }
+                setRgba(rgbaArr, (iv & 0xff0000) >> 16, (iv & 0xff00) >> 8, iv & 0xff, strLen === 9 ? parseInt(str.slice(7), 16) / 0xff : 1);
+                putToCache(colorStr, rgbaArr);
+                return rgbaArr;
+            }
+            return;
+        }
+        var op = str.indexOf('(');
+        var ep = str.indexOf(')');
+        if (op !== -1 && ep + 1 === strLen) {
+            var fname = str.substr(0, op);
+            var params = str.substr(op + 1, ep - (op + 1)).split(',');
+            var alpha = 1;
+            switch (fname) {
+                case 'rgba':
+                    if (params.length !== 4) {
+                        return params.length === 3
+                            ? setRgba(rgbaArr, +params[0], +params[1], +params[2], 1)
+                            : setRgba(rgbaArr, 0, 0, 0, 1);
+                    }
+                    alpha = parseCssFloat(params.pop());
+                case 'rgb':
+                    if (params.length >= 3) {
+                        setRgba(rgbaArr, parseCssInt(params[0]), parseCssInt(params[1]), parseCssInt(params[2]), params.length === 3 ? alpha : parseCssFloat(params[3]));
+                        putToCache(colorStr, rgbaArr);
+                        return rgbaArr;
+                    }
+                    else {
+                        setRgba(rgbaArr, 0, 0, 0, 1);
+                        return;
+                    }
+                case 'hsla':
+                    if (params.length !== 4) {
+                        setRgba(rgbaArr, 0, 0, 0, 1);
+                        return;
+                    }
+                    params[3] = parseCssFloat(params[3]);
+                    hsla2rgba(params, rgbaArr);
+                    putToCache(colorStr, rgbaArr);
+                    return rgbaArr;
+                case 'hsl':
+                    if (params.length !== 3) {
+                        setRgba(rgbaArr, 0, 0, 0, 1);
+                        return;
+                    }
+                    hsla2rgba(params, rgbaArr);
+                    putToCache(colorStr, rgbaArr);
+                    return rgbaArr;
+                default:
+                    return;
+            }
+        }
+        setRgba(rgbaArr, 0, 0, 0, 1);
+        return;
+    }
+    function hsla2rgba(hsla, rgba) {
+        var h = (((parseFloat(hsla[0]) % 360) + 360) % 360) / 360;
+        var s = parseCssFloat(hsla[1]);
+        var l = parseCssFloat(hsla[2]);
+        var m2 = l <= 0.5 ? l * (s + 1) : l + s - l * s;
+        var m1 = l * 2 - m2;
+        rgba = rgba || [];
+        setRgba(rgba, clampCssByte(cssHueToRgb(m1, m2, h + 1 / 3) * 255), clampCssByte(cssHueToRgb(m1, m2, h) * 255), clampCssByte(cssHueToRgb(m1, m2, h - 1 / 3) * 255), 1);
+        if (hsla.length === 4) {
+            rgba[3] = hsla[3];
+        }
+        return rgba;
+    }
+    function rgba2hsla(rgba) {
+        if (!rgba) {
+            return;
+        }
+        var R = rgba[0] / 255;
+        var G = rgba[1] / 255;
+        var B = rgba[2] / 255;
+        var vMin = Math.min(R, G, B);
+        var vMax = Math.max(R, G, B);
+        var delta = vMax - vMin;
+        var L = (vMax + vMin) / 2;
+        var H;
+        var S;
+        if (delta === 0) {
+            H = 0;
+            S = 0;
+        }
+        else {
+            if (L < 0.5) {
+                S = delta / (vMax + vMin);
+            }
+            else {
+                S = delta / (2 - vMax - vMin);
+            }
+            var deltaR = (((vMax - R) / 6) + (delta / 2)) / delta;
+            var deltaG = (((vMax - G) / 6) + (delta / 2)) / delta;
+            var deltaB = (((vMax - B) / 6) + (delta / 2)) / delta;
+            if (R === vMax) {
+                H = deltaB - deltaG;
+            }
+            else if (G === vMax) {
+                H = (1 / 3) + deltaR - deltaB;
+            }
+            else if (B === vMax) {
+                H = (2 / 3) + deltaG - deltaR;
+            }
+            if (H < 0) {
+                H += 1;
+            }
+            if (H > 1) {
+                H -= 1;
+            }
+        }
+        var hsla = [H * 360, S, L];
+        if (rgba[3] != null) {
+            hsla.push(rgba[3]);
+        }
+        return hsla;
+    }
+    function lift(color, level) {
+        var colorArr = parse(color);
+        if (colorArr) {
+            for (var i = 0; i < 3; i++) {
+                if (level < 0) {
+                    colorArr[i] = colorArr[i] * (1 - level) | 0;
+                }
+                else {
+                    colorArr[i] = ((255 - colorArr[i]) * level + colorArr[i]) | 0;
+                }
+                if (colorArr[i] > 255) {
+                    colorArr[i] = 255;
+                }
+                else if (colorArr[i] < 0) {
+                    colorArr[i] = 0;
+                }
+            }
+            return stringify(colorArr, colorArr.length === 4 ? 'rgba' : 'rgb');
+        }
+    }
+    function toHex(color) {
+        var colorArr = parse(color);
+        if (colorArr) {
+            return ((1 << 24) + (colorArr[0] << 16) + (colorArr[1] << 8) + (+colorArr[2])).toString(16).slice(1);
+        }
+    }
+    function fastLerp(normalizedValue, colors, out) {
+        if (!(colors && colors.length)
+            || !(normalizedValue >= 0 && normalizedValue <= 1)) {
+            return;
+        }
+        out = out || [];
+        var value = normalizedValue * (colors.length - 1);
+        var leftIndex = Math.floor(value);
+        var rightIndex = Math.ceil(value);
+        var leftColor = colors[leftIndex];
+        var rightColor = colors[rightIndex];
+        var dv = value - leftIndex;
+        out[0] = clampCssByte(lerpNumber(leftColor[0], rightColor[0], dv));
+        out[1] = clampCssByte(lerpNumber(leftColor[1], rightColor[1], dv));
+        out[2] = clampCssByte(lerpNumber(leftColor[2], rightColor[2], dv));
+        out[3] = clampCssFloat(lerpNumber(leftColor[3], rightColor[3], dv));
+        return out;
+    }
+    var fastMapToColor = fastLerp;
+    function lerp$1(normalizedValue, colors, fullOutput) {
+        if (!(colors && colors.length)
+            || !(normalizedValue >= 0 && normalizedValue <= 1)) {
+            return;
+        }
+        var value = normalizedValue * (colors.length - 1);
+        var leftIndex = Math.floor(value);
+        var rightIndex = Math.ceil(value);
+        var leftColor = parse(colors[leftIndex]);
+        var rightColor = parse(colors[rightIndex]);
+        var dv = value - leftIndex;
+        var color = stringify([
+            clampCssByte(lerpNumber(leftColor[0], rightColor[0], dv)),
+            clampCssByte(lerpNumber(leftColor[1], rightColor[1], dv)),
+            clampCssByte(lerpNumber(leftColor[2], rightColor[2], dv)),
+            clampCssFloat(lerpNumber(leftColor[3], rightColor[3], dv))
+        ], 'rgba');
+        return fullOutput
+            ? {
+                color: color,
+                leftIndex: leftIndex,
+                rightIndex: rightIndex,
+                value: value
+            }
+            : color;
+    }
+    var mapToColor = lerp$1;
+    function modifyHSL(color, h, s, l) {
+        var colorArr = parse(color);
+        if (color) {
+            colorArr = rgba2hsla(colorArr);
+            h != null && (colorArr[0] = clampCssAngle(h));
+            s != null && (colorArr[1] = parseCssFloat(s));
+            l != null && (colorArr[2] = parseCssFloat(l));
+            return stringify(hsla2rgba(colorArr), 'rgba');
+        }
+    }
+    function modifyAlpha(color, alpha) {
+        var colorArr = parse(color);
+        if (colorArr && alpha != null) {
+            colorArr[3] = clampCssFloat(alpha);
+            return stringify(colorArr, 'rgba');
+        }
+    }
+    function stringify(arrColor, type) {
+        if (!arrColor || !arrColor.length) {
+            return;
+        }
+        var colorStr = arrColor[0] + ',' + arrColor[1] + ',' + arrColor[2];
+        if (type === 'rgba' || type === 'hsva' || type === 'hsla') {
+            colorStr += ',' + arrColor[3];
+        }
+        return type + '(' + colorStr + ')';
+    }
+    function lum(color, backgroundLum) {
+        var arr = parse(color);
+        return arr
+            ? (0.299 * arr[0] + 0.587 * arr[1] + 0.114 * arr[2]) * arr[3] / 255
+                + (1 - arr[3]) * backgroundLum
+            : 0;
+    }
+    function random() {
+        return stringify([
+            Math.round(Math.random() * 255),
+            Math.round(Math.random() * 255),
+            Math.round(Math.random() * 255)
+        ], 'rgb');
+    }
+    var liftedColorCache = new LRU(100);
+    function liftColor(color) {
+        if (isString(color)) {
+            var liftedColor = liftedColorCache.get(color);
+            if (!liftedColor) {
+                liftedColor = lift(color, -0.1);
+                liftedColorCache.put(color, liftedColor);
+            }
+            return liftedColor;
+        }
+        else if (isGradientObject(color)) {
+            var ret = extend({}, color);
+            ret.colorStops = map(color.colorStops, function (stop) { return ({
+                offset: stop.offset,
+                color: lift(stop.color, -0.1)
+            }); });
+            return ret;
+        }
+        return color;
+    }
+
+    var color = /*#__PURE__*/Object.freeze({
+        __proto__: null,
+        parse: parse,
+        lift: lift,
+        toHex: toHex,
+        fastLerp: fastLerp,
+        fastMapToColor: fastMapToColor,
+        lerp: lerp$1,
+        mapToColor: mapToColor,
+        modifyHSL: modifyHSL,
+        modifyAlpha: modifyAlpha,
+        stringify: stringify,
+        lum: lum,
+        random: random,
+        liftColor: liftColor
+    });
+
+    var mathRound = Math.round;
+    function normalizeColor(color) {
+        var opacity;
+        if (!color || color === 'transparent') {
+            color = 'none';
+        }
+        else if (typeof color === 'string' && color.indexOf('rgba') > -1) {
+            var arr = parse(color);
+            if (arr) {
+                color = 'rgb(' + arr[0] + ',' + arr[1] + ',' + arr[2] + ')';
+                opacity = arr[3];
+            }
+        }
+        return {
+            color: color,
+            opacity: opacity == null ? 1 : opacity
+        };
+    }
+    var EPSILON$1 = 1e-4;
+    function isAroundZero$1(transform) {
+        return transform < EPSILON$1 && transform > -EPSILON$1;
+    }
+    function round3(transform) {
+        return mathRound(transform * 1e3) / 1e3;
+    }
+    function round4(transform) {
+        return mathRound(transform * 1e4) / 1e4;
+    }
+    function getMatrixStr(m) {
+        return 'matrix('
+            + round3(m[0]) + ','
+            + round3(m[1]) + ','
+            + round3(m[2]) + ','
+            + round3(m[3]) + ','
+            + round4(m[4]) + ','
+            + round4(m[5])
+            + ')';
+    }
+    var TEXT_ALIGN_TO_ANCHOR = {
+        left: 'start',
+        right: 'end',
+        center: 'middle',
+        middle: 'middle'
+    };
+    function adjustTextY(y, lineHeight, textBaseline) {
+        if (textBaseline === 'top') {
+            y += lineHeight / 2;
+        }
+        else if (textBaseline === 'bottom') {
+            y -= lineHeight / 2;
+        }
+        return y;
+    }
+    function hasShadow(style) {
+        return style
+            && (style.shadowBlur || style.shadowOffsetX || style.shadowOffsetY);
+    }
+    function getShadowKey(displayable) {
+        var style = displayable.style;
+        var globalScale = displayable.getGlobalScale();
+        return [
+            style.shadowColor,
+            (style.shadowBlur || 0).toFixed(2),
+            (style.shadowOffsetX || 0).toFixed(2),
+            (style.shadowOffsetY || 0).toFixed(2),
+            globalScale[0],
+            globalScale[1]
+        ].join(',');
+    }
+    function isImagePattern(val) {
+        return val && (!!val.image);
+    }
+    function isSVGPattern(val) {
+        return val && (!!val.svgElement);
+    }
+    function isPattern(val) {
+        return isImagePattern(val) || isSVGPattern(val);
+    }
+    function isLinearGradient(val) {
+        return val.type === 'linear';
+    }
+    function isRadialGradient(val) {
+        return val.type === 'radial';
+    }
+    function isGradient(val) {
+        return val && (val.type === 'linear'
+            || val.type === 'radial');
+    }
+    function getIdURL(id) {
+        return "url(#" + id + ")";
+    }
+    function getPathPrecision(el) {
+        var scale = el.getGlobalScale();
+        var size = Math.max(scale[0], scale[1]);
+        return Math.max(Math.ceil(Math.log(size) / Math.log(10)), 1);
+    }
+    function getSRTTransformString(transform) {
+        var x = transform.x || 0;
+        var y = transform.y || 0;
+        var rotation = (transform.rotation || 0) * RADIAN_TO_DEGREE;
+        var scaleX = retrieve2(transform.scaleX, 1);
+        var scaleY = retrieve2(transform.scaleY, 1);
+        var skewX = transform.skewX || 0;
+        var skewY = transform.skewY || 0;
+        var res = [];
+        if (x || y) {
+            res.push("translate(" + x + "px," + y + "px)");
+        }
+        if (rotation) {
+            res.push("rotate(" + rotation + ")");
+        }
+        if (scaleX !== 1 || scaleY !== 1) {
+            res.push("scale(" + scaleX + "," + scaleY + ")");
+        }
+        if (skewX || skewY) {
+            res.push("skew(" + mathRound(skewX * RADIAN_TO_DEGREE) + "deg, " + mathRound(skewY * RADIAN_TO_DEGREE) + "deg)");
+        }
+        return res.join(' ');
+    }
+    var encodeBase64 = (function () {
+        if (env.hasGlobalWindow && isFunction(window.btoa)) {
+            return function (str) {
+                return window.btoa(unescape(encodeURIComponent(str)));
+            };
+        }
+        if (typeof Buffer !== 'undefined') {
+            return function (str) {
+                return Buffer.from(str).toString('base64');
+            };
+        }
+        return function (str) {
+            {
+                logError('Base64 isn\'t natively supported in the current environment.');
+            }
+            return null;
+        };
+    })();
+
+    var arraySlice = Array.prototype.slice;
+    function interpolateNumber(p0, p1, percent) {
+        return (p1 - p0) * percent + p0;
+    }
+    function interpolate1DArray(out, p0, p1, percent) {
+        var len = p0.length;
+        for (var i = 0; i < len; i++) {
+            out[i] = interpolateNumber(p0[i], p1[i], percent);
+        }
+        return out;
+    }
+    function interpolate2DArray(out, p0, p1, percent) {
+        var len = p0.length;
+        var len2 = len && p0[0].length;
+        for (var i = 0; i < len; i++) {
+            if (!out[i]) {
+                out[i] = [];
+            }
+            for (var j = 0; j < len2; j++) {
+                out[i][j] = interpolateNumber(p0[i][j], p1[i][j], percent);
+            }
+        }
+        return out;
+    }
+    function add1DArray(out, p0, p1, sign) {
+        var len = p0.length;
+        for (var i = 0; i < len; i++) {
+            out[i] = p0[i] + p1[i] * sign;
+        }
+        return out;
+    }
+    function add2DArray(out, p0, p1, sign) {
+        var len = p0.length;
+        var len2 = len && p0[0].length;
+        for (var i = 0; i < len; i++) {
+            if (!out[i]) {
+                out[i] = [];
+            }
+            for (var j = 0; j < len2; j++) {
+                out[i][j] = p0[i][j] + p1[i][j] * sign;
+            }
+        }
+        return out;
+    }
+    function fillColorStops(val0, val1) {
+        var len0 = val0.length;
+        var len1 = val1.length;
+        var shorterArr = len0 > len1 ? val1 : val0;
+        var shorterLen = Math.min(len0, len1);
+        var last = shorterArr[shorterLen - 1] || { color: [0, 0, 0, 0], offset: 0 };
+        for (var i = shorterLen; i < Math.max(len0, len1); i++) {
+            shorterArr.push({
+                offset: last.offset,
+                color: last.color.slice()
+            });
+        }
+    }
+    function fillArray(val0, val1, arrDim) {
+        var arr0 = val0;
+        var arr1 = val1;
+        if (!arr0.push || !arr1.push) {
+            return;
+        }
+        var arr0Len = arr0.length;
+        var arr1Len = arr1.length;
+        if (arr0Len !== arr1Len) {
+            var isPreviousLarger = arr0Len > arr1Len;
+            if (isPreviousLarger) {
+                arr0.length = arr1Len;
+            }
+            else {
+                for (var i = arr0Len; i < arr1Len; i++) {
+                    arr0.push(arrDim === 1 ? arr1[i] : arraySlice.call(arr1[i]));
+                }
+            }
+        }
+        var len2 = arr0[0] && arr0[0].length;
+        for (var i = 0; i < arr0.length; i++) {
+            if (arrDim === 1) {
+                if (isNaN(arr0[i])) {
+                    arr0[i] = arr1[i];
+                }
+            }
+            else {
+                for (var j = 0; j < len2; j++) {
+                    if (isNaN(arr0[i][j])) {
+                        arr0[i][j] = arr1[i][j];
+                    }
+                }
+            }
+        }
+    }
+    function cloneValue(value) {
+        if (isArrayLike(value)) {
+            var len = value.length;
+            if (isArrayLike(value[0])) {
+                var ret = [];
+                for (var i = 0; i < len; i++) {
+                    ret.push(arraySlice.call(value[i]));
+                }
+                return ret;
+            }
+            return arraySlice.call(value);
+        }
+        return value;
+    }
+    function rgba2String(rgba) {
+        rgba[0] = Math.floor(rgba[0]) || 0;
+        rgba[1] = Math.floor(rgba[1]) || 0;
+        rgba[2] = Math.floor(rgba[2]) || 0;
+        rgba[3] = rgba[3] == null ? 1 : rgba[3];
+        return 'rgba(' + rgba.join(',') + ')';
+    }
+    function guessArrayDim(value) {
+        return isArrayLike(value && value[0]) ? 2 : 1;
+    }
+    var VALUE_TYPE_NUMBER = 0;
+    var VALUE_TYPE_1D_ARRAY = 1;
+    var VALUE_TYPE_2D_ARRAY = 2;
+    var VALUE_TYPE_COLOR = 3;
+    var VALUE_TYPE_LINEAR_GRADIENT = 4;
+    var VALUE_TYPE_RADIAL_GRADIENT = 5;
+    var VALUE_TYPE_UNKOWN = 6;
+    function isGradientValueType(valType) {
+        return valType === VALUE_TYPE_LINEAR_GRADIENT || valType === VALUE_TYPE_RADIAL_GRADIENT;
+    }
+    function isArrayValueType(valType) {
+        return valType === VALUE_TYPE_1D_ARRAY || valType === VALUE_TYPE_2D_ARRAY;
+    }
+    var tmpRgba = [0, 0, 0, 0];
+    var Track = (function () {
+        function Track(propName) {
+            this.keyframes = [];
+            this.discrete = false;
+            this._invalid = false;
+            this._needsSort = false;
+            this._lastFr = 0;
+            this._lastFrP = 0;
+            this.propName = propName;
+        }
+        Track.prototype.isFinished = function () {
+            return this._finished;
+        };
+        Track.prototype.setFinished = function () {
+            this._finished = true;
+            if (this._additiveTrack) {
+                this._additiveTrack.setFinished();
+            }
+        };
+        Track.prototype.needsAnimate = function () {
+            return this.keyframes.length >= 1;
+        };
+        Track.prototype.getAdditiveTrack = function () {
+            return this._additiveTrack;
+        };
+        Track.prototype.addKeyframe = function (time, rawValue, easing) {
+            this._needsSort = true;
+            var keyframes = this.keyframes;
+            var len = keyframes.length;
+            var discrete = false;
+            var valType = VALUE_TYPE_UNKOWN;
+            var value = rawValue;
+            if (isArrayLike(rawValue)) {
+                var arrayDim = guessArrayDim(rawValue);
+                valType = arrayDim;
+                if (arrayDim === 1 && !isNumber(rawValue[0])
+                    || arrayDim === 2 && !isNumber(rawValue[0][0])) {
+                    discrete = true;
+                }
+            }
+            else {
+                if (isNumber(rawValue) && !eqNaN(rawValue)) {
+                    valType = VALUE_TYPE_NUMBER;
+                }
+                else if (isString(rawValue)) {
+                    if (!isNaN(+rawValue)) {
+                        valType = VALUE_TYPE_NUMBER;
+                    }
+                    else {
+                        var colorArray = parse(rawValue);
+                        if (colorArray) {
+                            value = colorArray;
+                            valType = VALUE_TYPE_COLOR;
+                        }
+                    }
+                }
+                else if (isGradientObject(rawValue)) {
+                    var parsedGradient = extend({}, value);
+                    parsedGradient.colorStops = map(rawValue.colorStops, function (colorStop) { return ({
+                        offset: colorStop.offset,
+                        color: parse(colorStop.color)
+                    }); });
+                    if (isLinearGradient(rawValue)) {
+                        valType = VALUE_TYPE_LINEAR_GRADIENT;
+                    }
+                    else if (isRadialGradient(rawValue)) {
+                        valType = VALUE_TYPE_RADIAL_GRADIENT;
+                    }
+                    value = parsedGradient;
+                }
+            }
+            if (len === 0) {
+                this.valType = valType;
+            }
+            else if (valType !== this.valType || valType === VALUE_TYPE_UNKOWN) {
+                discrete = true;
+            }
+            this.discrete = this.discrete || discrete;
+            var kf = {
+                time: time,
+                value: value,
+                rawValue: rawValue,
+                percent: 0
+            };
+            if (easing) {
+                kf.easing = easing;
+                kf.easingFunc = isFunction(easing)
+                    ? easing
+                    : easingFuncs[easing] || createCubicEasingFunc(easing);
+            }
+            keyframes.push(kf);
+            return kf;
+        };
+        Track.prototype.prepare = function (maxTime, additiveTrack) {
+            var kfs = this.keyframes;
+            if (this._needsSort) {
+                kfs.sort(function (a, b) {
+                    return a.time - b.time;
+                });
+            }
+            var valType = this.valType;
+            var kfsLen = kfs.length;
+            var lastKf = kfs[kfsLen - 1];
+            var isDiscrete = this.discrete;
+            var isArr = isArrayValueType(valType);
+            var isGradient = isGradientValueType(valType);
+            for (var i = 0; i < kfsLen; i++) {
+                var kf = kfs[i];
+                var value = kf.value;
+                var lastValue = lastKf.value;
+                kf.percent = kf.time / maxTime;
+                if (!isDiscrete) {
+                    if (isArr && i !== kfsLen - 1) {
+                        fillArray(value, lastValue, valType);
+                    }
+                    else if (isGradient) {
+                        fillColorStops(value.colorStops, lastValue.colorStops);
+                    }
+                }
+            }
+            if (!isDiscrete
+                && valType !== VALUE_TYPE_RADIAL_GRADIENT
+                && additiveTrack
+                && this.needsAnimate()
+                && additiveTrack.needsAnimate()
+                && valType === additiveTrack.valType
+                && !additiveTrack._finished) {
+                this._additiveTrack = additiveTrack;
+                var startValue = kfs[0].value;
+                for (var i = 0; i < kfsLen; i++) {
+                    if (valType === VALUE_TYPE_NUMBER) {
+                        kfs[i].additiveValue = kfs[i].value - startValue;
+                    }
+                    else if (valType === VALUE_TYPE_COLOR) {
+                        kfs[i].additiveValue =
+                            add1DArray([], kfs[i].value, startValue, -1);
+                    }
+                    else if (isArrayValueType(valType)) {
+                        kfs[i].additiveValue = valType === VALUE_TYPE_1D_ARRAY
+                            ? add1DArray([], kfs[i].value, startValue, -1)
+                            : add2DArray([], kfs[i].value, startValue, -1);
+                    }
+                }
+            }
+        };
+        Track.prototype.step = function (target, percent) {
+            if (this._finished) {
+                return;
+            }
+            if (this._additiveTrack && this._additiveTrack._finished) {
+                this._additiveTrack = null;
+            }
+            var isAdditive = this._additiveTrack != null;
+            var valueKey = isAdditive ? 'additiveValue' : 'value';
+            var valType = this.valType;
+            var keyframes = this.keyframes;
+            var kfsNum = keyframes.length;
+            var propName = this.propName;
+            var isValueColor = valType === VALUE_TYPE_COLOR;
+            var frameIdx;
+            var lastFrame = this._lastFr;
+            var mathMin = Math.min;
+            var frame;
+            var nextFrame;
+            if (kfsNum === 1) {
+                frame = nextFrame = keyframes[0];
+            }
+            else {
+                if (percent < 0) {
+                    frameIdx = 0;
+                }
+                else if (percent < this._lastFrP) {
+                    var start = mathMin(lastFrame + 1, kfsNum - 1);
+                    for (frameIdx = start; frameIdx >= 0; frameIdx--) {
+                        if (keyframes[frameIdx].percent <= percent) {
+                            break;
+                        }
+                    }
+                    frameIdx = mathMin(frameIdx, kfsNum - 2);
+                }
+                else {
+                    for (frameIdx = lastFrame; frameIdx < kfsNum; frameIdx++) {
+                        if (keyframes[frameIdx].percent > percent) {
+                            break;
+                        }
+                    }
+                    frameIdx = mathMin(frameIdx - 1, kfsNum - 2);
+                }
+                nextFrame = keyframes[frameIdx + 1];
+                frame = keyframes[frameIdx];
+            }
+            if (!(frame && nextFrame)) {
+                return;
+            }
+            this._lastFr = frameIdx;
+            this._lastFrP = percent;
+            var interval = (nextFrame.percent - frame.percent);
+            var w = interval === 0 ? 1 : mathMin((percent - frame.percent) / interval, 1);
+            if (nextFrame.easingFunc) {
+                w = nextFrame.easingFunc(w);
+            }
+            var targetArr = isAdditive ? this._additiveValue
+                : (isValueColor ? tmpRgba : target[propName]);
+            if ((isArrayValueType(valType) || isValueColor) && !targetArr) {
+                targetArr = this._additiveValue = [];
+            }
+            if (this.discrete) {
+                target[propName] = w < 1 ? frame.rawValue : nextFrame.rawValue;
+            }
+            else if (isArrayValueType(valType)) {
+                valType === VALUE_TYPE_1D_ARRAY
+                    ? interpolate1DArray(targetArr, frame[valueKey], nextFrame[valueKey], w)
+                    : interpolate2DArray(targetArr, frame[valueKey], nextFrame[valueKey], w);
+            }
+            else if (isGradientValueType(valType)) {
+                var val = frame[valueKey];
+                var nextVal_1 = nextFrame[valueKey];
+                var isLinearGradient_1 = valType === VALUE_TYPE_LINEAR_GRADIENT;
+                target[propName] = {
+                    type: isLinearGradient_1 ? 'linear' : 'radial',
+                    x: interpolateNumber(val.x, nextVal_1.x, w),
+                    y: interpolateNumber(val.y, nextVal_1.y, w),
+                    colorStops: map(val.colorStops, function (colorStop, idx) {
+                        var nextColorStop = nextVal_1.colorStops[idx];
+                        return {
+                            offset: interpolateNumber(colorStop.offset, nextColorStop.offset, w),
+                            color: rgba2String(interpolate1DArray([], colorStop.color, nextColorStop.color, w))
+                        };
+                    }),
+                    global: nextVal_1.global
+                };
+                if (isLinearGradient_1) {
+                    target[propName].x2 = interpolateNumber(val.x2, nextVal_1.x2, w);
+                    target[propName].y2 = interpolateNumber(val.y2, nextVal_1.y2, w);
+                }
+                else {
+                    target[propName].r = interpolateNumber(val.r, nextVal_1.r, w);
+                }
+            }
+            else if (isValueColor) {
+                interpolate1DArray(targetArr, frame[valueKey], nextFrame[valueKey], w);
+                if (!isAdditive) {
+                    target[propName] = rgba2String(targetArr);
+                }
+            }
+            else {
+                var value = interpolateNumber(frame[valueKey], nextFrame[valueKey], w);
+                if (isAdditive) {
+                    this._additiveValue = value;
+                }
+                else {
+                    target[propName] = value;
+                }
+            }
+            if (isAdditive) {
+                this._addToTarget(target);
+            }
+        };
+        Track.prototype._addToTarget = function (target) {
+            var valType = this.valType;
+            var propName = this.propName;
+            var additiveValue = this._additiveValue;
+            if (valType === VALUE_TYPE_NUMBER) {
+                target[propName] = target[propName] + additiveValue;
+            }
+            else if (valType === VALUE_TYPE_COLOR) {
+                parse(target[propName], tmpRgba);
+                add1DArray(tmpRgba, tmpRgba, additiveValue, 1);
+                target[propName] = rgba2String(tmpRgba);
+            }
+            else if (valType === VALUE_TYPE_1D_ARRAY) {
+                add1DArray(target[propName], target[propName], additiveValue, 1);
+            }
+            else if (valType === VALUE_TYPE_2D_ARRAY) {
+                add2DArray(target[propName], target[propName], additiveValue, 1);
+            }
+        };
+        return Track;
+    }());
+    var Animator = (function () {
+        function Animator(target, loop, allowDiscreteAnimation, additiveTo) {
+            this._tracks = {};
+            this._trackKeys = [];
+            this._maxTime = 0;
+            this._started = 0;
+            this._clip = null;
+            this._target = target;
+            this._loop = loop;
+            if (loop && additiveTo) {
+                logError('Can\' use additive animation on looped animation.');
+                return;
+            }
+            this._additiveAnimators = additiveTo;
+            this._allowDiscrete = allowDiscreteAnimation;
+        }
+        Animator.prototype.getMaxTime = function () {
+            return this._maxTime;
+        };
+        Animator.prototype.getDelay = function () {
+            return this._delay;
+        };
+        Animator.prototype.getLoop = function () {
+            return this._loop;
+        };
+        Animator.prototype.getTarget = function () {
+            return this._target;
+        };
+        Animator.prototype.changeTarget = function (target) {
+            this._target = target;
+        };
+        Animator.prototype.when = function (time, props, easing) {
+            return this.whenWithKeys(time, props, keys(props), easing);
+        };
+        Animator.prototype.whenWithKeys = function (time, props, propNames, easing) {
+            var tracks = this._tracks;
+            for (var i = 0; i < propNames.length; i++) {
+                var propName = propNames[i];
+                var track = tracks[propName];
+                if (!track) {
+                    track = tracks[propName] = new Track(propName);
+                    var initialValue = void 0;
+                    var additiveTrack = this._getAdditiveTrack(propName);
+                    if (additiveTrack) {
+                        var addtiveTrackKfs = additiveTrack.keyframes;
+                        var lastFinalKf = addtiveTrackKfs[addtiveTrackKfs.length - 1];
+                        initialValue = lastFinalKf && lastFinalKf.value;
+                        if (additiveTrack.valType === VALUE_TYPE_COLOR && initialValue) {
+                            initialValue = rgba2String(initialValue);
+                        }
+                    }
+                    else {
+                        initialValue = this._target[propName];
+                    }
+                    if (initialValue == null) {
+                        continue;
+                    }
+                    if (time > 0) {
+                        track.addKeyframe(0, cloneValue(initialValue), easing);
+                    }
+                    this._trackKeys.push(propName);
+                }
+                track.addKeyframe(time, cloneValue(props[propName]), easing);
+            }
+            this._maxTime = Math.max(this._maxTime, time);
+            return this;
+        };
+        Animator.prototype.pause = function () {
+            this._clip.pause();
+            this._paused = true;
+        };
+        Animator.prototype.resume = function () {
+            this._clip.resume();
+            this._paused = false;
+        };
+        Animator.prototype.isPaused = function () {
+            return !!this._paused;
+        };
+        Animator.prototype.duration = function (duration) {
+            this._maxTime = duration;
+            this._force = true;
+            return this;
+        };
+        Animator.prototype._doneCallback = function () {
+            this._setTracksFinished();
+            this._clip = null;
+            var doneList = this._doneCbs;
+            if (doneList) {
+                var len = doneList.length;
+                for (var i = 0; i < len; i++) {
+                    doneList[i].call(this);
+                }
+            }
+        };
+        Animator.prototype._abortedCallback = function () {
+            this._setTracksFinished();
+            var animation = this.animation;
+            var abortedList = this._abortedCbs;
+            if (animation) {
+                animation.removeClip(this._clip);
+            }
+            this._clip = null;
+            if (abortedList) {
+                for (var i = 0; i < abortedList.length; i++) {
+                    abortedList[i].call(this);
+                }
+            }
+        };
+        Animator.prototype._setTracksFinished = function () {
+            var tracks = this._tracks;
+            var tracksKeys = this._trackKeys;
+            for (var i = 0; i < tracksKeys.length; i++) {
+                tracks[tracksKeys[i]].setFinished();
+            }
+        };
+        Animator.prototype._getAdditiveTrack = function (trackName) {
+            var additiveTrack;
+            var additiveAnimators = this._additiveAnimators;
+            if (additiveAnimators) {
+                for (var i = 0; i < additiveAnimators.length; i++) {
+                    var track = additiveAnimators[i].getTrack(trackName);
+                    if (track) {
+                        additiveTrack = track;
+                    }
+                }
+            }
+            return additiveTrack;
+        };
+        Animator.prototype.start = function (easing) {
+            if (this._started > 0) {
+                return;
+            }
+            this._started = 1;
+            var self = this;
+            var tracks = [];
+            var maxTime = this._maxTime || 0;
+            for (var i = 0; i < this._trackKeys.length; i++) {
+                var propName = this._trackKeys[i];
+                var track = this._tracks[propName];
+                var additiveTrack = this._getAdditiveTrack(propName);
+                var kfs = track.keyframes;
+                var kfsNum = kfs.length;
+                track.prepare(maxTime, additiveTrack);
+                if (track.needsAnimate()) {
+                    if (!this._allowDiscrete && track.discrete) {
+                        var lastKf = kfs[kfsNum - 1];
+                        if (lastKf) {
+                            self._target[track.propName] = lastKf.rawValue;
+                        }
+                        track.setFinished();
+                    }
+                    else {
+                        tracks.push(track);
+                    }
+                }
+            }
+            if (tracks.length || this._force) {
+                var clip = new Clip({
+                    life: maxTime,
+                    loop: this._loop,
+                    delay: this._delay || 0,
+                    onframe: function (percent) {
+                        self._started = 2;
+                        var additiveAnimators = self._additiveAnimators;
+                        if (additiveAnimators) {
+                            var stillHasAdditiveAnimator = false;
+                            for (var i = 0; i < additiveAnimators.length; i++) {
+                                if (additiveAnimators[i]._clip) {
+                                    stillHasAdditiveAnimator = true;
+                                    break;
+                                }
+                            }
+                            if (!stillHasAdditiveAnimator) {
+                                self._additiveAnimators = null;
+                            }
+                        }
+                        for (var i = 0; i < tracks.length; i++) {
+                            tracks[i].step(self._target, percent);
+                        }
+                        var onframeList = self._onframeCbs;
+                        if (onframeList) {
+                            for (var i = 0; i < onframeList.length; i++) {
+                                onframeList[i](self._target, percent);
+                            }
+                        }
+                    },
+                    ondestroy: function () {
+                        self._doneCallback();
+                    }
+                });
+                this._clip = clip;
+                if (this.animation) {
+                    this.animation.addClip(clip);
+                }
+                if (easing) {
+                    clip.setEasing(easing);
+                }
+            }
+            else {
+                this._doneCallback();
+            }
+            return this;
+        };
+        Animator.prototype.stop = function (forwardToLast) {
+            if (!this._clip) {
+                return;
+            }
+            var clip = this._clip;
+            if (forwardToLast) {
+                clip.onframe(1);
+            }
+            this._abortedCallback();
+        };
+        Animator.prototype.delay = function (time) {
+            this._delay = time;
+            return this;
+        };
+        Animator.prototype.during = function (cb) {
+            if (cb) {
+                if (!this._onframeCbs) {
+                    this._onframeCbs = [];
+                }
+                this._onframeCbs.push(cb);
+            }
+            return this;
+        };
+        Animator.prototype.done = function (cb) {
+            if (cb) {
+                if (!this._doneCbs) {
+                    this._doneCbs = [];
+                }
+                this._doneCbs.push(cb);
+            }
+            return this;
+        };
+        Animator.prototype.aborted = function (cb) {
+            if (cb) {
+                if (!this._abortedCbs) {
+                    this._abortedCbs = [];
+                }
+                this._abortedCbs.push(cb);
+            }
+            return this;
+        };
+        Animator.prototype.getClip = function () {
+            return this._clip;
+        };
+        Animator.prototype.getTrack = function (propName) {
+            return this._tracks[propName];
+        };
+        Animator.prototype.getTracks = function () {
+            var _this = this;
+            return map(this._trackKeys, function (key) { return _this._tracks[key]; });
+        };
+        Animator.prototype.stopTracks = function (propNames, forwardToLast) {
+            if (!propNames.length || !this._clip) {
+                return true;
+            }
+            var tracks = this._tracks;
+            var tracksKeys = this._trackKeys;
+            for (var i = 0; i < propNames.length; i++) {
+                var track = tracks[propNames[i]];
+                if (track && !track.isFinished()) {
+                    if (forwardToLast) {
+                        track.step(this._target, 1);
+                    }
+                    else if (this._started === 1) {
+                        track.step(this._target, 0);
+                    }
+                    track.setFinished();
+                }
+            }
+            var allAborted = true;
+            for (var i = 0; i < tracksKeys.length; i++) {
+                if (!tracks[tracksKeys[i]].isFinished()) {
+                    allAborted = false;
+                    break;
+                }
+            }
+            if (allAborted) {
+                this._abortedCallback();
+            }
+            return allAborted;
+        };
+        Animator.prototype.saveTo = function (target, trackKeys, firstOrLast) {
+            if (!target) {
+                return;
+            }
+            trackKeys = trackKeys || this._trackKeys;
+            for (var i = 0; i < trackKeys.length; i++) {
+                var propName = trackKeys[i];
+                var track = this._tracks[propName];
+                if (!track || track.isFinished()) {
+                    continue;
+                }
+                var kfs = track.keyframes;
+                var kf = kfs[firstOrLast ? 0 : kfs.length - 1];
+                if (kf) {
+                    target[propName] = cloneValue(kf.rawValue);
+                }
+            }
+        };
+        Animator.prototype.__changeFinalValue = function (finalProps, trackKeys) {
+            trackKeys = trackKeys || keys(finalProps);
+            for (var i = 0; i < trackKeys.length; i++) {
+                var propName = trackKeys[i];
+                var track = this._tracks[propName];
+                if (!track) {
+                    continue;
+                }
+                var kfs = track.keyframes;
+                if (kfs.length > 1) {
+                    var lastKf = kfs.pop();
+                    track.addKeyframe(lastKf.time, finalProps[propName]);
+                    track.prepare(this._maxTime, track.getAdditiveTrack());
+                }
+            }
+        };
+        return Animator;
+    }());
+
+    function getTime() {
+        return new Date().getTime();
+    }
+    var Animation = (function (_super) {
+        __extends(Animation, _super);
+        function Animation(opts) {
+            var _this = _super.call(this) || this;
+            _this._running = false;
+            _this._time = 0;
+            _this._pausedTime = 0;
+            _this._pauseStart = 0;
+            _this._paused = false;
+            opts = opts || {};
+            _this.stage = opts.stage || {};
+            return _this;
+        }
+        Animation.prototype.addClip = function (clip) {
+            if (clip.animation) {
+                this.removeClip(clip);
+            }
+            if (!this._head) {
+                this._head = this._tail = clip;
+            }
+            else {
+                this._tail.next = clip;
+                clip.prev = this._tail;
+                clip.next = null;
+                this._tail = clip;
+            }
+            clip.animation = this;
+        };
+        Animation.prototype.addAnimator = function (animator) {
+            animator.animation = this;
+            var clip = animator.getClip();
+            if (clip) {
+                this.addClip(clip);
+            }
+        };
+        Animation.prototype.removeClip = function (clip) {
+            if (!clip.animation) {
+                return;
+            }
+            var prev = clip.prev;
+            var next = clip.next;
+            if (prev) {
+                prev.next = next;
+            }
+            else {
+                this._head = next;
+            }
+            if (next) {
+                next.prev = prev;
+            }
+            else {
+                this._tail = prev;
+            }
+            clip.next = clip.prev = clip.animation = null;
+        };
+        Animation.prototype.removeAnimator = function (animator) {
+            var clip = animator.getClip();
+            if (clip) {
+                this.removeClip(clip);
+            }
+            animator.animation = null;
+        };
+        Animation.prototype.update = function (notTriggerFrameAndStageUpdate) {
+            var time = getTime() - this._pausedTime;
+            var delta = time - this._time;
+            var clip = this._head;
+            while (clip) {
+                var nextClip = clip.next;
+                var finished = clip.step(time, delta);
+                if (finished) {
+                    clip.ondestroy();
+                    this.removeClip(clip);
+                    clip = nextClip;
+                }
+                else {
+                    clip = nextClip;
+                }
+            }
+            this._time = time;
+            if (!notTriggerFrameAndStageUpdate) {
+                this.trigger('frame', delta);
+                this.stage.update && this.stage.update();
+            }
+        };
+        Animation.prototype._startLoop = function () {
+            var self = this;
+            this._running = true;
+            function step() {
+                if (self._running) {
+                    requestAnimationFrame$1(step);
+                    !self._paused && self.update();
+                }
+            }
+            requestAnimationFrame$1(step);
+        };
+        Animation.prototype.start = function () {
+            if (this._running) {
+                return;
+            }
+            this._time = getTime();
+            this._pausedTime = 0;
+            this._startLoop();
+        };
+        Animation.prototype.stop = function () {
+            this._running = false;
+        };
+        Animation.prototype.pause = function () {
+            if (!this._paused) {
+                this._pauseStart = getTime();
+                this._paused = true;
+            }
+        };
+        Animation.prototype.resume = function () {
+            if (this._paused) {
+                this._pausedTime += getTime() - this._pauseStart;
+                this._paused = false;
+            }
+        };
+        Animation.prototype.clear = function () {
+            var clip = this._head;
+            while (clip) {
+                var nextClip = clip.next;
+                clip.prev = clip.next = clip.animation = null;
+                clip = nextClip;
+            }
+            this._head = this._tail = null;
+        };
+        Animation.prototype.isFinished = function () {
+            return this._head == null;
+        };
+        Animation.prototype.animate = function (target, options) {
+            options = options || {};
+            this.start();
+            var animator = new Animator(target, options.loop);
+            this.addAnimator(animator);
+            return animator;
+        };
+        return Animation;
+    }(Eventful));
+
+    var TOUCH_CLICK_DELAY = 300;
+    var globalEventSupported = env.domSupported;
+    var localNativeListenerNames = (function () {
+        var mouseHandlerNames = [
+            'click', 'dblclick', 'mousewheel', 'wheel', 'mouseout',
+            'mouseup', 'mousedown', 'mousemove', 'contextmenu'
+        ];
+        var touchHandlerNames = [
+            'touchstart', 'touchend', 'touchmove'
+        ];
+        var pointerEventNameMap = {
+            pointerdown: 1, pointerup: 1, pointermove: 1, pointerout: 1
+        };
+        var pointerHandlerNames = map(mouseHandlerNames, function (name) {
+            var nm = name.replace('mouse', 'pointer');
+            return pointerEventNameMap.hasOwnProperty(nm) ? nm : name;
+        });
+        return {
+            mouse: mouseHandlerNames,
+            touch: touchHandlerNames,
+            pointer: pointerHandlerNames
+        };
+    })();
+    var globalNativeListenerNames = {
+        mouse: ['mousemove', 'mouseup'],
+        pointer: ['pointermove', 'pointerup']
+    };
+    var wheelEventSupported = false;
+    function isPointerFromTouch(event) {
+        var pointerType = event.pointerType;
+        return pointerType === 'pen' || pointerType === 'touch';
+    }
+    function setTouchTimer(scope) {
+        scope.touching = true;
+        if (scope.touchTimer != null) {
+            clearTimeout(scope.touchTimer);
+            scope.touchTimer = null;
+        }
+        scope.touchTimer = setTimeout(function () {
+            scope.touching = false;
+            scope.touchTimer = null;
+        }, 700);
+    }
+    function markTouch(event) {
+        event && (event.zrByTouch = true);
+    }
+    function normalizeGlobalEvent(instance, event) {
+        return normalizeEvent(instance.dom, new FakeGlobalEvent(instance, event), true);
+    }
+    function isLocalEl(instance, el) {
+        var elTmp = el;
+        var isLocal = false;
+        while (elTmp && elTmp.nodeType !== 9
+            && !(isLocal = elTmp.domBelongToZr
+                || (elTmp !== el && elTmp === instance.painterRoot))) {
+            elTmp = elTmp.parentNode;
+        }
+        return isLocal;
+    }
+    var FakeGlobalEvent = (function () {
+        function FakeGlobalEvent(instance, event) {
+            this.stopPropagation = noop;
+            this.stopImmediatePropagation = noop;
+            this.preventDefault = noop;
+            this.type = event.type;
+            this.target = this.currentTarget = instance.dom;
+            this.pointerType = event.pointerType;
+            this.clientX = event.clientX;
+            this.clientY = event.clientY;
+        }
+        return FakeGlobalEvent;
+    }());
+    var localDOMHandlers = {
+        mousedown: function (event) {
+            event = normalizeEvent(this.dom, event);
+            this.__mayPointerCapture = [event.zrX, event.zrY];
+            this.trigger('mousedown', event);
+        },
+        mousemove: function (event) {
+            event = normalizeEvent(this.dom, event);
+            var downPoint = this.__mayPointerCapture;
+            if (downPoint && (event.zrX !== downPoint[0] || event.zrY !== downPoint[1])) {
+                this.__togglePointerCapture(true);
+            }
+            this.trigger('mousemove', event);
+        },
+        mouseup: function (event) {
+            event = normalizeEvent(this.dom, event);
+            this.__togglePointerCapture(false);
+            this.trigger('mouseup', event);
+        },
+        mouseout: function (event) {
+            event = normalizeEvent(this.dom, event);
+            var element = event.toElement || event.relatedTarget;
+            if (!isLocalEl(this, element)) {
+                if (this.__pointerCapturing) {
+                    event.zrEventControl = 'no_globalout';
+                }
+                this.trigger('mouseout', event);
+            }
+        },
+        wheel: function (event) {
+            wheelEventSupported = true;
+            event = normalizeEvent(this.dom, event);
+            this.trigger('mousewheel', event);
+        },
+        mousewheel: function (event) {
+            if (wheelEventSupported) {
+                return;
+            }
+            event = normalizeEvent(this.dom, event);
+            this.trigger('mousewheel', event);
+        },
+        touchstart: function (event) {
+            event = normalizeEvent(this.dom, event);
+            markTouch(event);
+            this.__lastTouchMoment = new Date();
+            this.handler.processGesture(event, 'start');
+            localDOMHandlers.mousemove.call(this, event);
+            localDOMHandlers.mousedown.call(this, event);
+        },
+        touchmove: function (event) {
+            event = normalizeEvent(this.dom, event);
+            markTouch(event);
+            this.handler.processGesture(event, 'change');
+            localDOMHandlers.mousemove.call(this, event);
+        },
+        touchend: function (event) {
+            event = normalizeEvent(this.dom, event);
+            markTouch(event);
+            this.handler.processGesture(event, 'end');
+            localDOMHandlers.mouseup.call(this, event);
+            if (+new Date() - (+this.__lastTouchMoment) < TOUCH_CLICK_DELAY) {
+                localDOMHandlers.click.call(this, event);
+            }
+        },
+        pointerdown: function (event) {
+            localDOMHandlers.mousedown.call(this, event);
+        },
+        pointermove: function (event) {
+            if (!isPointerFromTouch(event)) {
+                localDOMHandlers.mousemove.call(this, event);
+            }
+        },
+        pointerup: function (event) {
+            localDOMHandlers.mouseup.call(this, event);
+        },
+        pointerout: function (event) {
+            if (!isPointerFromTouch(event)) {
+                localDOMHandlers.mouseout.call(this, event);
+            }
+        }
+    };
+    each(['click', 'dblclick', 'contextmenu'], function (name) {
+        localDOMHandlers[name] = function (event) {
+            event = normalizeEvent(this.dom, event);
+            this.trigger(name, event);
+        };
+    });
+    var globalDOMHandlers = {
+        pointermove: function (event) {
+            if (!isPointerFromTouch(event)) {
+                globalDOMHandlers.mousemove.call(this, event);
+            }
+        },
+        pointerup: function (event) {
+            globalDOMHandlers.mouseup.call(this, event);
+        },
+        mousemove: function (event) {
+            this.trigger('mousemove', event);
+        },
+        mouseup: function (event) {
+            var pointerCaptureReleasing = this.__pointerCapturing;
+            this.__togglePointerCapture(false);
+            this.trigger('mouseup', event);
+            if (pointerCaptureReleasing) {
+                event.zrEventControl = 'only_globalout';
+                this.trigger('mouseout', event);
+            }
+        }
+    };
+    function mountLocalDOMEventListeners(instance, scope) {
+        var domHandlers = scope.domHandlers;
+        if (env.pointerEventsSupported) {
+            each(localNativeListenerNames.pointer, function (nativeEventName) {
+                mountSingleDOMEventListener(scope, nativeEventName, function (event) {
+                    domHandlers[nativeEventName].call(instance, event);
+                });
+            });
+        }
+        else {
+            if (env.touchEventsSupported) {
+                each(localNativeListenerNames.touch, function (nativeEventName) {
+                    mountSingleDOMEventListener(scope, nativeEventName, function (event) {
+                        domHandlers[nativeEventName].call(instance, event);
+                        setTouchTimer(scope);
+                    });
+                });
+            }
+            each(localNativeListenerNames.mouse, function (nativeEventName) {
+                mountSingleDOMEventListener(scope, nativeEventName, function (event) {
+                    event = getNativeEvent(event);
+                    if (!scope.touching) {
+                        domHandlers[nativeEventName].call(instance, event);
+                    }
+                });
+            });
+        }
+    }
+    function mountGlobalDOMEventListeners(instance, scope) {
+        if (env.pointerEventsSupported) {
+            each(globalNativeListenerNames.pointer, mount);
+        }
+        else if (!env.touchEventsSupported) {
+            each(globalNativeListenerNames.mouse, mount);
+        }
+        function mount(nativeEventName) {
+            function nativeEventListener(event) {
+                event = getNativeEvent(event);
+                if (!isLocalEl(instance, event.target)) {
+                    event = normalizeGlobalEvent(instance, event);
+                    scope.domHandlers[nativeEventName].call(instance, event);
+                }
+            }
+            mountSingleDOMEventListener(scope, nativeEventName, nativeEventListener, { capture: true });
+        }
+    }
+    function mountSingleDOMEventListener(scope, nativeEventName, listener, opt) {
+        scope.mounted[nativeEventName] = listener;
+        scope.listenerOpts[nativeEventName] = opt;
+        addEventListener(scope.domTarget, nativeEventName, listener, opt);
+    }
+    function unmountDOMEventListeners(scope) {
+        var mounted = scope.mounted;
+        for (var nativeEventName in mounted) {
+            if (mounted.hasOwnProperty(nativeEventName)) {
+                removeEventListener(scope.domTarget, nativeEventName, mounted[nativeEventName], scope.listenerOpts[nativeEventName]);
+            }
+        }
+        scope.mounted = {};
+    }
+    var DOMHandlerScope = (function () {
+        function DOMHandlerScope(domTarget, domHandlers) {
+            this.mounted = {};
+            this.listenerOpts = {};
+            this.touching = false;
+            this.domTarget = domTarget;
+            this.domHandlers = domHandlers;
+        }
+        return DOMHandlerScope;
+    }());
+    var HandlerDomProxy = (function (_super) {
+        __extends(HandlerDomProxy, _super);
+        function HandlerDomProxy(dom, painterRoot) {
+            var _this = _super.call(this) || this;
+            _this.__pointerCapturing = false;
+            _this.dom = dom;
+            _this.painterRoot = painterRoot;
+            _this._localHandlerScope = new DOMHandlerScope(dom, localDOMHandlers);
+            if (globalEventSupported) {
+                _this._globalHandlerScope = new DOMHandlerScope(document, globalDOMHandlers);
+            }
+            mountLocalDOMEventListeners(_this, _this._localHandlerScope);
+            return _this;
+        }
+        HandlerDomProxy.prototype.dispose = function () {
+            unmountDOMEventListeners(this._localHandlerScope);
+            if (globalEventSupported) {
+                unmountDOMEventListeners(this._globalHandlerScope);
+            }
+        };
+        HandlerDomProxy.prototype.setCursor = function (cursorStyle) {
+            this.dom.style && (this.dom.style.cursor = cursorStyle || 'default');
+        };
+        HandlerDomProxy.prototype.__togglePointerCapture = function (isPointerCapturing) {
+            this.__mayPointerCapture = null;
+            if (globalEventSupported
+                && ((+this.__pointerCapturing) ^ (+isPointerCapturing))) {
+                this.__pointerCapturing = isPointerCapturing;
+                var globalHandlerScope = this._globalHandlerScope;
+                isPointerCapturing
+                    ? mountGlobalDOMEventListeners(this, globalHandlerScope)
+                    : unmountDOMEventListeners(globalHandlerScope);
+            }
+        };
+        return HandlerDomProxy;
+    }(Eventful));
+
+    var dpr = 1;
+    if (env.hasGlobalWindow) {
+        dpr = Math.max(window.devicePixelRatio
+            || (window.screen && window.screen.deviceXDPI / window.screen.logicalXDPI)
+            || 1, 1);
+    }
+    var devicePixelRatio = dpr;
+    var DARK_MODE_THRESHOLD = 0.4;
+    var DARK_LABEL_COLOR = '#333';
+    var LIGHT_LABEL_COLOR = '#ccc';
+    var LIGHTER_LABEL_COLOR = '#eee';
+
+    var mIdentity = identity;
+    var EPSILON$2 = 5e-5;
+    function isNotAroundZero$1(val) {
+        return val > EPSILON$2 || val < -EPSILON$2;
+    }
+    var scaleTmp = [];
+    var tmpTransform = [];
+    var originTransform = create$1();
+    var abs = Math.abs;
+    var Transformable = (function () {
+        function Transformable() {
+        }
+        Transformable.prototype.getLocalTransform = function (m) {
+            return Transformable.getLocalTransform(this, m);
+        };
+        Transformable.prototype.setPosition = function (arr) {
+            this.x = arr[0];
+            this.y = arr[1];
+        };
+        Transformable.prototype.setScale = function (arr) {
+            this.scaleX = arr[0];
+            this.scaleY = arr[1];
+        };
+        Transformable.prototype.setSkew = function (arr) {
+            this.skewX = arr[0];
+            this.skewY = arr[1];
+        };
+        Transformable.prototype.setOrigin = function (arr) {
+            this.originX = arr[0];
+            this.originY = arr[1];
+        };
+        Transformable.prototype.needLocalTransform = function () {
+            return isNotAroundZero$1(this.rotation)
+                || isNotAroundZero$1(this.x)
+                || isNotAroundZero$1(this.y)
+                || isNotAroundZero$1(this.scaleX - 1)
+                || isNotAroundZero$1(this.scaleY - 1)
+                || isNotAroundZero$1(this.skewX)
+                || isNotAroundZero$1(this.skewY);
+        };
+        Transformable.prototype.updateTransform = function () {
+            var parentTransform = this.parent && this.parent.transform;
+            var needLocalTransform = this.needLocalTransform();
+            var m = this.transform;
+            if (!(needLocalTransform || parentTransform)) {
+                if (m) {
+                    mIdentity(m);
+                    this.invTransform = null;
+                }
+                return;
+            }
+            m = m || create$1();
+            if (needLocalTransform) {
+                this.getLocalTransform(m);
+            }
+            else {
+                mIdentity(m);
+            }
+            if (parentTransform) {
+                if (needLocalTransform) {
+                    mul$1(m, parentTransform, m);
+                }
+                else {
+                    copy$1(m, parentTransform);
+                }
+            }
+            this.transform = m;
+            this._resolveGlobalScaleRatio(m);
+        };
+        Transformable.prototype._resolveGlobalScaleRatio = function (m) {
+            var globalScaleRatio = this.globalScaleRatio;
+            if (globalScaleRatio != null && globalScaleRatio !== 1) {
+                this.getGlobalScale(scaleTmp);
+                var relX = scaleTmp[0] < 0 ? -1 : 1;
+                var relY = scaleTmp[1] < 0 ? -1 : 1;
+                var sx = ((scaleTmp[0] - relX) * globalScaleRatio + relX) / scaleTmp[0] || 0;
+                var sy = ((scaleTmp[1] - relY) * globalScaleRatio + relY) / scaleTmp[1] || 0;
+                m[0] *= sx;
+                m[1] *= sx;
+                m[2] *= sy;
+                m[3] *= sy;
+            }
+            this.invTransform = this.invTransform || create$1();
+            invert(this.invTransform, m);
+        };
+        Transformable.prototype.getComputedTransform = function () {
+            var transformNode = this;
+            var ancestors = [];
+            while (transformNode) {
+                ancestors.push(transformNode);
+                transformNode = transformNode.parent;
+            }
+            while (transformNode = ancestors.pop()) {
+                transformNode.updateTransform();
+            }
+            return this.transform;
+        };
+        Transformable.prototype.setLocalTransform = function (m) {
+            if (!m) {
+                return;
+            }
+            var sx = m[0] * m[0] + m[1] * m[1];
+            var sy = m[2] * m[2] + m[3] * m[3];
+            var rotation = Math.atan2(m[1], m[0]);
+            var shearX = Math.PI / 2 + rotation - Math.atan2(m[3], m[2]);
+            sy = Math.sqrt(sy) * Math.cos(shearX);
+            sx = Math.sqrt(sx);
+            this.skewX = shearX;
+            this.skewY = 0;
+            this.rotation = -rotation;
+            this.x = +m[4];
+            this.y = +m[5];
+            this.scaleX = sx;
+            this.scaleY = sy;
+            this.originX = 0;
+            this.originY = 0;
+        };
+        Transformable.prototype.decomposeTransform = function () {
+            if (!this.transform) {
+                return;
+            }
+            var parent = this.parent;
+            var m = this.transform;
+            if (parent && parent.transform) {
+                parent.invTransform = parent.invTransform || create$1();
+                mul$1(tmpTransform, parent.invTransform, m);
+                m = tmpTransform;
+            }
+            var ox = this.originX;
+            var oy = this.originY;
+            if (ox || oy) {
+                originTransform[4] = ox;
+                originTransform[5] = oy;
+                mul$1(tmpTransform, m, originTransform);
+                tmpTransform[4] -= ox;
+                tmpTransform[5] -= oy;
+                m = tmpTransform;
+            }
+            this.setLocalTransform(m);
+        };
+        Transformable.prototype.getGlobalScale = function (out) {
+            var m = this.transform;
+            out = out || [];
+            if (!m) {
+                out[0] = 1;
+                out[1] = 1;
+                return out;
+            }
+            out[0] = Math.sqrt(m[0] * m[0] + m[1] * m[1]);
+            out[1] = Math.sqrt(m[2] * m[2] + m[3] * m[3]);
+            if (m[0] < 0) {
+                out[0] = -out[0];
+            }
+            if (m[3] < 0) {
+                out[1] = -out[1];
+            }
+            return out;
+        };
+        Transformable.prototype.transformCoordToLocal = function (x, y) {
+            var v2 = [x, y];
+            var invTransform = this.invTransform;
+            if (invTransform) {
+                applyTransform(v2, v2, invTransform);
+            }
+            return v2;
+        };
+        Transformable.prototype.transformCoordToGlobal = function (x, y) {
+            var v2 = [x, y];
+            var transform = this.transform;
+            if (transform) {
+                applyTransform(v2, v2, transform);
+            }
+            return v2;
+        };
+        Transformable.prototype.getLineScale = function () {
+            var m = this.transform;
+            return m && abs(m[0] - 1) > 1e-10 && abs(m[3] - 1) > 1e-10
+                ? Math.sqrt(abs(m[0] * m[3] - m[2] * m[1]))
+                : 1;
+        };
+        Transformable.prototype.copyTransform = function (source) {
+            copyTransform(this, source);
+        };
+        Transformable.getLocalTransform = function (target, m) {
+            m = m || [];
+            var ox = target.originX || 0;
+            var oy = target.originY || 0;
+            var sx = target.scaleX;
+            var sy = target.scaleY;
+            var ax = target.anchorX;
+            var ay = target.anchorY;
+            var rotation = target.rotation || 0;
+            var x = target.x;
+            var y = target.y;
+            var skewX = target.skewX ? Math.tan(target.skewX) : 0;
+            var skewY = target.skewY ? Math.tan(-target.skewY) : 0;
+            if (ox || oy || ax || ay) {
+                var dx = ox + ax;
+                var dy = oy + ay;
+                m[4] = -dx * sx - skewX * dy * sy;
+                m[5] = -dy * sy - skewY * dx * sx;
+            }
+            else {
+                m[4] = m[5] = 0;
+            }
+            m[0] = sx;
+            m[3] = sy;
+            m[1] = skewY * sx;
+            m[2] = skewX * sy;
+            rotation && rotate(m, m, rotation);
+            m[4] += ox + x;
+            m[5] += oy + y;
+            return m;
+        };
+        Transformable.initDefaultProps = (function () {
+            var proto = Transformable.prototype;
+            proto.scaleX =
+                proto.scaleY =
+                    proto.globalScaleRatio = 1;
+            proto.x =
+                proto.y =
+                    proto.originX =
+                        proto.originY =
+                            proto.skewX =
+                                proto.skewY =
+                                    proto.rotation =
+                                        proto.anchorX =
+                                            proto.anchorY = 0;
+        })();
+        return Transformable;
+    }());
+    var TRANSFORMABLE_PROPS = [
+        'x', 'y', 'originX', 'originY', 'anchorX', 'anchorY', 'rotation', 'scaleX', 'scaleY', 'skewX', 'skewY'
+    ];
+    function copyTransform(target, source) {
+        for (var i = 0; i < TRANSFORMABLE_PROPS.length; i++) {
+            var propName = TRANSFORMABLE_PROPS[i];
+            target[propName] = source[propName];
+        }
+    }
+
+    var textWidthCache = {};
+    function getWidth(text, font) {
+        font = font || DEFAULT_FONT;
+        var cacheOfFont = textWidthCache[font];
+        if (!cacheOfFont) {
+            cacheOfFont = textWidthCache[font] = new LRU(500);
+        }
+        var width = cacheOfFont.get(text);
+        if (width == null) {
+            width = platformApi.measureText(text, font).width;
+            cacheOfFont.put(text, width);
+        }
+        return width;
+    }
+    function innerGetBoundingRect(text, font, textAlign, textBaseline) {
+        var width = getWidth(text, font);
+        var height = getLineHeight(font);
+        var x = adjustTextX(0, width, textAlign);
+        var y = adjustTextY$1(0, height, textBaseline);
+        var rect = new BoundingRect(x, y, width, height);
+        return rect;
+    }
+    function getBoundingRect(text, font, textAlign, textBaseline) {
+        var textLines = ((text || '') + '').split('\n');
+        var len = textLines.length;
+        if (len === 1) {
+            return innerGetBoundingRect(textLines[0], font, textAlign, textBaseline);
+        }
+        else {
+            var uniondRect = new BoundingRect(0, 0, 0, 0);
+            for (var i = 0; i < textLines.length; i++) {
+                var rect = innerGetBoundingRect(textLines[i], font, textAlign, textBaseline);
+                i === 0 ? uniondRect.copy(rect) : uniondRect.union(rect);
+            }
+            return uniondRect;
+        }
+    }
+    function adjustTextX(x, width, textAlign) {
+        if (textAlign === 'right') {
+            x -= width;
+        }
+        else if (textAlign === 'center') {
+            x -= width / 2;
+        }
+        return x;
+    }
+    function adjustTextY$1(y, height, verticalAlign) {
+        if (verticalAlign === 'middle') {
+            y -= height / 2;
+        }
+        else if (verticalAlign === 'bottom') {
+            y -= height;
+        }
+        return y;
+    }
+    function getLineHeight(font) {
+        return getWidth('国', font);
+    }
+    function parsePercent(value, maxValue) {
+        if (typeof value === 'string') {
+            if (value.lastIndexOf('%') >= 0) {
+                return parseFloat(value) / 100 * maxValue;
+            }
+            return parseFloat(value);
+        }
+        return value;
+    }
+    function calculateTextPosition(out, opts, rect) {
+        var textPosition = opts.position || 'inside';
+        var distance = opts.distance != null ? opts.distance : 5;
+        var height = rect.height;
+        var width = rect.width;
+        var halfHeight = height / 2;
+        var x = rect.x;
+        var y = rect.y;
+        var textAlign = 'left';
+        var textVerticalAlign = 'top';
+        if (textPosition instanceof Array) {
+            x += parsePercent(textPosition[0], rect.width);
+            y += parsePercent(textPosition[1], rect.height);
+            textAlign = null;
+            textVerticalAlign = null;
+        }
+        else {
+            switch (textPosition) {
+                case 'left':
+                    x -= distance;
+                    y += halfHeight;
+                    textAlign = 'right';
+                    textVerticalAlign = 'middle';
+                    break;
+                case 'right':
+                    x += distance + width;
+                    y += halfHeight;
+                    textVerticalAlign = 'middle';
+                    break;
+                case 'top':
+                    x += width / 2;
+                    y -= distance;
+                    textAlign = 'center';
+                    textVerticalAlign = 'bottom';
+                    break;
+                case 'bottom':
+                    x += width / 2;
+                    y += height + distance;
+                    textAlign = 'center';
+                    break;
+                case 'inside':
+                    x += width / 2;
+                    y += halfHeight;
+                    textAlign = 'center';
+                    textVerticalAlign = 'middle';
+                    break;
+                case 'insideLeft':
+                    x += distance;
+                    y += halfHeight;
+                    textVerticalAlign = 'middle';
+                    break;
+                case 'insideRight':
+                    x += width - distance;
+                    y += halfHeight;
+                    textAlign = 'right';
+                    textVerticalAlign = 'middle';
+                    break;
+                case 'insideTop':
+                    x += width / 2;
+                    y += distance;
+                    textAlign = 'center';
+                    break;
+                case 'insideBottom':
+                    x += width / 2;
+                    y += height - distance;
+                    textAlign = 'center';
+                    textVerticalAlign = 'bottom';
+                    break;
+                case 'insideTopLeft':
+                    x += distance;
+                    y += distance;
+                    break;
+                case 'insideTopRight':
+                    x += width - distance;
+                    y += distance;
+                    textAlign = 'right';
+                    break;
+                case 'insideBottomLeft':
+                    x += distance;
+                    y += height - distance;
+                    textVerticalAlign = 'bottom';
+                    break;
+                case 'insideBottomRight':
+                    x += width - distance;
+                    y += height - distance;
+                    textAlign = 'right';
+                    textVerticalAlign = 'bottom';
+                    break;
+            }
+        }
+        out = out || {};
+        out.x = x;
+        out.y = y;
+        out.align = textAlign;
+        out.verticalAlign = textVerticalAlign;
+        return out;
+    }
+
+    var PRESERVED_NORMAL_STATE = '__zr_normal__';
+    var PRIMARY_STATES_KEYS = TRANSFORMABLE_PROPS.concat(['ignore']);
+    var DEFAULT_ANIMATABLE_MAP = reduce(TRANSFORMABLE_PROPS, function (obj, key) {
+        obj[key] = true;
+        return obj;
+    }, { ignore: false });
+    var tmpTextPosCalcRes = {};
+    var tmpBoundingRect = new BoundingRect(0, 0, 0, 0);
+    var Element = (function () {
+        function Element(props) {
+            this.id = guid();
+            this.animators = [];
+            this.currentStates = [];
+            this.states = {};
+            this._init(props);
+        }
+        Element.prototype._init = function (props) {
+            this.attr(props);
+        };
+        Element.prototype.drift = function (dx, dy, e) {
+            switch (this.draggable) {
+                case 'horizontal':
+                    dy = 0;
+                    break;
+                case 'vertical':
+                    dx = 0;
+                    break;
+            }
+            var m = this.transform;
+            if (!m) {
+                m = this.transform = [1, 0, 0, 1, 0, 0];
+            }
+            m[4] += dx;
+            m[5] += dy;
+            this.decomposeTransform();
+            this.markRedraw();
+        };
+        Element.prototype.beforeUpdate = function () { };
+        Element.prototype.afterUpdate = function () { };
+        Element.prototype.update = function () {
+            this.updateTransform();
+            if (this.__dirty) {
+                this.updateInnerText();
+            }
+        };
+        Element.prototype.updateInnerText = function (forceUpdate) {
+            var textEl = this._textContent;
+            if (textEl && (!textEl.ignore || forceUpdate)) {
+                if (!this.textConfig) {
+                    this.textConfig = {};
+                }
+                var textConfig = this.textConfig;
+                var isLocal = textConfig.local;
+                var innerTransformable = textEl.innerTransformable;
+                var textAlign = void 0;
+                var textVerticalAlign = void 0;
+                var textStyleChanged = false;
+                innerTransformable.parent = isLocal ? this : null;
+                var innerOrigin = false;
+                innerTransformable.copyTransform(textEl);
+                if (textConfig.position != null) {
+                    var layoutRect = tmpBoundingRect;
+                    if (textConfig.layoutRect) {
+                        layoutRect.copy(textConfig.layoutRect);
+                    }
+                    else {
+                        layoutRect.copy(this.getBoundingRect());
+                    }
+                    if (!isLocal) {
+                        layoutRect.applyTransform(this.transform);
+                    }
+                    if (this.calculateTextPosition) {
+                        this.calculateTextPosition(tmpTextPosCalcRes, textConfig, layoutRect);
+                    }
+                    else {
+                        calculateTextPosition(tmpTextPosCalcRes, textConfig, layoutRect);
+                    }
+                    innerTransformable.x = tmpTextPosCalcRes.x;
+                    innerTransformable.y = tmpTextPosCalcRes.y;
+                    textAlign = tmpTextPosCalcRes.align;
+                    textVerticalAlign = tmpTextPosCalcRes.verticalAlign;
+                    var textOrigin = textConfig.origin;
+                    if (textOrigin && textConfig.rotation != null) {
+                        var relOriginX = void 0;
+                        var relOriginY = void 0;
+                        if (textOrigin === 'center') {
+                            relOriginX = layoutRect.width * 0.5;
+                            relOriginY = layoutRect.height * 0.5;
+                        }
+                        else {
+                            relOriginX = parsePercent(textOrigin[0], layoutRect.width);
+                            relOriginY = parsePercent(textOrigin[1], layoutRect.height);
+                        }
+                        innerOrigin = true;
+                        innerTransformable.originX = -innerTransformable.x + relOriginX + (isLocal ? 0 : layoutRect.x);
+                        innerTransformable.originY = -innerTransformable.y + relOriginY + (isLocal ? 0 : layoutRect.y);
+                    }
+                }
+                if (textConfig.rotation != null) {
+                    innerTransformable.rotation = textConfig.rotation;
+                }
+                var textOffset = textConfig.offset;
+                if (textOffset) {
+                    innerTransformable.x += textOffset[0];
+                    innerTransformable.y += textOffset[1];
+                    if (!innerOrigin) {
+                        innerTransformable.originX = -textOffset[0];
+                        innerTransformable.originY = -textOffset[1];
+                    }
+                }
+                var isInside = textConfig.inside == null
+                    ? (typeof textConfig.position === 'string' && textConfig.position.indexOf('inside') >= 0)
+                    : textConfig.inside;
+                var innerTextDefaultStyle = this._innerTextDefaultStyle || (this._innerTextDefaultStyle = {});
+                var textFill = void 0;
+                var textStroke = void 0;
+                var autoStroke = void 0;
+                if (isInside && this.canBeInsideText()) {
+                    textFill = textConfig.insideFill;
+                    textStroke = textConfig.insideStroke;
+                    if (textFill == null || textFill === 'auto') {
+                        textFill = this.getInsideTextFill();
+                    }
+                    if (textStroke == null || textStroke === 'auto') {
+                        textStroke = this.getInsideTextStroke(textFill);
+                        autoStroke = true;
+                    }
+                }
+                else {
+                    textFill = textConfig.outsideFill;
+                    textStroke = textConfig.outsideStroke;
+                    if (textFill == null || textFill === 'auto') {
+                        textFill = this.getOutsideFill();
+                    }
+                    if (textStroke == null || textStroke === 'auto') {
+                        textStroke = this.getOutsideStroke(textFill);
+                        autoStroke = true;
+                    }
+                }
+                textFill = textFill || '#000';
+                if (textFill !== innerTextDefaultStyle.fill
+                    || textStroke !== innerTextDefaultStyle.stroke
+                    || autoStroke !== innerTextDefaultStyle.autoStroke
+                    || textAlign !== innerTextDefaultStyle.align
+                    || textVerticalAlign !== innerTextDefaultStyle.verticalAlign) {
+                    textStyleChanged = true;
+                    innerTextDefaultStyle.fill = textFill;
+                    innerTextDefaultStyle.stroke = textStroke;
+                    innerTextDefaultStyle.autoStroke = autoStroke;
+                    innerTextDefaultStyle.align = textAlign;
+                    innerTextDefaultStyle.verticalAlign = textVerticalAlign;
+                    textEl.setDefaultTextStyle(innerTextDefaultStyle);
+                }
+                textEl.__dirty |= REDRAW_BIT;
+                if (textStyleChanged) {
+                    textEl.dirtyStyle(true);
+                }
+            }
+        };
+        Element.prototype.canBeInsideText = function () {
+            return true;
+        };
+        Element.prototype.getInsideTextFill = function () {
+            return '#fff';
+        };
+        Element.prototype.getInsideTextStroke = function (textFill) {
+            return '#000';
+        };
+        Element.prototype.getOutsideFill = function () {
+            return this.__zr && this.__zr.isDarkMode() ? LIGHT_LABEL_COLOR : DARK_LABEL_COLOR;
+        };
+        Element.prototype.getOutsideStroke = function (textFill) {
+            var backgroundColor = this.__zr && this.__zr.getBackgroundColor();
+            var colorArr = typeof backgroundColor === 'string' && parse(backgroundColor);
+            if (!colorArr) {
+                colorArr = [255, 255, 255, 1];
+            }
+            var alpha = colorArr[3];
+            var isDark = this.__zr.isDarkMode();
+            for (var i = 0; i < 3; i++) {
+                colorArr[i] = colorArr[i] * alpha + (isDark ? 0 : 255) * (1 - alpha);
+            }
+            colorArr[3] = 1;
+            return stringify(colorArr, 'rgba');
+        };
+        Element.prototype.traverse = function (cb, context) { };
+        Element.prototype.attrKV = function (key, value) {
+            if (key === 'textConfig') {
+                this.setTextConfig(value);
+            }
+            else if (key === 'textContent') {
+                this.setTextContent(value);
+            }
+            else if (key === 'clipPath') {
+                this.setClipPath(value);
+            }
+            else if (key === 'extra') {
+                this.extra = this.extra || {};
+                extend(this.extra, value);
+            }
+            else {
+                this[key] = value;
+            }
+        };
+        Element.prototype.hide = function () {
+            this.ignore = true;
+            this.markRedraw();
+        };
+        Element.prototype.show = function () {
+            this.ignore = false;
+            this.markRedraw();
+        };
+        Element.prototype.attr = function (keyOrObj, value) {
+            if (typeof keyOrObj === 'string') {
+                this.attrKV(keyOrObj, value);
+            }
+            else if (isObject(keyOrObj)) {
+                var obj = keyOrObj;
+                var keysArr = keys(obj);
+                for (var i = 0; i < keysArr.length; i++) {
+                    var key = keysArr[i];
+                    this.attrKV(key, keyOrObj[key]);
+                }
+            }
+            this.markRedraw();
+            return this;
+        };
+        Element.prototype.saveCurrentToNormalState = function (toState) {
+            this._innerSaveToNormal(toState);
+            var normalState = this._normalState;
+            for (var i = 0; i < this.animators.length; i++) {
+                var animator = this.animators[i];
+                var fromStateTransition = animator.__fromStateTransition;
+                if (animator.getLoop() || fromStateTransition && fromStateTransition !== PRESERVED_NORMAL_STATE) {
+                    continue;
+                }
+                var targetName = animator.targetName;
+                var target = targetName
+                    ? normalState[targetName] : normalState;
+                animator.saveTo(target);
+            }
+        };
+        Element.prototype._innerSaveToNormal = function (toState) {
+            var normalState = this._normalState;
+            if (!normalState) {
+                normalState = this._normalState = {};
+            }
+            if (toState.textConfig && !normalState.textConfig) {
+                normalState.textConfig = this.textConfig;
+            }
+            this._savePrimaryToNormal(toState, normalState, PRIMARY_STATES_KEYS);
+        };
+        Element.prototype._savePrimaryToNormal = function (toState, normalState, primaryKeys) {
+            for (var i = 0; i < primaryKeys.length; i++) {
+                var key = primaryKeys[i];
+                if (toState[key] != null && !(key in normalState)) {
+                    normalState[key] = this[key];
+                }
+            }
+        };
+        Element.prototype.hasState = function () {
+            return this.currentStates.length > 0;
+        };
+        Element.prototype.getState = function (name) {
+            return this.states[name];
+        };
+        Element.prototype.ensureState = function (name) {
+            var states = this.states;
+            if (!states[name]) {
+                states[name] = {};
+            }
+            return states[name];
+        };
+        Element.prototype.clearStates = function (noAnimation) {
+            this.useState(PRESERVED_NORMAL_STATE, false, noAnimation);
+        };
+        Element.prototype.useState = function (stateName, keepCurrentStates, noAnimation, forceUseHoverLayer) {
+            var toNormalState = stateName === PRESERVED_NORMAL_STATE;
+            var hasStates = this.hasState();
+            if (!hasStates && toNormalState) {
+                return;
+            }
+            var currentStates = this.currentStates;
+            var animationCfg = this.stateTransition;
+            if (indexOf(currentStates, stateName) >= 0 && (keepCurrentStates || currentStates.length === 1)) {
+                return;
+            }
+            var state;
+            if (this.stateProxy && !toNormalState) {
+                state = this.stateProxy(stateName);
+            }
+            if (!state) {
+                state = (this.states && this.states[stateName]);
+            }
+            if (!state && !toNormalState) {
+                logError("State " + stateName + " not exists.");
+                return;
+            }
+            if (!toNormalState) {
+                this.saveCurrentToNormalState(state);
+            }
+            var useHoverLayer = !!((state && state.hoverLayer) || forceUseHoverLayer);
+            if (useHoverLayer) {
+                this._toggleHoverLayerFlag(true);
+            }
+            this._applyStateObj(stateName, state, this._normalState, keepCurrentStates, !noAnimation && !this.__inHover && animationCfg && animationCfg.duration > 0, animationCfg);
+            var textContent = this._textContent;
+            var textGuide = this._textGuide;
+            if (textContent) {
+                textContent.useState(stateName, keepCurrentStates, noAnimation, useHoverLayer);
+            }
+            if (textGuide) {
+                textGuide.useState(stateName, keepCurrentStates, noAnimation, useHoverLayer);
+            }
+            if (toNormalState) {
+                this.currentStates = [];
+                this._normalState = {};
+            }
+            else {
+                if (!keepCurrentStates) {
+                    this.currentStates = [stateName];
+                }
+                else {
+                    this.currentStates.push(stateName);
+                }
+            }
+            this._updateAnimationTargets();
+            this.markRedraw();
+            if (!useHoverLayer && this.__inHover) {
+                this._toggleHoverLayerFlag(false);
+                this.__dirty &= ~REDRAW_BIT;
+            }
+            return state;
+        };
+        Element.prototype.useStates = function (states, noAnimation, forceUseHoverLayer) {
+            if (!states.length) {
+                this.clearStates();
+            }
+            else {
+                var stateObjects = [];
+                var currentStates = this.currentStates;
+                var len = states.length;
+                var notChange = len === currentStates.length;
+                if (notChange) {
+                    for (var i = 0; i < len; i++) {
+                        if (states[i] !== currentStates[i]) {
+                            notChange = false;
+                            break;
+                        }
+                    }
+                }
+                if (notChange) {
+                    return;
+                }
+                for (var i = 0; i < len; i++) {
+                    var stateName = states[i];
+                    var stateObj = void 0;
+                    if (this.stateProxy) {
+                        stateObj = this.stateProxy(stateName, states);
+                    }
+                    if (!stateObj) {
+                        stateObj = this.states[stateName];
+                    }
+                    if (stateObj) {
+                        stateObjects.push(stateObj);
+                    }
+                }
+                var lastStateObj = stateObjects[len - 1];
+                var useHoverLayer = !!((lastStateObj && lastStateObj.hoverLayer) || forceUseHoverLayer);
+                if (useHoverLayer) {
+                    this._toggleHoverLayerFlag(true);
+                }
+                var mergedState = this._mergeStates(stateObjects);
+                var animationCfg = this.stateTransition;
+                this.saveCurrentToNormalState(mergedState);
+                this._applyStateObj(states.join(','), mergedState, this._normalState, false, !noAnimation && !this.__inHover && animationCfg && animationCfg.duration > 0, animationCfg);
+                var textContent = this._textContent;
+                var textGuide = this._textGuide;
+                if (textContent) {
+                    textContent.useStates(states, noAnimation, useHoverLayer);
+                }
+                if (textGuide) {
+                    textGuide.useStates(states, noAnimation, useHoverLayer);
+                }
+                this._updateAnimationTargets();
+                this.currentStates = states.slice();
+                this.markRedraw();
+                if (!useHoverLayer && this.__inHover) {
+                    this._toggleHoverLayerFlag(false);
+                    this.__dirty &= ~REDRAW_BIT;
+                }
+            }
+        };
+        Element.prototype.isSilent = function () {
+            var isSilent = this.silent;
+            var ancestor = this.parent;
+            while (!isSilent && ancestor) {
+                if (ancestor.silent) {
+                    isSilent = true;
+                    break;
+                }
+                ancestor = ancestor.parent;
+            }
+            return isSilent;
+        };
+        Element.prototype._updateAnimationTargets = function () {
+            for (var i = 0; i < this.animators.length; i++) {
+                var animator = this.animators[i];
+                if (animator.targetName) {
+                    animator.changeTarget(this[animator.targetName]);
+                }
+            }
+        };
+        Element.prototype.removeState = function (state) {
+            var idx = indexOf(this.currentStates, state);
+            if (idx >= 0) {
+                var currentStates = this.currentStates.slice();
+                currentStates.splice(idx, 1);
+                this.useStates(currentStates);
+            }
+        };
+        Element.prototype.replaceState = function (oldState, newState, forceAdd) {
+            var currentStates = this.currentStates.slice();
+            var idx = indexOf(currentStates, oldState);
+            var newStateExists = indexOf(currentStates, newState) >= 0;
+            if (idx >= 0) {
+                if (!newStateExists) {
+                    currentStates[idx] = newState;
+                }
+                else {
+                    currentStates.splice(idx, 1);
+                }
+            }
+            else if (forceAdd && !newStateExists) {
+                currentStates.push(newState);
+            }
+            this.useStates(currentStates);
+        };
+        Element.prototype.toggleState = function (state, enable) {
+            if (enable) {
+                this.useState(state, true);
+            }
+            else {
+                this.removeState(state);
+            }
+        };
+        Element.prototype._mergeStates = function (states) {
+            var mergedState = {};
+            var mergedTextConfig;
+            for (var i = 0; i < states.length; i++) {
+                var state = states[i];
+                extend(mergedState, state);
+                if (state.textConfig) {
+                    mergedTextConfig = mergedTextConfig || {};
+                    extend(mergedTextConfig, state.textConfig);
+                }
+            }
+            if (mergedTextConfig) {
+                mergedState.textConfig = mergedTextConfig;
+            }
+            return mergedState;
+        };
+        Element.prototype._applyStateObj = function (stateName, state, normalState, keepCurrentStates, transition, animationCfg) {
+            var needsRestoreToNormal = !(state && keepCurrentStates);
+            if (state && state.textConfig) {
+                this.textConfig = extend({}, keepCurrentStates ? this.textConfig : normalState.textConfig);
+                extend(this.textConfig, state.textConfig);
+            }
+            else if (needsRestoreToNormal) {
+                if (normalState.textConfig) {
+                    this.textConfig = normalState.textConfig;
+                }
+            }
+            var transitionTarget = {};
+            var hasTransition = false;
+            for (var i = 0; i < PRIMARY_STATES_KEYS.length; i++) {
+                var key = PRIMARY_STATES_KEYS[i];
+                var propNeedsTransition = transition && DEFAULT_ANIMATABLE_MAP[key];
+                if (state && state[key] != null) {
+                    if (propNeedsTransition) {
+                        hasTransition = true;
+                        transitionTarget[key] = state[key];
+                    }
+                    else {
+                        this[key] = state[key];
+                    }
+                }
+                else if (needsRestoreToNormal) {
+                    if (normalState[key] != null) {
+                        if (propNeedsTransition) {
+                            hasTransition = true;
+                            transitionTarget[key] = normalState[key];
+                        }
+                        else {
+                            this[key] = normalState[key];
+                        }
+                    }
+                }
+            }
+            if (!transition) {
+                for (var i = 0; i < this.animators.length; i++) {
+                    var animator = this.animators[i];
+                    var targetName = animator.targetName;
+                    if (!animator.getLoop()) {
+                        animator.__changeFinalValue(targetName
+                            ? (state || normalState)[targetName]
+                            : (state || normalState));
+                    }
+                }
+            }
+            if (hasTransition) {
+                this._transitionState(stateName, transitionTarget, animationCfg);
+            }
+        };
+        Element.prototype._attachComponent = function (componentEl) {
+            if (componentEl.__zr && !componentEl.__hostTarget) {
+                {
+                    throw new Error('Text element has been added to zrender.');
+                }
+            }
+            if (componentEl === this) {
+                {
+                    throw new Error('Recursive component attachment.');
+                }
+            }
+            var zr = this.__zr;
+            if (zr) {
+                componentEl.addSelfToZr(zr);
+            }
+            componentEl.__zr = zr;
+            componentEl.__hostTarget = this;
+        };
+        Element.prototype._detachComponent = function (componentEl) {
+            if (componentEl.__zr) {
+                componentEl.removeSelfFromZr(componentEl.__zr);
+            }
+            componentEl.__zr = null;
+            componentEl.__hostTarget = null;
+        };
+        Element.prototype.getClipPath = function () {
+            return this._clipPath;
+        };
+        Element.prototype.setClipPath = function (clipPath) {
+            if (this._clipPath && this._clipPath !== clipPath) {
+                this.removeClipPath();
+            }
+            this._attachComponent(clipPath);
+            this._clipPath = clipPath;
+            this.markRedraw();
+        };
+        Element.prototype.removeClipPath = function () {
+            var clipPath = this._clipPath;
+            if (clipPath) {
+                this._detachComponent(clipPath);
+                this._clipPath = null;
+                this.markRedraw();
+            }
+        };
+        Element.prototype.getTextContent = function () {
+            return this._textContent;
+        };
+        Element.prototype.setTextContent = function (textEl) {
+            var previousTextContent = this._textContent;
+            if (previousTextContent === textEl) {
+                return;
+            }
+            if (previousTextContent && previousTextContent !== textEl) {
+                this.removeTextContent();
+            }
+            {
+                if (textEl.__zr && !textEl.__hostTarget) {
+                    throw new Error('Text element has been added to zrender.');
+                }
+            }
+            textEl.innerTransformable = new Transformable();
+            this._attachComponent(textEl);
+            this._textContent = textEl;
+            this.markRedraw();
+        };
+        Element.prototype.setTextConfig = function (cfg) {
+            if (!this.textConfig) {
+                this.textConfig = {};
+            }
+            extend(this.textConfig, cfg);
+            this.markRedraw();
+        };
+        Element.prototype.removeTextConfig = function () {
+            this.textConfig = null;
+            this.markRedraw();
+        };
+        Element.prototype.removeTextContent = function () {
+            var textEl = this._textContent;
+            if (textEl) {
+                textEl.innerTransformable = null;
+                this._detachComponent(textEl);
+                this._textContent = null;
+                this._innerTextDefaultStyle = null;
+                this.markRedraw();
+            }
+        };
+        Element.prototype.getTextGuideLine = function () {
+            return this._textGuide;
+        };
+        Element.prototype.setTextGuideLine = function (guideLine) {
+            if (this._textGuide && this._textGuide !== guideLine) {
+                this.removeTextGuideLine();
+            }
+            this._attachComponent(guideLine);
+            this._textGuide = guideLine;
+            this.markRedraw();
+        };
+        Element.prototype.removeTextGuideLine = function () {
+            var textGuide = this._textGuide;
+            if (textGuide) {
+                this._detachComponent(textGuide);
+                this._textGuide = null;
+                this.markRedraw();
+            }
+        };
+        Element.prototype.markRedraw = function () {
+            this.__dirty |= REDRAW_BIT;
+            var zr = this.__zr;
+            if (zr) {
+                if (this.__inHover) {
+                    zr.refreshHover();
+                }
+                else {
+                    zr.refresh();
+                }
+            }
+            if (this.__hostTarget) {
+                this.__hostTarget.markRedraw();
+            }
+        };
+        Element.prototype.dirty = function () {
+            this.markRedraw();
+        };
+        Element.prototype._toggleHoverLayerFlag = function (inHover) {
+            this.__inHover = inHover;
+            var textContent = this._textContent;
+            var textGuide = this._textGuide;
+            if (textContent) {
+                textContent.__inHover = inHover;
+            }
+            if (textGuide) {
+                textGuide.__inHover = inHover;
+            }
+        };
+        Element.prototype.addSelfToZr = function (zr) {
+            if (this.__zr === zr) {
+                return;
+            }
+            this.__zr = zr;
+            var animators = this.animators;
+            if (animators) {
+                for (var i = 0; i < animators.length; i++) {
+                    zr.animation.addAnimator(animators[i]);
+                }
+            }
+            if (this._clipPath) {
+                this._clipPath.addSelfToZr(zr);
+            }
+            if (this._textContent) {
+                this._textContent.addSelfToZr(zr);
+            }
+            if (this._textGuide) {
+                this._textGuide.addSelfToZr(zr);
+            }
+        };
+        Element.prototype.removeSelfFromZr = function (zr) {
+            if (!this.__zr) {
+                return;
+            }
+            this.__zr = null;
+            var animators = this.animators;
+            if (animators) {
+                for (var i = 0; i < animators.length; i++) {
+                    zr.animation.removeAnimator(animators[i]);
+                }
+            }
+            if (this._clipPath) {
+                this._clipPath.removeSelfFromZr(zr);
+            }
+            if (this._textContent) {
+                this._textContent.removeSelfFromZr(zr);
+            }
+            if (this._textGuide) {
+                this._textGuide.removeSelfFromZr(zr);
+            }
+        };
+        Element.prototype.animate = function (key, loop, allowDiscreteAnimation) {
+            var target = key ? this[key] : this;
+            {
+                if (!target) {
+                    logError('Property "'
+                        + key
+                        + '" is not existed in element '
+                        + this.id);
+                    return;
+                }
+            }
+            var animator = new Animator(target, loop, allowDiscreteAnimation);
+            key && (animator.targetName = key);
+            this.addAnimator(animator, key);
+            return animator;
+        };
+        Element.prototype.addAnimator = function (animator, key) {
+            var zr = this.__zr;
+            var el = this;
+            animator.during(function () {
+                el.updateDuringAnimation(key);
+            }).done(function () {
+                var animators = el.animators;
+                var idx = indexOf(animators, animator);
+                if (idx >= 0) {
+                    animators.splice(idx, 1);
+                }
+            });
+            this.animators.push(animator);
+            if (zr) {
+                zr.animation.addAnimator(animator);
+            }
+            zr && zr.wakeUp();
+        };
+        Element.prototype.updateDuringAnimation = function (key) {
+            this.markRedraw();
+        };
+        Element.prototype.stopAnimation = function (scope, forwardToLast) {
+            var animators = this.animators;
+            var len = animators.length;
+            var leftAnimators = [];
+            for (var i = 0; i < len; i++) {
+                var animator = animators[i];
+                if (!scope || scope === animator.scope) {
+                    animator.stop(forwardToLast);
+                }
+                else {
+                    leftAnimators.push(animator);
+                }
+            }
+            this.animators = leftAnimators;
+            return this;
+        };
+        Element.prototype.animateTo = function (target, cfg, animationProps) {
+            animateTo(this, target, cfg, animationProps);
+        };
+        Element.prototype.animateFrom = function (target, cfg, animationProps) {
+            animateTo(this, target, cfg, animationProps, true);
+        };
+        Element.prototype._transitionState = function (stateName, target, cfg, animationProps) {
+            var animators = animateTo(this, target, cfg, animationProps);
+            for (var i = 0; i < animators.length; i++) {
+                animators[i].__fromStateTransition = stateName;
+            }
+        };
+        Element.prototype.getBoundingRect = function () {
+            return null;
+        };
+        Element.prototype.getPaintRect = function () {
+            return null;
+        };
+        Element.initDefaultProps = (function () {
+            var elProto = Element.prototype;
+            elProto.type = 'element';
+            elProto.name = '';
+            elProto.ignore =
+                elProto.silent =
+                    elProto.isGroup =
+                        elProto.draggable =
+                            elProto.dragging =
+                                elProto.ignoreClip =
+                                    elProto.__inHover = false;
+            elProto.__dirty = REDRAW_BIT;
+            var logs = {};
+            function logDeprecatedError(key, xKey, yKey) {
+                if (!logs[key + xKey + yKey]) {
+                    console.warn("DEPRECATED: '" + key + "' has been deprecated. use '" + xKey + "', '" + yKey + "' instead");
+                    logs[key + xKey + yKey] = true;
+                }
+            }
+            function createLegacyProperty(key, privateKey, xKey, yKey) {
+                Object.defineProperty(elProto, key, {
+                    get: function () {
+                        {
+                            logDeprecatedError(key, xKey, yKey);
+                        }
+                        if (!this[privateKey]) {
+                            var pos = this[privateKey] = [];
+                            enhanceArray(this, pos);
+                        }
+                        return this[privateKey];
+                    },
+                    set: function (pos) {
+                        {
+                            logDeprecatedError(key, xKey, yKey);
+                        }
+                        this[xKey] = pos[0];
+                        this[yKey] = pos[1];
+                        this[privateKey] = pos;
+                        enhanceArray(this, pos);
+                    }
+                });
+                function enhanceArray(self, pos) {
+                    Object.defineProperty(pos, 0, {
+                        get: function () {
+                            return self[xKey];
+                        },
+                        set: function (val) {
+                            self[xKey] = val;
+                        }
+                    });
+                    Object.defineProperty(pos, 1, {
+                        get: function () {
+                            return self[yKey];
+                        },
+                        set: function (val) {
+                            self[yKey] = val;
+                        }
+                    });
+                }
+            }
+            if (Object.defineProperty) {
+                createLegacyProperty('position', '_legacyPos', 'x', 'y');
+                createLegacyProperty('scale', '_legacyScale', 'scaleX', 'scaleY');
+                createLegacyProperty('origin', '_legacyOrigin', 'originX', 'originY');
+            }
+        })();
+        return Element;
+    }());
+    mixin(Element, Eventful);
+    mixin(Element, Transformable);
+    function animateTo(animatable, target, cfg, animationProps, reverse) {
+        cfg = cfg || {};
+        var animators = [];
+        animateToShallow(animatable, '', animatable, target, cfg, animationProps, animators, reverse);
+        var finishCount = animators.length;
+        var doneHappened = false;
+        var cfgDone = cfg.done;
+        var cfgAborted = cfg.aborted;
+        var doneCb = function () {
+            doneHappened = true;
+            finishCount--;
+            if (finishCount <= 0) {
+                doneHappened
+                    ? (cfgDone && cfgDone())
+                    : (cfgAborted && cfgAborted());
+            }
+        };
+        var abortedCb = function () {
+            finishCount--;
+            if (finishCount <= 0) {
+                doneHappened
+                    ? (cfgDone && cfgDone())
+                    : (cfgAborted && cfgAborted());
+            }
+        };
+        if (!finishCount) {
+            cfgDone && cfgDone();
+        }
+        if (animators.length > 0 && cfg.during) {
+            animators[0].during(function (target, percent) {
+                cfg.during(percent);
+            });
+        }
+        for (var i = 0; i < animators.length; i++) {
+            var animator = animators[i];
+            if (doneCb) {
+                animator.done(doneCb);
+            }
+            if (abortedCb) {
+                animator.aborted(abortedCb);
+            }
+            if (cfg.force) {
+                animator.duration(cfg.duration);
+            }
+            animator.start(cfg.easing);
+        }
+        return animators;
+    }
+    function copyArrShallow(source, target, len) {
+        for (var i = 0; i < len; i++) {
+            source[i] = target[i];
+        }
+    }
+    function is2DArray(value) {
+        return isArrayLike(value[0]);
+    }
+    function copyValue(target, source, key) {
+        if (isArrayLike(source[key])) {
+            if (!isArrayLike(target[key])) {
+                target[key] = [];
+            }
+            if (isTypedArray(source[key])) {
+                var len = source[key].length;
+                if (target[key].length !== len) {
+                    target[key] = new (source[key].constructor)(len);
+                    copyArrShallow(target[key], source[key], len);
+                }
+            }
+            else {
+                var sourceArr = source[key];
+                var targetArr = target[key];
+                var len0 = sourceArr.length;
+                if (is2DArray(sourceArr)) {
+                    var len1 = sourceArr[0].length;
+                    for (var i = 0; i < len0; i++) {
+                        if (!targetArr[i]) {
+                            targetArr[i] = Array.prototype.slice.call(sourceArr[i]);
+                        }
+                        else {
+                            copyArrShallow(targetArr[i], sourceArr[i], len1);
+                        }
+                    }
+                }
+                else {
+                    copyArrShallow(targetArr, sourceArr, len0);
+                }
+                targetArr.length = sourceArr.length;
+            }
+        }
+        else {
+            target[key] = source[key];
+        }
+    }
+    function isValueSame(val1, val2) {
+        return val1 === val2
+            || isArrayLike(val1) && isArrayLike(val2) && is1DArraySame(val1, val2);
+    }
+    function is1DArraySame(arr0, arr1) {
+        var len = arr0.length;
+        if (len !== arr1.length) {
+            return false;
+        }
+        for (var i = 0; i < len; i++) {
+            if (arr0[i] !== arr1[i]) {
+                return false;
+            }
+        }
+        return true;
+    }
+    function animateToShallow(animatable, topKey, animateObj, target, cfg, animationProps, animators, reverse) {
+        var targetKeys = keys(target);
+        var duration = cfg.duration;
+        var delay = cfg.delay;
+        var additive = cfg.additive;
+        var setToFinal = cfg.setToFinal;
+        var animateAll = !isObject(animationProps);
+        var existsAnimators = animatable.animators;
+        var animationKeys = [];
+        for (var k = 0; k < targetKeys.length; k++) {
+            var innerKey = targetKeys[k];
+            var targetVal = target[innerKey];
+            if (targetVal != null && animateObj[innerKey] != null
+                && (animateAll || animationProps[innerKey])) {
+                if (isObject(targetVal)
+                    && !isArrayLike(targetVal)
+                    && !isGradientObject(targetVal)) {
+                    if (topKey) {
+                        if (!reverse) {
+                            animateObj[innerKey] = targetVal;
+                            animatable.updateDuringAnimation(topKey);
+                        }
+                        continue;
+                    }
+                    animateToShallow(animatable, innerKey, animateObj[innerKey], targetVal, cfg, animationProps && animationProps[innerKey], animators, reverse);
+                }
+                else {
+                    animationKeys.push(innerKey);
+                }
+            }
+            else if (!reverse) {
+                animateObj[innerKey] = targetVal;
+                animatable.updateDuringAnimation(topKey);
+                animationKeys.push(innerKey);
+            }
+        }
+        var keyLen = animationKeys.length;
+        if (!additive && keyLen) {
+            for (var i = 0; i < existsAnimators.length; i++) {
+                var animator = existsAnimators[i];
+                if (animator.targetName === topKey) {
+                    var allAborted = animator.stopTracks(animationKeys);
+                    if (allAborted) {
+                        var idx = indexOf(existsAnimators, animator);
+                        existsAnimators.splice(idx, 1);
+                    }
+                }
+            }
+        }
+        if (!cfg.force) {
+            animationKeys = filter(animationKeys, function (key) { return !isValueSame(target[key], animateObj[key]); });
+            keyLen = animationKeys.length;
+        }
+        if (keyLen > 0
+            || (cfg.force && !animators.length)) {
+            var revertedSource = void 0;
+            var reversedTarget = void 0;
+            var sourceClone = void 0;
+            if (reverse) {
+                reversedTarget = {};
+                if (setToFinal) {
+                    revertedSource = {};
+                }
+                for (var i = 0; i < keyLen; i++) {
+                    var innerKey = animationKeys[i];
+                    reversedTarget[innerKey] = animateObj[innerKey];
+                    if (setToFinal) {
+                        revertedSource[innerKey] = target[innerKey];
+                    }
+                    else {
+                        animateObj[innerKey] = target[innerKey];
+                    }
+                }
+            }
+            else if (setToFinal) {
+                sourceClone = {};
+                for (var i = 0; i < keyLen; i++) {
+                    var innerKey = animationKeys[i];
+                    sourceClone[innerKey] = cloneValue(animateObj[innerKey]);
+                    copyValue(animateObj, target, innerKey);
+                }
+            }
+            var animator = new Animator(animateObj, false, false, additive ? filter(existsAnimators, function (animator) { return animator.targetName === topKey; }) : null);
+            animator.targetName = topKey;
+            if (cfg.scope) {
+                animator.scope = cfg.scope;
+            }
+            if (setToFinal && revertedSource) {
+                animator.whenWithKeys(0, revertedSource, animationKeys);
+            }
+            if (sourceClone) {
+                animator.whenWithKeys(0, sourceClone, animationKeys);
+            }
+            animator.whenWithKeys(duration == null ? 500 : duration, reverse ? reversedTarget : target, animationKeys).delay(delay || 0);
+            animatable.addAnimator(animator, topKey);
+            animators.push(animator);
+        }
+    }
+
+    var Group = (function (_super) {
+        __extends(Group, _super);
+        function Group(opts) {
+            var _this = _super.call(this) || this;
+            _this.isGroup = true;
+            _this._children = [];
+            _this.attr(opts);
+            return _this;
+        }
+        Group.prototype.childrenRef = function () {
+            return this._children;
+        };
+        Group.prototype.children = function () {
+            return this._children.slice();
+        };
+        Group.prototype.childAt = function (idx) {
+            return this._children[idx];
+        };
+        Group.prototype.childOfName = function (name) {
+            var children = this._children;
+            for (var i = 0; i < children.length; i++) {
+                if (children[i].name === name) {
+                    return children[i];
+                }
+            }
+        };
+        Group.prototype.childCount = function () {
+            return this._children.length;
+        };
+        Group.prototype.add = function (child) {
+            if (child) {
+                if (child !== this && child.parent !== this) {
+                    this._children.push(child);
+                    this._doAdd(child);
+                }
+                {
+                    if (child.__hostTarget) {
+                        throw 'This elemenet has been used as an attachment';
+                    }
+                }
+            }
+            return this;
+        };
+        Group.prototype.addBefore = function (child, nextSibling) {
+            if (child && child !== this && child.parent !== this
+                && nextSibling && nextSibling.parent === this) {
+                var children = this._children;
+                var idx = children.indexOf(nextSibling);
+                if (idx >= 0) {
+                    children.splice(idx, 0, child);
+                    this._doAdd(child);
+                }
+            }
+            return this;
+        };
+        Group.prototype.replace = function (oldChild, newChild) {
+            var idx = indexOf(this._children, oldChild);
+            if (idx >= 0) {
+                this.replaceAt(newChild, idx);
+            }
+            return this;
+        };
+        Group.prototype.replaceAt = function (child, index) {
+            var children = this._children;
+            var old = children[index];
+            if (child && child !== this && child.parent !== this && child !== old) {
+                children[index] = child;
+                old.parent = null;
+                var zr = this.__zr;
+                if (zr) {
+                    old.removeSelfFromZr(zr);
+                }
+                this._doAdd(child);
+            }
+            return this;
+        };
+        Group.prototype._doAdd = function (child) {
+            if (child.parent) {
+                child.parent.remove(child);
+            }
+            child.parent = this;
+            var zr = this.__zr;
+            if (zr && zr !== child.__zr) {
+                child.addSelfToZr(zr);
+            }
+            zr && zr.refresh();
+        };
+        Group.prototype.remove = function (child) {
+            var zr = this.__zr;
+            var children = this._children;
+            var idx = indexOf(children, child);
+            if (idx < 0) {
+                return this;
+            }
+            children.splice(idx, 1);
+            child.parent = null;
+            if (zr) {
+                child.removeSelfFromZr(zr);
+            }
+            zr && zr.refresh();
+            return this;
+        };
+        Group.prototype.removeAll = function () {
+            var children = this._children;
+            var zr = this.__zr;
+            for (var i = 0; i < children.length; i++) {
+                var child = children[i];
+                if (zr) {
+                    child.removeSelfFromZr(zr);
+                }
+                child.parent = null;
+            }
+            children.length = 0;
+            return this;
+        };
+        Group.prototype.eachChild = function (cb, context) {
+            var children = this._children;
+            for (var i = 0; i < children.length; i++) {
+                var child = children[i];
+                cb.call(context, child, i);
+            }
+            return this;
+        };
+        Group.prototype.traverse = function (cb, context) {
+            for (var i = 0; i < this._children.length; i++) {
+                var child = this._children[i];
+                var stopped = cb.call(context, child);
+                if (child.isGroup && !stopped) {
+                    child.traverse(cb, context);
+                }
+            }
+            return this;
+        };
+        Group.prototype.addSelfToZr = function (zr) {
+            _super.prototype.addSelfToZr.call(this, zr);
+            for (var i = 0; i < this._children.length; i++) {
+                var child = this._children[i];
+                child.addSelfToZr(zr);
+            }
+        };
+        Group.prototype.removeSelfFromZr = function (zr) {
+            _super.prototype.removeSelfFromZr.call(this, zr);
+            for (var i = 0; i < this._children.length; i++) {
+                var child = this._children[i];
+                child.removeSelfFromZr(zr);
+            }
+        };
+        Group.prototype.getBoundingRect = function (includeChildren) {
+            var tmpRect = new BoundingRect(0, 0, 0, 0);
+            var children = includeChildren || this._children;
+            var tmpMat = [];
+            var rect = null;
+            for (var i = 0; i < children.length; i++) {
+                var child = children[i];
+                if (child.ignore || child.invisible) {
+                    continue;
+                }
+                var childRect = child.getBoundingRect();
+                var transform = child.getLocalTransform(tmpMat);
+                if (transform) {
+                    BoundingRect.applyTransform(tmpRect, childRect, transform);
+                    rect = rect || tmpRect.clone();
+                    rect.union(tmpRect);
+                }
+                else {
+                    rect = rect || childRect.clone();
+                    rect.union(childRect);
+                }
+            }
+            return rect || tmpRect;
+        };
+        return Group;
+    }(Element));
+    Group.prototype.type = 'group';
+
+    /*!
+    * ZRender, a high performance 2d drawing library.
+    *
+    * Copyright (c) 2013, Baidu Inc.
+    * All rights reserved.
+    *
+    * LICENSE
+    * https://github.com/ecomfe/zrender/blob/master/LICENSE.txt
+    */
+    var painterCtors = {};
+    var instances = {};
+    function delInstance(id) {
+        delete instances[id];
+    }
+    function isDarkMode(backgroundColor) {
+        if (!backgroundColor) {
+            return false;
+        }
+        if (typeof backgroundColor === 'string') {
+            return lum(backgroundColor, 1) < DARK_MODE_THRESHOLD;
+        }
+        else if (backgroundColor.colorStops) {
+            var colorStops = backgroundColor.colorStops;
+            var totalLum = 0;
+            var len = colorStops.length;
+            for (var i = 0; i < len; i++) {
+                totalLum += lum(colorStops[i].color, 1);
+            }
+            totalLum /= len;
+            return totalLum < DARK_MODE_THRESHOLD;
+        }
+        return false;
+    }
+    var ZRender = (function () {
+        function ZRender(id, dom, opts) {
+            var _this = this;
+            this._sleepAfterStill = 10;
+            this._stillFrameAccum = 0;
+            this._needsRefresh = true;
+            this._needsRefreshHover = true;
+            this._darkMode = false;
+            opts = opts || {};
+            this.dom = dom;
+            this.id = id;
+            var storage = new Storage();
+            var rendererType = opts.renderer || 'canvas';
+            if (!painterCtors[rendererType]) {
+                rendererType = keys(painterCtors)[0];
+            }
+            {
+                if (!painterCtors[rendererType]) {
+                    throw new Error("Renderer '" + rendererType + "' is not imported. Please import it first.");
+                }
+            }
+            opts.useDirtyRect = opts.useDirtyRect == null
+                ? false
+                : opts.useDirtyRect;
+            var painter = new painterCtors[rendererType](dom, storage, opts, id);
+            var ssrMode = opts.ssr || painter.ssrOnly;
+            this.storage = storage;
+            this.painter = painter;
+            var handlerProxy = (!env.node && !env.worker && !ssrMode)
+                ? new HandlerDomProxy(painter.getViewportRoot(), painter.root)
+                : null;
+            var useCoarsePointer = opts.useCoarsePointer;
+            var usePointerSize = (useCoarsePointer == null || useCoarsePointer === 'auto')
+                ? env.touchEventsSupported
+                : !!useCoarsePointer;
+            var defaultPointerSize = 44;
+            var pointerSize;
+            if (usePointerSize) {
+                pointerSize = retrieve2(opts.pointerSize, defaultPointerSize);
+            }
+            this.handler = new Handler(storage, painter, handlerProxy, painter.root, pointerSize);
+            this.animation = new Animation({
+                stage: {
+                    update: ssrMode ? null : function () { return _this._flush(true); }
+                }
+            });
+            if (!ssrMode) {
+                this.animation.start();
+            }
+        }
+        ZRender.prototype.add = function (el) {
+            if (this._disposed || !el) {
+                return;
+            }
+            this.storage.addRoot(el);
+            el.addSelfToZr(this);
+            this.refresh();
+        };
+        ZRender.prototype.remove = function (el) {
+            if (this._disposed || !el) {
+                return;
+            }
+            this.storage.delRoot(el);
+            el.removeSelfFromZr(this);
+            this.refresh();
+        };
+        ZRender.prototype.configLayer = function (zLevel, config) {
+            if (this._disposed) {
+                return;
+            }
+            if (this.painter.configLayer) {
+                this.painter.configLayer(zLevel, config);
+            }
+            this.refresh();
+        };
+        ZRender.prototype.setBackgroundColor = function (backgroundColor) {
+            if (this._disposed) {
+                return;
+            }
+            if (this.painter.setBackgroundColor) {
+                this.painter.setBackgroundColor(backgroundColor);
+            }
+            this.refresh();
+            this._backgroundColor = backgroundColor;
+            this._darkMode = isDarkMode(backgroundColor);
+        };
+        ZRender.prototype.getBackgroundColor = function () {
+            return this._backgroundColor;
+        };
+        ZRender.prototype.setDarkMode = function (darkMode) {
+            this._darkMode = darkMode;
+        };
+        ZRender.prototype.isDarkMode = function () {
+            return this._darkMode;
+        };
+        ZRender.prototype.refreshImmediately = function (fromInside) {
+            if (this._disposed) {
+                return;
+            }
+            if (!fromInside) {
+                this.animation.update(true);
+            }
+            this._needsRefresh = false;
+            this.painter.refresh();
+            this._needsRefresh = false;
+        };
+        ZRender.prototype.refresh = function () {
+            if (this._disposed) {
+                return;
+            }
+            this._needsRefresh = true;
+            this.animation.start();
+        };
+        ZRender.prototype.flush = function () {
+            if (this._disposed) {
+                return;
+            }
+            this._flush(false);
+        };
+        ZRender.prototype._flush = function (fromInside) {
+            var triggerRendered;
+            var start = getTime();
+            if (this._needsRefresh) {
+                triggerRendered = true;
+                this.refreshImmediately(fromInside);
+            }
+            if (this._needsRefreshHover) {
+                triggerRendered = true;
+                this.refreshHoverImmediately();
+            }
+            var end = getTime();
+            if (triggerRendered) {
+                this._stillFrameAccum = 0;
+                this.trigger('rendered', {
+                    elapsedTime: end - start
+                });
+            }
+            else if (this._sleepAfterStill > 0) {
+                this._stillFrameAccum++;
+                if (this._stillFrameAccum > this._sleepAfterStill) {
+                    this.animation.stop();
+                }
+            }
+        };
+        ZRender.prototype.setSleepAfterStill = function (stillFramesCount) {
+            this._sleepAfterStill = stillFramesCount;
+        };
+        ZRender.prototype.wakeUp = function () {
+            if (this._disposed) {
+                return;
+            }
+            this.animation.start();
+            this._stillFrameAccum = 0;
+        };
+        ZRender.prototype.refreshHover = function () {
+            this._needsRefreshHover = true;
+        };
+        ZRender.prototype.refreshHoverImmediately = function () {
+            if (this._disposed) {
+                return;
+            }
+            this._needsRefreshHover = false;
+            if (this.painter.refreshHover && this.painter.getType() === 'canvas') {
+                this.painter.refreshHover();
+            }
+        };
+        ZRender.prototype.resize = function (opts) {
+            if (this._disposed) {
+                return;
+            }
+            opts = opts || {};
+            this.painter.resize(opts.width, opts.height);
+            this.handler.resize();
+        };
+        ZRender.prototype.clearAnimation = function () {
+            if (this._disposed) {
+                return;
+            }
+            this.animation.clear();
+        };
+        ZRender.prototype.getWidth = function () {
+            if (this._disposed) {
+                return;
+            }
+            return this.painter.getWidth();
+        };
+        ZRender.prototype.getHeight = function () {
+            if (this._disposed) {
+                return;
+            }
+            return this.painter.getHeight();
+        };
+        ZRender.prototype.setCursorStyle = function (cursorStyle) {
+            if (this._disposed) {
+                return;
+            }
+            this.handler.setCursorStyle(cursorStyle);
+        };
+        ZRender.prototype.findHover = function (x, y) {
+            if (this._disposed) {
+                return;
+            }
+            return this.handler.findHover(x, y);
+        };
+        ZRender.prototype.on = function (eventName, eventHandler, context) {
+            if (!this._disposed) {
+                this.handler.on(eventName, eventHandler, context);
+            }
+            return this;
+        };
+        ZRender.prototype.off = function (eventName, eventHandler) {
+            if (this._disposed) {
+                return;
+            }
+            this.handler.off(eventName, eventHandler);
+        };
+        ZRender.prototype.trigger = function (eventName, event) {
+            if (this._disposed) {
+                return;
+            }
+            this.handler.trigger(eventName, event);
+        };
+        ZRender.prototype.clear = function () {
+            if (this._disposed) {
+                return;
+            }
+            var roots = this.storage.getRoots();
+            for (var i = 0; i < roots.length; i++) {
+                if (roots[i] instanceof Group) {
+                    roots[i].removeSelfFromZr(this);
+                }
+            }
+            this.storage.delAllRoots();
+            this.painter.clear();
+        };
+        ZRender.prototype.dispose = function () {
+            if (this._disposed) {
+                return;
+            }
+            this.animation.stop();
+            this.clear();
+            this.storage.dispose();
+            this.painter.dispose();
+            this.handler.dispose();
+            this.animation =
+                this.storage =
+                    this.painter =
+                        this.handler = null;
+            this._disposed = true;
+            delInstance(this.id);
+        };
+        return ZRender;
+    }());
+    function init(dom, opts) {
+        var zr = new ZRender(guid(), dom, opts);
+        instances[zr.id] = zr;
+        return zr;
+    }
+    function dispose(zr) {
+        zr.dispose();
+    }
+    function disposeAll() {
+        for (var key in instances) {
+            if (instances.hasOwnProperty(key)) {
+                instances[key].dispose();
+            }
+        }
+        instances = {};
+    }
+    function getInstance(id) {
+        return instances[id];
+    }
+    function registerPainter(name, Ctor) {
+        painterCtors[name] = Ctor;
+    }
+    var ssrDataGetter;
+    function getElementSSRData(el) {
+        if (typeof ssrDataGetter === 'function') {
+            return ssrDataGetter(el);
+        }
+    }
+    function registerSSRDataGetter(getter) {
+        ssrDataGetter = getter;
+    }
+    var version = '5.6.0';
+
+    var STYLE_MAGIC_KEY = '__zr_style_' + Math.round((Math.random() * 10));
+    var DEFAULT_COMMON_STYLE = {
+        shadowBlur: 0,
+        shadowOffsetX: 0,
+        shadowOffsetY: 0,
+        shadowColor: '#000',
+        opacity: 1,
+        blend: 'source-over'
+    };
+    var DEFAULT_COMMON_ANIMATION_PROPS = {
+        style: {
+            shadowBlur: true,
+            shadowOffsetX: true,
+            shadowOffsetY: true,
+            shadowColor: true,
+            opacity: true
+        }
+    };
+    DEFAULT_COMMON_STYLE[STYLE_MAGIC_KEY] = true;
+    var PRIMARY_STATES_KEYS$1 = ['z', 'z2', 'invisible'];
+    var PRIMARY_STATES_KEYS_IN_HOVER_LAYER = ['invisible'];
+    var Displayable = (function (_super) {
+        __extends(Displayable, _super);
+        function Displayable(props) {
+            return _super.call(this, props) || this;
+        }
+        Displayable.prototype._init = function (props) {
+            var keysArr = keys(props);
+            for (var i = 0; i < keysArr.length; i++) {
+                var key = keysArr[i];
+                if (key === 'style') {
+                    this.useStyle(props[key]);
+                }
+                else {
+                    _super.prototype.attrKV.call(this, key, props[key]);
+                }
+            }
+            if (!this.style) {
+                this.useStyle({});
+            }
+        };
+        Displayable.prototype.beforeBrush = function () { };
+        Displayable.prototype.afterBrush = function () { };
+        Displayable.prototype.innerBeforeBrush = function () { };
+        Displayable.prototype.innerAfterBrush = function () { };
+        Displayable.prototype.shouldBePainted = function (viewWidth, viewHeight, considerClipPath, considerAncestors) {
+            var m = this.transform;
+            if (this.ignore
+                || this.invisible
+                || this.style.opacity === 0
+                || (this.culling
+                    && isDisplayableCulled(this, viewWidth, viewHeight))
+                || (m && !m[0] && !m[3])) {
+                return false;
+            }
+            if (considerClipPath && this.__clipPaths) {
+                for (var i = 0; i < this.__clipPaths.length; ++i) {
+                    if (this.__clipPaths[i].isZeroArea()) {
+                        return false;
+                    }
+                }
+            }
+            if (considerAncestors && this.parent) {
+                var parent_1 = this.parent;
+                while (parent_1) {
+                    if (parent_1.ignore) {
+                        return false;
+                    }
+                    parent_1 = parent_1.parent;
+                }
+            }
+            return true;
+        };
+        Displayable.prototype.contain = function (x, y) {
+            return this.rectContain(x, y);
+        };
+        Displayable.prototype.traverse = function (cb, context) {
+            cb.call(context, this);
+        };
+        Displayable.prototype.rectContain = function (x, y) {
+            var coord = this.transformCoordToLocal(x, y);
+            var rect = this.getBoundingRect();
+            return rect.contain(coord[0], coord[1]);
+        };
+        Displayable.prototype.getPaintRect = function () {
+            var rect = this._paintRect;
+            if (!this._paintRect || this.__dirty) {
+                var transform = this.transform;
+                var elRect = this.getBoundingRect();
+                var style = this.style;
+                var shadowSize = style.shadowBlur || 0;
+                var shadowOffsetX = style.shadowOffsetX || 0;
+                var shadowOffsetY = style.shadowOffsetY || 0;
+                rect = this._paintRect || (this._paintRect = new BoundingRect(0, 0, 0, 0));
+                if (transform) {
+                    BoundingRect.applyTransform(rect, elRect, transform);
+                }
+                else {
+                    rect.copy(elRect);
+                }
+                if (shadowSize || shadowOffsetX || shadowOffsetY) {
+                    rect.width += shadowSize * 2 + Math.abs(shadowOffsetX);
+                    rect.height += shadowSize * 2 + Math.abs(shadowOffsetY);
+                    rect.x = Math.min(rect.x, rect.x + shadowOffsetX - shadowSize);
+                    rect.y = Math.min(rect.y, rect.y + shadowOffsetY - shadowSize);
+                }
+                var tolerance = this.dirtyRectTolerance;
+                if (!rect.isZero()) {
+                    rect.x = Math.floor(rect.x - tolerance);
+                    rect.y = Math.floor(rect.y - tolerance);
+                    rect.width = Math.ceil(rect.width + 1 + tolerance * 2);
+                    rect.height = Math.ceil(rect.height + 1 + tolerance * 2);
+                }
+            }
+            return rect;
+        };
+        Displayable.prototype.setPrevPaintRect = function (paintRect) {
+            if (paintRect) {
+                this._prevPaintRect = this._prevPaintRect || new BoundingRect(0, 0, 0, 0);
+                this._prevPaintRect.copy(paintRect);
+            }
+            else {
+                this._prevPaintRect = null;
+            }
+        };
+        Displayable.prototype.getPrevPaintRect = function () {
+            return this._prevPaintRect;
+        };
+        Displayable.prototype.animateStyle = function (loop) {
+            return this.animate('style', loop);
+        };
+        Displayable.prototype.updateDuringAnimation = function (targetKey) {
+            if (targetKey === 'style') {
+                this.dirtyStyle();
+            }
+            else {
+                this.markRedraw();
+            }
+        };
+        Displayable.prototype.attrKV = function (key, value) {
+            if (key !== 'style') {
+                _super.prototype.attrKV.call(this, key, value);
+            }
+            else {
+                if (!this.style) {
+                    this.useStyle(value);
+                }
+                else {
+                    this.setStyle(value);
+                }
+            }
+        };
+        Displayable.prototype.setStyle = function (keyOrObj, value) {
+            if (typeof keyOrObj === 'string') {
+                this.style[keyOrObj] = value;
+            }
+            else {
+                extend(this.style, keyOrObj);
+            }
+            this.dirtyStyle();
+            return this;
+        };
+        Displayable.prototype.dirtyStyle = function (notRedraw) {
+            if (!notRedraw) {
+                this.markRedraw();
+            }
+            this.__dirty |= STYLE_CHANGED_BIT;
+            if (this._rect) {
+                this._rect = null;
+            }
+        };
+        Displayable.prototype.dirty = function () {
+            this.dirtyStyle();
+        };
+        Displayable.prototype.styleChanged = function () {
+            return !!(this.__dirty & STYLE_CHANGED_BIT);
+        };
+        Displayable.prototype.styleUpdated = function () {
+            this.__dirty &= ~STYLE_CHANGED_BIT;
+        };
+        Displayable.prototype.createStyle = function (obj) {
+            return createObject(DEFAULT_COMMON_STYLE, obj);
+        };
+        Displayable.prototype.useStyle = function (obj) {
+            if (!obj[STYLE_MAGIC_KEY]) {
+                obj = this.createStyle(obj);
+            }
+            if (this.__inHover) {
+                this.__hoverStyle = obj;
+            }
+            else {
+                this.style = obj;
+            }
+            this.dirtyStyle();
+        };
+        Displayable.prototype.isStyleObject = function (obj) {
+            return obj[STYLE_MAGIC_KEY];
+        };
+        Displayable.prototype._innerSaveToNormal = function (toState) {
+            _super.prototype._innerSaveToNormal.call(this, toState);
+            var normalState = this._normalState;
+            if (toState.style && !normalState.style) {
+                normalState.style = this._mergeStyle(this.createStyle(), this.style);
+            }
+            this._savePrimaryToNormal(toState, normalState, PRIMARY_STATES_KEYS$1);
+        };
+        Displayable.prototype._applyStateObj = function (stateName, state, normalState, keepCurrentStates, transition, animationCfg) {
+            _super.prototype._applyStateObj.call(this, stateName, state, normalState, keepCurrentStates, transition, animationCfg);
+            var needsRestoreToNormal = !(state && keepCurrentStates);
+            var targetStyle;
+            if (state && state.style) {
+                if (transition) {
+                    if (keepCurrentStates) {
+                        targetStyle = state.style;
+                    }
+                    else {
+                        targetStyle = this._mergeStyle(this.createStyle(), normalState.style);
+                        this._mergeStyle(targetStyle, state.style);
+                    }
+                }
+                else {
+                    targetStyle = this._mergeStyle(this.createStyle(), keepCurrentStates ? this.style : normalState.style);
+                    this._mergeStyle(targetStyle, state.style);
+                }
+            }
+            else if (needsRestoreToNormal) {
+                targetStyle = normalState.style;
+            }
+            if (targetStyle) {
+                if (transition) {
+                    var sourceStyle = this.style;
+                    this.style = this.createStyle(needsRestoreToNormal ? {} : sourceStyle);
+                    if (needsRestoreToNormal) {
+                        var changedKeys = keys(sourceStyle);
+                        for (var i = 0; i < changedKeys.length; i++) {
+                            var key = changedKeys[i];
+                            if (key in targetStyle) {
+                                targetStyle[key] = targetStyle[key];
+                                this.style[key] = sourceStyle[key];
+                            }
+                        }
+                    }
+                    var targetKeys = keys(targetStyle);
+                    for (var i = 0; i < targetKeys.length; i++) {
+                        var key = targetKeys[i];
+                        this.style[key] = this.style[key];
+                    }
+                    this._transitionState(stateName, {
+                        style: targetStyle
+                    }, animationCfg, this.getAnimationStyleProps());
+                }
+                else {
+                    this.useStyle(targetStyle);
+                }
+            }
+            var statesKeys = this.__inHover ? PRIMARY_STATES_KEYS_IN_HOVER_LAYER : PRIMARY_STATES_KEYS$1;
+            for (var i = 0; i < statesKeys.length; i++) {
+                var key = statesKeys[i];
+                if (state && state[key] != null) {
+                    this[key] = state[key];
+                }
+                else if (needsRestoreToNormal) {
+                    if (normalState[key] != null) {
+                        this[key] = normalState[key];
+                    }
+                }
+            }
+        };
+        Displayable.prototype._mergeStates = function (states) {
+            var mergedState = _super.prototype._mergeStates.call(this, states);
+            var mergedStyle;
+            for (var i = 0; i < states.length; i++) {
+                var state = states[i];
+                if (state.style) {
+                    mergedStyle = mergedStyle || {};
+                    this._mergeStyle(mergedStyle, state.style);
+                }
+            }
+            if (mergedStyle) {
+                mergedState.style = mergedStyle;
+            }
+            return mergedState;
+        };
+        Displayable.prototype._mergeStyle = function (targetStyle, sourceStyle) {
+            extend(targetStyle, sourceStyle);
+            return targetStyle;
+        };
+        Displayable.prototype.getAnimationStyleProps = function () {
+            return DEFAULT_COMMON_ANIMATION_PROPS;
+        };
+        Displayable.initDefaultProps = (function () {
+            var dispProto = Displayable.prototype;
+            dispProto.type = 'displayable';
+            dispProto.invisible = false;
+            dispProto.z = 0;
+            dispProto.z2 = 0;
+            dispProto.zlevel = 0;
+            dispProto.culling = false;
+            dispProto.cursor = 'pointer';
+            dispProto.rectHover = false;
+            dispProto.incremental = false;
+            dispProto._rect = null;
+            dispProto.dirtyRectTolerance = 0;
+            dispProto.__dirty = REDRAW_BIT | STYLE_CHANGED_BIT;
+        })();
+        return Displayable;
+    }(Element));
+    var tmpRect$1 = new BoundingRect(0, 0, 0, 0);
+    var viewRect = new BoundingRect(0, 0, 0, 0);
+    function isDisplayableCulled(el, width, height) {
+        tmpRect$1.copy(el.getBoundingRect());
+        if (el.transform) {
+            tmpRect$1.applyTransform(el.transform);
+        }
+        viewRect.width = width;
+        viewRect.height = height;
+        return !tmpRect$1.intersect(viewRect);
+    }
+
+    var mathMin$1 = Math.min;
+    var mathMax$1 = Math.max;
+    var mathSin = Math.sin;
+    var mathCos = Math.cos;
+    var PI2 = Math.PI * 2;
+    var start = create();
+    var end = create();
+    var extremity = create();
+    function fromPoints(points, min, max) {
+        if (points.length === 0) {
+            return;
+        }
+        var p = points[0];
+        var left = p[0];
+        var right = p[0];
+        var top = p[1];
+        var bottom = p[1];
+        for (var i = 1; i < points.length; i++) {
+            p = points[i];
+            left = mathMin$1(left, p[0]);
+            right = mathMax$1(right, p[0]);
+            top = mathMin$1(top, p[1]);
+            bottom = mathMax$1(bottom, p[1]);
+        }
+        min[0] = left;
+        min[1] = top;
+        max[0] = right;
+        max[1] = bottom;
+    }
+    function fromLine(x0, y0, x1, y1, min, max) {
+        min[0] = mathMin$1(x0, x1);
+        min[1] = mathMin$1(y0, y1);
+        max[0] = mathMax$1(x0, x1);
+        max[1] = mathMax$1(y0, y1);
+    }
+    var xDim = [];
+    var yDim = [];
+    function fromCubic(x0, y0, x1, y1, x2, y2, x3, y3, min, max) {
+        var cubicExtrema$1 = cubicExtrema;
+        var cubicAt$1 = cubicAt;
+        var n = cubicExtrema$1(x0, x1, x2, x3, xDim);
+        min[0] = Infinity;
+        min[1] = Infinity;
+        max[0] = -Infinity;
+        max[1] = -Infinity;
+        for (var i = 0; i < n; i++) {
+            var x = cubicAt$1(x0, x1, x2, x3, xDim[i]);
+            min[0] = mathMin$1(x, min[0]);
+            max[0] = mathMax$1(x, max[0]);
+        }
+        n = cubicExtrema$1(y0, y1, y2, y3, yDim);
+        for (var i = 0; i < n; i++) {
+            var y = cubicAt$1(y0, y1, y2, y3, yDim[i]);
+            min[1] = mathMin$1(y, min[1]);
+            max[1] = mathMax$1(y, max[1]);
+        }
+        min[0] = mathMin$1(x0, min[0]);
+        max[0] = mathMax$1(x0, max[0]);
+        min[0] = mathMin$1(x3, min[0]);
+        max[0] = mathMax$1(x3, max[0]);
+        min[1] = mathMin$1(y0, min[1]);
+        max[1] = mathMax$1(y0, max[1]);
+        min[1] = mathMin$1(y3, min[1]);
+        max[1] = mathMax$1(y3, max[1]);
+    }
+    function fromQuadratic(x0, y0, x1, y1, x2, y2, min, max) {
+        var quadraticExtremum$1 = quadraticExtremum;
+        var quadraticAt$1 = quadraticAt;
+        var tx = mathMax$1(mathMin$1(quadraticExtremum$1(x0, x1, x2), 1), 0);
+        var ty = mathMax$1(mathMin$1(quadraticExtremum$1(y0, y1, y2), 1), 0);
+        var x = quadraticAt$1(x0, x1, x2, tx);
+        var y = quadraticAt$1(y0, y1, y2, ty);
+        min[0] = mathMin$1(x0, x2, x);
+        min[1] = mathMin$1(y0, y2, y);
+        max[0] = mathMax$1(x0, x2, x);
+        max[1] = mathMax$1(y0, y2, y);
+    }
+    function fromArc(x, y, rx, ry, startAngle, endAngle, anticlockwise, min$1, max$1) {
+        var vec2Min = min;
+        var vec2Max = max;
+        var diff = Math.abs(startAngle - endAngle);
+        if (diff % PI2 < 1e-4 && diff > 1e-4) {
+            min$1[0] = x - rx;
+            min$1[1] = y - ry;
+            max$1[0] = x + rx;
+            max$1[1] = y + ry;
+            return;
+        }
+        start[0] = mathCos(startAngle) * rx + x;
+        start[1] = mathSin(startAngle) * ry + y;
+        end[0] = mathCos(endAngle) * rx + x;
+        end[1] = mathSin(endAngle) * ry + y;
+        vec2Min(min$1, start, end);
+        vec2Max(max$1, start, end);
+        startAngle = startAngle % (PI2);
+        if (startAngle < 0) {
+            startAngle = startAngle + PI2;
+        }
+        endAngle = endAngle % (PI2);
+        if (endAngle < 0) {
+            endAngle = endAngle + PI2;
+        }
+        if (startAngle > endAngle && !anticlockwise) {
+            endAngle += PI2;
+        }
+        else if (startAngle < endAngle && anticlockwise) {
+            startAngle += PI2;
+        }
+        if (anticlockwise) {
+            var tmp = endAngle;
+            endAngle = startAngle;
+            startAngle = tmp;
+        }
+        for (var angle = 0; angle < endAngle; angle += Math.PI / 2) {
+            if (angle > startAngle) {
+                extremity[0] = mathCos(angle) * rx + x;
+                extremity[1] = mathSin(angle) * ry + y;
+                vec2Min(min$1, extremity, min$1);
+                vec2Max(max$1, extremity, max$1);
+            }
+        }
+    }
+
+    var CMD = {
+        M: 1,
+        L: 2,
+        C: 3,
+        Q: 4,
+        A: 5,
+        Z: 6,
+        R: 7
+    };
+    var tmpOutX = [];
+    var tmpOutY = [];
+    var min$1 = [];
+    var max$1 = [];
+    var min2 = [];
+    var max2 = [];
+    var mathMin$2 = Math.min;
+    var mathMax$2 = Math.max;
+    var mathCos$1 = Math.cos;
+    var mathSin$1 = Math.sin;
+    var mathAbs = Math.abs;
+    var PI = Math.PI;
+    var PI2$1 = PI * 2;
+    var hasTypedArray = typeof Float32Array !== 'undefined';
+    var tmpAngles = [];
+    function modPI2(radian) {
+        var n = Math.round(radian / PI * 1e8) / 1e8;
+        return (n % 2) * PI;
+    }
+    function normalizeArcAngles(angles, anticlockwise) {
+        var newStartAngle = modPI2(angles[0]);
+        if (newStartAngle < 0) {
+            newStartAngle += PI2$1;
+        }
+        var delta = newStartAngle - angles[0];
+        var newEndAngle = angles[1];
+        newEndAngle += delta;
+        if (!anticlockwise && newEndAngle - newStartAngle >= PI2$1) {
+            newEndAngle = newStartAngle + PI2$1;
+        }
+        else if (anticlockwise && newStartAngle - newEndAngle >= PI2$1) {
+            newEndAngle = newStartAngle - PI2$1;
+        }
+        else if (!anticlockwise && newStartAngle > newEndAngle) {
+            newEndAngle = newStartAngle + (PI2$1 - modPI2(newStartAngle - newEndAngle));
+        }
+        else if (anticlockwise && newStartAngle < newEndAngle) {
+            newEndAngle = newStartAngle - (PI2$1 - modPI2(newEndAngle - newStartAngle));
+        }
+        angles[0] = newStartAngle;
+        angles[1] = newEndAngle;
+    }
+    var PathProxy = (function () {
+        function PathProxy(notSaveData) {
+            this.dpr = 1;
+            this._xi = 0;
+            this._yi = 0;
+            this._x0 = 0;
+            this._y0 = 0;
+            this._len = 0;
+            if (notSaveData) {
+                this._saveData = false;
+            }
+            if (this._saveData) {
+                this.data = [];
+            }
+        }
+        PathProxy.prototype.increaseVersion = function () {
+            this._version++;
+        };
+        PathProxy.prototype.getVersion = function () {
+            return this._version;
+        };
+        PathProxy.prototype.setScale = function (sx, sy, segmentIgnoreThreshold) {
+            segmentIgnoreThreshold = segmentIgnoreThreshold || 0;
+            if (segmentIgnoreThreshold > 0) {
+                this._ux = mathAbs(segmentIgnoreThreshold / devicePixelRatio / sx) || 0;
+                this._uy = mathAbs(segmentIgnoreThreshold / devicePixelRatio / sy) || 0;
+            }
+        };
+        PathProxy.prototype.setDPR = function (dpr) {
+            this.dpr = dpr;
+        };
+        PathProxy.prototype.setContext = function (ctx) {
+            this._ctx = ctx;
+        };
+        PathProxy.prototype.getContext = function () {
+            return this._ctx;
+        };
+        PathProxy.prototype.beginPath = function () {
+            this._ctx && this._ctx.beginPath();
+            this.reset();
+            return this;
+        };
+        PathProxy.prototype.reset = function () {
+            if (this._saveData) {
+                this._len = 0;
+            }
+            if (this._pathSegLen) {
+                this._pathSegLen = null;
+                this._pathLen = 0;
+            }
+            this._version++;
+        };
+        PathProxy.prototype.moveTo = function (x, y) {
+            this._drawPendingPt();
+            this.addData(CMD.M, x, y);
+            this._ctx && this._ctx.moveTo(x, y);
+            this._x0 = x;
+            this._y0 = y;
+            this._xi = x;
+            this._yi = y;
+            return this;
+        };
+        PathProxy.prototype.lineTo = function (x, y) {
+            var dx = mathAbs(x - this._xi);
+            var dy = mathAbs(y - this._yi);
+            var exceedUnit = dx > this._ux || dy > this._uy;
+            this.addData(CMD.L, x, y);
+            if (this._ctx && exceedUnit) {
+                this._ctx.lineTo(x, y);
+            }
+            if (exceedUnit) {
+                this._xi = x;
+                this._yi = y;
+                this._pendingPtDist = 0;
+            }
+            else {
+                var d2 = dx * dx + dy * dy;
+                if (d2 > this._pendingPtDist) {
+                    this._pendingPtX = x;
+                    this._pendingPtY = y;
+                    this._pendingPtDist = d2;
+                }
+            }
+            return this;
+        };
+        PathProxy.prototype.bezierCurveTo = function (x1, y1, x2, y2, x3, y3) {
+            this._drawPendingPt();
+            this.addData(CMD.C, x1, y1, x2, y2, x3, y3);
+            if (this._ctx) {
+                this._ctx.bezierCurveTo(x1, y1, x2, y2, x3, y3);
+            }
+            this._xi = x3;
+            this._yi = y3;
+            return this;
+        };
+        PathProxy.prototype.quadraticCurveTo = function (x1, y1, x2, y2) {
+            this._drawPendingPt();
+            this.addData(CMD.Q, x1, y1, x2, y2);
+            if (this._ctx) {
+                this._ctx.quadraticCurveTo(x1, y1, x2, y2);
+            }
+            this._xi = x2;
+            this._yi = y2;
+            return this;
+        };
+        PathProxy.prototype.arc = function (cx, cy, r, startAngle, endAngle, anticlockwise) {
+            this._drawPendingPt();
+            tmpAngles[0] = startAngle;
+            tmpAngles[1] = endAngle;
+            normalizeArcAngles(tmpAngles, anticlockwise);
+            startAngle = tmpAngles[0];
+            endAngle = tmpAngles[1];
+            var delta = endAngle - startAngle;
+            this.addData(CMD.A, cx, cy, r, r, startAngle, delta, 0, anticlockwise ? 0 : 1);
+            this._ctx && this._ctx.arc(cx, cy, r, startAngle, endAngle, anticlockwise);
+            this._xi = mathCos$1(endAngle) * r + cx;
+            this._yi = mathSin$1(endAngle) * r + cy;
+            return this;
+        };
+        PathProxy.prototype.arcTo = function (x1, y1, x2, y2, radius) {
+            this._drawPendingPt();
+            if (this._ctx) {
+                this._ctx.arcTo(x1, y1, x2, y2, radius);
+            }
+            return this;
+        };
+        PathProxy.prototype.rect = function (x, y, w, h) {
+            this._drawPendingPt();
+            this._ctx && this._ctx.rect(x, y, w, h);
+            this.addData(CMD.R, x, y, w, h);
+            return this;
+        };
+        PathProxy.prototype.closePath = function () {
+            this._drawPendingPt();
+            this.addData(CMD.Z);
+            var ctx = this._ctx;
+            var x0 = this._x0;
+            var y0 = this._y0;
+            if (ctx) {
+                ctx.closePath();
+            }
+            this._xi = x0;
+            this._yi = y0;
+            return this;
+        };
+        PathProxy.prototype.fill = function (ctx) {
+            ctx && ctx.fill();
+            this.toStatic();
+        };
+        PathProxy.prototype.stroke = function (ctx) {
+            ctx && ctx.stroke();
+            this.toStatic();
+        };
+        PathProxy.prototype.len = function () {
+            return this._len;
+        };
+        PathProxy.prototype.setData = function (data) {
+            var len = data.length;
+            if (!(this.data && this.data.length === len) && hasTypedArray) {
+                this.data = new Float32Array(len);
+            }
+            for (var i = 0; i < len; i++) {
+                this.data[i] = data[i];
+            }
+            this._len = len;
+        };
+        PathProxy.prototype.appendPath = function (path) {
+            if (!(path instanceof Array)) {
+                path = [path];
+            }
+            var len = path.length;
+            var appendSize = 0;
+            var offset = this._len;
+            for (var i = 0; i < len; i++) {
+                appendSize += path[i].len();
+            }
+            if (hasTypedArray && (this.data instanceof Float32Array)) {
+                this.data = new Float32Array(offset + appendSize);
+            }
+            for (var i = 0; i < len; i++) {
+                var appendPathData = path[i].data;
+                for (var k = 0; k < appendPathData.length; k++) {
+                    this.data[offset++] = appendPathData[k];
+                }
+            }
+            this._len = offset;
+        };
+        PathProxy.prototype.addData = function (cmd, a, b, c, d, e, f, g, h) {
+            if (!this._saveData) {
+                return;
+            }
+            var data = this.data;
+            if (this._len + arguments.length > data.length) {
+                this._expandData();
+                data = this.data;
+            }
+            for (var i = 0; i < arguments.length; i++) {
+                data[this._len++] = arguments[i];
+            }
+        };
+        PathProxy.prototype._drawPendingPt = function () {
+            if (this._pendingPtDist > 0) {
+                this._ctx && this._ctx.lineTo(this._pendingPtX, this._pendingPtY);
+                this._pendingPtDist = 0;
+            }
+        };
+        PathProxy.prototype._expandData = function () {
+            if (!(this.data instanceof Array)) {
+                var newData = [];
+                for (var i = 0; i < this._len; i++) {
+                    newData[i] = this.data[i];
+                }
+                this.data = newData;
+            }
+        };
+        PathProxy.prototype.toStatic = function () {
+            if (!this._saveData) {
+                return;
+            }
+            this._drawPendingPt();
+            var data = this.data;
+            if (data instanceof Array) {
+                data.length = this._len;
+                if (hasTypedArray && this._len > 11) {
+                    this.data = new Float32Array(data);
+                }
+            }
+        };
+        PathProxy.prototype.getBoundingRect = function () {
+            min$1[0] = min$1[1] = min2[0] = min2[1] = Number.MAX_VALUE;
+            max$1[0] = max$1[1] = max2[0] = max2[1] = -Number.MAX_VALUE;
+            var data = this.data;
+            var xi = 0;
+            var yi = 0;
+            var x0 = 0;
+            var y0 = 0;
+            var i;
+            for (i = 0; i < this._len;) {
+                var cmd = data[i++];
+                var isFirst = i === 1;
+                if (isFirst) {
+                    xi = data[i];
+                    yi = data[i + 1];
+                    x0 = xi;
+                    y0 = yi;
+                }
+                switch (cmd) {
+                    case CMD.M:
+                        xi = x0 = data[i++];
+                        yi = y0 = data[i++];
+                        min2[0] = x0;
+                        min2[1] = y0;
+                        max2[0] = x0;
+                        max2[1] = y0;
+                        break;
+                    case CMD.L:
+                        fromLine(xi, yi, data[i], data[i + 1], min2, max2);
+                        xi = data[i++];
+                        yi = data[i++];
+                        break;
+                    case CMD.C:
+                        fromCubic(xi, yi, data[i++], data[i++], data[i++], data[i++], data[i], data[i + 1], min2, max2);
+                        xi = data[i++];
+                        yi = data[i++];
+                        break;
+                    case CMD.Q:
+                        fromQuadratic(xi, yi, data[i++], data[i++], data[i], data[i + 1], min2, max2);
+                        xi = data[i++];
+                        yi = data[i++];
+                        break;
+                    case CMD.A:
+                        var cx = data[i++];
+                        var cy = data[i++];
+                        var rx = data[i++];
+                        var ry = data[i++];
+                        var startAngle = data[i++];
+                        var endAngle = data[i++] + startAngle;
+                        i += 1;
+                        var anticlockwise = !data[i++];
+                        if (isFirst) {
+                            x0 = mathCos$1(startAngle) * rx + cx;
+                            y0 = mathSin$1(startAngle) * ry + cy;
+                        }
+                        fromArc(cx, cy, rx, ry, startAngle, endAngle, anticlockwise, min2, max2);
+                        xi = mathCos$1(endAngle) * rx + cx;
+                        yi = mathSin$1(endAngle) * ry + cy;
+                        break;
+                    case CMD.R:
+                        x0 = xi = data[i++];
+                        y0 = yi = data[i++];
+                        var width = data[i++];
+                        var height = data[i++];
+                        fromLine(x0, y0, x0 + width, y0 + height, min2, max2);
+                        break;
+                    case CMD.Z:
+                        xi = x0;
+                        yi = y0;
+                        break;
+                }
+                min(min$1, min$1, min2);
+                max(max$1, max$1, max2);
+            }
+            if (i === 0) {
+                min$1[0] = min$1[1] = max$1[0] = max$1[1] = 0;
+            }
+            return new BoundingRect(min$1[0], min$1[1], max$1[0] - min$1[0], max$1[1] - min$1[1]);
+        };
+        PathProxy.prototype._calculateLength = function () {
+            var data = this.data;
+            var len = this._len;
+            var ux = this._ux;
+            var uy = this._uy;
+            var xi = 0;
+            var yi = 0;
+            var x0 = 0;
+            var y0 = 0;
+            if (!this._pathSegLen) {
+                this._pathSegLen = [];
+            }
+            var pathSegLen = this._pathSegLen;
+            var pathTotalLen = 0;
+            var segCount = 0;
+            for (var i = 0; i < len;) {
+                var cmd = data[i++];
+                var isFirst = i === 1;
+                if (isFirst) {
+                    xi = data[i];
+                    yi = data[i + 1];
+                    x0 = xi;
+                    y0 = yi;
+                }
+                var l = -1;
+                switch (cmd) {
+                    case CMD.M:
+                        xi = x0 = data[i++];
+                        yi = y0 = data[i++];
+                        break;
+                    case CMD.L: {
+                        var x2 = data[i++];
+                        var y2 = data[i++];
+                        var dx = x2 - xi;
+                        var dy = y2 - yi;
+                        if (mathAbs(dx) > ux || mathAbs(dy) > uy || i === len - 1) {
+                            l = Math.sqrt(dx * dx + dy * dy);
+                            xi = x2;
+                            yi = y2;
+                        }
+                        break;
+                    }
+                    case CMD.C: {
+                        var x1 = data[i++];
+                        var y1 = data[i++];
+                        var x2 = data[i++];
+                        var y2 = data[i++];
+                        var x3 = data[i++];
+                        var y3 = data[i++];
+                        l = cubicLength(xi, yi, x1, y1, x2, y2, x3, y3, 10);
+                        xi = x3;
+                        yi = y3;
+                        break;
+                    }
+                    case CMD.Q: {
+                        var x1 = data[i++];
+                        var y1 = data[i++];
+                        var x2 = data[i++];
+                        var y2 = data[i++];
+                        l = quadraticLength(xi, yi, x1, y1, x2, y2, 10);
+                        xi = x2;
+                        yi = y2;
+                        break;
+                    }
+                    case CMD.A:
+                        var cx = data[i++];
+                        var cy = data[i++];
+                        var rx = data[i++];
+                        var ry = data[i++];
+                        var startAngle = data[i++];
+                        var delta = data[i++];
+                        var endAngle = delta + startAngle;
+                        i += 1;
+                        if (isFirst) {
+                            x0 = mathCos$1(startAngle) * rx + cx;
+                            y0 = mathSin$1(startAngle) * ry + cy;
+                        }
+                        l = mathMax$2(rx, ry) * mathMin$2(PI2$1, Math.abs(delta));
+                        xi = mathCos$1(endAngle) * rx + cx;
+                        yi = mathSin$1(endAngle) * ry + cy;
+                        break;
+                    case CMD.R: {
+                        x0 = xi = data[i++];
+                        y0 = yi = data[i++];
+                        var width = data[i++];
+                        var height = data[i++];
+                        l = width * 2 + height * 2;
+                        break;
+                    }
+                    case CMD.Z: {
+                        var dx = x0 - xi;
+                        var dy = y0 - yi;
+                        l = Math.sqrt(dx * dx + dy * dy);
+                        xi = x0;
+                        yi = y0;
+                        break;
+                    }
+                }
+                if (l >= 0) {
+                    pathSegLen[segCount++] = l;
+                    pathTotalLen += l;
+                }
+            }
+            this._pathLen = pathTotalLen;
+            return pathTotalLen;
+        };
+        PathProxy.prototype.rebuildPath = function (ctx, percent) {
+            var d = this.data;
+            var ux = this._ux;
+            var uy = this._uy;
+            var len = this._len;
+            var x0;
+            var y0;
+            var xi;
+            var yi;
+            var x;
+            var y;
+            var drawPart = percent < 1;
+            var pathSegLen;
+            var pathTotalLen;
+            var accumLength = 0;
+            var segCount = 0;
+            var displayedLength;
+            var pendingPtDist = 0;
+            var pendingPtX;
+            var pendingPtY;
+            if (drawPart) {
+                if (!this._pathSegLen) {
+                    this._calculateLength();
+                }
+                pathSegLen = this._pathSegLen;
+                pathTotalLen = this._pathLen;
+                displayedLength = percent * pathTotalLen;
+                if (!displayedLength) {
+                    return;
+                }
+            }
+            lo: for (var i = 0; i < len;) {
+                var cmd = d[i++];
+                var isFirst = i === 1;
+                if (isFirst) {
+                    xi = d[i];
+                    yi = d[i + 1];
+                    x0 = xi;
+                    y0 = yi;
+                }
+                if (cmd !== CMD.L && pendingPtDist > 0) {
+                    ctx.lineTo(pendingPtX, pendingPtY);
+                    pendingPtDist = 0;
+                }
+                switch (cmd) {
+                    case CMD.M:
+                        x0 = xi = d[i++];
+                        y0 = yi = d[i++];
+                        ctx.moveTo(xi, yi);
+                        break;
+                    case CMD.L: {
+                        x = d[i++];
+                        y = d[i++];
+                        var dx = mathAbs(x - xi);
+                        var dy = mathAbs(y - yi);
+                        if (dx > ux || dy > uy) {
+                            if (drawPart) {
+                                var l = pathSegLen[segCount++];
+                                if (accumLength + l > displayedLength) {
+                                    var t = (displayedLength - accumLength) / l;
+                                    ctx.lineTo(xi * (1 - t) + x * t, yi * (1 - t) + y * t);
+                                    break lo;
+                                }
+                                accumLength += l;
+                            }
+                            ctx.lineTo(x, y);
+                            xi = x;
+                            yi = y;
+                            pendingPtDist = 0;
+                        }
+                        else {
+                            var d2 = dx * dx + dy * dy;
+                            if (d2 > pendingPtDist) {
+                                pendingPtX = x;
+                                pendingPtY = y;
+                                pendingPtDist = d2;
+                            }
+                        }
+                        break;
+                    }
+                    case CMD.C: {
+                        var x1 = d[i++];
+                        var y1 = d[i++];
+                        var x2 = d[i++];
+                        var y2 = d[i++];
+                        var x3 = d[i++];
+                        var y3 = d[i++];
+                        if (drawPart) {
+                            var l = pathSegLen[segCount++];
+                            if (accumLength + l > displayedLength) {
+                                var t = (displayedLength - accumLength) / l;
+                                cubicSubdivide(xi, x1, x2, x3, t, tmpOutX);
+                                cubicSubdivide(yi, y1, y2, y3, t, tmpOutY);
+                                ctx.bezierCurveTo(tmpOutX[1], tmpOutY[1], tmpOutX[2], tmpOutY[2], tmpOutX[3], tmpOutY[3]);
+                                break lo;
+                            }
+                            accumLength += l;
+                        }
+                        ctx.bezierCurveTo(x1, y1, x2, y2, x3, y3);
+                        xi = x3;
+                        yi = y3;
+                        break;
+                    }
+                    case CMD.Q: {
+                        var x1 = d[i++];
+                        var y1 = d[i++];
+                        var x2 = d[i++];
+                        var y2 = d[i++];
+                        if (drawPart) {
+                            var l = pathSegLen[segCount++];
+                            if (accumLength + l > displayedLength) {
+                                var t = (displayedLength - accumLength) / l;
+                                quadraticSubdivide(xi, x1, x2, t, tmpOutX);
+                                quadraticSubdivide(yi, y1, y2, t, tmpOutY);
+                                ctx.quadraticCurveTo(tmpOutX[1], tmpOutY[1], tmpOutX[2], tmpOutY[2]);
+                                break lo;
+                            }
+                            accumLength += l;
+                        }
+                        ctx.quadraticCurveTo(x1, y1, x2, y2);
+                        xi = x2;
+                        yi = y2;
+                        break;
+                    }
+                    case CMD.A:
+                        var cx = d[i++];
+                        var cy = d[i++];
+                        var rx = d[i++];
+                        var ry = d[i++];
+                        var startAngle = d[i++];
+                        var delta = d[i++];
+                        var psi = d[i++];
+                        var anticlockwise = !d[i++];
+                        var r = (rx > ry) ? rx : ry;
+                        var isEllipse = mathAbs(rx - ry) > 1e-3;
+                        var endAngle = startAngle + delta;
+                        var breakBuild = false;
+                        if (drawPart) {
+                            var l = pathSegLen[segCount++];
+                            if (accumLength + l > displayedLength) {
+                                endAngle = startAngle + delta * (displayedLength - accumLength) / l;
+                                breakBuild = true;
+                            }
+                            accumLength += l;
+                        }
+                        if (isEllipse && ctx.ellipse) {
+                            ctx.ellipse(cx, cy, rx, ry, psi, startAngle, endAngle, anticlockwise);
+                        }
+                        else {
+                            ctx.arc(cx, cy, r, startAngle, endAngle, anticlockwise);
+                        }
+                        if (breakBuild) {
+                            break lo;
+                        }
+                        if (isFirst) {
+                            x0 = mathCos$1(startAngle) * rx + cx;
+                            y0 = mathSin$1(startAngle) * ry + cy;
+                        }
+                        xi = mathCos$1(endAngle) * rx + cx;
+                        yi = mathSin$1(endAngle) * ry + cy;
+                        break;
+                    case CMD.R:
+                        x0 = xi = d[i];
+                        y0 = yi = d[i + 1];
+                        x = d[i++];
+                        y = d[i++];
+                        var width = d[i++];
+                        var height = d[i++];
+                        if (drawPart) {
+                            var l = pathSegLen[segCount++];
+                            if (accumLength + l > displayedLength) {
+                                var d_1 = displayedLength - accumLength;
+                                ctx.moveTo(x, y);
+                                ctx.lineTo(x + mathMin$2(d_1, width), y);
+                                d_1 -= width;
+                                if (d_1 > 0) {
+                                    ctx.lineTo(x + width, y + mathMin$2(d_1, height));
+                                }
+                                d_1 -= height;
+                                if (d_1 > 0) {
+                                    ctx.lineTo(x + mathMax$2(width - d_1, 0), y + height);
+                                }
+                                d_1 -= width;
+                                if (d_1 > 0) {
+                                    ctx.lineTo(x, y + mathMax$2(height - d_1, 0));
+                                }
+                                break lo;
+                            }
+                            accumLength += l;
+                        }
+                        ctx.rect(x, y, width, height);
+                        break;
+                    case CMD.Z:
+                        if (drawPart) {
+                            var l = pathSegLen[segCount++];
+                            if (accumLength + l > displayedLength) {
+                                var t = (displayedLength - accumLength) / l;
+                                ctx.lineTo(xi * (1 - t) + x0 * t, yi * (1 - t) + y0 * t);
+                                break lo;
+                            }
+                            accumLength += l;
+                        }
+                        ctx.closePath();
+                        xi = x0;
+                        yi = y0;
+                }
+            }
+        };
+        PathProxy.prototype.clone = function () {
+            var newProxy = new PathProxy();
+            var data = this.data;
+            newProxy.data = data.slice ? data.slice()
+                : Array.prototype.slice.call(data);
+            newProxy._len = this._len;
+            return newProxy;
+        };
+        PathProxy.CMD = CMD;
+        PathProxy.initDefaultProps = (function () {
+            var proto = PathProxy.prototype;
+            proto._saveData = true;
+            proto._ux = 0;
+            proto._uy = 0;
+            proto._pendingPtDist = 0;
+            proto._version = 0;
+        })();
+        return PathProxy;
+    }());
+
+    function containStroke(x0, y0, x1, y1, lineWidth, x, y) {
+        if (lineWidth === 0) {
+            return false;
+        }
+        var _l = lineWidth;
+        var _a = 0;
+        var _b = x0;
+        if ((y > y0 + _l && y > y1 + _l)
+            || (y < y0 - _l && y < y1 - _l)
+            || (x > x0 + _l && x > x1 + _l)
+            || (x < x0 - _l && x < x1 - _l)) {
+            return false;
+        }
+        if (x0 !== x1) {
+            _a = (y0 - y1) / (x0 - x1);
+            _b = (x0 * y1 - x1 * y0) / (x0 - x1);
+        }
+        else {
+            return Math.abs(x - x0) <= _l / 2;
+        }
+        var tmp = _a * x - y + _b;
+        var _s = tmp * tmp / (_a * _a + 1);
+        return _s <= _l / 2 * _l / 2;
+    }
+
+    function containStroke$1(x0, y0, x1, y1, x2, y2, x3, y3, lineWidth, x, y) {
+        if (lineWidth === 0) {
+            return false;
+        }
+        var _l = lineWidth;
+        if ((y > y0 + _l && y > y1 + _l && y > y2 + _l && y > y3 + _l)
+            || (y < y0 - _l && y < y1 - _l && y < y2 - _l && y < y3 - _l)
+            || (x > x0 + _l && x > x1 + _l && x > x2 + _l && x > x3 + _l)
+            || (x < x0 - _l && x < x1 - _l && x < x2 - _l && x < x3 - _l)) {
+            return false;
+        }
+        var d = cubicProjectPoint(x0, y0, x1, y1, x2, y2, x3, y3, x, y, null);
+        return d <= _l / 2;
+    }
+
+    function containStroke$2(x0, y0, x1, y1, x2, y2, lineWidth, x, y) {
+        if (lineWidth === 0) {
+            return false;
+        }
+        var _l = lineWidth;
+        if ((y > y0 + _l && y > y1 + _l && y > y2 + _l)
+            || (y < y0 - _l && y < y1 - _l && y < y2 - _l)
+            || (x > x0 + _l && x > x1 + _l && x > x2 + _l)
+            || (x < x0 - _l && x < x1 - _l && x < x2 - _l)) {
+            return false;
+        }
+        var d = quadraticProjectPoint(x0, y0, x1, y1, x2, y2, x, y, null);
+        return d <= _l / 2;
+    }
+
+    var PI2$2 = Math.PI * 2;
+    function normalizeRadian(angle) {
+        angle %= PI2$2;
+        if (angle < 0) {
+            angle += PI2$2;
+        }
+        return angle;
+    }
+
+    var PI2$3 = Math.PI * 2;
+    function containStroke$3(cx, cy, r, startAngle, endAngle, anticlockwise, lineWidth, x, y) {
+        if (lineWidth === 0) {
+            return false;
+        }
+        var _l = lineWidth;
+        x -= cx;
+        y -= cy;
+        var d = Math.sqrt(x * x + y * y);
+        if ((d - _l > r) || (d + _l < r)) {
+            return false;
+        }
+        if (Math.abs(startAngle - endAngle) % PI2$3 < 1e-4) {
+            return true;
+        }
+        if (anticlockwise) {
+            var tmp = startAngle;
+            startAngle = normalizeRadian(endAngle);
+            endAngle = normalizeRadian(tmp);
+        }
+        else {
+            startAngle = normalizeRadian(startAngle);
+            endAngle = normalizeRadian(endAngle);
+        }
+        if (startAngle > endAngle) {
+            endAngle += PI2$3;
+        }
+        var angle = Math.atan2(y, x);
+        if (angle < 0) {
+            angle += PI2$3;
+        }
+        return (angle >= startAngle && angle <= endAngle)
+            || (angle + PI2$3 >= startAngle && angle + PI2$3 <= endAngle);
+    }
+
+    function windingLine(x0, y0, x1, y1, x, y) {
+        if ((y > y0 && y > y1) || (y < y0 && y < y1)) {
+            return 0;
+        }
+        if (y1 === y0) {
+            return 0;
+        }
+        var t = (y - y0) / (y1 - y0);
+        var dir = y1 < y0 ? 1 : -1;
+        if (t === 1 || t === 0) {
+            dir = y1 < y0 ? 0.5 : -0.5;
+        }
+        var x_ = t * (x1 - x0) + x0;
+        return x_ === x ? Infinity : x_ > x ? dir : 0;
+    }
+
+    var CMD$1 = PathProxy.CMD;
+    var PI2$4 = Math.PI * 2;
+    var EPSILON$3 = 1e-4;
+    function isAroundEqual(a, b) {
+        return Math.abs(a - b) < EPSILON$3;
+    }
+    var roots = [-1, -1, -1];
+    var extrema = [-1, -1];
+    function swapExtrema() {
+        var tmp = extrema[0];
+        extrema[0] = extrema[1];
+        extrema[1] = tmp;
+    }
+    function windingCubic(x0, y0, x1, y1, x2, y2, x3, y3, x, y) {
+        if ((y > y0 && y > y1 && y > y2 && y > y3)
+            || (y < y0 && y < y1 && y < y2 && y < y3)) {
+            return 0;
+        }
+        var nRoots = cubicRootAt(y0, y1, y2, y3, y, roots);
+        if (nRoots === 0) {
+            return 0;
+        }
+        else {
+            var w = 0;
+            var nExtrema = -1;
+            var y0_ = void 0;
+            var y1_ = void 0;
+            for (var i = 0; i < nRoots; i++) {
+                var t = roots[i];
+                var unit = (t === 0 || t === 1) ? 0.5 : 1;
+                var x_ = cubicAt(x0, x1, x2, x3, t);
+                if (x_ < x) {
+                    continue;
+                }
+                if (nExtrema < 0) {
+                    nExtrema = cubicExtrema(y0, y1, y2, y3, extrema);
+                    if (extrema[1] < extrema[0] && nExtrema > 1) {
+                        swapExtrema();
+                    }
+                    y0_ = cubicAt(y0, y1, y2, y3, extrema[0]);
+                    if (nExtrema > 1) {
+                        y1_ = cubicAt(y0, y1, y2, y3, extrema[1]);
+                    }
+                }
+                if (nExtrema === 2) {
+                    if (t < extrema[0]) {
+                        w += y0_ < y0 ? unit : -unit;
+                    }
+                    else if (t < extrema[1]) {
+                        w += y1_ < y0_ ? unit : -unit;
+                    }
+                    else {
+                        w += y3 < y1_ ? unit : -unit;
+                    }
+                }
+                else {
+                    if (t < extrema[0]) {
+                        w += y0_ < y0 ? unit : -unit;
+                    }
+                    else {
+                        w += y3 < y0_ ? unit : -unit;
+                    }
+                }
+            }
+            return w;
+        }
+    }
+    function windingQuadratic(x0, y0, x1, y1, x2, y2, x, y) {
+        if ((y > y0 && y > y1 && y > y2)
+            || (y < y0 && y < y1 && y < y2)) {
+            return 0;
+        }
+        var nRoots = quadraticRootAt(y0, y1, y2, y, roots);
+        if (nRoots === 0) {
+            return 0;
+        }
+        else {
+            var t = quadraticExtremum(y0, y1, y2);
+            if (t >= 0 && t <= 1) {
+                var w = 0;
+                var y_ = quadraticAt(y0, y1, y2, t);
+                for (var i = 0; i < nRoots; i++) {
+                    var unit = (roots[i] === 0 || roots[i] === 1) ? 0.5 : 1;
+                    var x_ = quadraticAt(x0, x1, x2, roots[i]);
+                    if (x_ < x) {
+                        continue;
+                    }
+                    if (roots[i] < t) {
+                        w += y_ < y0 ? unit : -unit;
+                    }
+                    else {
+                        w += y2 < y_ ? unit : -unit;
+                    }
+                }
+                return w;
+            }
+            else {
+                var unit = (roots[0] === 0 || roots[0] === 1) ? 0.5 : 1;
+                var x_ = quadraticAt(x0, x1, x2, roots[0]);
+                if (x_ < x) {
+                    return 0;
+                }
+                return y2 < y0 ? unit : -unit;
+            }
+        }
+    }
+    function windingArc(cx, cy, r, startAngle, endAngle, anticlockwise, x, y) {
+        y -= cy;
+        if (y > r || y < -r) {
+            return 0;
+        }
+        var tmp = Math.sqrt(r * r - y * y);
+        roots[0] = -tmp;
+        roots[1] = tmp;
+        var dTheta = Math.abs(startAngle - endAngle);
+        if (dTheta < 1e-4) {
+            return 0;
+        }
+        if (dTheta >= PI2$4 - 1e-4) {
+            startAngle = 0;
+            endAngle = PI2$4;
+            var dir = anticlockwise ? 1 : -1;
+            if (x >= roots[0] + cx && x <= roots[1] + cx) {
+                return dir;
+            }
+            else {
+                return 0;
+            }
+        }
+        if (startAngle > endAngle) {
+            var tmp_1 = startAngle;
+            startAngle = endAngle;
+            endAngle = tmp_1;
+        }
+        if (startAngle < 0) {
+            startAngle += PI2$4;
+            endAngle += PI2$4;
+        }
+        var w = 0;
+        for (var i = 0; i < 2; i++) {
+            var x_ = roots[i];
+            if (x_ + cx > x) {
+                var angle = Math.atan2(y, x_);
+                var dir = anticlockwise ? 1 : -1;
+                if (angle < 0) {
+                    angle = PI2$4 + angle;
+                }
+                if ((angle >= startAngle && angle <= endAngle)
+                    || (angle + PI2$4 >= startAngle && angle + PI2$4 <= endAngle)) {
+                    if (angle > Math.PI / 2 && angle < Math.PI * 1.5) {
+                        dir = -dir;
+                    }
+                    w += dir;
+                }
+            }
+        }
+        return w;
+    }
+    function containPath(path, lineWidth, isStroke, x, y) {
+        var data = path.data;
+        var len = path.len();
+        var w = 0;
+        var xi = 0;
+        var yi = 0;
+        var x0 = 0;
+        var y0 = 0;
+        var x1;
+        var y1;
+        for (var i = 0; i < len;) {
+            var cmd = data[i++];
+            var isFirst = i === 1;
+            if (cmd === CMD$1.M && i > 1) {
+                if (!isStroke) {
+                    w += windingLine(xi, yi, x0, y0, x, y);
+                }
+            }
+            if (isFirst) {
+                xi = data[i];
+                yi = data[i + 1];
+                x0 = xi;
+                y0 = yi;
+            }
+            switch (cmd) {
+                case CMD$1.M:
+                    x0 = data[i++];
+                    y0 = data[i++];
+                    xi = x0;
+                    yi = y0;
+                    break;
+                case CMD$1.L:
+                    if (isStroke) {
+                        if (containStroke(xi, yi, data[i], data[i + 1], lineWidth, x, y)) {
+                            return true;
+                        }
+                    }
+                    else {
+                        w += windingLine(xi, yi, data[i], data[i + 1], x, y) || 0;
+                    }
+                    xi = data[i++];
+                    yi = data[i++];
+                    break;
+                case CMD$1.C:
+                    if (isStroke) {
+                        if (containStroke$1(xi, yi, data[i++], data[i++], data[i++], data[i++], data[i], data[i + 1], lineWidth, x, y)) {
+                            return true;
+                        }
+                    }
+                    else {
+                        w += windingCubic(xi, yi, data[i++], data[i++], data[i++], data[i++], data[i], data[i + 1], x, y) || 0;
+                    }
+                    xi = data[i++];
+                    yi = data[i++];
+                    break;
+                case CMD$1.Q:
+                    if (isStroke) {
+                        if (containStroke$2(xi, yi, data[i++], data[i++], data[i], data[i + 1], lineWidth, x, y)) {
+                            return true;
+                        }
+                    }
+                    else {
+                        w += windingQuadratic(xi, yi, data[i++], data[i++], data[i], data[i + 1], x, y) || 0;
+                    }
+                    xi = data[i++];
+                    yi = data[i++];
+                    break;
+                case CMD$1.A:
+                    var cx = data[i++];
+                    var cy = data[i++];
+                    var rx = data[i++];
+                    var ry = data[i++];
+                    var theta = data[i++];
+                    var dTheta = data[i++];
+                    i += 1;
+                    var anticlockwise = !!(1 - data[i++]);
+                    x1 = Math.cos(theta) * rx + cx;
+                    y1 = Math.sin(theta) * ry + cy;
+                    if (!isFirst) {
+                        w += windingLine(xi, yi, x1, y1, x, y);
+                    }
+                    else {
+                        x0 = x1;
+                        y0 = y1;
+                    }
+                    var _x = (x - cx) * ry / rx + cx;
+                    if (isStroke) {
+                        if (containStroke$3(cx, cy, ry, theta, theta + dTheta, anticlockwise, lineWidth, _x, y)) {
+                            return true;
+                        }
+                    }
+                    else {
+                        w += windingArc(cx, cy, ry, theta, theta + dTheta, anticlockwise, _x, y);
+                    }
+                    xi = Math.cos(theta + dTheta) * rx + cx;
+                    yi = Math.sin(theta + dTheta) * ry + cy;
+                    break;
+                case CMD$1.R:
+                    x0 = xi = data[i++];
+                    y0 = yi = data[i++];
+                    var width = data[i++];
+                    var height = data[i++];
+                    x1 = x0 + width;
+                    y1 = y0 + height;
+                    if (isStroke) {
+                        if (containStroke(x0, y0, x1, y0, lineWidth, x, y)
+                            || containStroke(x1, y0, x1, y1, lineWidth, x, y)
+                            || containStroke(x1, y1, x0, y1, lineWidth, x, y)
+                            || containStroke(x0, y1, x0, y0, lineWidth, x, y)) {
+                            return true;
+                        }
+                    }
+                    else {
+                        w += windingLine(x1, y0, x1, y1, x, y);
+                        w += windingLine(x0, y1, x0, y0, x, y);
+                    }
+                    break;
+                case CMD$1.Z:
+                    if (isStroke) {
+                        if (containStroke(xi, yi, x0, y0, lineWidth, x, y)) {
+                            return true;
+                        }
+                    }
+                    else {
+                        w += windingLine(xi, yi, x0, y0, x, y);
+                    }
+                    xi = x0;
+                    yi = y0;
+                    break;
+            }
+        }
+        if (!isStroke && !isAroundEqual(yi, y0)) {
+            w += windingLine(xi, yi, x0, y0, x, y) || 0;
+        }
+        return w !== 0;
+    }
+    function contain(pathProxy, x, y) {
+        return containPath(pathProxy, 0, false, x, y);
+    }
+    function containStroke$4(pathProxy, lineWidth, x, y) {
+        return containPath(pathProxy, lineWidth, true, x, y);
+    }
+
+    var DEFAULT_PATH_STYLE = defaults({
+        fill: '#000',
+        stroke: null,
+        strokePercent: 1,
+        fillOpacity: 1,
+        strokeOpacity: 1,
+        lineDashOffset: 0,
+        lineWidth: 1,
+        lineCap: 'butt',
+        miterLimit: 10,
+        strokeNoScale: false,
+        strokeFirst: false
+    }, DEFAULT_COMMON_STYLE);
+    var DEFAULT_PATH_ANIMATION_PROPS = {
+        style: defaults({
+            fill: true,
+            stroke: true,
+            strokePercent: true,
+            fillOpacity: true,
+            strokeOpacity: true,
+            lineDashOffset: true,
+            lineWidth: true,
+            miterLimit: true
+        }, DEFAULT_COMMON_ANIMATION_PROPS.style)
+    };
+    var pathCopyParams = TRANSFORMABLE_PROPS.concat(['invisible',
+        'culling', 'z', 'z2', 'zlevel', 'parent'
+    ]);
+    var Path = (function (_super) {
+        __extends(Path, _super);
+        function Path(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Path.prototype.update = function () {
+            var _this = this;
+            _super.prototype.update.call(this);
+            var style = this.style;
+            if (style.decal) {
+                var decalEl = this._decalEl = this._decalEl || new Path();
+                if (decalEl.buildPath === Path.prototype.buildPath) {
+                    decalEl.buildPath = function (ctx) {
+                        _this.buildPath(ctx, _this.shape);
+                    };
+                }
+                decalEl.silent = true;
+                var decalElStyle = decalEl.style;
+                for (var key in style) {
+                    if (decalElStyle[key] !== style[key]) {
+                        decalElStyle[key] = style[key];
+                    }
+                }
+                decalElStyle.fill = style.fill ? style.decal : null;
+                decalElStyle.decal = null;
+                decalElStyle.shadowColor = null;
+                style.strokeFirst && (decalElStyle.stroke = null);
+                for (var i = 0; i < pathCopyParams.length; ++i) {
+                    decalEl[pathCopyParams[i]] = this[pathCopyParams[i]];
+                }
+                decalEl.__dirty |= REDRAW_BIT;
+            }
+            else if (this._decalEl) {
+                this._decalEl = null;
+            }
+        };
+        Path.prototype.getDecalElement = function () {
+            return this._decalEl;
+        };
+        Path.prototype._init = function (props) {
+            var keysArr = keys(props);
+            this.shape = this.getDefaultShape();
+            var defaultStyle = this.getDefaultStyle();
+            if (defaultStyle) {
+                this.useStyle(defaultStyle);
+            }
+            for (var i = 0; i < keysArr.length; i++) {
+                var key = keysArr[i];
+                var value = props[key];
+                if (key === 'style') {
+                    if (!this.style) {
+                        this.useStyle(value);
+                    }
+                    else {
+                        extend(this.style, value);
+                    }
+                }
+                else if (key === 'shape') {
+                    extend(this.shape, value);
+                }
+                else {
+                    _super.prototype.attrKV.call(this, key, value);
+                }
+            }
+            if (!this.style) {
+                this.useStyle({});
+            }
+        };
+        Path.prototype.getDefaultStyle = function () {
+            return null;
+        };
+        Path.prototype.getDefaultShape = function () {
+            return {};
+        };
+        Path.prototype.canBeInsideText = function () {
+            return this.hasFill();
+        };
+        Path.prototype.getInsideTextFill = function () {
+            var pathFill = this.style.fill;
+            if (pathFill !== 'none') {
+                if (isString(pathFill)) {
+                    var fillLum = lum(pathFill, 0);
+                    if (fillLum > 0.5) {
+                        return DARK_LABEL_COLOR;
+                    }
+                    else if (fillLum > 0.2) {
+                        return LIGHTER_LABEL_COLOR;
+                    }
+                    return LIGHT_LABEL_COLOR;
+                }
+                else if (pathFill) {
+                    return LIGHT_LABEL_COLOR;
+                }
+            }
+            return DARK_LABEL_COLOR;
+        };
+        Path.prototype.getInsideTextStroke = function (textFill) {
+            var pathFill = this.style.fill;
+            if (isString(pathFill)) {
+                var zr = this.__zr;
+                var isDarkMode = !!(zr && zr.isDarkMode());
+                var isDarkLabel = lum(textFill, 0) < DARK_MODE_THRESHOLD;
+                if (isDarkMode === isDarkLabel) {
+                    return pathFill;
+                }
+            }
+        };
+        Path.prototype.buildPath = function (ctx, shapeCfg, inBatch) { };
+        Path.prototype.pathUpdated = function () {
+            this.__dirty &= ~SHAPE_CHANGED_BIT;
+        };
+        Path.prototype.getUpdatedPathProxy = function (inBatch) {
+            !this.path && this.createPathProxy();
+            this.path.beginPath();
+            this.buildPath(this.path, this.shape, inBatch);
+            return this.path;
+        };
+        Path.prototype.createPathProxy = function () {
+            this.path = new PathProxy(false);
+        };
+        Path.prototype.hasStroke = function () {
+            var style = this.style;
+            var stroke = style.stroke;
+            return !(stroke == null || stroke === 'none' || !(style.lineWidth > 0));
+        };
+        Path.prototype.hasFill = function () {
+            var style = this.style;
+            var fill = style.fill;
+            return fill != null && fill !== 'none';
+        };
+        Path.prototype.getBoundingRect = function () {
+            var rect = this._rect;
+            var style = this.style;
+            var needsUpdateRect = !rect;
+            if (needsUpdateRect) {
+                var firstInvoke = false;
+                if (!this.path) {
+                    firstInvoke = true;
+                    this.createPathProxy();
+                }
+                var path = this.path;
+                if (firstInvoke || (this.__dirty & SHAPE_CHANGED_BIT)) {
+                    path.beginPath();
+                    this.buildPath(path, this.shape, false);
+                    this.pathUpdated();
+                }
+                rect = path.getBoundingRect();
+            }
+            this._rect = rect;
+            if (this.hasStroke() && this.path && this.path.len() > 0) {
+                var rectStroke = this._rectStroke || (this._rectStroke = rect.clone());
+                if (this.__dirty || needsUpdateRect) {
+                    rectStroke.copy(rect);
+                    var lineScale = style.strokeNoScale ? this.getLineScale() : 1;
+                    var w = style.lineWidth;
+                    if (!this.hasFill()) {
+                        var strokeContainThreshold = this.strokeContainThreshold;
+                        w = Math.max(w, strokeContainThreshold == null ? 4 : strokeContainThreshold);
+                    }
+                    if (lineScale > 1e-10) {
+                        rectStroke.width += w / lineScale;
+                        rectStroke.height += w / lineScale;
+                        rectStroke.x -= w / lineScale / 2;
+                        rectStroke.y -= w / lineScale / 2;
+                    }
+                }
+                return rectStroke;
+            }
+            return rect;
+        };
+        Path.prototype.contain = function (x, y) {
+            var localPos = this.transformCoordToLocal(x, y);
+            var rect = this.getBoundingRect();
+            var style = this.style;
+            x = localPos[0];
+            y = localPos[1];
+            if (rect.contain(x, y)) {
+                var pathProxy = this.path;
+                if (this.hasStroke()) {
+                    var lineWidth = style.lineWidth;
+                    var lineScale = style.strokeNoScale ? this.getLineScale() : 1;
+                    if (lineScale > 1e-10) {
+                        if (!this.hasFill()) {
+                            lineWidth = Math.max(lineWidth, this.strokeContainThreshold);
+                        }
+                        if (containStroke$4(pathProxy, lineWidth / lineScale, x, y)) {
+                            return true;
+                        }
+                    }
+                }
+                if (this.hasFill()) {
+                    return contain(pathProxy, x, y);
+                }
+            }
+            return false;
+        };
+        Path.prototype.dirtyShape = function () {
+            this.__dirty |= SHAPE_CHANGED_BIT;
+            if (this._rect) {
+                this._rect = null;
+            }
+            if (this._decalEl) {
+                this._decalEl.dirtyShape();
+            }
+            this.markRedraw();
+        };
+        Path.prototype.dirty = function () {
+            this.dirtyStyle();
+            this.dirtyShape();
+        };
+        Path.prototype.animateShape = function (loop) {
+            return this.animate('shape', loop);
+        };
+        Path.prototype.updateDuringAnimation = function (targetKey) {
+            if (targetKey === 'style') {
+                this.dirtyStyle();
+            }
+            else if (targetKey === 'shape') {
+                this.dirtyShape();
+            }
+            else {
+                this.markRedraw();
+            }
+        };
+        Path.prototype.attrKV = function (key, value) {
+            if (key === 'shape') {
+                this.setShape(value);
+            }
+            else {
+                _super.prototype.attrKV.call(this, key, value);
+            }
+        };
+        Path.prototype.setShape = function (keyOrObj, value) {
+            var shape = this.shape;
+            if (!shape) {
+                shape = this.shape = {};
+            }
+            if (typeof keyOrObj === 'string') {
+                shape[keyOrObj] = value;
+            }
+            else {
+                extend(shape, keyOrObj);
+            }
+            this.dirtyShape();
+            return this;
+        };
+        Path.prototype.shapeChanged = function () {
+            return !!(this.__dirty & SHAPE_CHANGED_BIT);
+        };
+        Path.prototype.createStyle = function (obj) {
+            return createObject(DEFAULT_PATH_STYLE, obj);
+        };
+        Path.prototype._innerSaveToNormal = function (toState) {
+            _super.prototype._innerSaveToNormal.call(this, toState);
+            var normalState = this._normalState;
+            if (toState.shape && !normalState.shape) {
+                normalState.shape = extend({}, this.shape);
+            }
+        };
+        Path.prototype._applyStateObj = function (stateName, state, normalState, keepCurrentStates, transition, animationCfg) {
+            _super.prototype._applyStateObj.call(this, stateName, state, normalState, keepCurrentStates, transition, animationCfg);
+            var needsRestoreToNormal = !(state && keepCurrentStates);
+            var targetShape;
+            if (state && state.shape) {
+                if (transition) {
+                    if (keepCurrentStates) {
+                        targetShape = state.shape;
+                    }
+                    else {
+                        targetShape = extend({}, normalState.shape);
+                        extend(targetShape, state.shape);
+                    }
+                }
+                else {
+                    targetShape = extend({}, keepCurrentStates ? this.shape : normalState.shape);
+                    extend(targetShape, state.shape);
+                }
+            }
+            else if (needsRestoreToNormal) {
+                targetShape = normalState.shape;
+            }
+            if (targetShape) {
+                if (transition) {
+                    this.shape = extend({}, this.shape);
+                    var targetShapePrimaryProps = {};
+                    var shapeKeys = keys(targetShape);
+                    for (var i = 0; i < shapeKeys.length; i++) {
+                        var key = shapeKeys[i];
+                        if (typeof targetShape[key] === 'object') {
+                            this.shape[key] = targetShape[key];
+                        }
+                        else {
+                            targetShapePrimaryProps[key] = targetShape[key];
+                        }
+                    }
+                    this._transitionState(stateName, {
+                        shape: targetShapePrimaryProps
+                    }, animationCfg);
+                }
+                else {
+                    this.shape = targetShape;
+                    this.dirtyShape();
+                }
+            }
+        };
+        Path.prototype._mergeStates = function (states) {
+            var mergedState = _super.prototype._mergeStates.call(this, states);
+            var mergedShape;
+            for (var i = 0; i < states.length; i++) {
+                var state = states[i];
+                if (state.shape) {
+                    mergedShape = mergedShape || {};
+                    this._mergeStyle(mergedShape, state.shape);
+                }
+            }
+            if (mergedShape) {
+                mergedState.shape = mergedShape;
+            }
+            return mergedState;
+        };
+        Path.prototype.getAnimationStyleProps = function () {
+            return DEFAULT_PATH_ANIMATION_PROPS;
+        };
+        Path.prototype.isZeroArea = function () {
+            return false;
+        };
+        Path.extend = function (defaultProps) {
+            var Sub = (function (_super) {
+                __extends(Sub, _super);
+                function Sub(opts) {
+                    var _this = _super.call(this, opts) || this;
+                    defaultProps.init && defaultProps.init.call(_this, opts);
+                    return _this;
+                }
+                Sub.prototype.getDefaultStyle = function () {
+                    return clone(defaultProps.style);
+                };
+                Sub.prototype.getDefaultShape = function () {
+                    return clone(defaultProps.shape);
+                };
+                return Sub;
+            }(Path));
+            for (var key in defaultProps) {
+                if (typeof defaultProps[key] === 'function') {
+                    Sub.prototype[key] = defaultProps[key];
+                }
+            }
+            return Sub;
+        };
+        Path.initDefaultProps = (function () {
+            var pathProto = Path.prototype;
+            pathProto.type = 'path';
+            pathProto.strokeContainThreshold = 5;
+            pathProto.segmentIgnoreThreshold = 0;
+            pathProto.subPixelOptimize = false;
+            pathProto.autoBatch = false;
+            pathProto.__dirty = REDRAW_BIT | STYLE_CHANGED_BIT | SHAPE_CHANGED_BIT;
+        })();
+        return Path;
+    }(Displayable));
+
+    var CMD$2 = PathProxy.CMD;
+    var points = [[], [], []];
+    var mathSqrt$1 = Math.sqrt;
+    var mathAtan2 = Math.atan2;
+    function transformPath(path, m) {
+        if (!m) {
+            return;
+        }
+        var data = path.data;
+        var len = path.len();
+        var cmd;
+        var nPoint;
+        var i;
+        var j;
+        var k;
+        var p;
+        var M = CMD$2.M;
+        var C = CMD$2.C;
+        var L = CMD$2.L;
+        var R = CMD$2.R;
+        var A = CMD$2.A;
+        var Q = CMD$2.Q;
+        for (i = 0, j = 0; i < len;) {
+            cmd = data[i++];
+            j = i;
+            nPoint = 0;
+            switch (cmd) {
+                case M:
+                    nPoint = 1;
+                    break;
+                case L:
+                    nPoint = 1;
+                    break;
+                case C:
+                    nPoint = 3;
+                    break;
+                case Q:
+                    nPoint = 2;
+                    break;
+                case A:
+                    var x = m[4];
+                    var y = m[5];
+                    var sx = mathSqrt$1(m[0] * m[0] + m[1] * m[1]);
+                    var sy = mathSqrt$1(m[2] * m[2] + m[3] * m[3]);
+                    var angle = mathAtan2(-m[1] / sy, m[0] / sx);
+                    data[i] *= sx;
+                    data[i++] += x;
+                    data[i] *= sy;
+                    data[i++] += y;
+                    data[i++] *= sx;
+                    data[i++] *= sy;
+                    data[i++] += angle;
+                    data[i++] += angle;
+                    i += 2;
+                    j = i;
+                    break;
+                case R:
+                    p[0] = data[i++];
+                    p[1] = data[i++];
+                    applyTransform(p, p, m);
+                    data[j++] = p[0];
+                    data[j++] = p[1];
+                    p[0] += data[i++];
+                    p[1] += data[i++];
+                    applyTransform(p, p, m);
+                    data[j++] = p[0];
+                    data[j++] = p[1];
+            }
+            for (k = 0; k < nPoint; k++) {
+                var p_1 = points[k];
+                p_1[0] = data[i++];
+                p_1[1] = data[i++];
+                applyTransform(p_1, p_1, m);
+                data[j++] = p_1[0];
+                data[j++] = p_1[1];
+            }
+        }
+        path.increaseVersion();
+    }
+
+    var mathSqrt$2 = Math.sqrt;
+    var mathSin$2 = Math.sin;
+    var mathCos$2 = Math.cos;
+    var PI$1 = Math.PI;
+    function vMag(v) {
+        return Math.sqrt(v[0] * v[0] + v[1] * v[1]);
+    }
+    function vRatio(u, v) {
+        return (u[0] * v[0] + u[1] * v[1]) / (vMag(u) * vMag(v));
+    }
+    function vAngle(u, v) {
+        return (u[0] * v[1] < u[1] * v[0] ? -1 : 1)
+            * Math.acos(vRatio(u, v));
+    }
+    function processArc(x1, y1, x2, y2, fa, fs, rx, ry, psiDeg, cmd, path) {
+        var psi = psiDeg * (PI$1 / 180.0);
+        var xp = mathCos$2(psi) * (x1 - x2) / 2.0
+            + mathSin$2(psi) * (y1 - y2) / 2.0;
+        var yp = -1 * mathSin$2(psi) * (x1 - x2) / 2.0
+            + mathCos$2(psi) * (y1 - y2) / 2.0;
+        var lambda = (xp * xp) / (rx * rx) + (yp * yp) / (ry * ry);
+        if (lambda > 1) {
+            rx *= mathSqrt$2(lambda);
+            ry *= mathSqrt$2(lambda);
+        }
+        var f = (fa === fs ? -1 : 1)
+            * mathSqrt$2((((rx * rx) * (ry * ry))
+                - ((rx * rx) * (yp * yp))
+                - ((ry * ry) * (xp * xp))) / ((rx * rx) * (yp * yp)
+                + (ry * ry) * (xp * xp))) || 0;
+        var cxp = f * rx * yp / ry;
+        var cyp = f * -ry * xp / rx;
+        var cx = (x1 + x2) / 2.0
+            + mathCos$2(psi) * cxp
+            - mathSin$2(psi) * cyp;
+        var cy = (y1 + y2) / 2.0
+            + mathSin$2(psi) * cxp
+            + mathCos$2(psi) * cyp;
+        var theta = vAngle([1, 0], [(xp - cxp) / rx, (yp - cyp) / ry]);
+        var u = [(xp - cxp) / rx, (yp - cyp) / ry];
+        var v = [(-1 * xp - cxp) / rx, (-1 * yp - cyp) / ry];
+        var dTheta = vAngle(u, v);
+        if (vRatio(u, v) <= -1) {
+            dTheta = PI$1;
+        }
+        if (vRatio(u, v) >= 1) {
+            dTheta = 0;
+        }
+        if (dTheta < 0) {
+            var n = Math.round(dTheta / PI$1 * 1e6) / 1e6;
+            dTheta = PI$1 * 2 + (n % 2) * PI$1;
+        }
+        path.addData(cmd, cx, cy, rx, ry, theta, dTheta, psi, fs);
+    }
+    var commandReg = /([mlvhzcqtsa])([^mlvhzcqtsa]*)/ig;
+    var numberReg = /-?([0-9]*\.)?[0-9]+([eE]-?[0-9]+)?/g;
+    function createPathProxyFromString(data) {
+        var path = new PathProxy();
+        if (!data) {
+            return path;
+        }
+        var cpx = 0;
+        var cpy = 0;
+        var subpathX = cpx;
+        var subpathY = cpy;
+        var prevCmd;
+        var CMD = PathProxy.CMD;
+        var cmdList = data.match(commandReg);
+        if (!cmdList) {
+            return path;
+        }
+        for (var l = 0; l < cmdList.length; l++) {
+            var cmdText = cmdList[l];
+            var cmdStr = cmdText.charAt(0);
+            var cmd = void 0;
+            var p = cmdText.match(numberReg) || [];
+            var pLen = p.length;
+            for (var i = 0; i < pLen; i++) {
+                p[i] = parseFloat(p[i]);
+            }
+            var off = 0;
+            while (off < pLen) {
+                var ctlPtx = void 0;
+                var ctlPty = void 0;
+                var rx = void 0;
+                var ry = void 0;
+                var psi = void 0;
+                var fa = void 0;
+                var fs = void 0;
+                var x1 = cpx;
+                var y1 = cpy;
+                var len = void 0;
+                var pathData = void 0;
+                switch (cmdStr) {
+                    case 'l':
+                        cpx += p[off++];
+                        cpy += p[off++];
+                        cmd = CMD.L;
+                        path.addData(cmd, cpx, cpy);
+                        break;
+                    case 'L':
+                        cpx = p[off++];
+                        cpy = p[off++];
+                        cmd = CMD.L;
+                        path.addData(cmd, cpx, cpy);
+                        break;
+                    case 'm':
+                        cpx += p[off++];
+                        cpy += p[off++];
+                        cmd = CMD.M;
+                        path.addData(cmd, cpx, cpy);
+                        subpathX = cpx;
+                        subpathY = cpy;
+                        cmdStr = 'l';
+                        break;
+                    case 'M':
+                        cpx = p[off++];
+                        cpy = p[off++];
+                        cmd = CMD.M;
+                        path.addData(cmd, cpx, cpy);
+                        subpathX = cpx;
+                        subpathY = cpy;
+                        cmdStr = 'L';
+                        break;
+                    case 'h':
+                        cpx += p[off++];
+                        cmd = CMD.L;
+                        path.addData(cmd, cpx, cpy);
+                        break;
+                    case 'H':
+                        cpx = p[off++];
+                        cmd = CMD.L;
+                        path.addData(cmd, cpx, cpy);
+                        break;
+                    case 'v':
+                        cpy += p[off++];
+                        cmd = CMD.L;
+                        path.addData(cmd, cpx, cpy);
+                        break;
+                    case 'V':
+                        cpy = p[off++];
+                        cmd = CMD.L;
+                        path.addData(cmd, cpx, cpy);
+                        break;
+                    case 'C':
+                        cmd = CMD.C;
+                        path.addData(cmd, p[off++], p[off++], p[off++], p[off++], p[off++], p[off++]);
+                        cpx = p[off - 2];
+                        cpy = p[off - 1];
+                        break;
+                    case 'c':
+                        cmd = CMD.C;
+                        path.addData(cmd, p[off++] + cpx, p[off++] + cpy, p[off++] + cpx, p[off++] + cpy, p[off++] + cpx, p[off++] + cpy);
+                        cpx += p[off - 2];
+                        cpy += p[off - 1];
+                        break;
+                    case 'S':
+                        ctlPtx = cpx;
+                        ctlPty = cpy;
+                        len = path.len();
+                        pathData = path.data;
+                        if (prevCmd === CMD.C) {
+                            ctlPtx += cpx - pathData[len - 4];
+                            ctlPty += cpy - pathData[len - 3];
+                        }
+                        cmd = CMD.C;
+                        x1 = p[off++];
+                        y1 = p[off++];
+                        cpx = p[off++];
+                        cpy = p[off++];
+                        path.addData(cmd, ctlPtx, ctlPty, x1, y1, cpx, cpy);
+                        break;
+                    case 's':
+                        ctlPtx = cpx;
+                        ctlPty = cpy;
+                        len = path.len();
+                        pathData = path.data;
+                        if (prevCmd === CMD.C) {
+                            ctlPtx += cpx - pathData[len - 4];
+                            ctlPty += cpy - pathData[len - 3];
+                        }
+                        cmd = CMD.C;
+                        x1 = cpx + p[off++];
+                        y1 = cpy + p[off++];
+                        cpx += p[off++];
+                        cpy += p[off++];
+                        path.addData(cmd, ctlPtx, ctlPty, x1, y1, cpx, cpy);
+                        break;
+                    case 'Q':
+                        x1 = p[off++];
+                        y1 = p[off++];
+                        cpx = p[off++];
+                        cpy = p[off++];
+                        cmd = CMD.Q;
+                        path.addData(cmd, x1, y1, cpx, cpy);
+                        break;
+                    case 'q':
+                        x1 = p[off++] + cpx;
+                        y1 = p[off++] + cpy;
+                        cpx += p[off++];
+                        cpy += p[off++];
+                        cmd = CMD.Q;
+                        path.addData(cmd, x1, y1, cpx, cpy);
+                        break;
+                    case 'T':
+                        ctlPtx = cpx;
+                        ctlPty = cpy;
+                        len = path.len();
+                        pathData = path.data;
+                        if (prevCmd === CMD.Q) {
+                            ctlPtx += cpx - pathData[len - 4];
+                            ctlPty += cpy - pathData[len - 3];
+                        }
+                        cpx = p[off++];
+                        cpy = p[off++];
+                        cmd = CMD.Q;
+                        path.addData(cmd, ctlPtx, ctlPty, cpx, cpy);
+                        break;
+                    case 't':
+                        ctlPtx = cpx;
+                        ctlPty = cpy;
+                        len = path.len();
+                        pathData = path.data;
+                        if (prevCmd === CMD.Q) {
+                            ctlPtx += cpx - pathData[len - 4];
+                            ctlPty += cpy - pathData[len - 3];
+                        }
+                        cpx += p[off++];
+                        cpy += p[off++];
+                        cmd = CMD.Q;
+                        path.addData(cmd, ctlPtx, ctlPty, cpx, cpy);
+                        break;
+                    case 'A':
+                        rx = p[off++];
+                        ry = p[off++];
+                        psi = p[off++];
+                        fa = p[off++];
+                        fs = p[off++];
+                        x1 = cpx, y1 = cpy;
+                        cpx = p[off++];
+                        cpy = p[off++];
+                        cmd = CMD.A;
+                        processArc(x1, y1, cpx, cpy, fa, fs, rx, ry, psi, cmd, path);
+                        break;
+                    case 'a':
+                        rx = p[off++];
+                        ry = p[off++];
+                        psi = p[off++];
+                        fa = p[off++];
+                        fs = p[off++];
+                        x1 = cpx, y1 = cpy;
+                        cpx += p[off++];
+                        cpy += p[off++];
+                        cmd = CMD.A;
+                        processArc(x1, y1, cpx, cpy, fa, fs, rx, ry, psi, cmd, path);
+                        break;
+                }
+            }
+            if (cmdStr === 'z' || cmdStr === 'Z') {
+                cmd = CMD.Z;
+                path.addData(cmd);
+                cpx = subpathX;
+                cpy = subpathY;
+            }
+            prevCmd = cmd;
+        }
+        path.toStatic();
+        return path;
+    }
+    var SVGPath = (function (_super) {
+        __extends(SVGPath, _super);
+        function SVGPath() {
+            return _super !== null && _super.apply(this, arguments) || this;
+        }
+        SVGPath.prototype.applyTransform = function (m) { };
+        return SVGPath;
+    }(Path));
+    function isPathProxy(path) {
+        return path.setData != null;
+    }
+    function createPathOptions(str, opts) {
+        var pathProxy = createPathProxyFromString(str);
+        var innerOpts = extend({}, opts);
+        innerOpts.buildPath = function (path) {
+            if (isPathProxy(path)) {
+                path.setData(pathProxy.data);
+                var ctx = path.getContext();
+                if (ctx) {
+                    path.rebuildPath(ctx, 1);
+                }
+            }
+            else {
+                var ctx = path;
+                pathProxy.rebuildPath(ctx, 1);
+            }
+        };
+        innerOpts.applyTransform = function (m) {
+            transformPath(pathProxy, m);
+            this.dirtyShape();
+        };
+        return innerOpts;
+    }
+    function createFromString(str, opts) {
+        return new SVGPath(createPathOptions(str, opts));
+    }
+    function extendFromString(str, defaultOpts) {
+        var innerOpts = createPathOptions(str, defaultOpts);
+        var Sub = (function (_super) {
+            __extends(Sub, _super);
+            function Sub(opts) {
+                var _this = _super.call(this, opts) || this;
+                _this.applyTransform = innerOpts.applyTransform;
+                _this.buildPath = innerOpts.buildPath;
+                return _this;
+            }
+            return Sub;
+        }(SVGPath));
+        return Sub;
+    }
+    function mergePath(pathEls, opts) {
+        var pathList = [];
+        var len = pathEls.length;
+        for (var i = 0; i < len; i++) {
+            var pathEl = pathEls[i];
+            pathList.push(pathEl.getUpdatedPathProxy(true));
+        }
+        var pathBundle = new Path(opts);
+        pathBundle.createPathProxy();
+        pathBundle.buildPath = function (path) {
+            if (isPathProxy(path)) {
+                path.appendPath(pathList);
+                var ctx = path.getContext();
+                if (ctx) {
+                    path.rebuildPath(ctx, 1);
+                }
+            }
+        };
+        return pathBundle;
+    }
+    function clonePath(sourcePath, opts) {
+        opts = opts || {};
+        var path = new Path();
+        if (sourcePath.shape) {
+            path.setShape(sourcePath.shape);
+        }
+        path.setStyle(sourcePath.style);
+        if (opts.bakeTransform) {
+            transformPath(path.path, sourcePath.getComputedTransform());
+        }
+        else {
+            if (opts.toLocal) {
+                path.setLocalTransform(sourcePath.getComputedTransform());
+            }
+            else {
+                path.copyTransform(sourcePath);
+            }
+        }
+        path.buildPath = sourcePath.buildPath;
+        path.applyTransform = path.applyTransform;
+        path.z = sourcePath.z;
+        path.z2 = sourcePath.z2;
+        path.zlevel = sourcePath.zlevel;
+        return path;
+    }
+
+    var path = /*#__PURE__*/Object.freeze({
+        __proto__: null,
+        createFromString: createFromString,
+        extendFromString: extendFromString,
+        mergePath: mergePath,
+        clonePath: clonePath
+    });
+
+    var DEFAULT_IMAGE_STYLE = defaults({
+        x: 0,
+        y: 0
+    }, DEFAULT_COMMON_STYLE);
+    var DEFAULT_IMAGE_ANIMATION_PROPS = {
+        style: defaults({
+            x: true,
+            y: true,
+            width: true,
+            height: true,
+            sx: true,
+            sy: true,
+            sWidth: true,
+            sHeight: true
+        }, DEFAULT_COMMON_ANIMATION_PROPS.style)
+    };
+    function isImageLike(source) {
+        return !!(source
+            && typeof source !== 'string'
+            && source.width && source.height);
+    }
+    var ZRImage = (function (_super) {
+        __extends(ZRImage, _super);
+        function ZRImage() {
+            return _super !== null && _super.apply(this, arguments) || this;
+        }
+        ZRImage.prototype.createStyle = function (obj) {
+            return createObject(DEFAULT_IMAGE_STYLE, obj);
+        };
+        ZRImage.prototype._getSize = function (dim) {
+            var style = this.style;
+            var size = style[dim];
+            if (size != null) {
+                return size;
+            }
+            var imageSource = isImageLike(style.image)
+                ? style.image : this.__image;
+            if (!imageSource) {
+                return 0;
+            }
+            var otherDim = dim === 'width' ? 'height' : 'width';
+            var otherDimSize = style[otherDim];
+            if (otherDimSize == null) {
+                return imageSource[dim];
+            }
+            else {
+                return imageSource[dim] / imageSource[otherDim] * otherDimSize;
+            }
+        };
+        ZRImage.prototype.getWidth = function () {
+            return this._getSize('width');
+        };
+        ZRImage.prototype.getHeight = function () {
+            return this._getSize('height');
+        };
+        ZRImage.prototype.getAnimationStyleProps = function () {
+            return DEFAULT_IMAGE_ANIMATION_PROPS;
+        };
+        ZRImage.prototype.getBoundingRect = function () {
+            var style = this.style;
+            if (!this._rect) {
+                this._rect = new BoundingRect(style.x || 0, style.y || 0, this.getWidth(), this.getHeight());
+            }
+            return this._rect;
+        };
+        return ZRImage;
+    }(Displayable));
+    ZRImage.prototype.type = 'image';
+
+    var CircleShape = (function () {
+        function CircleShape() {
+            this.cx = 0;
+            this.cy = 0;
+            this.r = 0;
+        }
+        return CircleShape;
+    }());
+    var Circle = (function (_super) {
+        __extends(Circle, _super);
+        function Circle(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Circle.prototype.getDefaultShape = function () {
+            return new CircleShape();
+        };
+        Circle.prototype.buildPath = function (ctx, shape) {
+            ctx.moveTo(shape.cx + shape.r, shape.cy);
+            ctx.arc(shape.cx, shape.cy, shape.r, 0, Math.PI * 2);
+        };
+        return Circle;
+    }(Path));
+    Circle.prototype.type = 'circle';
+
+    function buildPath(ctx, shape) {
+        var x = shape.x;
+        var y = shape.y;
+        var width = shape.width;
+        var height = shape.height;
+        var r = shape.r;
+        var r1;
+        var r2;
+        var r3;
+        var r4;
+        if (width < 0) {
+            x = x + width;
+            width = -width;
+        }
+        if (height < 0) {
+            y = y + height;
+            height = -height;
+        }
+        if (typeof r === 'number') {
+            r1 = r2 = r3 = r4 = r;
+        }
+        else if (r instanceof Array) {
+            if (r.length === 1) {
+                r1 = r2 = r3 = r4 = r[0];
+            }
+            else if (r.length === 2) {
+                r1 = r3 = r[0];
+                r2 = r4 = r[1];
+            }
+            else if (r.length === 3) {
+                r1 = r[0];
+                r2 = r4 = r[1];
+                r3 = r[2];
+            }
+            else {
+                r1 = r[0];
+                r2 = r[1];
+                r3 = r[2];
+                r4 = r[3];
+            }
+        }
+        else {
+            r1 = r2 = r3 = r4 = 0;
+        }
+        var total;
+        if (r1 + r2 > width) {
+            total = r1 + r2;
+            r1 *= width / total;
+            r2 *= width / total;
+        }
+        if (r3 + r4 > width) {
+            total = r3 + r4;
+            r3 *= width / total;
+            r4 *= width / total;
+        }
+        if (r2 + r3 > height) {
+            total = r2 + r3;
+            r2 *= height / total;
+            r3 *= height / total;
+        }
+        if (r1 + r4 > height) {
+            total = r1 + r4;
+            r1 *= height / total;
+            r4 *= height / total;
+        }
+        ctx.moveTo(x + r1, y);
+        ctx.lineTo(x + width - r2, y);
+        r2 !== 0 && ctx.arc(x + width - r2, y + r2, r2, -Math.PI / 2, 0);
+        ctx.lineTo(x + width, y + height - r3);
+        r3 !== 0 && ctx.arc(x + width - r3, y + height - r3, r3, 0, Math.PI / 2);
+        ctx.lineTo(x + r4, y + height);
+        r4 !== 0 && ctx.arc(x + r4, y + height - r4, r4, Math.PI / 2, Math.PI);
+        ctx.lineTo(x, y + r1);
+        r1 !== 0 && ctx.arc(x + r1, y + r1, r1, Math.PI, Math.PI * 1.5);
+    }
+
+    var round = Math.round;
+    function subPixelOptimizeLine(outputShape, inputShape, style) {
+        if (!inputShape) {
+            return;
+        }
+        var x1 = inputShape.x1;
+        var x2 = inputShape.x2;
+        var y1 = inputShape.y1;
+        var y2 = inputShape.y2;
+        outputShape.x1 = x1;
+        outputShape.x2 = x2;
+        outputShape.y1 = y1;
+        outputShape.y2 = y2;
+        var lineWidth = style && style.lineWidth;
+        if (!lineWidth) {
+            return outputShape;
+        }
+        if (round(x1 * 2) === round(x2 * 2)) {
+            outputShape.x1 = outputShape.x2 = subPixelOptimize(x1, lineWidth, true);
+        }
+        if (round(y1 * 2) === round(y2 * 2)) {
+            outputShape.y1 = outputShape.y2 = subPixelOptimize(y1, lineWidth, true);
+        }
+        return outputShape;
+    }
+    function subPixelOptimizeRect(outputShape, inputShape, style) {
+        if (!inputShape) {
+            return;
+        }
+        var originX = inputShape.x;
+        var originY = inputShape.y;
+        var originWidth = inputShape.width;
+        var originHeight = inputShape.height;
+        outputShape.x = originX;
+        outputShape.y = originY;
+        outputShape.width = originWidth;
+        outputShape.height = originHeight;
+        var lineWidth = style && style.lineWidth;
+        if (!lineWidth) {
+            return outputShape;
+        }
+        outputShape.x = subPixelOptimize(originX, lineWidth, true);
+        outputShape.y = subPixelOptimize(originY, lineWidth, true);
+        outputShape.width = Math.max(subPixelOptimize(originX + originWidth, lineWidth, false) - outputShape.x, originWidth === 0 ? 0 : 1);
+        outputShape.height = Math.max(subPixelOptimize(originY + originHeight, lineWidth, false) - outputShape.y, originHeight === 0 ? 0 : 1);
+        return outputShape;
+    }
+    function subPixelOptimize(position, lineWidth, positiveOrNegative) {
+        if (!lineWidth) {
+            return position;
+        }
+        var doubledPosition = round(position * 2);
+        return (doubledPosition + round(lineWidth)) % 2 === 0
+            ? doubledPosition / 2
+            : (doubledPosition + (positiveOrNegative ? 1 : -1)) / 2;
+    }
+
+    var RectShape = (function () {
+        function RectShape() {
+            this.x = 0;
+            this.y = 0;
+            this.width = 0;
+            this.height = 0;
+        }
+        return RectShape;
+    }());
+    var subPixelOptimizeOutputShape = {};
+    var Rect = (function (_super) {
+        __extends(Rect, _super);
+        function Rect(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Rect.prototype.getDefaultShape = function () {
+            return new RectShape();
+        };
+        Rect.prototype.buildPath = function (ctx, shape) {
+            var x;
+            var y;
+            var width;
+            var height;
+            if (this.subPixelOptimize) {
+                var optimizedShape = subPixelOptimizeRect(subPixelOptimizeOutputShape, shape, this.style);
+                x = optimizedShape.x;
+                y = optimizedShape.y;
+                width = optimizedShape.width;
+                height = optimizedShape.height;
+                optimizedShape.r = shape.r;
+                shape = optimizedShape;
+            }
+            else {
+                x = shape.x;
+                y = shape.y;
+                width = shape.width;
+                height = shape.height;
+            }
+            if (!shape.r) {
+                ctx.rect(x, y, width, height);
+            }
+            else {
+                buildPath(ctx, shape);
+            }
+        };
+        Rect.prototype.isZeroArea = function () {
+            return !this.shape.width || !this.shape.height;
+        };
+        return Rect;
+    }(Path));
+    Rect.prototype.type = 'rect';
+
+    var EllipseShape = (function () {
+        function EllipseShape() {
+            this.cx = 0;
+            this.cy = 0;
+            this.rx = 0;
+            this.ry = 0;
+        }
+        return EllipseShape;
+    }());
+    var Ellipse = (function (_super) {
+        __extends(Ellipse, _super);
+        function Ellipse(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Ellipse.prototype.getDefaultShape = function () {
+            return new EllipseShape();
+        };
+        Ellipse.prototype.buildPath = function (ctx, shape) {
+            var k = 0.5522848;
+            var x = shape.cx;
+            var y = shape.cy;
+            var a = shape.rx;
+            var b = shape.ry;
+            var ox = a * k;
+            var oy = b * k;
+            ctx.moveTo(x - a, y);
+            ctx.bezierCurveTo(x - a, y - oy, x - ox, y - b, x, y - b);
+            ctx.bezierCurveTo(x + ox, y - b, x + a, y - oy, x + a, y);
+            ctx.bezierCurveTo(x + a, y + oy, x + ox, y + b, x, y + b);
+            ctx.bezierCurveTo(x - ox, y + b, x - a, y + oy, x - a, y);
+            ctx.closePath();
+        };
+        return Ellipse;
+    }(Path));
+    Ellipse.prototype.type = 'ellipse';
+
+    var subPixelOptimizeOutputShape$1 = {};
+    var LineShape = (function () {
+        function LineShape() {
+            this.x1 = 0;
+            this.y1 = 0;
+            this.x2 = 0;
+            this.y2 = 0;
+            this.percent = 1;
+        }
+        return LineShape;
+    }());
+    var Line = (function (_super) {
+        __extends(Line, _super);
+        function Line(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Line.prototype.getDefaultStyle = function () {
+            return {
+                stroke: '#000',
+                fill: null
+            };
+        };
+        Line.prototype.getDefaultShape = function () {
+            return new LineShape();
+        };
+        Line.prototype.buildPath = function (ctx, shape) {
+            var x1;
+            var y1;
+            var x2;
+            var y2;
+            if (this.subPixelOptimize) {
+                var optimizedShape = subPixelOptimizeLine(subPixelOptimizeOutputShape$1, shape, this.style);
+                x1 = optimizedShape.x1;
+                y1 = optimizedShape.y1;
+                x2 = optimizedShape.x2;
+                y2 = optimizedShape.y2;
+            }
+            else {
+                x1 = shape.x1;
+                y1 = shape.y1;
+                x2 = shape.x2;
+                y2 = shape.y2;
+            }
+            var percent = shape.percent;
+            if (percent === 0) {
+                return;
+            }
+            ctx.moveTo(x1, y1);
+            if (percent < 1) {
+                x2 = x1 * (1 - percent) + x2 * percent;
+                y2 = y1 * (1 - percent) + y2 * percent;
+            }
+            ctx.lineTo(x2, y2);
+        };
+        Line.prototype.pointAt = function (p) {
+            var shape = this.shape;
+            return [
+                shape.x1 * (1 - p) + shape.x2 * p,
+                shape.y1 * (1 - p) + shape.y2 * p
+            ];
+        };
+        return Line;
+    }(Path));
+    Line.prototype.type = 'line';
+
+    function smoothBezier(points, smooth, isLoop, constraint) {
+        var cps = [];
+        var v = [];
+        var v1 = [];
+        var v2 = [];
+        var prevPoint;
+        var nextPoint;
+        var min$1;
+        var max$1;
+        if (constraint) {
+            min$1 = [Infinity, Infinity];
+            max$1 = [-Infinity, -Infinity];
+            for (var i = 0, len = points.length; i < len; i++) {
+                min(min$1, min$1, points[i]);
+                max(max$1, max$1, points[i]);
+            }
+            min(min$1, min$1, constraint[0]);
+            max(max$1, max$1, constraint[1]);
+        }
+        for (var i = 0, len = points.length; i < len; i++) {
+            var point = points[i];
+            if (isLoop) {
+                prevPoint = points[i ? i - 1 : len - 1];
+                nextPoint = points[(i + 1) % len];
+            }
+            else {
+                if (i === 0 || i === len - 1) {
+                    cps.push(clone$1(points[i]));
+                    continue;
+                }
+                else {
+                    prevPoint = points[i - 1];
+                    nextPoint = points[i + 1];
+                }
+            }
+            sub(v, nextPoint, prevPoint);
+            scale(v, v, smooth);
+            var d0 = distance(point, prevPoint);
+            var d1 = distance(point, nextPoint);
+            var sum = d0 + d1;
+            if (sum !== 0) {
+                d0 /= sum;
+                d1 /= sum;
+            }
+            scale(v1, v, -d0);
+            scale(v2, v, d1);
+            var cp0 = add([], point, v1);
+            var cp1 = add([], point, v2);
+            if (constraint) {
+                max(cp0, cp0, min$1);
+                min(cp0, cp0, max$1);
+                max(cp1, cp1, min$1);
+                min(cp1, cp1, max$1);
+            }
+            cps.push(cp0);
+            cps.push(cp1);
+        }
+        if (isLoop) {
+            cps.push(cps.shift());
+        }
+        return cps;
+    }
+
+    function buildPath$1(ctx, shape, closePath) {
+        var smooth = shape.smooth;
+        var points = shape.points;
+        if (points && points.length >= 2) {
+            if (smooth) {
+                var controlPoints = smoothBezier(points, smooth, closePath, shape.smoothConstraint);
+                ctx.moveTo(points[0][0], points[0][1]);
+                var len = points.length;
+                for (var i = 0; i < (closePath ? len : len - 1); i++) {
+                    var cp1 = controlPoints[i * 2];
+                    var cp2 = controlPoints[i * 2 + 1];
+                    var p = points[(i + 1) % len];
+                    ctx.bezierCurveTo(cp1[0], cp1[1], cp2[0], cp2[1], p[0], p[1]);
+                }
+            }
+            else {
+                ctx.moveTo(points[0][0], points[0][1]);
+                for (var i = 1, l = points.length; i < l; i++) {
+                    ctx.lineTo(points[i][0], points[i][1]);
+                }
+            }
+            closePath && ctx.closePath();
+        }
+    }
+
+    var PolygonShape = (function () {
+        function PolygonShape() {
+            this.points = null;
+            this.smooth = 0;
+            this.smoothConstraint = null;
+        }
+        return PolygonShape;
+    }());
+    var Polygon = (function (_super) {
+        __extends(Polygon, _super);
+        function Polygon(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Polygon.prototype.getDefaultShape = function () {
+            return new PolygonShape();
+        };
+        Polygon.prototype.buildPath = function (ctx, shape) {
+            buildPath$1(ctx, shape, true);
+        };
+        return Polygon;
+    }(Path));
+    Polygon.prototype.type = 'polygon';
+
+    var PolylineShape = (function () {
+        function PolylineShape() {
+            this.points = null;
+            this.percent = 1;
+            this.smooth = 0;
+            this.smoothConstraint = null;
+        }
+        return PolylineShape;
+    }());
+    var Polyline = (function (_super) {
+        __extends(Polyline, _super);
+        function Polyline(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Polyline.prototype.getDefaultStyle = function () {
+            return {
+                stroke: '#000',
+                fill: null
+            };
+        };
+        Polyline.prototype.getDefaultShape = function () {
+            return new PolylineShape();
+        };
+        Polyline.prototype.buildPath = function (ctx, shape) {
+            buildPath$1(ctx, shape, false);
+        };
+        return Polyline;
+    }(Path));
+    Polyline.prototype.type = 'polyline';
+
+    var Gradient = (function () {
+        function Gradient(colorStops) {
+            this.colorStops = colorStops || [];
+        }
+        Gradient.prototype.addColorStop = function (offset, color) {
+            this.colorStops.push({
+                offset: offset,
+                color: color
+            });
+        };
+        return Gradient;
+    }());
+
+    var LinearGradient = (function (_super) {
+        __extends(LinearGradient, _super);
+        function LinearGradient(x, y, x2, y2, colorStops, globalCoord) {
+            var _this = _super.call(this, colorStops) || this;
+            _this.x = x == null ? 0 : x;
+            _this.y = y == null ? 0 : y;
+            _this.x2 = x2 == null ? 1 : x2;
+            _this.y2 = y2 == null ? 0 : y2;
+            _this.type = 'linear';
+            _this.global = globalCoord || false;
+            return _this;
+        }
+        return LinearGradient;
+    }(Gradient));
+
+    var RadialGradient = (function (_super) {
+        __extends(RadialGradient, _super);
+        function RadialGradient(x, y, r, colorStops, globalCoord) {
+            var _this = _super.call(this, colorStops) || this;
+            _this.x = x == null ? 0.5 : x;
+            _this.y = y == null ? 0.5 : y;
+            _this.r = r == null ? 0.5 : r;
+            _this.type = 'radial';
+            _this.global = globalCoord || false;
+            return _this;
+        }
+        return RadialGradient;
+    }(Gradient));
+
+    var DEFAULT_TSPAN_STYLE = defaults({
+        strokeFirst: true,
+        font: DEFAULT_FONT,
+        x: 0,
+        y: 0,
+        textAlign: 'left',
+        textBaseline: 'top',
+        miterLimit: 2
+    }, DEFAULT_PATH_STYLE);
+    var TSpan = (function (_super) {
+        __extends(TSpan, _super);
+        function TSpan() {
+            return _super !== null && _super.apply(this, arguments) || this;
+        }
+        TSpan.prototype.hasStroke = function () {
+            var style = this.style;
+            var stroke = style.stroke;
+            return stroke != null && stroke !== 'none' && style.lineWidth > 0;
+        };
+        TSpan.prototype.hasFill = function () {
+            var style = this.style;
+            var fill = style.fill;
+            return fill != null && fill !== 'none';
+        };
+        TSpan.prototype.createStyle = function (obj) {
+            return createObject(DEFAULT_TSPAN_STYLE, obj);
+        };
+        TSpan.prototype.setBoundingRect = function (rect) {
+            this._rect = rect;
+        };
+        TSpan.prototype.getBoundingRect = function () {
+            var style = this.style;
+            if (!this._rect) {
+                var text = style.text;
+                text != null ? (text += '') : (text = '');
+                var rect = getBoundingRect(text, style.font, style.textAlign, style.textBaseline);
+                rect.x += style.x || 0;
+                rect.y += style.y || 0;
+                if (this.hasStroke()) {
+                    var w = style.lineWidth;
+                    rect.x -= w / 2;
+                    rect.y -= w / 2;
+                    rect.width += w;
+                    rect.height += w;
+                }
+                this._rect = rect;
+            }
+            return this._rect;
+        };
+        TSpan.initDefaultProps = (function () {
+            var tspanProto = TSpan.prototype;
+            tspanProto.dirtyRectTolerance = 10;
+        })();
+        return TSpan;
+    }(Displayable));
+    TSpan.prototype.type = 'tspan';
+
+    function parseXML(svg) {
+        if (isString(svg)) {
+            var parser = new DOMParser();
+            svg = parser.parseFromString(svg, 'text/xml');
+        }
+        var svgNode = svg;
+        if (svgNode.nodeType === 9) {
+            svgNode = svgNode.firstChild;
+        }
+        while (svgNode.nodeName.toLowerCase() !== 'svg' || svgNode.nodeType !== 1) {
+            svgNode = svgNode.nextSibling;
+        }
+        return svgNode;
+    }
+
+    var nodeParsers;
+    var INHERITABLE_STYLE_ATTRIBUTES_MAP = {
+        'fill': 'fill',
+        'stroke': 'stroke',
+        'stroke-width': 'lineWidth',
+        'opacity': 'opacity',
+        'fill-opacity': 'fillOpacity',
+        'stroke-opacity': 'strokeOpacity',
+        'stroke-dasharray': 'lineDash',
+        'stroke-dashoffset': 'lineDashOffset',
+        'stroke-linecap': 'lineCap',
+        'stroke-linejoin': 'lineJoin',
+        'stroke-miterlimit': 'miterLimit',
+        'font-family': 'fontFamily',
+        'font-size': 'fontSize',
+        'font-style': 'fontStyle',
+        'font-weight': 'fontWeight',
+        'text-anchor': 'textAlign',
+        'visibility': 'visibility',
+        'display': 'display'
+    };
+    var INHERITABLE_STYLE_ATTRIBUTES_MAP_KEYS = keys(INHERITABLE_STYLE_ATTRIBUTES_MAP);
+    var SELF_STYLE_ATTRIBUTES_MAP = {
+        'alignment-baseline': 'textBaseline',
+        'stop-color': 'stopColor'
+    };
+    var SELF_STYLE_ATTRIBUTES_MAP_KEYS = keys(SELF_STYLE_ATTRIBUTES_MAP);
+    var SVGParser = (function () {
+        function SVGParser() {
+            this._defs = {};
+            this._root = null;
+        }
+        SVGParser.prototype.parse = function (xml, opt) {
+            opt = opt || {};
+            var svg = parseXML(xml);
+            {
+                if (!svg) {
+                    throw new Error('Illegal svg');
+                }
+            }
+            this._defsUsePending = [];
+            var root = new Group();
+            this._root = root;
+            var named = [];
+            var viewBox = svg.getAttribute('viewBox') || '';
+            var width = parseFloat((svg.getAttribute('width') || opt.width));
+            var height = parseFloat((svg.getAttribute('height') || opt.height));
+            isNaN(width) && (width = null);
+            isNaN(height) && (height = null);
+            parseAttributes(svg, root, null, true, false);
+            var child = svg.firstChild;
+            while (child) {
+                this._parseNode(child, root, named, null, false, false);
+                child = child.nextSibling;
+            }
+            applyDefs(this._defs, this._defsUsePending);
+            this._defsUsePending = [];
+            var viewBoxRect;
+            var viewBoxTransform;
+            if (viewBox) {
+                var viewBoxArr = splitNumberSequence(viewBox);
+                if (viewBoxArr.length >= 4) {
+                    viewBoxRect = {
+                        x: parseFloat((viewBoxArr[0] || 0)),
+                        y: parseFloat((viewBoxArr[1] || 0)),
+                        width: parseFloat(viewBoxArr[2]),
+                        height: parseFloat(viewBoxArr[3])
+                    };
+                }
+            }
+            if (viewBoxRect && width != null && height != null) {
+                viewBoxTransform = makeViewBoxTransform(viewBoxRect, { x: 0, y: 0, width: width, height: height });
+                if (!opt.ignoreViewBox) {
+                    var elRoot = root;
+                    root = new Group();
+                    root.add(elRoot);
+                    elRoot.scaleX = elRoot.scaleY = viewBoxTransform.scale;
+                    elRoot.x = viewBoxTransform.x;
+                    elRoot.y = viewBoxTransform.y;
+                }
+            }
+            if (!opt.ignoreRootClip && width != null && height != null) {
+                root.setClipPath(new Rect({
+                    shape: { x: 0, y: 0, width: width, height: height }
+                }));
+            }
+            return {
+                root: root,
+                width: width,
+                height: height,
+                viewBoxRect: viewBoxRect,
+                viewBoxTransform: viewBoxTransform,
+                named: named
+            };
+        };
+        SVGParser.prototype._parseNode = function (xmlNode, parentGroup, named, namedFrom, isInDefs, isInText) {
+            var nodeName = xmlNode.nodeName.toLowerCase();
+            var el;
+            var namedFromForSub = namedFrom;
+            if (nodeName === 'defs') {
+                isInDefs = true;
+            }
+            if (nodeName === 'text') {
+                isInText = true;
+            }
+            if (nodeName === 'defs' || nodeName === 'switch') {
+                el = parentGroup;
+            }
+            else {
+                if (!isInDefs) {
+                    var parser_1 = nodeParsers[nodeName];
+                    if (parser_1 && hasOwn(nodeParsers, nodeName)) {
+                        el = parser_1.call(this, xmlNode, parentGroup);
+                        var nameAttr = xmlNode.getAttribute('name');
+                        if (nameAttr) {
+                            var newNamed = {
+                                name: nameAttr,
+                                namedFrom: null,
+                                svgNodeTagLower: nodeName,
+                                el: el
+                            };
+                            named.push(newNamed);
+                            if (nodeName === 'g') {
+                                namedFromForSub = newNamed;
+                            }
+                        }
+                        else if (namedFrom) {
+                            named.push({
+                                name: namedFrom.name,
+                                namedFrom: namedFrom,
+                                svgNodeTagLower: nodeName,
+                                el: el
+                            });
+                        }
+                        parentGroup.add(el);
+                    }
+                }
+                var parser = paintServerParsers[nodeName];
+                if (parser && hasOwn(paintServerParsers, nodeName)) {
+                    var def = parser.call(this, xmlNode);
+                    var id = xmlNode.getAttribute('id');
+                    if (id) {
+                        this._defs[id] = def;
+                    }
+                }
+            }
+            if (el && el.isGroup) {
+                var child = xmlNode.firstChild;
+                while (child) {
+                    if (child.nodeType === 1) {
+                        this._parseNode(child, el, named, namedFromForSub, isInDefs, isInText);
+                    }
+                    else if (child.nodeType === 3 && isInText) {
+                        this._parseText(child, el);
+                    }
+                    child = child.nextSibling;
+                }
+            }
+        };
+        SVGParser.prototype._parseText = function (xmlNode, parentGroup) {
+            var text = new TSpan({
+                style: {
+                    text: xmlNode.textContent
+                },
+                silent: true,
+                x: this._textX || 0,
+                y: this._textY || 0
+            });
+            inheritStyle(parentGroup, text);
+            parseAttributes(xmlNode, text, this._defsUsePending, false, false);
+            applyTextAlignment(text, parentGroup);
+            var textStyle = text.style;
+            var fontSize = textStyle.fontSize;
+            if (fontSize && fontSize < 9) {
+                textStyle.fontSize = 9;
+                text.scaleX *= fontSize / 9;
+                text.scaleY *= fontSize / 9;
+            }
+            var font = (textStyle.fontSize || textStyle.fontFamily) && [
+                textStyle.fontStyle,
+                textStyle.fontWeight,
+                (textStyle.fontSize || 12) + 'px',
+                textStyle.fontFamily || 'sans-serif'
+            ].join(' ');
+            textStyle.font = font;
+            var rect = text.getBoundingRect();
+            this._textX += rect.width;
+            parentGroup.add(text);
+            return text;
+        };
+        SVGParser.internalField = (function () {
+            nodeParsers = {
+                'g': function (xmlNode, parentGroup) {
+                    var g = new Group();
+                    inheritStyle(parentGroup, g);
+                    parseAttributes(xmlNode, g, this._defsUsePending, false, false);
+                    return g;
+                },
+                'rect': function (xmlNode, parentGroup) {
+                    var rect = new Rect();
+                    inheritStyle(parentGroup, rect);
+                    parseAttributes(xmlNode, rect, this._defsUsePending, false, false);
+                    rect.setShape({
+                        x: parseFloat(xmlNode.getAttribute('x') || '0'),
+                        y: parseFloat(xmlNode.getAttribute('y') || '0'),
+                        width: parseFloat(xmlNode.getAttribute('width') || '0'),
+                        height: parseFloat(xmlNode.getAttribute('height') || '0')
+                    });
+                    rect.silent = true;
+                    return rect;
+                },
+                'circle': function (xmlNode, parentGroup) {
+                    var circle = new Circle();
+                    inheritStyle(parentGroup, circle);
+                    parseAttributes(xmlNode, circle, this._defsUsePending, false, false);
+                    circle.setShape({
+                        cx: parseFloat(xmlNode.getAttribute('cx') || '0'),
+                        cy: parseFloat(xmlNode.getAttribute('cy') || '0'),
+                        r: parseFloat(xmlNode.getAttribute('r') || '0')
+                    });
+                    circle.silent = true;
+                    return circle;
+                },
+                'line': function (xmlNode, parentGroup) {
+                    var line = new Line();
+                    inheritStyle(parentGroup, line);
+                    parseAttributes(xmlNode, line, this._defsUsePending, false, false);
+                    line.setShape({
+                        x1: parseFloat(xmlNode.getAttribute('x1') || '0'),
+                        y1: parseFloat(xmlNode.getAttribute('y1') || '0'),
+                        x2: parseFloat(xmlNode.getAttribute('x2') || '0'),
+                        y2: parseFloat(xmlNode.getAttribute('y2') || '0')
+                    });
+                    line.silent = true;
+                    return line;
+                },
+                'ellipse': function (xmlNode, parentGroup) {
+                    var ellipse = new Ellipse();
+                    inheritStyle(parentGroup, ellipse);
+                    parseAttributes(xmlNode, ellipse, this._defsUsePending, false, false);
+                    ellipse.setShape({
+                        cx: parseFloat(xmlNode.getAttribute('cx') || '0'),
+                        cy: parseFloat(xmlNode.getAttribute('cy') || '0'),
+                        rx: parseFloat(xmlNode.getAttribute('rx') || '0'),
+                        ry: parseFloat(xmlNode.getAttribute('ry') || '0')
+                    });
+                    ellipse.silent = true;
+                    return ellipse;
+                },
+                'polygon': function (xmlNode, parentGroup) {
+                    var pointsStr = xmlNode.getAttribute('points');
+                    var pointsArr;
+                    if (pointsStr) {
+                        pointsArr = parsePoints(pointsStr);
+                    }
+                    var polygon = new Polygon({
+                        shape: {
+                            points: pointsArr || []
+                        },
+                        silent: true
+                    });
+                    inheritStyle(parentGroup, polygon);
+                    parseAttributes(xmlNode, polygon, this._defsUsePending, false, false);
+                    return polygon;
+                },
+                'polyline': function (xmlNode, parentGroup) {
+                    var pointsStr = xmlNode.getAttribute('points');
+                    var pointsArr;
+                    if (pointsStr) {
+                        pointsArr = parsePoints(pointsStr);
+                    }
+                    var polyline = new Polyline({
+                        shape: {
+                            points: pointsArr || []
+                        },
+                        silent: true
+                    });
+                    inheritStyle(parentGroup, polyline);
+                    parseAttributes(xmlNode, polyline, this._defsUsePending, false, false);
+                    return polyline;
+                },
+                'image': function (xmlNode, parentGroup) {
+                    var img = new ZRImage();
+                    inheritStyle(parentGroup, img);
+                    parseAttributes(xmlNode, img, this._defsUsePending, false, false);
+                    img.setStyle({
+                        image: xmlNode.getAttribute('xlink:href') || xmlNode.getAttribute('href'),
+                        x: +xmlNode.getAttribute('x'),
+                        y: +xmlNode.getAttribute('y'),
+                        width: +xmlNode.getAttribute('width'),
+                        height: +xmlNode.getAttribute('height')
+                    });
+                    img.silent = true;
+                    return img;
+                },
+                'text': function (xmlNode, parentGroup) {
+                    var x = xmlNode.getAttribute('x') || '0';
+                    var y = xmlNode.getAttribute('y') || '0';
+                    var dx = xmlNode.getAttribute('dx') || '0';
+                    var dy = xmlNode.getAttribute('dy') || '0';
+                    this._textX = parseFloat(x) + parseFloat(dx);
+                    this._textY = parseFloat(y) + parseFloat(dy);
+                    var g = new Group();
+                    inheritStyle(parentGroup, g);
+                    parseAttributes(xmlNode, g, this._defsUsePending, false, true);
+                    return g;
+                },
+                'tspan': function (xmlNode, parentGroup) {
+                    var x = xmlNode.getAttribute('x');
+                    var y = xmlNode.getAttribute('y');
+                    if (x != null) {
+                        this._textX = parseFloat(x);
+                    }
+                    if (y != null) {
+                        this._textY = parseFloat(y);
+                    }
+                    var dx = xmlNode.getAttribute('dx') || '0';
+                    var dy = xmlNode.getAttribute('dy') || '0';
+                    var g = new Group();
+                    inheritStyle(parentGroup, g);
+                    parseAttributes(xmlNode, g, this._defsUsePending, false, true);
+                    this._textX += parseFloat(dx);
+                    this._textY += parseFloat(dy);
+                    return g;
+                },
+                'path': function (xmlNode, parentGroup) {
+                    var d = xmlNode.getAttribute('d') || '';
+                    var path = createFromString(d);
+                    inheritStyle(parentGroup, path);
+                    parseAttributes(xmlNode, path, this._defsUsePending, false, false);
+                    path.silent = true;
+                    return path;
+                }
+            };
+        })();
+        return SVGParser;
+    }());
+    var paintServerParsers = {
+        'lineargradient': function (xmlNode) {
+            var x1 = parseInt(xmlNode.getAttribute('x1') || '0', 10);
+            var y1 = parseInt(xmlNode.getAttribute('y1') || '0', 10);
+            var x2 = parseInt(xmlNode.getAttribute('x2') || '10', 10);
+            var y2 = parseInt(xmlNode.getAttribute('y2') || '0', 10);
+            var gradient = new LinearGradient(x1, y1, x2, y2);
+            parsePaintServerUnit(xmlNode, gradient);
+            parseGradientColorStops(xmlNode, gradient);
+            return gradient;
+        },
+        'radialgradient': function (xmlNode) {
+            var cx = parseInt(xmlNode.getAttribute('cx') || '0', 10);
+            var cy = parseInt(xmlNode.getAttribute('cy') || '0', 10);
+            var r = parseInt(xmlNode.getAttribute('r') || '0', 10);
+            var gradient = new RadialGradient(cx, cy, r);
+            parsePaintServerUnit(xmlNode, gradient);
+            parseGradientColorStops(xmlNode, gradient);
+            return gradient;
+        }
+    };
+    function parsePaintServerUnit(xmlNode, gradient) {
+        var gradientUnits = xmlNode.getAttribute('gradientUnits');
+        if (gradientUnits === 'userSpaceOnUse') {
+            gradient.global = true;
+        }
+    }
+    function parseGradientColorStops(xmlNode, gradient) {
+        var stop = xmlNode.firstChild;
+        while (stop) {
+            if (stop.nodeType === 1
+                && stop.nodeName.toLocaleLowerCase() === 'stop') {
+                var offsetStr = stop.getAttribute('offset');
+                var offset = void 0;
+                if (offsetStr && offsetStr.indexOf('%') > 0) {
+                    offset = parseInt(offsetStr, 10) / 100;
+                }
+                else if (offsetStr) {
+                    offset = parseFloat(offsetStr);
+                }
+                else {
+                    offset = 0;
+                }
+                var styleVals = {};
+                parseInlineStyle(stop, styleVals, styleVals);
+                var stopColor = styleVals.stopColor
+                    || stop.getAttribute('stop-color')
+                    || '#000000';
+                gradient.colorStops.push({
+                    offset: offset,
+                    color: stopColor
+                });
+            }
+            stop = stop.nextSibling;
+        }
+    }
+    function inheritStyle(parent, child) {
+        if (parent && parent.__inheritedStyle) {
+            if (!child.__inheritedStyle) {
+                child.__inheritedStyle = {};
+            }
+            defaults(child.__inheritedStyle, parent.__inheritedStyle);
+        }
+    }
+    function parsePoints(pointsString) {
+        var list = splitNumberSequence(pointsString);
+        var points = [];
+        for (var i = 0; i < list.length; i += 2) {
+            var x = parseFloat(list[i]);
+            var y = parseFloat(list[i + 1]);
+            points.push([x, y]);
+        }
+        return points;
+    }
+    function parseAttributes(xmlNode, el, defsUsePending, onlyInlineStyle, isTextGroup) {
+        var disp = el;
+        var inheritedStyle = disp.__inheritedStyle = disp.__inheritedStyle || {};
+        var selfStyle = {};
+        if (xmlNode.nodeType === 1) {
+            parseTransformAttribute(xmlNode, el);
+            parseInlineStyle(xmlNode, inheritedStyle, selfStyle);
+            if (!onlyInlineStyle) {
+                parseAttributeStyle(xmlNode, inheritedStyle, selfStyle);
+            }
+        }
+        disp.style = disp.style || {};
+        if (inheritedStyle.fill != null) {
+            disp.style.fill = getFillStrokeStyle(disp, 'fill', inheritedStyle.fill, defsUsePending);
+        }
+        if (inheritedStyle.stroke != null) {
+            disp.style.stroke = getFillStrokeStyle(disp, 'stroke', inheritedStyle.stroke, defsUsePending);
+        }
+        each([
+            'lineWidth', 'opacity', 'fillOpacity', 'strokeOpacity', 'miterLimit', 'fontSize'
+        ], function (propName) {
+            if (inheritedStyle[propName] != null) {
+                disp.style[propName] = parseFloat(inheritedStyle[propName]);
+            }
+        });
+        each([
+            'lineDashOffset', 'lineCap', 'lineJoin', 'fontWeight', 'fontFamily', 'fontStyle', 'textAlign'
+        ], function (propName) {
+            if (inheritedStyle[propName] != null) {
+                disp.style[propName] = inheritedStyle[propName];
+            }
+        });
+        if (isTextGroup) {
+            disp.__selfStyle = selfStyle;
+        }
+        if (inheritedStyle.lineDash) {
+            disp.style.lineDash = map(splitNumberSequence(inheritedStyle.lineDash), function (str) {
+                return parseFloat(str);
+            });
+        }
+        if (inheritedStyle.visibility === 'hidden' || inheritedStyle.visibility === 'collapse') {
+            disp.invisible = true;
+        }
+        if (inheritedStyle.display === 'none') {
+            disp.ignore = true;
+        }
+    }
+    function applyTextAlignment(text, parentGroup) {
+        var parentSelfStyle = parentGroup.__selfStyle;
+        if (parentSelfStyle) {
+            var textBaseline = parentSelfStyle.textBaseline;
+            var zrTextBaseline = textBaseline;
+            if (!textBaseline || textBaseline === 'auto') {
+                zrTextBaseline = 'alphabetic';
+            }
+            else if (textBaseline === 'baseline') {
+                zrTextBaseline = 'alphabetic';
+            }
+            else if (textBaseline === 'before-edge' || textBaseline === 'text-before-edge') {
+                zrTextBaseline = 'top';
+            }
+            else if (textBaseline === 'after-edge' || textBaseline === 'text-after-edge') {
+                zrTextBaseline = 'bottom';
+            }
+            else if (textBaseline === 'central' || textBaseline === 'mathematical') {
+                zrTextBaseline = 'middle';
+            }
+            text.style.textBaseline = zrTextBaseline;
+        }
+        var parentInheritedStyle = parentGroup.__inheritedStyle;
+        if (parentInheritedStyle) {
+            var textAlign = parentInheritedStyle.textAlign;
+            var zrTextAlign = textAlign;
+            if (textAlign) {
+                if (textAlign === 'middle') {
+                    zrTextAlign = 'center';
+                }
+                text.style.textAlign = zrTextAlign;
+            }
+        }
+    }
+    var urlRegex = /^url\(\s*#(.*?)\)/;
+    function getFillStrokeStyle(el, method, str, defsUsePending) {
+        var urlMatch = str && str.match(urlRegex);
+        if (urlMatch) {
+            var url = trim(urlMatch[1]);
+            defsUsePending.push([el, method, url]);
+            return;
+        }
+        if (str === 'none') {
+            str = null;
+        }
+        return str;
+    }
+    function applyDefs(defs, defsUsePending) {
+        for (var i = 0; i < defsUsePending.length; i++) {
+            var item = defsUsePending[i];
+            item[0].style[item[1]] = defs[item[2]];
+        }
+    }
+    var numberReg$1 = /-?([0-9]*\.)?[0-9]+([eE]-?[0-9]+)?/g;
+    function splitNumberSequence(rawStr) {
+        return rawStr.match(numberReg$1) || [];
+    }
+    var transformRegex = /(translate|scale|rotate|skewX|skewY|matrix)\(([\-\s0-9\.eE,]*)\)/g;
+    var DEGREE_TO_ANGLE = Math.PI / 180;
+    function parseTransformAttribute(xmlNode, node) {
+        var transform = xmlNode.getAttribute('transform');
+        if (transform) {
+            transform = transform.replace(/,/g, ' ');
+            var transformOps_1 = [];
+            var mt = null;
+            transform.replace(transformRegex, function (str, type, value) {
+                transformOps_1.push(type, value);
+                return '';
+            });
+            for (var i = transformOps_1.length - 1; i > 0; i -= 2) {
+                var value = transformOps_1[i];
+                var type = transformOps_1[i - 1];
+                var valueArr = splitNumberSequence(value);
+                mt = mt || create$1();
+                switch (type) {
+                    case 'translate':
+                        translate(mt, mt, [parseFloat(valueArr[0]), parseFloat(valueArr[1] || '0')]);
+                        break;
+                    case 'scale':
+                        scale$1(mt, mt, [parseFloat(valueArr[0]), parseFloat(valueArr[1] || valueArr[0])]);
+                        break;
+                    case 'rotate':
+                        rotate(mt, mt, -parseFloat(valueArr[0]) * DEGREE_TO_ANGLE, [
+                            parseFloat(valueArr[1] || '0'),
+                            parseFloat(valueArr[2] || '0')
+                        ]);
+                        break;
+                    case 'skewX':
+                        var sx = Math.tan(parseFloat(valueArr[0]) * DEGREE_TO_ANGLE);
+                        mul$1(mt, [1, 0, sx, 1, 0, 0], mt);
+                        break;
+                    case 'skewY':
+                        var sy = Math.tan(parseFloat(valueArr[0]) * DEGREE_TO_ANGLE);
+                        mul$1(mt, [1, sy, 0, 1, 0, 0], mt);
+                        break;
+                    case 'matrix':
+                        mt[0] = parseFloat(valueArr[0]);
+                        mt[1] = parseFloat(valueArr[1]);
+                        mt[2] = parseFloat(valueArr[2]);
+                        mt[3] = parseFloat(valueArr[3]);
+                        mt[4] = parseFloat(valueArr[4]);
+                        mt[5] = parseFloat(valueArr[5]);
+                        break;
+                }
+            }
+            node.setLocalTransform(mt);
+        }
+    }
+    var styleRegex = /([^\s:;]+)\s*:\s*([^:;]+)/g;
+    function parseInlineStyle(xmlNode, inheritableStyleResult, selfStyleResult) {
+        var style = xmlNode.getAttribute('style');
+        if (!style) {
+            return;
+        }
+        styleRegex.lastIndex = 0;
+        var styleRegResult;
+        while ((styleRegResult = styleRegex.exec(style)) != null) {
+            var svgStlAttr = styleRegResult[1];
+            var zrInheritableStlAttr = hasOwn(INHERITABLE_STYLE_ATTRIBUTES_MAP, svgStlAttr)
+                ? INHERITABLE_STYLE_ATTRIBUTES_MAP[svgStlAttr]
+                : null;
+            if (zrInheritableStlAttr) {
+                inheritableStyleResult[zrInheritableStlAttr] = styleRegResult[2];
+            }
+            var zrSelfStlAttr = hasOwn(SELF_STYLE_ATTRIBUTES_MAP, svgStlAttr)
+                ? SELF_STYLE_ATTRIBUTES_MAP[svgStlAttr]
+                : null;
+            if (zrSelfStlAttr) {
+                selfStyleResult[zrSelfStlAttr] = styleRegResult[2];
+            }
+        }
+    }
+    function parseAttributeStyle(xmlNode, inheritableStyleResult, selfStyleResult) {
+        for (var i = 0; i < INHERITABLE_STYLE_ATTRIBUTES_MAP_KEYS.length; i++) {
+            var svgAttrName = INHERITABLE_STYLE_ATTRIBUTES_MAP_KEYS[i];
+            var attrValue = xmlNode.getAttribute(svgAttrName);
+            if (attrValue != null) {
+                inheritableStyleResult[INHERITABLE_STYLE_ATTRIBUTES_MAP[svgAttrName]] = attrValue;
+            }
+        }
+        for (var i = 0; i < SELF_STYLE_ATTRIBUTES_MAP_KEYS.length; i++) {
+            var svgAttrName = SELF_STYLE_ATTRIBUTES_MAP_KEYS[i];
+            var attrValue = xmlNode.getAttribute(svgAttrName);
+            if (attrValue != null) {
+                selfStyleResult[SELF_STYLE_ATTRIBUTES_MAP[svgAttrName]] = attrValue;
+            }
+        }
+    }
+    function makeViewBoxTransform(viewBoxRect, boundingRect) {
+        var scaleX = boundingRect.width / viewBoxRect.width;
+        var scaleY = boundingRect.height / viewBoxRect.height;
+        var scale = Math.min(scaleX, scaleY);
+        return {
+            scale: scale,
+            x: -(viewBoxRect.x + viewBoxRect.width / 2) * scale + (boundingRect.x + boundingRect.width / 2),
+            y: -(viewBoxRect.y + viewBoxRect.height / 2) * scale + (boundingRect.y + boundingRect.height / 2)
+        };
+    }
+    function parseSVG(xml, opt) {
+        var parser = new SVGParser();
+        return parser.parse(xml, opt);
+    }
+
+    var PI$2 = Math.PI;
+    var PI2$5 = PI$2 * 2;
+    var mathSin$3 = Math.sin;
+    var mathCos$3 = Math.cos;
+    var mathACos = Math.acos;
+    var mathATan2 = Math.atan2;
+    var mathAbs$1 = Math.abs;
+    var mathSqrt$3 = Math.sqrt;
+    var mathMax$3 = Math.max;
+    var mathMin$3 = Math.min;
+    var e = 1e-4;
+    function intersect(x0, y0, x1, y1, x2, y2, x3, y3) {
+        var dx10 = x1 - x0;
+        var dy10 = y1 - y0;
+        var dx32 = x3 - x2;
+        var dy32 = y3 - y2;
+        var t = dy32 * dx10 - dx32 * dy10;
+        if (t * t < e) {
+            return;
+        }
+        t = (dx32 * (y0 - y2) - dy32 * (x0 - x2)) / t;
+        return [x0 + t * dx10, y0 + t * dy10];
+    }
+    function computeCornerTangents(x0, y0, x1, y1, radius, cr, clockwise) {
+        var x01 = x0 - x1;
+        var y01 = y0 - y1;
+        var lo = (clockwise ? cr : -cr) / mathSqrt$3(x01 * x01 + y01 * y01);
+        var ox = lo * y01;
+        var oy = -lo * x01;
+        var x11 = x0 + ox;
+        var y11 = y0 + oy;
+        var x10 = x1 + ox;
+        var y10 = y1 + oy;
+        var x00 = (x11 + x10) / 2;
+        var y00 = (y11 + y10) / 2;
+        var dx = x10 - x11;
+        var dy = y10 - y11;
+        var d2 = dx * dx + dy * dy;
+        var r = radius - cr;
+        var s = x11 * y10 - x10 * y11;
+        var d = (dy < 0 ? -1 : 1) * mathSqrt$3(mathMax$3(0, r * r * d2 - s * s));
+        var cx0 = (s * dy - dx * d) / d2;
+        var cy0 = (-s * dx - dy * d) / d2;
+        var cx1 = (s * dy + dx * d) / d2;
+        var cy1 = (-s * dx + dy * d) / d2;
+        var dx0 = cx0 - x00;
+        var dy0 = cy0 - y00;
+        var dx1 = cx1 - x00;
+        var dy1 = cy1 - y00;
+        if (dx0 * dx0 + dy0 * dy0 > dx1 * dx1 + dy1 * dy1) {
+            cx0 = cx1;
+            cy0 = cy1;
+        }
+        return {
+            cx: cx0,
+            cy: cy0,
+            x0: -ox,
+            y0: -oy,
+            x1: cx0 * (radius / r - 1),
+            y1: cy0 * (radius / r - 1)
+        };
+    }
+    function normalizeCornerRadius(cr) {
+        var arr;
+        if (isArray(cr)) {
+            var len = cr.length;
+            if (!len) {
+                return cr;
+            }
+            if (len === 1) {
+                arr = [cr[0], cr[0], 0, 0];
+            }
+            else if (len === 2) {
+                arr = [cr[0], cr[0], cr[1], cr[1]];
+            }
+            else if (len === 3) {
+                arr = cr.concat(cr[2]);
+            }
+            else {
+                arr = cr;
+            }
+        }
+        else {
+            arr = [cr, cr, cr, cr];
+        }
+        return arr;
+    }
+    function buildPath$2(ctx, shape) {
+        var _a;
+        var radius = mathMax$3(shape.r, 0);
+        var innerRadius = mathMax$3(shape.r0 || 0, 0);
+        var hasRadius = radius > 0;
+        var hasInnerRadius = innerRadius > 0;
+        if (!hasRadius && !hasInnerRadius) {
+            return;
+        }
+        if (!hasRadius) {
+            radius = innerRadius;
+            innerRadius = 0;
+        }
+        if (innerRadius > radius) {
+            var tmp = radius;
+            radius = innerRadius;
+            innerRadius = tmp;
+        }
+        var startAngle = shape.startAngle, endAngle = shape.endAngle;
+        if (isNaN(startAngle) || isNaN(endAngle)) {
+            return;
+        }
+        var cx = shape.cx, cy = shape.cy;
+        var clockwise = !!shape.clockwise;
+        var arc = mathAbs$1(endAngle - startAngle);
+        var mod = arc > PI2$5 && arc % PI2$5;
+        mod > e && (arc = mod);
+        if (!(radius > e)) {
+            ctx.moveTo(cx, cy);
+        }
+        else if (arc > PI2$5 - e) {
+            ctx.moveTo(cx + radius * mathCos$3(startAngle), cy + radius * mathSin$3(startAngle));
+            ctx.arc(cx, cy, radius, startAngle, endAngle, !clockwise);
+            if (innerRadius > e) {
+                ctx.moveTo(cx + innerRadius * mathCos$3(endAngle), cy + innerRadius * mathSin$3(endAngle));
+                ctx.arc(cx, cy, innerRadius, endAngle, startAngle, clockwise);
+            }
+        }
+        else {
+            var icrStart = void 0;
+            var icrEnd = void 0;
+            var ocrStart = void 0;
+            var ocrEnd = void 0;
+            var ocrs = void 0;
+            var ocre = void 0;
+            var icrs = void 0;
+            var icre = void 0;
+            var ocrMax = void 0;
+            var icrMax = void 0;
+            var limitedOcrMax = void 0;
+            var limitedIcrMax = void 0;
+            var xre = void 0;
+            var yre = void 0;
+            var xirs = void 0;
+            var yirs = void 0;
+            var xrs = radius * mathCos$3(startAngle);
+            var yrs = radius * mathSin$3(startAngle);
+            var xire = innerRadius * mathCos$3(endAngle);
+            var yire = innerRadius * mathSin$3(endAngle);
+            var hasArc = arc > e;
+            if (hasArc) {
+                var cornerRadius = shape.cornerRadius;
+                if (cornerRadius) {
+                    _a = normalizeCornerRadius(cornerRadius), icrStart = _a[0], icrEnd = _a[1], ocrStart = _a[2], ocrEnd = _a[3];
+                }
+                var halfRd = mathAbs$1(radius - innerRadius) / 2;
+                ocrs = mathMin$3(halfRd, ocrStart);
+                ocre = mathMin$3(halfRd, ocrEnd);
+                icrs = mathMin$3(halfRd, icrStart);
+                icre = mathMin$3(halfRd, icrEnd);
+                limitedOcrMax = ocrMax = mathMax$3(ocrs, ocre);
+                limitedIcrMax = icrMax = mathMax$3(icrs, icre);
+                if (ocrMax > e || icrMax > e) {
+                    xre = radius * mathCos$3(endAngle);
+                    yre = radius * mathSin$3(endAngle);
+                    xirs = innerRadius * mathCos$3(startAngle);
+                    yirs = innerRadius * mathSin$3(startAngle);
+                    if (arc < PI$2) {
+                        var it_1 = intersect(xrs, yrs, xirs, yirs, xre, yre, xire, yire);
+                        if (it_1) {
+                            var x0 = xrs - it_1[0];
+                            var y0 = yrs - it_1[1];
+                            var x1 = xre - it_1[0];
+                            var y1 = yre - it_1[1];
+                            var a = 1 / mathSin$3(mathACos((x0 * x1 + y0 * y1) / (mathSqrt$3(x0 * x0 + y0 * y0) * mathSqrt$3(x1 * x1 + y1 * y1))) / 2);
+                            var b = mathSqrt$3(it_1[0] * it_1[0] + it_1[1] * it_1[1]);
+                            limitedOcrMax = mathMin$3(ocrMax, (radius - b) / (a + 1));
+                            limitedIcrMax = mathMin$3(icrMax, (innerRadius - b) / (a - 1));
+                        }
+                    }
+                }
+            }
+            if (!hasArc) {
+                ctx.moveTo(cx + xrs, cy + yrs);
+            }
+            else if (limitedOcrMax > e) {
+                var crStart = mathMin$3(ocrStart, limitedOcrMax);
+                var crEnd = mathMin$3(ocrEnd, limitedOcrMax);
+                var ct0 = computeCornerTangents(xirs, yirs, xrs, yrs, radius, crStart, clockwise);
+                var ct1 = computeCornerTangents(xre, yre, xire, yire, radius, crEnd, clockwise);
+                ctx.moveTo(cx + ct0.cx + ct0.x0, cy + ct0.cy + ct0.y0);
+                if (limitedOcrMax < ocrMax && crStart === crEnd) {
+                    ctx.arc(cx + ct0.cx, cy + ct0.cy, limitedOcrMax, mathATan2(ct0.y0, ct0.x0), mathATan2(ct1.y0, ct1.x0), !clockwise);
+                }
+                else {
+                    crStart > 0 && ctx.arc(cx + ct0.cx, cy + ct0.cy, crStart, mathATan2(ct0.y0, ct0.x0), mathATan2(ct0.y1, ct0.x1), !clockwise);
+                    ctx.arc(cx, cy, radius, mathATan2(ct0.cy + ct0.y1, ct0.cx + ct0.x1), mathATan2(ct1.cy + ct1.y1, ct1.cx + ct1.x1), !clockwise);
+                    crEnd > 0 && ctx.arc(cx + ct1.cx, cy + ct1.cy, crEnd, mathATan2(ct1.y1, ct1.x1), mathATan2(ct1.y0, ct1.x0), !clockwise);
+                }
+            }
+            else {
+                ctx.moveTo(cx + xrs, cy + yrs);
+                ctx.arc(cx, cy, radius, startAngle, endAngle, !clockwise);
+            }
+            if (!(innerRadius > e) || !hasArc) {
+                ctx.lineTo(cx + xire, cy + yire);
+            }
+            else if (limitedIcrMax > e) {
+                var crStart = mathMin$3(icrStart, limitedIcrMax);
+                var crEnd = mathMin$3(icrEnd, limitedIcrMax);
+                var ct0 = computeCornerTangents(xire, yire, xre, yre, innerRadius, -crEnd, clockwise);
+                var ct1 = computeCornerTangents(xrs, yrs, xirs, yirs, innerRadius, -crStart, clockwise);
+                ctx.lineTo(cx + ct0.cx + ct0.x0, cy + ct0.cy + ct0.y0);
+                if (limitedIcrMax < icrMax && crStart === crEnd) {
+                    ctx.arc(cx + ct0.cx, cy + ct0.cy, limitedIcrMax, mathATan2(ct0.y0, ct0.x0), mathATan2(ct1.y0, ct1.x0), !clockwise);
+                }
+                else {
+                    crEnd > 0 && ctx.arc(cx + ct0.cx, cy + ct0.cy, crEnd, mathATan2(ct0.y0, ct0.x0), mathATan2(ct0.y1, ct0.x1), !clockwise);
+                    ctx.arc(cx, cy, innerRadius, mathATan2(ct0.cy + ct0.y1, ct0.cx + ct0.x1), mathATan2(ct1.cy + ct1.y1, ct1.cx + ct1.x1), clockwise);
+                    crStart > 0 && ctx.arc(cx + ct1.cx, cy + ct1.cy, crStart, mathATan2(ct1.y1, ct1.x1), mathATan2(ct1.y0, ct1.x0), !clockwise);
+                }
+            }
+            else {
+                ctx.lineTo(cx + xire, cy + yire);
+                ctx.arc(cx, cy, innerRadius, endAngle, startAngle, clockwise);
+            }
+        }
+        ctx.closePath();
+    }
+
+    var SectorShape = (function () {
+        function SectorShape() {
+            this.cx = 0;
+            this.cy = 0;
+            this.r0 = 0;
+            this.r = 0;
+            this.startAngle = 0;
+            this.endAngle = Math.PI * 2;
+            this.clockwise = true;
+            this.cornerRadius = 0;
+        }
+        return SectorShape;
+    }());
+    var Sector = (function (_super) {
+        __extends(Sector, _super);
+        function Sector(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Sector.prototype.getDefaultShape = function () {
+            return new SectorShape();
+        };
+        Sector.prototype.buildPath = function (ctx, shape) {
+            buildPath$2(ctx, shape);
+        };
+        Sector.prototype.isZeroArea = function () {
+            return this.shape.startAngle === this.shape.endAngle
+                || this.shape.r === this.shape.r0;
+        };
+        return Sector;
+    }(Path));
+    Sector.prototype.type = 'sector';
+
+    var CMD$3 = PathProxy.CMD;
+    function aroundEqual(a, b) {
+        return Math.abs(a - b) < 1e-5;
+    }
+    function pathToBezierCurves(path) {
+        var data = path.data;
+        var len = path.len();
+        var bezierArrayGroups = [];
+        var currentSubpath;
+        var xi = 0;
+        var yi = 0;
+        var x0 = 0;
+        var y0 = 0;
+        function createNewSubpath(x, y) {
+            if (currentSubpath && currentSubpath.length > 2) {
+                bezierArrayGroups.push(currentSubpath);
+            }
+            currentSubpath = [x, y];
+        }
+        function addLine(x0, y0, x1, y1) {
+            if (!(aroundEqual(x0, x1) && aroundEqual(y0, y1))) {
+                currentSubpath.push(x0, y0, x1, y1, x1, y1);
+            }
+        }
+        function addArc(startAngle, endAngle, cx, cy, rx, ry) {
+            var delta = Math.abs(endAngle - startAngle);
+            var len = Math.tan(delta / 4) * 4 / 3;
+            var dir = endAngle < startAngle ? -1 : 1;
+            var c1 = Math.cos(startAngle);
+            var s1 = Math.sin(startAngle);
+            var c2 = Math.cos(endAngle);
+            var s2 = Math.sin(endAngle);
+            var x1 = c1 * rx + cx;
+            var y1 = s1 * ry + cy;
+            var x4 = c2 * rx + cx;
+            var y4 = s2 * ry + cy;
+            var hx = rx * len * dir;
+            var hy = ry * len * dir;
+            currentSubpath.push(x1 - hx * s1, y1 + hy * c1, x4 + hx * s2, y4 - hy * c2, x4, y4);
+        }
+        var x1;
+        var y1;
+        var x2;
+        var y2;
+        for (var i = 0; i < len;) {
+            var cmd = data[i++];
+            var isFirst = i === 1;
+            if (isFirst) {
+                xi = data[i];
+                yi = data[i + 1];
+                x0 = xi;
+                y0 = yi;
+                if (cmd === CMD$3.L || cmd === CMD$3.C || cmd === CMD$3.Q) {
+                    currentSubpath = [x0, y0];
+                }
+            }
+            switch (cmd) {
+                case CMD$3.M:
+                    xi = x0 = data[i++];
+                    yi = y0 = data[i++];
+                    createNewSubpath(x0, y0);
+                    break;
+                case CMD$3.L:
+                    x1 = data[i++];
+                    y1 = data[i++];
+                    addLine(xi, yi, x1, y1);
+                    xi = x1;
+                    yi = y1;
+                    break;
+                case CMD$3.C:
+                    currentSubpath.push(data[i++], data[i++], data[i++], data[i++], xi = data[i++], yi = data[i++]);
+                    break;
+                case CMD$3.Q:
+                    x1 = data[i++];
+                    y1 = data[i++];
+                    x2 = data[i++];
+                    y2 = data[i++];
+                    currentSubpath.push(xi + 2 / 3 * (x1 - xi), yi + 2 / 3 * (y1 - yi), x2 + 2 / 3 * (x1 - x2), y2 + 2 / 3 * (y1 - y2), x2, y2);
+                    xi = x2;
+                    yi = y2;
+                    break;
+                case CMD$3.A:
+                    var cx = data[i++];
+                    var cy = data[i++];
+                    var rx = data[i++];
+                    var ry = data[i++];
+                    var startAngle = data[i++];
+                    var endAngle = data[i++] + startAngle;
+                    i += 1;
+                    var anticlockwise = !data[i++];
+                    x1 = Math.cos(startAngle) * rx + cx;
+                    y1 = Math.sin(startAngle) * ry + cy;
+                    if (isFirst) {
+                        x0 = x1;
+                        y0 = y1;
+                        createNewSubpath(x0, y0);
+                    }
+                    else {
+                        addLine(xi, yi, x1, y1);
+                    }
+                    xi = Math.cos(endAngle) * rx + cx;
+                    yi = Math.sin(endAngle) * ry + cy;
+                    var step = (anticlockwise ? -1 : 1) * Math.PI / 2;
+                    for (var angle = startAngle; anticlockwise ? angle > endAngle : angle < endAngle; angle += step) {
+                        var nextAngle = anticlockwise ? Math.max(angle + step, endAngle)
+                            : Math.min(angle + step, endAngle);
+                        addArc(angle, nextAngle, cx, cy, rx, ry);
+                    }
+                    break;
+                case CMD$3.R:
+                    x0 = xi = data[i++];
+                    y0 = yi = data[i++];
+                    x1 = x0 + data[i++];
+                    y1 = y0 + data[i++];
+                    createNewSubpath(x1, y0);
+                    addLine(x1, y0, x1, y1);
+                    addLine(x1, y1, x0, y1);
+                    addLine(x0, y1, x0, y0);
+                    addLine(x0, y0, x1, y0);
+                    break;
+                case CMD$3.Z:
+                    currentSubpath && addLine(xi, yi, x0, y0);
+                    xi = x0;
+                    yi = y0;
+                    break;
+            }
+        }
+        if (currentSubpath && currentSubpath.length > 2) {
+            bezierArrayGroups.push(currentSubpath);
+        }
+        return bezierArrayGroups;
+    }
+    function adpativeBezier(x0, y0, x1, y1, x2, y2, x3, y3, out, scale) {
+        if (aroundEqual(x0, x1) && aroundEqual(y0, y1) && aroundEqual(x2, x3) && aroundEqual(y2, y3)) {
+            out.push(x3, y3);
+            return;
+        }
+        var PIXEL_DISTANCE = 2 / scale;
+        var PIXEL_DISTANCE_SQR = PIXEL_DISTANCE * PIXEL_DISTANCE;
+        var dx = x3 - x0;
+        var dy = y3 - y0;
+        var d = Math.sqrt(dx * dx + dy * dy);
+        dx /= d;
+        dy /= d;
+        var dx1 = x1 - x0;
+        var dy1 = y1 - y0;
+        var dx2 = x2 - x3;
+        var dy2 = y2 - y3;
+        var cp1LenSqr = dx1 * dx1 + dy1 * dy1;
+        var cp2LenSqr = dx2 * dx2 + dy2 * dy2;
+        if (cp1LenSqr < PIXEL_DISTANCE_SQR && cp2LenSqr < PIXEL_DISTANCE_SQR) {
+            out.push(x3, y3);
+            return;
+        }
+        var projLen1 = dx * dx1 + dy * dy1;
+        var projLen2 = -dx * dx2 - dy * dy2;
+        var d1Sqr = cp1LenSqr - projLen1 * projLen1;
+        var d2Sqr = cp2LenSqr - projLen2 * projLen2;
+        if (d1Sqr < PIXEL_DISTANCE_SQR && projLen1 >= 0
+            && d2Sqr < PIXEL_DISTANCE_SQR && projLen2 >= 0) {
+            out.push(x3, y3);
+            return;
+        }
+        var tmpSegX = [];
+        var tmpSegY = [];
+        cubicSubdivide(x0, x1, x2, x3, 0.5, tmpSegX);
+        cubicSubdivide(y0, y1, y2, y3, 0.5, tmpSegY);
+        adpativeBezier(tmpSegX[0], tmpSegY[0], tmpSegX[1], tmpSegY[1], tmpSegX[2], tmpSegY[2], tmpSegX[3], tmpSegY[3], out, scale);
+        adpativeBezier(tmpSegX[4], tmpSegY[4], tmpSegX[5], tmpSegY[5], tmpSegX[6], tmpSegY[6], tmpSegX[7], tmpSegY[7], out, scale);
+    }
+    function pathToPolygons(path, scale) {
+        var bezierArrayGroups = pathToBezierCurves(path);
+        var polygons = [];
+        scale = scale || 1;
+        for (var i = 0; i < bezierArrayGroups.length; i++) {
+            var beziers = bezierArrayGroups[i];
+            var polygon = [];
+            var x0 = beziers[0];
+            var y0 = beziers[1];
+            polygon.push(x0, y0);
+            for (var k = 2; k < beziers.length;) {
+                var x1 = beziers[k++];
+                var y1 = beziers[k++];
+                var x2 = beziers[k++];
+                var y2 = beziers[k++];
+                var x3 = beziers[k++];
+                var y3 = beziers[k++];
+                adpativeBezier(x0, y0, x1, y1, x2, y2, x3, y3, polygon, scale);
+                x0 = x3;
+                y0 = y3;
+            }
+            polygons.push(polygon);
+        }
+        return polygons;
+    }
+
+    function getDividingGrids(dimSize, rowDim, count) {
+        var rowSize = dimSize[rowDim];
+        var columnSize = dimSize[1 - rowDim];
+        var ratio = Math.abs(rowSize / columnSize);
+        var rowCount = Math.ceil(Math.sqrt(ratio * count));
+        var columnCount = Math.floor(count / rowCount);
+        if (columnCount === 0) {
+            columnCount = 1;
+            rowCount = count;
+        }
+        var grids = [];
+        for (var i = 0; i < rowCount; i++) {
+            grids.push(columnCount);
+        }
+        var currentCount = rowCount * columnCount;
+        var remained = count - currentCount;
+        if (remained > 0) {
+            for (var i = 0; i < remained; i++) {
+                grids[i % rowCount] += 1;
+            }
+        }
+        return grids;
+    }
+    function divideSector(sectorShape, count, outShapes) {
+        var r0 = sectorShape.r0;
+        var r = sectorShape.r;
+        var startAngle = sectorShape.startAngle;
+        var endAngle = sectorShape.endAngle;
+        var angle = Math.abs(endAngle - startAngle);
+        var arcLen = angle * r;
+        var deltaR = r - r0;
+        var isAngleRow = arcLen > Math.abs(deltaR);
+        var grids = getDividingGrids([arcLen, deltaR], isAngleRow ? 0 : 1, count);
+        var rowSize = (isAngleRow ? angle : deltaR) / grids.length;
+        for (var row = 0; row < grids.length; row++) {
+            var columnSize = (isAngleRow ? deltaR : angle) / grids[row];
+            for (var column = 0; column < grids[row]; column++) {
+                var newShape = {};
+                if (isAngleRow) {
+                    newShape.startAngle = startAngle + rowSize * row;
+                    newShape.endAngle = startAngle + rowSize * (row + 1);
+                    newShape.r0 = r0 + columnSize * column;
+                    newShape.r = r0 + columnSize * (column + 1);
+                }
+                else {
+                    newShape.startAngle = startAngle + columnSize * column;
+                    newShape.endAngle = startAngle + columnSize * (column + 1);
+                    newShape.r0 = r0 + rowSize * row;
+                    newShape.r = r0 + rowSize * (row + 1);
+                }
+                newShape.clockwise = sectorShape.clockwise;
+                newShape.cx = sectorShape.cx;
+                newShape.cy = sectorShape.cy;
+                outShapes.push(newShape);
+            }
+        }
+    }
+    function divideRect(rectShape, count, outShapes) {
+        var width = rectShape.width;
+        var height = rectShape.height;
+        var isHorizontalRow = width > height;
+        var grids = getDividingGrids([width, height], isHorizontalRow ? 0 : 1, count);
+        var rowSizeDim = isHorizontalRow ? 'width' : 'height';
+        var columnSizeDim = isHorizontalRow ? 'height' : 'width';
+        var rowDim = isHorizontalRow ? 'x' : 'y';
+        var columnDim = isHorizontalRow ? 'y' : 'x';
+        var rowSize = rectShape[rowSizeDim] / grids.length;
+        for (var row = 0; row < grids.length; row++) {
+            var columnSize = rectShape[columnSizeDim] / grids[row];
+            for (var column = 0; column < grids[row]; column++) {
+                var newShape = {};
+                newShape[rowDim] = row * rowSize;
+                newShape[columnDim] = column * columnSize;
+                newShape[rowSizeDim] = rowSize;
+                newShape[columnSizeDim] = columnSize;
+                newShape.x += rectShape.x;
+                newShape.y += rectShape.y;
+                outShapes.push(newShape);
+            }
+        }
+    }
+    function crossProduct2d(x1, y1, x2, y2) {
+        return x1 * y2 - x2 * y1;
+    }
+    function lineLineIntersect(a1x, a1y, a2x, a2y, b1x, b1y, b2x, b2y) {
+        var mx = a2x - a1x;
+        var my = a2y - a1y;
+        var nx = b2x - b1x;
+        var ny = b2y - b1y;
+        var nmCrossProduct = crossProduct2d(nx, ny, mx, my);
+        if (Math.abs(nmCrossProduct) < 1e-6) {
+            return null;
+        }
+        var b1a1x = a1x - b1x;
+        var b1a1y = a1y - b1y;
+        var p = crossProduct2d(b1a1x, b1a1y, nx, ny) / nmCrossProduct;
+        if (p < 0 || p > 1) {
+            return null;
+        }
+        return new Point(p * mx + a1x, p * my + a1y);
+    }
+    function projPtOnLine(pt, lineA, lineB) {
+        var dir = new Point();
+        Point.sub(dir, lineB, lineA);
+        dir.normalize();
+        var dir2 = new Point();
+        Point.sub(dir2, pt, lineA);
+        var len = dir2.dot(dir);
+        return len;
+    }
+    function addToPoly(poly, pt) {
+        var last = poly[poly.length - 1];
+        if (last && last[0] === pt[0] && last[1] === pt[1]) {
+            return;
+        }
+        poly.push(pt);
+    }
+    function splitPolygonByLine(points, lineA, lineB) {
+        var len = points.length;
+        var intersections = [];
+        for (var i = 0; i < len; i++) {
+            var p0 = points[i];
+            var p1 = points[(i + 1) % len];
+            var intersectionPt = lineLineIntersect(p0[0], p0[1], p1[0], p1[1], lineA.x, lineA.y, lineB.x, lineB.y);
+            if (intersectionPt) {
+                intersections.push({
+                    projPt: projPtOnLine(intersectionPt, lineA, lineB),
+                    pt: intersectionPt,
+                    idx: i
+                });
+            }
+        }
+        if (intersections.length < 2) {
+            return [{ points: points }, { points: points }];
+        }
+        intersections.sort(function (a, b) {
+            return a.projPt - b.projPt;
+        });
+        var splitPt0 = intersections[0];
+        var splitPt1 = intersections[intersections.length - 1];
+        if (splitPt1.idx < splitPt0.idx) {
+            var tmp = splitPt0;
+            splitPt0 = splitPt1;
+            splitPt1 = tmp;
+        }
+        var splitPt0Arr = [splitPt0.pt.x, splitPt0.pt.y];
+        var splitPt1Arr = [splitPt1.pt.x, splitPt1.pt.y];
+        var newPolyA = [splitPt0Arr];
+        var newPolyB = [splitPt1Arr];
+        for (var i = splitPt0.idx + 1; i <= splitPt1.idx; i++) {
+            addToPoly(newPolyA, points[i].slice());
+        }
+        addToPoly(newPolyA, splitPt1Arr);
+        addToPoly(newPolyA, splitPt0Arr);
+        for (var i = splitPt1.idx + 1; i <= splitPt0.idx + len; i++) {
+            addToPoly(newPolyB, points[i % len].slice());
+        }
+        addToPoly(newPolyB, splitPt0Arr);
+        addToPoly(newPolyB, splitPt1Arr);
+        return [{
+                points: newPolyA
+            }, {
+                points: newPolyB
+            }];
+    }
+    function binaryDividePolygon(polygonShape) {
+        var points = polygonShape.points;
+        var min = [];
+        var max = [];
+        fromPoints(points, min, max);
+        var boundingRect = new BoundingRect(min[0], min[1], max[0] - min[0], max[1] - min[1]);
+        var width = boundingRect.width;
+        var height = boundingRect.height;
+        var x = boundingRect.x;
+        var y = boundingRect.y;
+        var pt0 = new Point();
+        var pt1 = new Point();
+        if (width > height) {
+            pt0.x = pt1.x = x + width / 2;
+            pt0.y = y;
+            pt1.y = y + height;
+        }
+        else {
+            pt0.y = pt1.y = y + height / 2;
+            pt0.x = x;
+            pt1.x = x + width;
+        }
+        return splitPolygonByLine(points, pt0, pt1);
+    }
+    function binaryDivideRecursive(divider, shape, count, out) {
+        if (count === 1) {
+            out.push(shape);
+        }
+        else {
+            var mid = Math.floor(count / 2);
+            var sub = divider(shape);
+            binaryDivideRecursive(divider, sub[0], mid, out);
+            binaryDivideRecursive(divider, sub[1], count - mid, out);
+        }
+        return out;
+    }
+    function clone$3(path, count) {
+        var paths = [];
+        for (var i = 0; i < count; i++) {
+            paths.push(clonePath(path));
+        }
+        return paths;
+    }
+    function copyPathProps(source, target) {
+        target.setStyle(source.style);
+        target.z = source.z;
+        target.z2 = source.z2;
+        target.zlevel = source.zlevel;
+    }
+    function polygonConvert(points) {
+        var out = [];
+        for (var i = 0; i < points.length;) {
+            out.push([points[i++], points[i++]]);
+        }
+        return out;
+    }
+    function split(path, count) {
+        var outShapes = [];
+        var shape = path.shape;
+        var OutShapeCtor;
+        switch (path.type) {
+            case 'rect':
+                divideRect(shape, count, outShapes);
+                OutShapeCtor = Rect;
+                break;
+            case 'sector':
+                divideSector(shape, count, outShapes);
+                OutShapeCtor = Sector;
+                break;
+            case 'circle':
+                divideSector({
+                    r0: 0, r: shape.r, startAngle: 0, endAngle: Math.PI * 2,
+                    cx: shape.cx, cy: shape.cy
+                }, count, outShapes);
+                OutShapeCtor = Sector;
+                break;
+            default:
+                var m = path.getComputedTransform();
+                var scale = m ? Math.sqrt(Math.max(m[0] * m[0] + m[1] * m[1], m[2] * m[2] + m[3] * m[3])) : 1;
+                var polygons = map(pathToPolygons(path.getUpdatedPathProxy(), scale), function (poly) { return polygonConvert(poly); });
+                var polygonCount = polygons.length;
+                if (polygonCount === 0) {
+                    binaryDivideRecursive(binaryDividePolygon, {
+                        points: polygons[0]
+                    }, count, outShapes);
+                }
+                else if (polygonCount === count) {
+                    for (var i = 0; i < polygonCount; i++) {
+                        outShapes.push({
+                            points: polygons[i]
+                        });
+                    }
+                }
+                else {
+                    var totalArea_1 = 0;
+                    var items = map(polygons, function (poly) {
+                        var min = [];
+                        var max = [];
+                        fromPoints(poly, min, max);
+                        var area = (max[1] - min[1]) * (max[0] - min[0]);
+                        totalArea_1 += area;
+                        return { poly: poly, area: area };
+                    });
+                    items.sort(function (a, b) { return b.area - a.area; });
+                    var left = count;
+                    for (var i = 0; i < polygonCount; i++) {
+                        var item = items[i];
+                        if (left <= 0) {
+                            break;
+                        }
+                        var selfCount = i === polygonCount - 1
+                            ? left
+                            : Math.ceil(item.area / totalArea_1 * count);
+                        if (selfCount < 0) {
+                            continue;
+                        }
+                        binaryDivideRecursive(binaryDividePolygon, {
+                            points: item.poly
+                        }, selfCount, outShapes);
+                        left -= selfCount;
+                    }
+                }
+                OutShapeCtor = Polygon;
+                break;
+        }
+        if (!OutShapeCtor) {
+            return clone$3(path, count);
+        }
+        var out = [];
+        for (var i = 0; i < outShapes.length; i++) {
+            var subPath = new OutShapeCtor();
+            subPath.setShape(outShapes[i]);
+            copyPathProps(path, subPath);
+            out.push(subPath);
+        }
+        return out;
+    }
+
+    function alignSubpath(subpath1, subpath2) {
+        var len1 = subpath1.length;
+        var len2 = subpath2.length;
+        if (len1 === len2) {
+            return [subpath1, subpath2];
+        }
+        var tmpSegX = [];
+        var tmpSegY = [];
+        var shorterPath = len1 < len2 ? subpath1 : subpath2;
+        var shorterLen = Math.min(len1, len2);
+        var diff = Math.abs(len2 - len1) / 6;
+        var shorterBezierCount = (shorterLen - 2) / 6;
+        var eachCurveSubDivCount = Math.ceil(diff / shorterBezierCount) + 1;
+        var newSubpath = [shorterPath[0], shorterPath[1]];
+        var remained = diff;
+        for (var i = 2; i < shorterLen;) {
+            var x0 = shorterPath[i - 2];
+            var y0 = shorterPath[i - 1];
+            var x1 = shorterPath[i++];
+            var y1 = shorterPath[i++];
+            var x2 = shorterPath[i++];
+            var y2 = shorterPath[i++];
+            var x3 = shorterPath[i++];
+            var y3 = shorterPath[i++];
+            if (remained <= 0) {
+                newSubpath.push(x1, y1, x2, y2, x3, y3);
+                continue;
+            }
+            var actualSubDivCount = Math.min(remained, eachCurveSubDivCount - 1) + 1;
+            for (var k = 1; k <= actualSubDivCount; k++) {
+                var p = k / actualSubDivCount;
+                cubicSubdivide(x0, x1, x2, x3, p, tmpSegX);
+                cubicSubdivide(y0, y1, y2, y3, p, tmpSegY);
+                x0 = tmpSegX[3];
+                y0 = tmpSegY[3];
+                newSubpath.push(tmpSegX[1], tmpSegY[1], tmpSegX[2], tmpSegY[2], x0, y0);
+                x1 = tmpSegX[5];
+                y1 = tmpSegY[5];
+                x2 = tmpSegX[6];
+                y2 = tmpSegY[6];
+            }
+            remained -= actualSubDivCount - 1;
+        }
+        return shorterPath === subpath1 ? [newSubpath, subpath2] : [subpath1, newSubpath];
+    }
+    function createSubpath(lastSubpathSubpath, otherSubpath) {
+        var len = lastSubpathSubpath.length;
+        var lastX = lastSubpathSubpath[len - 2];
+        var lastY = lastSubpathSubpath[len - 1];
+        var newSubpath = [];
+        for (var i = 0; i < otherSubpath.length;) {
+            newSubpath[i++] = lastX;
+            newSubpath[i++] = lastY;
+        }
+        return newSubpath;
+    }
+    function alignBezierCurves(array1, array2) {
+        var _a;
+        var lastSubpath1;
+        var lastSubpath2;
+        var newArray1 = [];
+        var newArray2 = [];
+        for (var i = 0; i < Math.max(array1.length, array2.length); i++) {
+            var subpath1 = array1[i];
+            var subpath2 = array2[i];
+            var newSubpath1 = void 0;
+            var newSubpath2 = void 0;
+            if (!subpath1) {
+                newSubpath1 = createSubpath(lastSubpath1 || subpath2, subpath2);
+                newSubpath2 = subpath2;
+            }
+            else if (!subpath2) {
+                newSubpath2 = createSubpath(lastSubpath2 || subpath1, subpath1);
+                newSubpath1 = subpath1;
+            }
+            else {
+                _a = alignSubpath(subpath1, subpath2), newSubpath1 = _a[0], newSubpath2 = _a[1];
+                lastSubpath1 = newSubpath1;
+                lastSubpath2 = newSubpath2;
+            }
+            newArray1.push(newSubpath1);
+            newArray2.push(newSubpath2);
+        }
+        return [newArray1, newArray2];
+    }
+    function centroid(array) {
+        var signedArea = 0;
+        var cx = 0;
+        var cy = 0;
+        var len = array.length;
+        for (var i = 0, j = len - 2; i < len; j = i, i += 2) {
+            var x0 = array[j];
+            var y0 = array[j + 1];
+            var x1 = array[i];
+            var y1 = array[i + 1];
+            var a = x0 * y1 - x1 * y0;
+            signedArea += a;
+            cx += (x0 + x1) * a;
+            cy += (y0 + y1) * a;
+        }
+        if (signedArea === 0) {
+            return [array[0] || 0, array[1] || 0];
+        }
+        return [cx / signedArea / 3, cy / signedArea / 3, signedArea];
+    }
+    function findBestRingOffset(fromSubBeziers, toSubBeziers, fromCp, toCp) {
+        var bezierCount = (fromSubBeziers.length - 2) / 6;
+        var bestScore = Infinity;
+        var bestOffset = 0;
+        var len = fromSubBeziers.length;
+        var len2 = len - 2;
+        for (var offset = 0; offset < bezierCount; offset++) {
+            var cursorOffset = offset * 6;
+            var score = 0;
+            for (var k = 0; k < len; k += 2) {
+                var idx = k === 0 ? cursorOffset : ((cursorOffset + k - 2) % len2 + 2);
+                var x0 = fromSubBeziers[idx] - fromCp[0];
+                var y0 = fromSubBeziers[idx + 1] - fromCp[1];
+                var x1 = toSubBeziers[k] - toCp[0];
+                var y1 = toSubBeziers[k + 1] - toCp[1];
+                var dx = x1 - x0;
+                var dy = y1 - y0;
+                score += dx * dx + dy * dy;
+            }
+            if (score < bestScore) {
+                bestScore = score;
+                bestOffset = offset;
+            }
+        }
+        return bestOffset;
+    }
+    function reverse(array) {
+        var newArr = [];
+        var len = array.length;
+        for (var i = 0; i < len; i += 2) {
+            newArr[i] = array[len - i - 2];
+            newArr[i + 1] = array[len - i - 1];
+        }
+        return newArr;
+    }
+    function findBestMorphingRotation(fromArr, toArr, searchAngleIteration, searchAngleRange) {
+        var result = [];
+        var fromNeedsReverse;
+        for (var i = 0; i < fromArr.length; i++) {
+            var fromSubpathBezier = fromArr[i];
+            var toSubpathBezier = toArr[i];
+            var fromCp = centroid(fromSubpathBezier);
+            var toCp = centroid(toSubpathBezier);
+            if (fromNeedsReverse == null) {
+                fromNeedsReverse = fromCp[2] < 0 !== toCp[2] < 0;
+            }
+            var newFromSubpathBezier = [];
+            var newToSubpathBezier = [];
+            var bestAngle = 0;
+            var bestScore = Infinity;
+            var tmpArr = [];
+            var len = fromSubpathBezier.length;
+            if (fromNeedsReverse) {
+                fromSubpathBezier = reverse(fromSubpathBezier);
+            }
+            var offset = findBestRingOffset(fromSubpathBezier, toSubpathBezier, fromCp, toCp) * 6;
+            var len2 = len - 2;
+            for (var k = 0; k < len2; k += 2) {
+                var idx = (offset + k) % len2 + 2;
+                newFromSubpathBezier[k + 2] = fromSubpathBezier[idx] - fromCp[0];
+                newFromSubpathBezier[k + 3] = fromSubpathBezier[idx + 1] - fromCp[1];
+            }
+            newFromSubpathBezier[0] = fromSubpathBezier[offset] - fromCp[0];
+            newFromSubpathBezier[1] = fromSubpathBezier[offset + 1] - fromCp[1];
+            if (searchAngleIteration > 0) {
+                var step = searchAngleRange / searchAngleIteration;
+                for (var angle = -searchAngleRange / 2; angle <= searchAngleRange / 2; angle += step) {
+                    var sa = Math.sin(angle);
+                    var ca = Math.cos(angle);
+                    var score = 0;
+                    for (var k = 0; k < fromSubpathBezier.length; k += 2) {
+                        var x0 = newFromSubpathBezier[k];
+                        var y0 = newFromSubpathBezier[k + 1];
+                        var x1 = toSubpathBezier[k] - toCp[0];
+                        var y1 = toSubpathBezier[k + 1] - toCp[1];
+                        var newX1 = x1 * ca - y1 * sa;
+                        var newY1 = x1 * sa + y1 * ca;
+                        tmpArr[k] = newX1;
+                        tmpArr[k + 1] = newY1;
+                        var dx = newX1 - x0;
+                        var dy = newY1 - y0;
+                        score += dx * dx + dy * dy;
+                    }
+                    if (score < bestScore) {
+                        bestScore = score;
+                        bestAngle = angle;
+                        for (var m = 0; m < tmpArr.length; m++) {
+                            newToSubpathBezier[m] = tmpArr[m];
+                        }
+                    }
+                }
+            }
+            else {
+                for (var i_1 = 0; i_1 < len; i_1 += 2) {
+                    newToSubpathBezier[i_1] = toSubpathBezier[i_1] - toCp[0];
+                    newToSubpathBezier[i_1 + 1] = toSubpathBezier[i_1 + 1] - toCp[1];
+                }
+            }
+            result.push({
+                from: newFromSubpathBezier,
+                to: newToSubpathBezier,
+                fromCp: fromCp,
+                toCp: toCp,
+                rotation: -bestAngle
+            });
+        }
+        return result;
+    }
+    function isCombineMorphing(path) {
+        return path.__isCombineMorphing;
+    }
+    function isMorphing(el) {
+        return el.__morphT >= 0;
+    }
+    var SAVED_METHOD_PREFIX = '__mOriginal_';
+    function saveAndModifyMethod(obj, methodName, modifiers) {
+        var savedMethodName = SAVED_METHOD_PREFIX + methodName;
+        var originalMethod = obj[savedMethodName] || obj[methodName];
+        if (!obj[savedMethodName]) {
+            obj[savedMethodName] = obj[methodName];
+        }
+        var replace = modifiers.replace;
+        var after = modifiers.after;
+        var before = modifiers.before;
+        obj[methodName] = function () {
+            var args = arguments;
+            var res;
+            before && before.apply(this, args);
+            if (replace) {
+                res = replace.apply(this, args);
+            }
+            else {
+                res = originalMethod.apply(this, args);
+            }
+            after && after.apply(this, args);
+            return res;
+        };
+    }
+    function restoreMethod(obj, methodName) {
+        var savedMethodName = SAVED_METHOD_PREFIX + methodName;
+        if (obj[savedMethodName]) {
+            obj[methodName] = obj[savedMethodName];
+            obj[savedMethodName] = null;
+        }
+    }
+    function applyTransformOnBeziers(bezierCurves, mm) {
+        for (var i = 0; i < bezierCurves.length; i++) {
+            var subBeziers = bezierCurves[i];
+            for (var k = 0; k < subBeziers.length;) {
+                var x = subBeziers[k];
+                var y = subBeziers[k + 1];
+                subBeziers[k++] = mm[0] * x + mm[2] * y + mm[4];
+                subBeziers[k++] = mm[1] * x + mm[3] * y + mm[5];
+            }
+        }
+    }
+    function prepareMorphPath(fromPath, toPath) {
+        var fromPathProxy = fromPath.getUpdatedPathProxy();
+        var toPathProxy = toPath.getUpdatedPathProxy();
+        var _a = alignBezierCurves(pathToBezierCurves(fromPathProxy), pathToBezierCurves(toPathProxy)), fromBezierCurves = _a[0], toBezierCurves = _a[1];
+        var fromPathTransform = fromPath.getComputedTransform();
+        var toPathTransform = toPath.getComputedTransform();
+        function updateIdentityTransform() {
+            this.transform = null;
+        }
+        fromPathTransform && applyTransformOnBeziers(fromBezierCurves, fromPathTransform);
+        toPathTransform && applyTransformOnBeziers(toBezierCurves, toPathTransform);
+        saveAndModifyMethod(toPath, 'updateTransform', { replace: updateIdentityTransform });
+        toPath.transform = null;
+        var morphingData = findBestMorphingRotation(fromBezierCurves, toBezierCurves, 10, Math.PI);
+        var tmpArr = [];
+        saveAndModifyMethod(toPath, 'buildPath', { replace: function (path) {
+                var t = toPath.__morphT;
+                var onet = 1 - t;
+                var newCp = [];
+                for (var i = 0; i < morphingData.length; i++) {
+                    var item = morphingData[i];
+                    var from = item.from;
+                    var to = item.to;
+                    var angle = item.rotation * t;
+                    var fromCp = item.fromCp;
+                    var toCp = item.toCp;
+                    var sa = Math.sin(angle);
+                    var ca = Math.cos(angle);
+                    lerp(newCp, fromCp, toCp, t);
+                    for (var m = 0; m < from.length; m += 2) {
+                        var x0_1 = from[m];
+                        var y0_1 = from[m + 1];
+                        var x1 = to[m];
+                        var y1 = to[m + 1];
+                        var x = x0_1 * onet + x1 * t;
+                        var y = y0_1 * onet + y1 * t;
+                        tmpArr[m] = (x * ca - y * sa) + newCp[0];
+                        tmpArr[m + 1] = (x * sa + y * ca) + newCp[1];
+                    }
+                    var x0 = tmpArr[0];
+                    var y0 = tmpArr[1];
+                    path.moveTo(x0, y0);
+                    for (var m = 2; m < from.length;) {
+                        var x1 = tmpArr[m++];
+                        var y1 = tmpArr[m++];
+                        var x2 = tmpArr[m++];
+                        var y2 = tmpArr[m++];
+                        var x3 = tmpArr[m++];
+                        var y3 = tmpArr[m++];
+                        if (x0 === x1 && y0 === y1 && x2 === x3 && y2 === y3) {
+                            path.lineTo(x3, y3);
+                        }
+                        else {
+                            path.bezierCurveTo(x1, y1, x2, y2, x3, y3);
+                        }
+                        x0 = x3;
+                        y0 = y3;
+                    }
+                }
+            } });
+    }
+    function morphPath(fromPath, toPath, animationOpts) {
+        if (!fromPath || !toPath) {
+            return toPath;
+        }
+        var oldDone = animationOpts.done;
+        var oldDuring = animationOpts.during;
+        prepareMorphPath(fromPath, toPath);
+        toPath.__morphT = 0;
+        function restoreToPath() {
+            restoreMethod(toPath, 'buildPath');
+            restoreMethod(toPath, 'updateTransform');
+            toPath.__morphT = -1;
+            toPath.createPathProxy();
+            toPath.dirtyShape();
+        }
+        toPath.animateTo({
+            __morphT: 1
+        }, defaults({
+            during: function (p) {
+                toPath.dirtyShape();
+                oldDuring && oldDuring(p);
+            },
+            done: function () {
+                restoreToPath();
+                oldDone && oldDone();
+            }
+        }, animationOpts));
+        return toPath;
+    }
+    function hilbert(x, y, minX, minY, maxX, maxY) {
+        var bits = 16;
+        x = (maxX === minX) ? 0 : Math.round(32767 * (x - minX) / (maxX - minX));
+        y = (maxY === minY) ? 0 : Math.round(32767 * (y - minY) / (maxY - minY));
+        var d = 0;
+        var tmp;
+        for (var s = (1 << bits) / 2; s > 0; s /= 2) {
+            var rx = 0;
+            var ry = 0;
+            if ((x & s) > 0) {
+                rx = 1;
+            }
+            if ((y & s) > 0) {
+                ry = 1;
+            }
+            d += s * s * ((3 * rx) ^ ry);
+            if (ry === 0) {
+                if (rx === 1) {
+                    x = s - 1 - x;
+                    y = s - 1 - y;
+                }
+                tmp = x;
+                x = y;
+                y = tmp;
+            }
+        }
+        return d;
+    }
+    function sortPaths(pathList) {
+        var xMin = Infinity;
+        var yMin = Infinity;
+        var xMax = -Infinity;
+        var yMax = -Infinity;
+        var cps = map(pathList, function (path) {
+            var rect = path.getBoundingRect();
+            var m = path.getComputedTransform();
+            var x = rect.x + rect.width / 2 + (m ? m[4] : 0);
+            var y = rect.y + rect.height / 2 + (m ? m[5] : 0);
+            xMin = Math.min(x, xMin);
+            yMin = Math.min(y, yMin);
+            xMax = Math.max(x, xMax);
+            yMax = Math.max(y, yMax);
+            return [x, y];
+        });
+        var items = map(cps, function (cp, idx) {
+            return {
+                cp: cp,
+                z: hilbert(cp[0], cp[1], xMin, yMin, xMax, yMax),
+                path: pathList[idx]
+            };
+        });
+        return items.sort(function (a, b) { return a.z - b.z; }).map(function (item) { return item.path; });
+    }
+    function defaultDividePath(param) {
+        return split(param.path, param.count);
+    }
+    function createEmptyReturn() {
+        return {
+            fromIndividuals: [],
+            toIndividuals: [],
+            count: 0
+        };
+    }
+    function combineMorph(fromList, toPath, animationOpts) {
+        var fromPathList = [];
+        function addFromPath(fromList) {
+            for (var i = 0; i < fromList.length; i++) {
+                var from = fromList[i];
+                if (isCombineMorphing(from)) {
+                    addFromPath(from.childrenRef());
+                }
+                else if (from instanceof Path) {
+                    fromPathList.push(from);
+                }
+            }
+        }
+        addFromPath(fromList);
+        var separateCount = fromPathList.length;
+        if (!separateCount) {
+            return createEmptyReturn();
+        }
+        var dividePath = animationOpts.dividePath || defaultDividePath;
+        var toSubPathList = dividePath({
+            path: toPath, count: separateCount
+        });
+        if (toSubPathList.length !== separateCount) {
+            console.error('Invalid morphing: unmatched splitted path');
+            return createEmptyReturn();
+        }
+        fromPathList = sortPaths(fromPathList);
+        toSubPathList = sortPaths(toSubPathList);
+        var oldDone = animationOpts.done;
+        var oldDuring = animationOpts.during;
+        var individualDelay = animationOpts.individualDelay;
+        var identityTransform = new Transformable();
+        for (var i = 0; i < separateCount; i++) {
+            var from = fromPathList[i];
+            var to = toSubPathList[i];
+            to.parent = toPath;
+            to.copyTransform(identityTransform);
+            if (!individualDelay) {
+                prepareMorphPath(from, to);
+            }
+        }
+        toPath.__isCombineMorphing = true;
+        toPath.childrenRef = function () {
+            return toSubPathList;
+        };
+        function addToSubPathListToZr(zr) {
+            for (var i = 0; i < toSubPathList.length; i++) {
+                toSubPathList[i].addSelfToZr(zr);
+            }
+        }
+        saveAndModifyMethod(toPath, 'addSelfToZr', {
+            after: function (zr) {
+                addToSubPathListToZr(zr);
+            }
+        });
+        saveAndModifyMethod(toPath, 'removeSelfFromZr', {
+            after: function (zr) {
+                for (var i = 0; i < toSubPathList.length; i++) {
+                    toSubPathList[i].removeSelfFromZr(zr);
+                }
+            }
+        });
+        function restoreToPath() {
+            toPath.__isCombineMorphing = false;
+            toPath.__morphT = -1;
+            toPath.childrenRef = null;
+            restoreMethod(toPath, 'addSelfToZr');
+            restoreMethod(toPath, 'removeSelfFromZr');
+        }
+        var toLen = toSubPathList.length;
+        if (individualDelay) {
+            var animating_1 = toLen;
+            var eachDone = function () {
+                animating_1--;
+                if (animating_1 === 0) {
+                    restoreToPath();
+                    oldDone && oldDone();
+                }
+            };
+            for (var i = 0; i < toLen; i++) {
+                var indivdualAnimationOpts = individualDelay ? defaults({
+                    delay: (animationOpts.delay || 0) + individualDelay(i, toLen, fromPathList[i], toSubPathList[i]),
+                    done: eachDone
+                }, animationOpts) : animationOpts;
+                morphPath(fromPathList[i], toSubPathList[i], indivdualAnimationOpts);
+            }
+        }
+        else {
+            toPath.__morphT = 0;
+            toPath.animateTo({
+                __morphT: 1
+            }, defaults({
+                during: function (p) {
+                    for (var i = 0; i < toLen; i++) {
+                        var child = toSubPathList[i];
+                        child.__morphT = toPath.__morphT;
+                        child.dirtyShape();
+                    }
+                    oldDuring && oldDuring(p);
+                },
+                done: function () {
+                    restoreToPath();
+                    for (var i = 0; i < fromList.length; i++) {
+                        restoreMethod(fromList[i], 'updateTransform');
+                    }
+                    oldDone && oldDone();
+                }
+            }, animationOpts));
+        }
+        if (toPath.__zr) {
+            addToSubPathListToZr(toPath.__zr);
+        }
+        return {
+            fromIndividuals: fromPathList,
+            toIndividuals: toSubPathList,
+            count: toLen
+        };
+    }
+    function separateMorph(fromPath, toPathList, animationOpts) {
+        var toLen = toPathList.length;
+        var fromPathList = [];
+        var dividePath = animationOpts.dividePath || defaultDividePath;
+        function addFromPath(fromList) {
+            for (var i = 0; i < fromList.length; i++) {
+                var from = fromList[i];
+                if (isCombineMorphing(from)) {
+                    addFromPath(from.childrenRef());
+                }
+                else if (from instanceof Path) {
+                    fromPathList.push(from);
+                }
+            }
+        }
+        if (isCombineMorphing(fromPath)) {
+            addFromPath(fromPath.childrenRef());
+            var fromLen = fromPathList.length;
+            if (fromLen < toLen) {
+                var k = 0;
+                for (var i = fromLen; i < toLen; i++) {
+                    fromPathList.push(clonePath(fromPathList[k++ % fromLen]));
+                }
+            }
+            fromPathList.length = toLen;
+        }
+        else {
+            fromPathList = dividePath({ path: fromPath, count: toLen });
+            var fromPathTransform = fromPath.getComputedTransform();
+            for (var i = 0; i < fromPathList.length; i++) {
+                fromPathList[i].setLocalTransform(fromPathTransform);
+            }
+            if (fromPathList.length !== toLen) {
+                console.error('Invalid morphing: unmatched splitted path');
+                return createEmptyReturn();
+            }
+        }
+        fromPathList = sortPaths(fromPathList);
+        toPathList = sortPaths(toPathList);
+        var individualDelay = animationOpts.individualDelay;
+        for (var i = 0; i < toLen; i++) {
+            var indivdualAnimationOpts = individualDelay ? defaults({
+                delay: (animationOpts.delay || 0) + individualDelay(i, toLen, fromPathList[i], toPathList[i])
+            }, animationOpts) : animationOpts;
+            morphPath(fromPathList[i], toPathList[i], indivdualAnimationOpts);
+        }
+        return {
+            fromIndividuals: fromPathList,
+            toIndividuals: toPathList,
+            count: toPathList.length
+        };
+    }
+
+    var morphPath$1 = /*#__PURE__*/Object.freeze({
+        __proto__: null,
+        alignBezierCurves: alignBezierCurves,
+        centroid: centroid,
+        isCombineMorphing: isCombineMorphing,
+        isMorphing: isMorphing,
+        morphPath: morphPath,
+        combineMorph: combineMorph,
+        separateMorph: separateMorph,
+        defaultDividePath: split
+    });
+
+    var CompoundPath = (function (_super) {
+        __extends(CompoundPath, _super);
+        function CompoundPath() {
+            var _this = _super !== null && _super.apply(this, arguments) || this;
+            _this.type = 'compound';
+            return _this;
+        }
+        CompoundPath.prototype._updatePathDirty = function () {
+            var paths = this.shape.paths;
+            var dirtyPath = this.shapeChanged();
+            for (var i = 0; i < paths.length; i++) {
+                dirtyPath = dirtyPath || paths[i].shapeChanged();
+            }
+            if (dirtyPath) {
+                this.dirtyShape();
+            }
+        };
+        CompoundPath.prototype.beforeBrush = function () {
+            this._updatePathDirty();
+            var paths = this.shape.paths || [];
+            var scale = this.getGlobalScale();
+            for (var i = 0; i < paths.length; i++) {
+                if (!paths[i].path) {
+                    paths[i].createPathProxy();
+                }
+                paths[i].path.setScale(scale[0], scale[1], paths[i].segmentIgnoreThreshold);
+            }
+        };
+        CompoundPath.prototype.buildPath = function (ctx, shape) {
+            var paths = shape.paths || [];
+            for (var i = 0; i < paths.length; i++) {
+                paths[i].buildPath(ctx, paths[i].shape, true);
+            }
+        };
+        CompoundPath.prototype.afterBrush = function () {
+            var paths = this.shape.paths || [];
+            for (var i = 0; i < paths.length; i++) {
+                paths[i].pathUpdated();
+            }
+        };
+        CompoundPath.prototype.getBoundingRect = function () {
+            this._updatePathDirty.call(this);
+            return Path.prototype.getBoundingRect.call(this);
+        };
+        return CompoundPath;
+    }(Path));
+
+    var m = [];
+    var IncrementalDisplayable = (function (_super) {
+        __extends(IncrementalDisplayable, _super);
+        function IncrementalDisplayable() {
+            var _this = _super !== null && _super.apply(this, arguments) || this;
+            _this.notClear = true;
+            _this.incremental = true;
+            _this._displayables = [];
+            _this._temporaryDisplayables = [];
+            _this._cursor = 0;
+            return _this;
+        }
+        IncrementalDisplayable.prototype.traverse = function (cb, context) {
+            cb.call(context, this);
+        };
+        IncrementalDisplayable.prototype.useStyle = function () {
+            this.style = {};
+        };
+        IncrementalDisplayable.prototype.getCursor = function () {
+            return this._cursor;
+        };
+        IncrementalDisplayable.prototype.innerAfterBrush = function () {
+            this._cursor = this._displayables.length;
+        };
+        IncrementalDisplayable.prototype.clearDisplaybles = function () {
+            this._displayables = [];
+            this._temporaryDisplayables = [];
+            this._cursor = 0;
+            this.markRedraw();
+            this.notClear = false;
+        };
+        IncrementalDisplayable.prototype.clearTemporalDisplayables = function () {
+            this._temporaryDisplayables = [];
+        };
+        IncrementalDisplayable.prototype.addDisplayable = function (displayable, notPersistent) {
+            if (notPersistent) {
+                this._temporaryDisplayables.push(displayable);
+            }
+            else {
+                this._displayables.push(displayable);
+            }
+            this.markRedraw();
+        };
+        IncrementalDisplayable.prototype.addDisplayables = function (displayables, notPersistent) {
+            notPersistent = notPersistent || false;
+            for (var i = 0; i < displayables.length; i++) {
+                this.addDisplayable(displayables[i], notPersistent);
+            }
+        };
+        IncrementalDisplayable.prototype.getDisplayables = function () {
+            return this._displayables;
+        };
+        IncrementalDisplayable.prototype.getTemporalDisplayables = function () {
+            return this._temporaryDisplayables;
+        };
+        IncrementalDisplayable.prototype.eachPendingDisplayable = function (cb) {
+            for (var i = this._cursor; i < this._displayables.length; i++) {
+                cb && cb(this._displayables[i]);
+            }
+            for (var i = 0; i < this._temporaryDisplayables.length; i++) {
+                cb && cb(this._temporaryDisplayables[i]);
+            }
+        };
+        IncrementalDisplayable.prototype.update = function () {
+            this.updateTransform();
+            for (var i = this._cursor; i < this._displayables.length; i++) {
+                var displayable = this._displayables[i];
+                displayable.parent = this;
+                displayable.update();
+                displayable.parent = null;
+            }
+            for (var i = 0; i < this._temporaryDisplayables.length; i++) {
+                var displayable = this._temporaryDisplayables[i];
+                displayable.parent = this;
+                displayable.update();
+                displayable.parent = null;
+            }
+        };
+        IncrementalDisplayable.prototype.getBoundingRect = function () {
+            if (!this._rect) {
+                var rect = new BoundingRect(Infinity, Infinity, -Infinity, -Infinity);
+                for (var i = 0; i < this._displayables.length; i++) {
+                    var displayable = this._displayables[i];
+                    var childRect = displayable.getBoundingRect().clone();
+                    if (displayable.needLocalTransform()) {
+                        childRect.applyTransform(displayable.getLocalTransform(m));
+                    }
+                    rect.union(childRect);
+                }
+                this._rect = rect;
+            }
+            return this._rect;
+        };
+        IncrementalDisplayable.prototype.contain = function (x, y) {
+            var localPos = this.transformCoordToLocal(x, y);
+            var rect = this.getBoundingRect();
+            if (rect.contain(localPos[0], localPos[1])) {
+                for (var i = 0; i < this._displayables.length; i++) {
+                    var displayable = this._displayables[i];
+                    if (displayable.contain(x, y)) {
+                        return true;
+                    }
+                }
+            }
+            return false;
+        };
+        return IncrementalDisplayable;
+    }(Displayable));
+
+    var globalImageCache = new LRU(50);
+    function findExistImage(newImageOrSrc) {
+        if (typeof newImageOrSrc === 'string') {
+            var cachedImgObj = globalImageCache.get(newImageOrSrc);
+            return cachedImgObj && cachedImgObj.image;
+        }
+        else {
+            return newImageOrSrc;
+        }
+    }
+    function createOrUpdateImage(newImageOrSrc, image, hostEl, onload, cbPayload) {
+        if (!newImageOrSrc) {
+            return image;
+        }
+        else if (typeof newImageOrSrc === 'string') {
+            if ((image && image.__zrImageSrc === newImageOrSrc) || !hostEl) {
+                return image;
+            }
+            var cachedImgObj = globalImageCache.get(newImageOrSrc);
+            var pendingWrap = { hostEl: hostEl, cb: onload, cbPayload: cbPayload };
+            if (cachedImgObj) {
+                image = cachedImgObj.image;
+                !isImageReady(image) && cachedImgObj.pending.push(pendingWrap);
+            }
+            else {
+                image = platformApi.loadImage(newImageOrSrc, imageOnLoad, imageOnLoad);
+                image.__zrImageSrc = newImageOrSrc;
+                globalImageCache.put(newImageOrSrc, image.__cachedImgObj = {
+                    image: image,
+                    pending: [pendingWrap]
+                });
+            }
+            return image;
+        }
+        else {
+            return newImageOrSrc;
+        }
+    }
+    function imageOnLoad() {
+        var cachedImgObj = this.__cachedImgObj;
+        this.onload = this.onerror = this.__cachedImgObj = null;
+        for (var i = 0; i < cachedImgObj.pending.length; i++) {
+            var pendingWrap = cachedImgObj.pending[i];
+            var cb = pendingWrap.cb;
+            cb && cb(this, pendingWrap.cbPayload);
+            pendingWrap.hostEl.dirty();
+        }
+        cachedImgObj.pending.length = 0;
+    }
+    function isImageReady(image) {
+        return image && image.width && image.height;
+    }
+
+    var STYLE_REG = /\{([a-zA-Z0-9_]+)\|([^}]*)\}/g;
+    function truncateText(text, containerWidth, font, ellipsis, options) {
+        if (!containerWidth) {
+            return '';
+        }
+        var textLines = (text + '').split('\n');
+        options = prepareTruncateOptions(containerWidth, font, ellipsis, options);
+        for (var i = 0, len = textLines.length; i < len; i++) {
+            textLines[i] = truncateSingleLine(textLines[i], options);
+        }
+        return textLines.join('\n');
+    }
+    function prepareTruncateOptions(containerWidth, font, ellipsis, options) {
+        options = options || {};
+        var preparedOpts = extend({}, options);
+        preparedOpts.font = font;
+        ellipsis = retrieve2(ellipsis, '...');
+        preparedOpts.maxIterations = retrieve2(options.maxIterations, 2);
+        var minChar = preparedOpts.minChar = retrieve2(options.minChar, 0);
+        preparedOpts.cnCharWidth = getWidth('国', font);
+        var ascCharWidth = preparedOpts.ascCharWidth = getWidth('a', font);
+        preparedOpts.placeholder = retrieve2(options.placeholder, '');
+        var contentWidth = containerWidth = Math.max(0, containerWidth - 1);
+        for (var i = 0; i < minChar && contentWidth >= ascCharWidth; i++) {
+            contentWidth -= ascCharWidth;
+        }
+        var ellipsisWidth = getWidth(ellipsis, font);
+        if (ellipsisWidth > contentWidth) {
+            ellipsis = '';
+            ellipsisWidth = 0;
+        }
+        contentWidth = containerWidth - ellipsisWidth;
+        preparedOpts.ellipsis = ellipsis;
+        preparedOpts.ellipsisWidth = ellipsisWidth;
+        preparedOpts.contentWidth = contentWidth;
+        preparedOpts.containerWidth = containerWidth;
+        return preparedOpts;
+    }
+    function truncateSingleLine(textLine, options) {
+        var containerWidth = options.containerWidth;
+        var font = options.font;
+        var contentWidth = options.contentWidth;
+        if (!containerWidth) {
+            return '';
+        }
+        var lineWidth = getWidth(textLine, font);
+        if (lineWidth <= containerWidth) {
+            return textLine;
+        }
+        for (var j = 0;; j++) {
+            if (lineWidth <= contentWidth || j >= options.maxIterations) {
+                textLine += options.ellipsis;
+                break;
+            }
+            var subLength = j === 0
+                ? estimateLength(textLine, contentWidth, options.ascCharWidth, options.cnCharWidth)
+                : lineWidth > 0
+                    ? Math.floor(textLine.length * contentWidth / lineWidth)
+                    : 0;
+            textLine = textLine.substr(0, subLength);
+            lineWidth = getWidth(textLine, font);
+        }
+        if (textLine === '') {
+            textLine = options.placeholder;
+        }
+        return textLine;
+    }
+    function estimateLength(text, contentWidth, ascCharWidth, cnCharWidth) {
+        var width = 0;
+        var i = 0;
+        for (var len = text.length; i < len && width < contentWidth; i++) {
+            var charCode = text.charCodeAt(i);
+            width += (0 <= charCode && charCode <= 127) ? ascCharWidth : cnCharWidth;
+        }
+        return i;
+    }
+    function parsePlainText(text, style) {
+        text != null && (text += '');
+        var overflow = style.overflow;
+        var padding = style.padding;
+        var font = style.font;
+        var truncate = overflow === 'truncate';
+        var calculatedLineHeight = getLineHeight(font);
+        var lineHeight = retrieve2(style.lineHeight, calculatedLineHeight);
+        var bgColorDrawn = !!(style.backgroundColor);
+        var truncateLineOverflow = style.lineOverflow === 'truncate';
+        var width = style.width;
+        var lines;
+        if (width != null && (overflow === 'break' || overflow === 'breakAll')) {
+            lines = text ? wrapText(text, style.font, width, overflow === 'breakAll', 0).lines : [];
+        }
+        else {
+            lines = text ? text.split('\n') : [];
+        }
+        var contentHeight = lines.length * lineHeight;
+        var height = retrieve2(style.height, contentHeight);
+        if (contentHeight > height && truncateLineOverflow) {
+            var lineCount = Math.floor(height / lineHeight);
+            lines = lines.slice(0, lineCount);
+        }
+        if (text && truncate && width != null) {
+            var options = prepareTruncateOptions(width, font, style.ellipsis, {
+                minChar: style.truncateMinChar,
+                placeholder: style.placeholder
+            });
+            for (var i = 0; i < lines.length; i++) {
+                lines[i] = truncateSingleLine(lines[i], options);
+            }
+        }
+        var outerHeight = height;
+        var contentWidth = 0;
+        for (var i = 0; i < lines.length; i++) {
+            contentWidth = Math.max(getWidth(lines[i], font), contentWidth);
+        }
+        if (width == null) {
+            width = contentWidth;
+        }
+        var outerWidth = contentWidth;
+        if (padding) {
+            outerHeight += padding[0] + padding[2];
+            outerWidth += padding[1] + padding[3];
+            width += padding[1] + padding[3];
+        }
+        if (bgColorDrawn) {
+            outerWidth = width;
+        }
+        return {
+            lines: lines,
+            height: height,
+            outerWidth: outerWidth,
+            outerHeight: outerHeight,
+            lineHeight: lineHeight,
+            calculatedLineHeight: calculatedLineHeight,
+            contentWidth: contentWidth,
+            contentHeight: contentHeight,
+            width: width
+        };
+    }
+    var RichTextToken = (function () {
+        function RichTextToken() {
+        }
+        return RichTextToken;
+    }());
+    var RichTextLine = (function () {
+        function RichTextLine(tokens) {
+            this.tokens = [];
+            if (tokens) {
+                this.tokens = tokens;
+            }
+        }
+        return RichTextLine;
+    }());
+    var RichTextContentBlock = (function () {
+        function RichTextContentBlock() {
+            this.width = 0;
+            this.height = 0;
+            this.contentWidth = 0;
+            this.contentHeight = 0;
+            this.outerWidth = 0;
+            this.outerHeight = 0;
+            this.lines = [];
+        }
+        return RichTextContentBlock;
+    }());
+    function parseRichText(text, style) {
+        var contentBlock = new RichTextContentBlock();
+        text != null && (text += '');
+        if (!text) {
+            return contentBlock;
+        }
+        var topWidth = style.width;
+        var topHeight = style.height;
+        var overflow = style.overflow;
+        var wrapInfo = (overflow === 'break' || overflow === 'breakAll') && topWidth != null
+            ? { width: topWidth, accumWidth: 0, breakAll: overflow === 'breakAll' }
+            : null;
+        var lastIndex = STYLE_REG.lastIndex = 0;
+        var result;
+        while ((result = STYLE_REG.exec(text)) != null) {
+            var matchedIndex = result.index;
+            if (matchedIndex > lastIndex) {
+                pushTokens(contentBlock, text.substring(lastIndex, matchedIndex), style, wrapInfo);
+            }
+            pushTokens(contentBlock, result[2], style, wrapInfo, result[1]);
+            lastIndex = STYLE_REG.lastIndex;
+        }
+        if (lastIndex < text.length) {
+            pushTokens(contentBlock, text.substring(lastIndex, text.length), style, wrapInfo);
+        }
+        var pendingList = [];
+        var calculatedHeight = 0;
+        var calculatedWidth = 0;
+        var stlPadding = style.padding;
+        var truncate = overflow === 'truncate';
+        var truncateLine = style.lineOverflow === 'truncate';
+        function finishLine(line, lineWidth, lineHeight) {
+            line.width = lineWidth;
+            line.lineHeight = lineHeight;
+            calculatedHeight += lineHeight;
+            calculatedWidth = Math.max(calculatedWidth, lineWidth);
+        }
+        outer: for (var i = 0; i < contentBlock.lines.length; i++) {
+            var line = contentBlock.lines[i];
+            var lineHeight = 0;
+            var lineWidth = 0;
+            for (var j = 0; j < line.tokens.length; j++) {
+                var token = line.tokens[j];
+                var tokenStyle = token.styleName && style.rich[token.styleName] || {};
+                var textPadding = token.textPadding = tokenStyle.padding;
+                var paddingH = textPadding ? textPadding[1] + textPadding[3] : 0;
+                var font = token.font = tokenStyle.font || style.font;
+                token.contentHeight = getLineHeight(font);
+                var tokenHeight = retrieve2(tokenStyle.height, token.contentHeight);
+                token.innerHeight = tokenHeight;
+                textPadding && (tokenHeight += textPadding[0] + textPadding[2]);
+                token.height = tokenHeight;
+                token.lineHeight = retrieve3(tokenStyle.lineHeight, style.lineHeight, tokenHeight);
+                token.align = tokenStyle && tokenStyle.align || style.align;
+                token.verticalAlign = tokenStyle && tokenStyle.verticalAlign || 'middle';
+                if (truncateLine && topHeight != null && calculatedHeight + token.lineHeight > topHeight) {
+                    if (j > 0) {
+                        line.tokens = line.tokens.slice(0, j);
+                        finishLine(line, lineWidth, lineHeight);
+                        contentBlock.lines = contentBlock.lines.slice(0, i + 1);
+                    }
+                    else {
+                        contentBlock.lines = contentBlock.lines.slice(0, i);
+                    }
+                    break outer;
+                }
+                var styleTokenWidth = tokenStyle.width;
+                var tokenWidthNotSpecified = styleTokenWidth == null || styleTokenWidth === 'auto';
+                if (typeof styleTokenWidth === 'string' && styleTokenWidth.charAt(styleTokenWidth.length - 1) === '%') {
+                    token.percentWidth = styleTokenWidth;
+                    pendingList.push(token);
+                    token.contentWidth = getWidth(token.text, font);
+                }
+                else {
+                    if (tokenWidthNotSpecified) {
+                        var textBackgroundColor = tokenStyle.backgroundColor;
+                        var bgImg = textBackgroundColor && textBackgroundColor.image;
+                        if (bgImg) {
+                            bgImg = findExistImage(bgImg);
+                            if (isImageReady(bgImg)) {
+                                token.width = Math.max(token.width, bgImg.width * tokenHeight / bgImg.height);
+                            }
+                        }
+                    }
+                    var remainTruncWidth = truncate && topWidth != null
+                        ? topWidth - lineWidth : null;
+                    if (remainTruncWidth != null && remainTruncWidth < token.width) {
+                        if (!tokenWidthNotSpecified || remainTruncWidth < paddingH) {
+                            token.text = '';
+                            token.width = token.contentWidth = 0;
+                        }
+                        else {
+                            token.text = truncateText(token.text, remainTruncWidth - paddingH, font, style.ellipsis, { minChar: style.truncateMinChar });
+                            token.width = token.contentWidth = getWidth(token.text, font);
+                        }
+                    }
+                    else {
+                        token.contentWidth = getWidth(token.text, font);
+                    }
+                }
+                token.width += paddingH;
+                lineWidth += token.width;
+                tokenStyle && (lineHeight = Math.max(lineHeight, token.lineHeight));
+            }
+            finishLine(line, lineWidth, lineHeight);
+        }
+        contentBlock.outerWidth = contentBlock.width = retrieve2(topWidth, calculatedWidth);
+        contentBlock.outerHeight = contentBlock.height = retrieve2(topHeight, calculatedHeight);
+        contentBlock.contentHeight = calculatedHeight;
+        contentBlock.contentWidth = calculatedWidth;
+        if (stlPadding) {
+            contentBlock.outerWidth += stlPadding[1] + stlPadding[3];
+            contentBlock.outerHeight += stlPadding[0] + stlPadding[2];
+        }
+        for (var i = 0; i < pendingList.length; i++) {
+            var token = pendingList[i];
+            var percentWidth = token.percentWidth;
+            token.width = parseInt(percentWidth, 10) / 100 * contentBlock.width;
+        }
+        return contentBlock;
+    }
+    function pushTokens(block, str, style, wrapInfo, styleName) {
+        var isEmptyStr = str === '';
+        var tokenStyle = styleName && style.rich[styleName] || {};
+        var lines = block.lines;
+        var font = tokenStyle.font || style.font;
+        var newLine = false;
+        var strLines;
+        var linesWidths;
+        if (wrapInfo) {
+            var tokenPadding = tokenStyle.padding;
+            var tokenPaddingH = tokenPadding ? tokenPadding[1] + tokenPadding[3] : 0;
+            if (tokenStyle.width != null && tokenStyle.width !== 'auto') {
+                var outerWidth_1 = parsePercent(tokenStyle.width, wrapInfo.width) + tokenPaddingH;
+                if (lines.length > 0) {
+                    if (outerWidth_1 + wrapInfo.accumWidth > wrapInfo.width) {
+                        strLines = str.split('\n');
+                        newLine = true;
+                    }
+                }
+                wrapInfo.accumWidth = outerWidth_1;
+            }
+            else {
+                var res = wrapText(str, font, wrapInfo.width, wrapInfo.breakAll, wrapInfo.accumWidth);
+                wrapInfo.accumWidth = res.accumWidth + tokenPaddingH;
+                linesWidths = res.linesWidths;
+                strLines = res.lines;
+            }
+        }
+        else {
+            strLines = str.split('\n');
+        }
+        for (var i = 0; i < strLines.length; i++) {
+            var text = strLines[i];
+            var token = new RichTextToken();
+            token.styleName = styleName;
+            token.text = text;
+            token.isLineHolder = !text && !isEmptyStr;
+            if (typeof tokenStyle.width === 'number') {
+                token.width = tokenStyle.width;
+            }
+            else {
+                token.width = linesWidths
+                    ? linesWidths[i]
+                    : getWidth(text, font);
+            }
+            if (!i && !newLine) {
+                var tokens = (lines[lines.length - 1] || (lines[0] = new RichTextLine())).tokens;
+                var tokensLen = tokens.length;
+                (tokensLen === 1 && tokens[0].isLineHolder)
+                    ? (tokens[0] = token)
+                    : ((text || !tokensLen || isEmptyStr) && tokens.push(token));
+            }
+            else {
+                lines.push(new RichTextLine([token]));
+            }
+        }
+    }
+    function isAlphabeticLetter(ch) {
+        var code = ch.charCodeAt(0);
+        return code >= 0x20 && code <= 0x24F
+            || code >= 0x370 && code <= 0x10FF
+            || code >= 0x1200 && code <= 0x13FF
+            || code >= 0x1E00 && code <= 0x206F;
+    }
+    var breakCharMap = reduce(',&?/;] '.split(''), function (obj, ch) {
+        obj[ch] = true;
+        return obj;
+    }, {});
+    function isWordBreakChar(ch) {
+        if (isAlphabeticLetter(ch)) {
+            if (breakCharMap[ch]) {
+                return true;
+            }
+            return false;
+        }
+        return true;
+    }
+    function wrapText(text, font, lineWidth, isBreakAll, lastAccumWidth) {
+        var lines = [];
+        var linesWidths = [];
+        var line = '';
+        var currentWord = '';
+        var currentWordWidth = 0;
+        var accumWidth = 0;
+        for (var i = 0; i < text.length; i++) {
+            var ch = text.charAt(i);
+            if (ch === '\n') {
+                if (currentWord) {
+                    line += currentWord;
+                    accumWidth += currentWordWidth;
+                }
+                lines.push(line);
+                linesWidths.push(accumWidth);
+                line = '';
+                currentWord = '';
+                currentWordWidth = 0;
+                accumWidth = 0;
+                continue;
+            }
+            var chWidth = getWidth(ch, font);
+            var inWord = isBreakAll ? false : !isWordBreakChar(ch);
+            if (!lines.length
+                ? lastAccumWidth + accumWidth + chWidth > lineWidth
+                : accumWidth + chWidth > lineWidth) {
+                if (!accumWidth) {
+                    if (inWord) {
+                        lines.push(currentWord);
+                        linesWidths.push(currentWordWidth);
+                        currentWord = ch;
+                        currentWordWidth = chWidth;
+                    }
+                    else {
+                        lines.push(ch);
+                        linesWidths.push(chWidth);
+                    }
+                }
+                else if (line || currentWord) {
+                    if (inWord) {
+                        if (!line) {
+                            line = currentWord;
+                            currentWord = '';
+                            currentWordWidth = 0;
+                            accumWidth = currentWordWidth;
+                        }
+                        lines.push(line);
+                        linesWidths.push(accumWidth - currentWordWidth);
+                        currentWord += ch;
+                        currentWordWidth += chWidth;
+                        line = '';
+                        accumWidth = currentWordWidth;
+                    }
+                    else {
+                        if (currentWord) {
+                            line += currentWord;
+                            currentWord = '';
+                            currentWordWidth = 0;
+                        }
+                        lines.push(line);
+                        linesWidths.push(accumWidth);
+                        line = ch;
+                        accumWidth = chWidth;
+                    }
+                }
+                continue;
+            }
+            accumWidth += chWidth;
+            if (inWord) {
+                currentWord += ch;
+                currentWordWidth += chWidth;
+            }
+            else {
+                if (currentWord) {
+                    line += currentWord;
+                    currentWord = '';
+                    currentWordWidth = 0;
+                }
+                line += ch;
+            }
+        }
+        if (!lines.length && !line) {
+            line = text;
+            currentWord = '';
+            currentWordWidth = 0;
+        }
+        if (currentWord) {
+            line += currentWord;
+        }
+        if (line) {
+            lines.push(line);
+            linesWidths.push(accumWidth);
+        }
+        if (lines.length === 1) {
+            accumWidth += lastAccumWidth;
+        }
+        return {
+            accumWidth: accumWidth,
+            lines: lines,
+            linesWidths: linesWidths
+        };
+    }
+
+    var DEFAULT_RICH_TEXT_COLOR = {
+        fill: '#000'
+    };
+    var DEFAULT_STROKE_LINE_WIDTH = 2;
+    var DEFAULT_TEXT_ANIMATION_PROPS = {
+        style: defaults({
+            fill: true,
+            stroke: true,
+            fillOpacity: true,
+            strokeOpacity: true,
+            lineWidth: true,
+            fontSize: true,
+            lineHeight: true,
+            width: true,
+            height: true,
+            textShadowColor: true,
+            textShadowBlur: true,
+            textShadowOffsetX: true,
+            textShadowOffsetY: true,
+            backgroundColor: true,
+            padding: true,
+            borderColor: true,
+            borderWidth: true,
+            borderRadius: true
+        }, DEFAULT_COMMON_ANIMATION_PROPS.style)
+    };
+    var ZRText = (function (_super) {
+        __extends(ZRText, _super);
+        function ZRText(opts) {
+            var _this = _super.call(this) || this;
+            _this.type = 'text';
+            _this._children = [];
+            _this._defaultStyle = DEFAULT_RICH_TEXT_COLOR;
+            _this.attr(opts);
+            return _this;
+        }
+        ZRText.prototype.childrenRef = function () {
+            return this._children;
+        };
+        ZRText.prototype.update = function () {
+            _super.prototype.update.call(this);
+            if (this.styleChanged()) {
+                this._updateSubTexts();
+            }
+            for (var i = 0; i < this._children.length; i++) {
+                var child = this._children[i];
+                child.zlevel = this.zlevel;
+                child.z = this.z;
+                child.z2 = this.z2;
+                child.culling = this.culling;
+                child.cursor = this.cursor;
+                child.invisible = this.invisible;
+            }
+        };
+        ZRText.prototype.updateTransform = function () {
+            var innerTransformable = this.innerTransformable;
+            if (innerTransformable) {
+                innerTransformable.updateTransform();
+                if (innerTransformable.transform) {
+                    this.transform = innerTransformable.transform;
+                }
+            }
+            else {
+                _super.prototype.updateTransform.call(this);
+            }
+        };
+        ZRText.prototype.getLocalTransform = function (m) {
+            var innerTransformable = this.innerTransformable;
+            return innerTransformable
+                ? innerTransformable.getLocalTransform(m)
+                : _super.prototype.getLocalTransform.call(this, m);
+        };
+        ZRText.prototype.getComputedTransform = function () {
+            if (this.__hostTarget) {
+                this.__hostTarget.getComputedTransform();
+                this.__hostTarget.updateInnerText(true);
+            }
+            return _super.prototype.getComputedTransform.call(this);
+        };
+        ZRText.prototype._updateSubTexts = function () {
+            this._childCursor = 0;
+            normalizeTextStyle(this.style);
+            this.style.rich
+                ? this._updateRichTexts()
+                : this._updatePlainTexts();
+            this._children.length = this._childCursor;
+            this.styleUpdated();
+        };
+        ZRText.prototype.addSelfToZr = function (zr) {
+            _super.prototype.addSelfToZr.call(this, zr);
+            for (var i = 0; i < this._children.length; i++) {
+                this._children[i].__zr = zr;
+            }
+        };
+        ZRText.prototype.removeSelfFromZr = function (zr) {
+            _super.prototype.removeSelfFromZr.call(this, zr);
+            for (var i = 0; i < this._children.length; i++) {
+                this._children[i].__zr = null;
+            }
+        };
+        ZRText.prototype.getBoundingRect = function () {
+            if (this.styleChanged()) {
+                this._updateSubTexts();
+            }
+            if (!this._rect) {
+                var tmpRect = new BoundingRect(0, 0, 0, 0);
+                var children = this._children;
+                var tmpMat = [];
+                var rect = null;
+                for (var i = 0; i < children.length; i++) {
+                    var child = children[i];
+                    var childRect = child.getBoundingRect();
+                    var transform = child.getLocalTransform(tmpMat);
+                    if (transform) {
+                        tmpRect.copy(childRect);
+                        tmpRect.applyTransform(transform);
+                        rect = rect || tmpRect.clone();
+                        rect.union(tmpRect);
+                    }
+                    else {
+                        rect = rect || childRect.clone();
+                        rect.union(childRect);
+                    }
+                }
+                this._rect = rect || tmpRect;
+            }
+            return this._rect;
+        };
+        ZRText.prototype.setDefaultTextStyle = function (defaultTextStyle) {
+            this._defaultStyle = defaultTextStyle || DEFAULT_RICH_TEXT_COLOR;
+        };
+        ZRText.prototype.setTextContent = function (textContent) {
+            {
+                throw new Error('Can\'t attach text on another text');
+            }
+        };
+        ZRText.prototype._mergeStyle = function (targetStyle, sourceStyle) {
+            if (!sourceStyle) {
+                return targetStyle;
+            }
+            var sourceRich = sourceStyle.rich;
+            var targetRich = targetStyle.rich || (sourceRich && {});
+            extend(targetStyle, sourceStyle);
+            if (sourceRich && targetRich) {
+                this._mergeRich(targetRich, sourceRich);
+                targetStyle.rich = targetRich;
+            }
+            else if (targetRich) {
+                targetStyle.rich = targetRich;
+            }
+            return targetStyle;
+        };
+        ZRText.prototype._mergeRich = function (targetRich, sourceRich) {
+            var richNames = keys(sourceRich);
+            for (var i = 0; i < richNames.length; i++) {
+                var richName = richNames[i];
+                targetRich[richName] = targetRich[richName] || {};
+                extend(targetRich[richName], sourceRich[richName]);
+            }
+        };
+        ZRText.prototype.getAnimationStyleProps = function () {
+            return DEFAULT_TEXT_ANIMATION_PROPS;
+        };
+        ZRText.prototype._getOrCreateChild = function (Ctor) {
+            var child = this._children[this._childCursor];
+            if (!child || !(child instanceof Ctor)) {
+                child = new Ctor();
+            }
+            this._children[this._childCursor++] = child;
+            child.__zr = this.__zr;
+            child.parent = this;
+            return child;
+        };
+        ZRText.prototype._updatePlainTexts = function () {
+            var style = this.style;
+            var textFont = style.font || DEFAULT_FONT;
+            var textPadding = style.padding;
+            var text = getStyleText(style);
+            var contentBlock = parsePlainText(text, style);
+            var needDrawBg = needDrawBackground(style);
+            var bgColorDrawn = !!(style.backgroundColor);
+            var outerHeight = contentBlock.outerHeight;
+            var outerWidth = contentBlock.outerWidth;
+            var contentWidth = contentBlock.contentWidth;
+            var textLines = contentBlock.lines;
+            var lineHeight = contentBlock.lineHeight;
+            var defaultStyle = this._defaultStyle;
+            var baseX = style.x || 0;
+            var baseY = style.y || 0;
+            var textAlign = style.align || defaultStyle.align || 'left';
+            var verticalAlign = style.verticalAlign || defaultStyle.verticalAlign || 'top';
+            var textX = baseX;
+            var textY = adjustTextY$1(baseY, contentBlock.contentHeight, verticalAlign);
+            if (needDrawBg || textPadding) {
+                var boxX = adjustTextX(baseX, outerWidth, textAlign);
+                var boxY = adjustTextY$1(baseY, outerHeight, verticalAlign);
+                needDrawBg && this._renderBackground(style, style, boxX, boxY, outerWidth, outerHeight);
+            }
+            textY += lineHeight / 2;
+            if (textPadding) {
+                textX = getTextXForPadding(baseX, textAlign, textPadding);
+                if (verticalAlign === 'top') {
+                    textY += textPadding[0];
+                }
+                else if (verticalAlign === 'bottom') {
+                    textY -= textPadding[2];
+                }
+            }
+            var defaultLineWidth = 0;
+            var useDefaultFill = false;
+            var textFill = getFill('fill' in style
+                ? style.fill
+                : (useDefaultFill = true, defaultStyle.fill));
+            var textStroke = getStroke('stroke' in style
+                ? style.stroke
+                : (!bgColorDrawn
+                    && (!defaultStyle.autoStroke || useDefaultFill))
+                    ? (defaultLineWidth = DEFAULT_STROKE_LINE_WIDTH, defaultStyle.stroke)
+                    : null);
+            var hasShadow = style.textShadowBlur > 0;
+            var fixedBoundingRect = style.width != null
+                && (style.overflow === 'truncate' || style.overflow === 'break' || style.overflow === 'breakAll');
+            var calculatedLineHeight = contentBlock.calculatedLineHeight;
+            for (var i = 0; i < textLines.length; i++) {
+                var el = this._getOrCreateChild(TSpan);
+                var subElStyle = el.createStyle();
+                el.useStyle(subElStyle);
+                subElStyle.text = textLines[i];
+                subElStyle.x = textX;
+                subElStyle.y = textY;
+                if (textAlign) {
+                    subElStyle.textAlign = textAlign;
+                }
+                subElStyle.textBaseline = 'middle';
+                subElStyle.opacity = style.opacity;
+                subElStyle.strokeFirst = true;
+                if (hasShadow) {
+                    subElStyle.shadowBlur = style.textShadowBlur || 0;
+                    subElStyle.shadowColor = style.textShadowColor || 'transparent';
+                    subElStyle.shadowOffsetX = style.textShadowOffsetX || 0;
+                    subElStyle.shadowOffsetY = style.textShadowOffsetY || 0;
+                }
+                subElStyle.stroke = textStroke;
+                subElStyle.fill = textFill;
+                if (textStroke) {
+                    subElStyle.lineWidth = style.lineWidth || defaultLineWidth;
+                    subElStyle.lineDash = style.lineDash;
+                    subElStyle.lineDashOffset = style.lineDashOffset || 0;
+                }
+                subElStyle.font = textFont;
+                setSeparateFont(subElStyle, style);
+                textY += lineHeight;
+                if (fixedBoundingRect) {
+                    el.setBoundingRect(new BoundingRect(adjustTextX(subElStyle.x, style.width, subElStyle.textAlign), adjustTextY$1(subElStyle.y, calculatedLineHeight, subElStyle.textBaseline), contentWidth, calculatedLineHeight));
+                }
+            }
+        };
+        ZRText.prototype._updateRichTexts = function () {
+            var style = this.style;
+            var text = getStyleText(style);
+            var contentBlock = parseRichText(text, style);
+            var contentWidth = contentBlock.width;
+            var outerWidth = contentBlock.outerWidth;
+            var outerHeight = contentBlock.outerHeight;
+            var textPadding = style.padding;
+            var baseX = style.x || 0;
+            var baseY = style.y || 0;
+            var defaultStyle = this._defaultStyle;
+            var textAlign = style.align || defaultStyle.align;
+            var verticalAlign = style.verticalAlign || defaultStyle.verticalAlign;
+            var boxX = adjustTextX(baseX, outerWidth, textAlign);
+            var boxY = adjustTextY$1(baseY, outerHeight, verticalAlign);
+            var xLeft = boxX;
+            var lineTop = boxY;
+            if (textPadding) {
+                xLeft += textPadding[3];
+                lineTop += textPadding[0];
+            }
+            var xRight = xLeft + contentWidth;
+            if (needDrawBackground(style)) {
+                this._renderBackground(style, style, boxX, boxY, outerWidth, outerHeight);
+            }
+            var bgColorDrawn = !!(style.backgroundColor);
+            for (var i = 0; i < contentBlock.lines.length; i++) {
+                var line = contentBlock.lines[i];
+                var tokens = line.tokens;
+                var tokenCount = tokens.length;
+                var lineHeight = line.lineHeight;
+                var remainedWidth = line.width;
+                var leftIndex = 0;
+                var lineXLeft = xLeft;
+                var lineXRight = xRight;
+                var rightIndex = tokenCount - 1;
+                var token = void 0;
+                while (leftIndex < tokenCount
+                    && (token = tokens[leftIndex], !token.align || token.align === 'left')) {
+                    this._placeToken(token, style, lineHeight, lineTop, lineXLeft, 'left', bgColorDrawn);
+                    remainedWidth -= token.width;
+                    lineXLeft += token.width;
+                    leftIndex++;
+                }
+                while (rightIndex >= 0
+                    && (token = tokens[rightIndex], token.align === 'right')) {
+                    this._placeToken(token, style, lineHeight, lineTop, lineXRight, 'right', bgColorDrawn);
+                    remainedWidth -= token.width;
+                    lineXRight -= token.width;
+                    rightIndex--;
+                }
+                lineXLeft += (contentWidth - (lineXLeft - xLeft) - (xRight - lineXRight) - remainedWidth) / 2;
+                while (leftIndex <= rightIndex) {
+                    token = tokens[leftIndex];
+                    this._placeToken(token, style, lineHeight, lineTop, lineXLeft + token.width / 2, 'center', bgColorDrawn);
+                    lineXLeft += token.width;
+                    leftIndex++;
+                }
+                lineTop += lineHeight;
+            }
+        };
+        ZRText.prototype._placeToken = function (token, style, lineHeight, lineTop, x, textAlign, parentBgColorDrawn) {
+            var tokenStyle = style.rich[token.styleName] || {};
+            tokenStyle.text = token.text;
+            var verticalAlign = token.verticalAlign;
+            var y = lineTop + lineHeight / 2;
+            if (verticalAlign === 'top') {
+                y = lineTop + token.height / 2;
+            }
+            else if (verticalAlign === 'bottom') {
+                y = lineTop + lineHeight - token.height / 2;
+            }
+            var needDrawBg = !token.isLineHolder && needDrawBackground(tokenStyle);
+            needDrawBg && this._renderBackground(tokenStyle, style, textAlign === 'right'
+                ? x - token.width
+                : textAlign === 'center'
+                    ? x - token.width / 2
+                    : x, y - token.height / 2, token.width, token.height);
+            var bgColorDrawn = !!tokenStyle.backgroundColor;
+            var textPadding = token.textPadding;
+            if (textPadding) {
+                x = getTextXForPadding(x, textAlign, textPadding);
+                y -= token.height / 2 - textPadding[0] - token.innerHeight / 2;
+            }
+            var el = this._getOrCreateChild(TSpan);
+            var subElStyle = el.createStyle();
+            el.useStyle(subElStyle);
+            var defaultStyle = this._defaultStyle;
+            var useDefaultFill = false;
+            var defaultLineWidth = 0;
+            var textFill = getFill('fill' in tokenStyle ? tokenStyle.fill
+                : 'fill' in style ? style.fill
+                    : (useDefaultFill = true, defaultStyle.fill));
+            var textStroke = getStroke('stroke' in tokenStyle ? tokenStyle.stroke
+                : 'stroke' in style ? style.stroke
+                    : (!bgColorDrawn
+                        && !parentBgColorDrawn
+                        && (!defaultStyle.autoStroke || useDefaultFill)) ? (defaultLineWidth = DEFAULT_STROKE_LINE_WIDTH, defaultStyle.stroke)
+                        : null);
+            var hasShadow = tokenStyle.textShadowBlur > 0
+                || style.textShadowBlur > 0;
+            subElStyle.text = token.text;
+            subElStyle.x = x;
+            subElStyle.y = y;
+            if (hasShadow) {
+                subElStyle.shadowBlur = tokenStyle.textShadowBlur || style.textShadowBlur || 0;
+                subElStyle.shadowColor = tokenStyle.textShadowColor || style.textShadowColor || 'transparent';
+                subElStyle.shadowOffsetX = tokenStyle.textShadowOffsetX || style.textShadowOffsetX || 0;
+                subElStyle.shadowOffsetY = tokenStyle.textShadowOffsetY || style.textShadowOffsetY || 0;
+            }
+            subElStyle.textAlign = textAlign;
+            subElStyle.textBaseline = 'middle';
+            subElStyle.font = token.font || DEFAULT_FONT;
+            subElStyle.opacity = retrieve3(tokenStyle.opacity, style.opacity, 1);
+            setSeparateFont(subElStyle, tokenStyle);
+            if (textStroke) {
+                subElStyle.lineWidth = retrieve3(tokenStyle.lineWidth, style.lineWidth, defaultLineWidth);
+                subElStyle.lineDash = retrieve2(tokenStyle.lineDash, style.lineDash);
+                subElStyle.lineDashOffset = style.lineDashOffset || 0;
+                subElStyle.stroke = textStroke;
+            }
+            if (textFill) {
+                subElStyle.fill = textFill;
+            }
+            var textWidth = token.contentWidth;
+            var textHeight = token.contentHeight;
+            el.setBoundingRect(new BoundingRect(adjustTextX(subElStyle.x, textWidth, subElStyle.textAlign), adjustTextY$1(subElStyle.y, textHeight, subElStyle.textBaseline), textWidth, textHeight));
+        };
+        ZRText.prototype._renderBackground = function (style, topStyle, x, y, width, height) {
+            var textBackgroundColor = style.backgroundColor;
+            var textBorderWidth = style.borderWidth;
+            var textBorderColor = style.borderColor;
+            var isImageBg = textBackgroundColor && textBackgroundColor.image;
+            var isPlainOrGradientBg = textBackgroundColor && !isImageBg;
+            var textBorderRadius = style.borderRadius;
+            var self = this;
+            var rectEl;
+            var imgEl;
+            if (isPlainOrGradientBg || style.lineHeight || (textBorderWidth && textBorderColor)) {
+                rectEl = this._getOrCreateChild(Rect);
+                rectEl.useStyle(rectEl.createStyle());
+                rectEl.style.fill = null;
+                var rectShape = rectEl.shape;
+                rectShape.x = x;
+                rectShape.y = y;
+                rectShape.width = width;
+                rectShape.height = height;
+                rectShape.r = textBorderRadius;
+                rectEl.dirtyShape();
+            }
+            if (isPlainOrGradientBg) {
+                var rectStyle = rectEl.style;
+                rectStyle.fill = textBackgroundColor || null;
+                rectStyle.fillOpacity = retrieve2(style.fillOpacity, 1);
+            }
+            else if (isImageBg) {
+                imgEl = this._getOrCreateChild(ZRImage);
+                imgEl.onload = function () {
+                    self.dirtyStyle();
+                };
+                var imgStyle = imgEl.style;
+                imgStyle.image = textBackgroundColor.image;
+                imgStyle.x = x;
+                imgStyle.y = y;
+                imgStyle.width = width;
+                imgStyle.height = height;
+            }
+            if (textBorderWidth && textBorderColor) {
+                var rectStyle = rectEl.style;
+                rectStyle.lineWidth = textBorderWidth;
+                rectStyle.stroke = textBorderColor;
+                rectStyle.strokeOpacity = retrieve2(style.strokeOpacity, 1);
+                rectStyle.lineDash = style.borderDash;
+                rectStyle.lineDashOffset = style.borderDashOffset || 0;
+                rectEl.strokeContainThreshold = 0;
+                if (rectEl.hasFill() && rectEl.hasStroke()) {
+                    rectStyle.strokeFirst = true;
+                    rectStyle.lineWidth *= 2;
+                }
+            }
+            var commonStyle = (rectEl || imgEl).style;
+            commonStyle.shadowBlur = style.shadowBlur || 0;
+            commonStyle.shadowColor = style.shadowColor || 'transparent';
+            commonStyle.shadowOffsetX = style.shadowOffsetX || 0;
+            commonStyle.shadowOffsetY = style.shadowOffsetY || 0;
+            commonStyle.opacity = retrieve3(style.opacity, topStyle.opacity, 1);
+        };
+        ZRText.makeFont = function (style) {
+            var font = '';
+            if (hasSeparateFont(style)) {
+                font = [
+                    style.fontStyle,
+                    style.fontWeight,
+                    parseFontSize(style.fontSize),
+                    style.fontFamily || 'sans-serif'
+                ].join(' ');
+            }
+            return font && trim(font) || style.textFont || style.font;
+        };
+        return ZRText;
+    }(Displayable));
+    var VALID_TEXT_ALIGN = { left: true, right: 1, center: 1 };
+    var VALID_TEXT_VERTICAL_ALIGN = { top: 1, bottom: 1, middle: 1 };
+    var FONT_PARTS = ['fontStyle', 'fontWeight', 'fontSize', 'fontFamily'];
+    function parseFontSize(fontSize) {
+        if (typeof fontSize === 'string'
+            && (fontSize.indexOf('px') !== -1
+                || fontSize.indexOf('rem') !== -1
+                || fontSize.indexOf('em') !== -1)) {
+            return fontSize;
+        }
+        else if (!isNaN(+fontSize)) {
+            return fontSize + 'px';
+        }
+        else {
+            return DEFAULT_FONT_SIZE + 'px';
+        }
+    }
+    function setSeparateFont(targetStyle, sourceStyle) {
+        for (var i = 0; i < FONT_PARTS.length; i++) {
+            var fontProp = FONT_PARTS[i];
+            var val = sourceStyle[fontProp];
+            if (val != null) {
+                targetStyle[fontProp] = val;
+            }
+        }
+    }
+    function hasSeparateFont(style) {
+        return style.fontSize != null || style.fontFamily || style.fontWeight;
+    }
+    function normalizeTextStyle(style) {
+        normalizeStyle(style);
+        each(style.rich, normalizeStyle);
+        return style;
+    }
+    function normalizeStyle(style) {
+        if (style) {
+            style.font = ZRText.makeFont(style);
+            var textAlign = style.align;
+            textAlign === 'middle' && (textAlign = 'center');
+            style.align = (textAlign == null || VALID_TEXT_ALIGN[textAlign]) ? textAlign : 'left';
+            var verticalAlign = style.verticalAlign;
+            verticalAlign === 'center' && (verticalAlign = 'middle');
+            style.verticalAlign = (verticalAlign == null || VALID_TEXT_VERTICAL_ALIGN[verticalAlign]) ? verticalAlign : 'top';
+            var textPadding = style.padding;
+            if (textPadding) {
+                style.padding = normalizeCssArray(style.padding);
+            }
+        }
+    }
+    function getStroke(stroke, lineWidth) {
+        return (stroke == null || lineWidth <= 0 || stroke === 'transparent' || stroke === 'none')
+            ? null
+            : (stroke.image || stroke.colorStops)
+                ? '#000'
+                : stroke;
+    }
+    function getFill(fill) {
+        return (fill == null || fill === 'none')
+            ? null
+            : (fill.image || fill.colorStops)
+                ? '#000'
+                : fill;
+    }
+    function getTextXForPadding(x, textAlign, textPadding) {
+        return textAlign === 'right'
+            ? (x - textPadding[1])
+            : textAlign === 'center'
+                ? (x + textPadding[3] / 2 - textPadding[1] / 2)
+                : (x + textPadding[3]);
+    }
+    function getStyleText(style) {
+        var text = style.text;
+        text != null && (text += '');
+        return text;
+    }
+    function needDrawBackground(style) {
+        return !!(style.backgroundColor
+            || style.lineHeight
+            || (style.borderWidth && style.borderColor));
+    }
+
+    var ArcShape = (function () {
+        function ArcShape() {
+            this.cx = 0;
+            this.cy = 0;
+            this.r = 0;
+            this.startAngle = 0;
+            this.endAngle = Math.PI * 2;
+            this.clockwise = true;
+        }
+        return ArcShape;
+    }());
+    var Arc = (function (_super) {
+        __extends(Arc, _super);
+        function Arc(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Arc.prototype.getDefaultStyle = function () {
+            return {
+                stroke: '#000',
+                fill: null
+            };
+        };
+        Arc.prototype.getDefaultShape = function () {
+            return new ArcShape();
+        };
+        Arc.prototype.buildPath = function (ctx, shape) {
+            var x = shape.cx;
+            var y = shape.cy;
+            var r = Math.max(shape.r, 0);
+            var startAngle = shape.startAngle;
+            var endAngle = shape.endAngle;
+            var clockwise = shape.clockwise;
+            var unitX = Math.cos(startAngle);
+            var unitY = Math.sin(startAngle);
+            ctx.moveTo(unitX * r + x, unitY * r + y);
+            ctx.arc(x, y, r, startAngle, endAngle, !clockwise);
+        };
+        return Arc;
+    }(Path));
+    Arc.prototype.type = 'arc';
+
+    var out = [];
+    var BezierCurveShape = (function () {
+        function BezierCurveShape() {
+            this.x1 = 0;
+            this.y1 = 0;
+            this.x2 = 0;
+            this.y2 = 0;
+            this.cpx1 = 0;
+            this.cpy1 = 0;
+            this.percent = 1;
+        }
+        return BezierCurveShape;
+    }());
+    function someVectorAt(shape, t, isTangent) {
+        var cpx2 = shape.cpx2;
+        var cpy2 = shape.cpy2;
+        if (cpx2 != null || cpy2 != null) {
+            return [
+                (isTangent ? cubicDerivativeAt : cubicAt)(shape.x1, shape.cpx1, shape.cpx2, shape.x2, t),
+                (isTangent ? cubicDerivativeAt : cubicAt)(shape.y1, shape.cpy1, shape.cpy2, shape.y2, t)
+            ];
+        }
+        else {
+            return [
+                (isTangent ? quadraticDerivativeAt : quadraticAt)(shape.x1, shape.cpx1, shape.x2, t),
+                (isTangent ? quadraticDerivativeAt : quadraticAt)(shape.y1, shape.cpy1, shape.y2, t)
+            ];
+        }
+    }
+    var BezierCurve = (function (_super) {
+        __extends(BezierCurve, _super);
+        function BezierCurve(opts) {
+            return _super.call(this, opts) || this;
+        }
+        BezierCurve.prototype.getDefaultStyle = function () {
+            return {
+                stroke: '#000',
+                fill: null
+            };
+        };
+        BezierCurve.prototype.getDefaultShape = function () {
+            return new BezierCurveShape();
+        };
+        BezierCurve.prototype.buildPath = function (ctx, shape) {
+            var x1 = shape.x1;
+            var y1 = shape.y1;
+            var x2 = shape.x2;
+            var y2 = shape.y2;
+            var cpx1 = shape.cpx1;
+            var cpy1 = shape.cpy1;
+            var cpx2 = shape.cpx2;
+            var cpy2 = shape.cpy2;
+            var percent = shape.percent;
+            if (percent === 0) {
+                return;
+            }
+            ctx.moveTo(x1, y1);
+            if (cpx2 == null || cpy2 == null) {
+                if (percent < 1) {
+                    quadraticSubdivide(x1, cpx1, x2, percent, out);
+                    cpx1 = out[1];
+                    x2 = out[2];
+                    quadraticSubdivide(y1, cpy1, y2, percent, out);
+                    cpy1 = out[1];
+                    y2 = out[2];
+                }
+                ctx.quadraticCurveTo(cpx1, cpy1, x2, y2);
+            }
+            else {
+                if (percent < 1) {
+                    cubicSubdivide(x1, cpx1, cpx2, x2, percent, out);
+                    cpx1 = out[1];
+                    cpx2 = out[2];
+                    x2 = out[3];
+                    cubicSubdivide(y1, cpy1, cpy2, y2, percent, out);
+                    cpy1 = out[1];
+                    cpy2 = out[2];
+                    y2 = out[3];
+                }
+                ctx.bezierCurveTo(cpx1, cpy1, cpx2, cpy2, x2, y2);
+            }
+        };
+        BezierCurve.prototype.pointAt = function (t) {
+            return someVectorAt(this.shape, t, false);
+        };
+        BezierCurve.prototype.tangentAt = function (t) {
+            var p = someVectorAt(this.shape, t, true);
+            return normalize(p, p);
+        };
+        return BezierCurve;
+    }(Path));
+    BezierCurve.prototype.type = 'bezier-curve';
+
+    var DropletShape = (function () {
+        function DropletShape() {
+            this.cx = 0;
+            this.cy = 0;
+            this.width = 0;
+            this.height = 0;
+        }
+        return DropletShape;
+    }());
+    var Droplet = (function (_super) {
+        __extends(Droplet, _super);
+        function Droplet(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Droplet.prototype.getDefaultShape = function () {
+            return new DropletShape();
+        };
+        Droplet.prototype.buildPath = function (ctx, shape) {
+            var x = shape.cx;
+            var y = shape.cy;
+            var a = shape.width;
+            var b = shape.height;
+            ctx.moveTo(x, y + a);
+            ctx.bezierCurveTo(x + a, y + a, x + a * 3 / 2, y - a / 3, x, y - b);
+            ctx.bezierCurveTo(x - a * 3 / 2, y - a / 3, x - a, y + a, x, y + a);
+            ctx.closePath();
+        };
+        return Droplet;
+    }(Path));
+    Droplet.prototype.type = 'droplet';
+
+    var HeartShape = (function () {
+        function HeartShape() {
+            this.cx = 0;
+            this.cy = 0;
+            this.width = 0;
+            this.height = 0;
+        }
+        return HeartShape;
+    }());
+    var Heart = (function (_super) {
+        __extends(Heart, _super);
+        function Heart(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Heart.prototype.getDefaultShape = function () {
+            return new HeartShape();
+        };
+        Heart.prototype.buildPath = function (ctx, shape) {
+            var x = shape.cx;
+            var y = shape.cy;
+            var a = shape.width;
+            var b = shape.height;
+            ctx.moveTo(x, y);
+            ctx.bezierCurveTo(x + a / 2, y - b * 2 / 3, x + a * 2, y + b / 3, x, y + b);
+            ctx.bezierCurveTo(x - a * 2, y + b / 3, x - a / 2, y - b * 2 / 3, x, y);
+        };
+        return Heart;
+    }(Path));
+    Heart.prototype.type = 'heart';
+
+    var PI$3 = Math.PI;
+    var sin = Math.sin;
+    var cos = Math.cos;
+    var IsogonShape = (function () {
+        function IsogonShape() {
+            this.x = 0;
+            this.y = 0;
+            this.r = 0;
+            this.n = 0;
+        }
+        return IsogonShape;
+    }());
+    var Isogon = (function (_super) {
+        __extends(Isogon, _super);
+        function Isogon(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Isogon.prototype.getDefaultShape = function () {
+            return new IsogonShape();
+        };
+        Isogon.prototype.buildPath = function (ctx, shape) {
+            var n = shape.n;
+            if (!n || n < 2) {
+                return;
+            }
+            var x = shape.x;
+            var y = shape.y;
+            var r = shape.r;
+            var dStep = 2 * PI$3 / n;
+            var deg = -PI$3 / 2;
+            ctx.moveTo(x + r * cos(deg), y + r * sin(deg));
+            for (var i = 0, end = n - 1; i < end; i++) {
+                deg += dStep;
+                ctx.lineTo(x + r * cos(deg), y + r * sin(deg));
+            }
+            ctx.closePath();
+            return;
+        };
+        return Isogon;
+    }(Path));
+    Isogon.prototype.type = 'isogon';
+
+    var RingShape = (function () {
+        function RingShape() {
+            this.cx = 0;
+            this.cy = 0;
+            this.r = 0;
+            this.r0 = 0;
+        }
+        return RingShape;
+    }());
+    var Ring = (function (_super) {
+        __extends(Ring, _super);
+        function Ring(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Ring.prototype.getDefaultShape = function () {
+            return new RingShape();
+        };
+        Ring.prototype.buildPath = function (ctx, shape) {
+            var x = shape.cx;
+            var y = shape.cy;
+            var PI2 = Math.PI * 2;
+            ctx.moveTo(x + shape.r, y);
+            ctx.arc(x, y, shape.r, 0, PI2, false);
+            ctx.moveTo(x + shape.r0, y);
+            ctx.arc(x, y, shape.r0, 0, PI2, true);
+        };
+        return Ring;
+    }(Path));
+    Ring.prototype.type = 'ring';
+
+    var sin$1 = Math.sin;
+    var cos$1 = Math.cos;
+    var radian = Math.PI / 180;
+    var RoseShape = (function () {
+        function RoseShape() {
+            this.cx = 0;
+            this.cy = 0;
+            this.r = [];
+            this.k = 0;
+            this.n = 1;
+        }
+        return RoseShape;
+    }());
+    var Rose = (function (_super) {
+        __extends(Rose, _super);
+        function Rose(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Rose.prototype.getDefaultStyle = function () {
+            return {
+                stroke: '#000',
+                fill: null
+            };
+        };
+        Rose.prototype.getDefaultShape = function () {
+            return new RoseShape();
+        };
+        Rose.prototype.buildPath = function (ctx, shape) {
+            var R = shape.r;
+            var k = shape.k;
+            var n = shape.n;
+            var x0 = shape.cx;
+            var y0 = shape.cy;
+            var x;
+            var y;
+            var r;
+            ctx.moveTo(x0, y0);
+            for (var i = 0, len = R.length; i < len; i++) {
+                r = R[i];
+                for (var j = 0; j <= 360 * n; j++) {
+                    x = r
+                        * sin$1(k / n * j % 360 * radian)
+                        * cos$1(j * radian)
+                        + x0;
+                    y = r
+                        * sin$1(k / n * j % 360 * radian)
+                        * sin$1(j * radian)
+                        + y0;
+                    ctx.lineTo(x, y);
+                }
+            }
+        };
+        return Rose;
+    }(Path));
+    Rose.prototype.type = 'rose';
+
+    var PI$4 = Math.PI;
+    var cos$2 = Math.cos;
+    var sin$2 = Math.sin;
+    var StarShape = (function () {
+        function StarShape() {
+            this.cx = 0;
+            this.cy = 0;
+            this.n = 3;
+            this.r = 0;
+        }
+        return StarShape;
+    }());
+    var Star = (function (_super) {
+        __extends(Star, _super);
+        function Star(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Star.prototype.getDefaultShape = function () {
+            return new StarShape();
+        };
+        Star.prototype.buildPath = function (ctx, shape) {
+            var n = shape.n;
+            if (!n || n < 2) {
+                return;
+            }
+            var x = shape.cx;
+            var y = shape.cy;
+            var r = shape.r;
+            var r0 = shape.r0;
+            if (r0 == null) {
+                r0 = n > 4
+                    ? r * cos$2(2 * PI$4 / n) / cos$2(PI$4 / n)
+                    : r / 3;
+            }
+            var dStep = PI$4 / n;
+            var deg = -PI$4 / 2;
+            var xStart = x + r * cos$2(deg);
+            var yStart = y + r * sin$2(deg);
+            deg += dStep;
+            ctx.moveTo(xStart, yStart);
+            for (var i = 0, end = n * 2 - 1, ri = void 0; i < end; i++) {
+                ri = i % 2 === 0 ? r0 : r;
+                ctx.lineTo(x + ri * cos$2(deg), y + ri * sin$2(deg));
+                deg += dStep;
+            }
+            ctx.closePath();
+        };
+        return Star;
+    }(Path));
+    Star.prototype.type = 'star';
+
+    var cos$3 = Math.cos;
+    var sin$3 = Math.sin;
+    var TrochoidShape = (function () {
+        function TrochoidShape() {
+            this.cx = 0;
+            this.cy = 0;
+            this.r = 0;
+            this.r0 = 0;
+            this.d = 0;
+            this.location = 'out';
+        }
+        return TrochoidShape;
+    }());
+    var Trochoid = (function (_super) {
+        __extends(Trochoid, _super);
+        function Trochoid(opts) {
+            return _super.call(this, opts) || this;
+        }
+        Trochoid.prototype.getDefaultStyle = function () {
+            return {
+                stroke: '#000',
+                fill: null
+            };
+        };
+        Trochoid.prototype.getDefaultShape = function () {
+            return new TrochoidShape();
+        };
+        Trochoid.prototype.buildPath = function (ctx, shape) {
+            var R = shape.r;
+            var r = shape.r0;
+            var d = shape.d;
+            var offsetX = shape.cx;
+            var offsetY = shape.cy;
+            var delta = shape.location === 'out' ? 1 : -1;
+            var x1;
+            var y1;
+            var x2;
+            var y2;
+            if (shape.location && R <= r) {
+                return;
+            }
+            var num = 0;
+            var i = 1;
+            var theta;
+            x1 = (R + delta * r) * cos$3(0)
+                - delta * d * cos$3(0) + offsetX;
+            y1 = (R + delta * r) * sin$3(0)
+                - d * sin$3(0) + offsetY;
+            ctx.moveTo(x1, y1);
+            do {
+                num++;
+            } while ((r * num) % (R + delta * r) !== 0);
+            do {
+                theta = Math.PI / 180 * i;
+                x2 = (R + delta * r) * cos$3(theta)
+                    - delta * d * cos$3((R / r + delta) * theta)
+                    + offsetX;
+                y2 = (R + delta * r) * sin$3(theta)
+                    - d * sin$3((R / r + delta) * theta)
+                    + offsetY;
+                ctx.lineTo(x2, y2);
+                i++;
+            } while (i <= (r * num) / (R + delta * r) * 360);
+        };
+        return Trochoid;
+    }(Path));
+    Trochoid.prototype.type = 'trochoid';
+
+    var Pattern = (function () {
+        function Pattern(image, repeat) {
+            this.image = image;
+            this.repeat = repeat;
+            this.x = 0;
+            this.y = 0;
+            this.rotation = 0;
+            this.scaleX = 1;
+            this.scaleY = 1;
+        }
+        return Pattern;
+    }());
+
+    var extent = [0, 0];
+    var extent2 = [0, 0];
+    var minTv$1 = new Point();
+    var maxTv$1 = new Point();
+    var OrientedBoundingRect = (function () {
+        function OrientedBoundingRect(rect, transform) {
+            this._corners = [];
+            this._axes = [];
+            this._origin = [0, 0];
+            for (var i = 0; i < 4; i++) {
+                this._corners[i] = new Point();
+            }
+            for (var i = 0; i < 2; i++) {
+                this._axes[i] = new Point();
+            }
+            if (rect) {
+                this.fromBoundingRect(rect, transform);
+            }
+        }
+        OrientedBoundingRect.prototype.fromBoundingRect = function (rect, transform) {
+            var corners = this._corners;
+            var axes = this._axes;
+            var x = rect.x;
+            var y = rect.y;
+            var x2 = x + rect.width;
+            var y2 = y + rect.height;
+            corners[0].set(x, y);
+            corners[1].set(x2, y);
+            corners[2].set(x2, y2);
+            corners[3].set(x, y2);
+            if (transform) {
+                for (var i = 0; i < 4; i++) {
+                    corners[i].transform(transform);
+                }
+            }
+            Point.sub(axes[0], corners[1], corners[0]);
+            Point.sub(axes[1], corners[3], corners[0]);
+            axes[0].normalize();
+            axes[1].normalize();
+            for (var i = 0; i < 2; i++) {
+                this._origin[i] = axes[i].dot(corners[0]);
+            }
+        };
+        OrientedBoundingRect.prototype.intersect = function (other, mtv) {
+            var overlapped = true;
+            var noMtv = !mtv;
+            minTv$1.set(Infinity, Infinity);
+            maxTv$1.set(0, 0);
+            if (!this._intersectCheckOneSide(this, other, minTv$1, maxTv$1, noMtv, 1)) {
+                overlapped = false;
+                if (noMtv) {
+                    return overlapped;
+                }
+            }
+            if (!this._intersectCheckOneSide(other, this, minTv$1, maxTv$1, noMtv, -1)) {
+                overlapped = false;
+                if (noMtv) {
+                    return overlapped;
+                }
+            }
+            if (!noMtv) {
+                Point.copy(mtv, overlapped ? minTv$1 : maxTv$1);
+            }
+            return overlapped;
+        };
+        OrientedBoundingRect.prototype._intersectCheckOneSide = function (self, other, minTv, maxTv, noMtv, inverse) {
+            var overlapped = true;
+            for (var i = 0; i < 2; i++) {
+                var axis = this._axes[i];
+                this._getProjMinMaxOnAxis(i, self._corners, extent);
+                this._getProjMinMaxOnAxis(i, other._corners, extent2);
+                if (extent[1] < extent2[0] || extent[0] > extent2[1]) {
+                    overlapped = false;
+                    if (noMtv) {
+                        return overlapped;
+                    }
+                    var dist0 = Math.abs(extent2[0] - extent[1]);
+                    var dist1 = Math.abs(extent[0] - extent2[1]);
+                    if (Math.min(dist0, dist1) > maxTv.len()) {
+                        if (dist0 < dist1) {
+                            Point.scale(maxTv, axis, -dist0 * inverse);
+                        }
+                        else {
+                            Point.scale(maxTv, axis, dist1 * inverse);
+                        }
+                    }
+                }
+                else if (minTv) {
+                    var dist0 = Math.abs(extent2[0] - extent[1]);
+                    var dist1 = Math.abs(extent[0] - extent2[1]);
+                    if (Math.min(dist0, dist1) < minTv.len()) {
+                        if (dist0 < dist1) {
+                            Point.scale(minTv, axis, dist0 * inverse);
+                        }
+                        else {
+                            Point.scale(minTv, axis, -dist1 * inverse);
+                        }
+                    }
+                }
+            }
+            return overlapped;
+        };
+        OrientedBoundingRect.prototype._getProjMinMaxOnAxis = function (dim, corners, out) {
+            var axis = this._axes[dim];
+            var origin = this._origin;
+            var proj = corners[0].dot(axis) + origin[dim];
+            var min = proj;
+            var max = proj;
+            for (var i = 1; i < corners.length; i++) {
+                var proj_1 = corners[i].dot(axis) + origin[dim];
+                min = Math.min(proj_1, min);
+                max = Math.max(proj_1, max);
+            }
+            out[0] = min;
+            out[1] = max;
+        };
+        return OrientedBoundingRect;
+    }());
+
+    var DebugRect = (function () {
+        function DebugRect(style) {
+            var dom = this.dom = document.createElement('div');
+            dom.className = 'ec-debug-dirty-rect';
+            style = extend({}, style);
+            extend(style, {
+                backgroundColor: 'rgba(0, 0, 255, 0.2)',
+                border: '1px solid #00f'
+            });
+            dom.style.cssText = "\nposition: absolute;\nopacity: 0;\ntransition: opacity 0.5s linear;\npointer-events: none;\n";
+            for (var key in style) {
+                if (style.hasOwnProperty(key)) {
+                    dom.style[key] = style[key];
+                }
+            }
+        }
+        DebugRect.prototype.update = function (rect) {
+            var domStyle = this.dom.style;
+            domStyle.width = rect.width + 'px';
+            domStyle.height = rect.height + 'px';
+            domStyle.left = rect.x + 'px';
+            domStyle.top = rect.y + 'px';
+        };
+        DebugRect.prototype.hide = function () {
+            this.dom.style.opacity = '0';
+        };
+        DebugRect.prototype.show = function (autoHideDelay) {
+            var _this = this;
+            clearTimeout(this._hideTimeout);
+            this.dom.style.opacity = '1';
+            this._hideTimeout = setTimeout(function () {
+                _this.hide();
+            }, autoHideDelay || 1000);
+        };
+        return DebugRect;
+    }());
+    function showDebugDirtyRect(zr, opts) {
+        opts = opts || {};
+        var painter = zr.painter;
+        if (!painter.getLayers) {
+            throw new Error('Debug dirty rect can only been used on canvas renderer.');
+        }
+        if (painter.isSingleCanvas()) {
+            throw new Error('Debug dirty rect can only been used on zrender inited with container.');
+        }
+        var debugViewRoot = document.createElement('div');
+        debugViewRoot.style.cssText = "\nposition:absolute;\nleft:0;\ntop:0;\nright:0;\nbottom:0;\npointer-events:none;\n";
+        debugViewRoot.className = 'ec-debug-dirty-rect-container';
+        var debugRects = [];
+        var dom = zr.dom;
+        dom.appendChild(debugViewRoot);
+        var computedStyle = getComputedStyle(dom);
+        if (computedStyle.position === 'static') {
+            dom.style.position = 'relative';
+        }
+        zr.on('rendered', function () {
+            if (painter.getLayers) {
+                var idx_1 = 0;
+                painter.eachBuiltinLayer(function (layer) {
+                    if (!layer.debugGetPaintRects) {
+                        return;
+                    }
+                    var paintRects = layer.debugGetPaintRects();
+                    for (var i = 0; i < paintRects.length; i++) {
+                        if (!paintRects[i].width || !paintRects[i].height) {
+                            continue;
+                        }
+                        if (!debugRects[idx_1]) {
+                            debugRects[idx_1] = new DebugRect(opts.style);
+                            debugViewRoot.appendChild(debugRects[idx_1].dom);
+                        }
+                        debugRects[idx_1].show(opts.autoHideDelay);
+                        debugRects[idx_1].update(paintRects[i]);
+                        idx_1++;
+                    }
+                });
+                for (var i = idx_1; i < debugRects.length; i++) {
+                    debugRects[i].hide();
+                }
+            }
+        });
+    }
+
+    function isSafeNum(num) {
+        return isFinite(num);
+    }
+    function createLinearGradient(ctx, obj, rect) {
+        var x = obj.x == null ? 0 : obj.x;
+        var x2 = obj.x2 == null ? 1 : obj.x2;
+        var y = obj.y == null ? 0 : obj.y;
+        var y2 = obj.y2 == null ? 0 : obj.y2;
+        if (!obj.global) {
+            x = x * rect.width + rect.x;
+            x2 = x2 * rect.width + rect.x;
+            y = y * rect.height + rect.y;
+            y2 = y2 * rect.height + rect.y;
+        }
+        x = isSafeNum(x) ? x : 0;
+        x2 = isSafeNum(x2) ? x2 : 1;
+        y = isSafeNum(y) ? y : 0;
+        y2 = isSafeNum(y2) ? y2 : 0;
+        var canvasGradient = ctx.createLinearGradient(x, y, x2, y2);
+        return canvasGradient;
+    }
+    function createRadialGradient(ctx, obj, rect) {
+        var width = rect.width;
+        var height = rect.height;
+        var min = Math.min(width, height);
+        var x = obj.x == null ? 0.5 : obj.x;
+        var y = obj.y == null ? 0.5 : obj.y;
+        var r = obj.r == null ? 0.5 : obj.r;
+        if (!obj.global) {
+            x = x * width + rect.x;
+            y = y * height + rect.y;
+            r = r * min;
+        }
+        x = isSafeNum(x) ? x : 0.5;
+        y = isSafeNum(y) ? y : 0.5;
+        r = r >= 0 && isSafeNum(r) ? r : 0.5;
+        var canvasGradient = ctx.createRadialGradient(x, y, 0, x, y, r);
+        return canvasGradient;
+    }
+    function getCanvasGradient(ctx, obj, rect) {
+        var canvasGradient = obj.type === 'radial'
+            ? createRadialGradient(ctx, obj, rect)
+            : createLinearGradient(ctx, obj, rect);
+        var colorStops = obj.colorStops;
+        for (var i = 0; i < colorStops.length; i++) {
+            canvasGradient.addColorStop(colorStops[i].offset, colorStops[i].color);
+        }
+        return canvasGradient;
+    }
+    function isClipPathChanged(clipPaths, prevClipPaths) {
+        if (clipPaths === prevClipPaths || (!clipPaths && !prevClipPaths)) {
+            return false;
+        }
+        if (!clipPaths || !prevClipPaths || (clipPaths.length !== prevClipPaths.length)) {
+            return true;
+        }
+        for (var i = 0; i < clipPaths.length; i++) {
+            if (clipPaths[i] !== prevClipPaths[i]) {
+                return true;
+            }
+        }
+        return false;
+    }
+    function parseInt10(val) {
+        return parseInt(val, 10);
+    }
+    function getSize(root, whIdx, opts) {
+        var wh = ['width', 'height'][whIdx];
+        var cwh = ['clientWidth', 'clientHeight'][whIdx];
+        var plt = ['paddingLeft', 'paddingTop'][whIdx];
+        var prb = ['paddingRight', 'paddingBottom'][whIdx];
+        if (opts[wh] != null && opts[wh] !== 'auto') {
+            return parseFloat(opts[wh]);
+        }
+        var stl = document.defaultView.getComputedStyle(root);
+        return ((root[cwh] || parseInt10(stl[wh]) || parseInt10(root.style[wh]))
+            - (parseInt10(stl[plt]) || 0)
+            - (parseInt10(stl[prb]) || 0)) | 0;
+    }
+
+    function normalizeLineDash(lineType, lineWidth) {
+        if (!lineType || lineType === 'solid' || !(lineWidth > 0)) {
+            return null;
+        }
+        return lineType === 'dashed'
+            ? [4 * lineWidth, 2 * lineWidth]
+            : lineType === 'dotted'
+                ? [lineWidth]
+                : isNumber(lineType)
+                    ? [lineType] : isArray(lineType) ? lineType : null;
+    }
+    function getLineDash(el) {
+        var style = el.style;
+        var lineDash = style.lineDash && style.lineWidth > 0 && normalizeLineDash(style.lineDash, style.lineWidth);
+        var lineDashOffset = style.lineDashOffset;
+        if (lineDash) {
+            var lineScale_1 = (style.strokeNoScale && el.getLineScale) ? el.getLineScale() : 1;
+            if (lineScale_1 && lineScale_1 !== 1) {
+                lineDash = map(lineDash, function (rawVal) {
+                    return rawVal / lineScale_1;
+                });
+                lineDashOffset /= lineScale_1;
+            }
+        }
+        return [lineDash, lineDashOffset];
+    }
+
+    var pathProxyForDraw = new PathProxy(true);
+    function styleHasStroke(style) {
+        var stroke = style.stroke;
+        return !(stroke == null || stroke === 'none' || !(style.lineWidth > 0));
+    }
+    function isValidStrokeFillStyle(strokeOrFill) {
+        return typeof strokeOrFill === 'string' && strokeOrFill !== 'none';
+    }
+    function styleHasFill(style) {
+        var fill = style.fill;
+        return fill != null && fill !== 'none';
+    }
+    function doFillPath(ctx, style) {
+        if (style.fillOpacity != null && style.fillOpacity !== 1) {
+            var originalGlobalAlpha = ctx.globalAlpha;
+            ctx.globalAlpha = style.fillOpacity * style.opacity;
+            ctx.fill();
+            ctx.globalAlpha = originalGlobalAlpha;
+        }
+        else {
+            ctx.fill();
+        }
+    }
+    function doStrokePath(ctx, style) {
+        if (style.strokeOpacity != null && style.strokeOpacity !== 1) {
+            var originalGlobalAlpha = ctx.globalAlpha;
+            ctx.globalAlpha = style.strokeOpacity * style.opacity;
+            ctx.stroke();
+            ctx.globalAlpha = originalGlobalAlpha;
+        }
+        else {
+            ctx.stroke();
+        }
+    }
+    function createCanvasPattern(ctx, pattern, el) {
+        var image = createOrUpdateImage(pattern.image, pattern.__image, el);
+        if (isImageReady(image)) {
+            var canvasPattern = ctx.createPattern(image, pattern.repeat || 'repeat');
+            if (typeof DOMMatrix === 'function'
+                && canvasPattern
+                && canvasPattern.setTransform) {
+                var matrix = new DOMMatrix();
+                matrix.translateSelf((pattern.x || 0), (pattern.y || 0));
+                matrix.rotateSelf(0, 0, (pattern.rotation || 0) * RADIAN_TO_DEGREE);
+                matrix.scaleSelf((pattern.scaleX || 1), (pattern.scaleY || 1));
+                canvasPattern.setTransform(matrix);
+            }
+            return canvasPattern;
+        }
+    }
+    function brushPath(ctx, el, style, inBatch) {
+        var _a;
+        var hasStroke = styleHasStroke(style);
+        var hasFill = styleHasFill(style);
+        var strokePercent = style.strokePercent;
+        var strokePart = strokePercent < 1;
+        var firstDraw = !el.path;
+        if ((!el.silent || strokePart) && firstDraw) {
+            el.createPathProxy();
+        }
+        var path = el.path || pathProxyForDraw;
+        var dirtyFlag = el.__dirty;
+        if (!inBatch) {
+            var fill = style.fill;
+            var stroke = style.stroke;
+            var hasFillGradient = hasFill && !!fill.colorStops;
+            var hasStrokeGradient = hasStroke && !!stroke.colorStops;
+            var hasFillPattern = hasFill && !!fill.image;
+            var hasStrokePattern = hasStroke && !!stroke.image;
+            var fillGradient = void 0;
+            var strokeGradient = void 0;
+            var fillPattern = void 0;
+            var strokePattern = void 0;
+            var rect = void 0;
+            if (hasFillGradient || hasStrokeGradient) {
+                rect = el.getBoundingRect();
+            }
+            if (hasFillGradient) {
+                fillGradient = dirtyFlag
+                    ? getCanvasGradient(ctx, fill, rect)
+                    : el.__canvasFillGradient;
+                el.__canvasFillGradient = fillGradient;
+            }
+            if (hasStrokeGradient) {
+                strokeGradient = dirtyFlag
+                    ? getCanvasGradient(ctx, stroke, rect)
+                    : el.__canvasStrokeGradient;
+                el.__canvasStrokeGradient = strokeGradient;
+            }
+            if (hasFillPattern) {
+                fillPattern = (dirtyFlag || !el.__canvasFillPattern)
+                    ? createCanvasPattern(ctx, fill, el)
+                    : el.__canvasFillPattern;
+                el.__canvasFillPattern = fillPattern;
+            }
+            if (hasStrokePattern) {
+                strokePattern = (dirtyFlag || !el.__canvasStrokePattern)
+                    ? createCanvasPattern(ctx, stroke, el)
+                    : el.__canvasStrokePattern;
+                el.__canvasStrokePattern = fillPattern;
+            }
+            if (hasFillGradient) {
+                ctx.fillStyle = fillGradient;
+            }
+            else if (hasFillPattern) {
+                if (fillPattern) {
+                    ctx.fillStyle = fillPattern;
+                }
+                else {
+                    hasFill = false;
+                }
+            }
+            if (hasStrokeGradient) {
+                ctx.strokeStyle = strokeGradient;
+            }
+            else if (hasStrokePattern) {
+                if (strokePattern) {
+                    ctx.strokeStyle = strokePattern;
+                }
+                else {
+                    hasStroke = false;
+                }
+            }
+        }
+        var scale = el.getGlobalScale();
+        path.setScale(scale[0], scale[1], el.segmentIgnoreThreshold);
+        var lineDash;
+        var lineDashOffset;
+        if (ctx.setLineDash && style.lineDash) {
+            _a = getLineDash(el), lineDash = _a[0], lineDashOffset = _a[1];
+        }
+        var needsRebuild = true;
+        if (firstDraw || (dirtyFlag & SHAPE_CHANGED_BIT)) {
+            path.setDPR(ctx.dpr);
+            if (strokePart) {
+                path.setContext(null);
+            }
+            else {
+                path.setContext(ctx);
+                needsRebuild = false;
+            }
+            path.reset();
+            el.buildPath(path, el.shape, inBatch);
+            path.toStatic();
+            el.pathUpdated();
+        }
+        if (needsRebuild) {
+            path.rebuildPath(ctx, strokePart ? strokePercent : 1);
+        }
+        if (lineDash) {
+            ctx.setLineDash(lineDash);
+            ctx.lineDashOffset = lineDashOffset;
+        }
+        if (!inBatch) {
+            if (style.strokeFirst) {
+                if (hasStroke) {
+                    doStrokePath(ctx, style);
+                }
+                if (hasFill) {
+                    doFillPath(ctx, style);
+                }
+            }
+            else {
+                if (hasFill) {
+                    doFillPath(ctx, style);
+                }
+                if (hasStroke) {
+                    doStrokePath(ctx, style);
+                }
+            }
+        }
+        if (lineDash) {
+            ctx.setLineDash([]);
+        }
+    }
+    function brushImage(ctx, el, style) {
+        var image = el.__image = createOrUpdateImage(style.image, el.__image, el, el.onload);
+        if (!image || !isImageReady(image)) {
+            return;
+        }
+        var x = style.x || 0;
+        var y = style.y || 0;
+        var width = el.getWidth();
+        var height = el.getHeight();
+        var aspect = image.width / image.height;
+        if (width == null && height != null) {
+            width = height * aspect;
+        }
+        else if (height == null && width != null) {
+            height = width / aspect;
+        }
+        else if (width == null && height == null) {
+            width = image.width;
+            height = image.height;
+        }
+        if (style.sWidth && style.sHeight) {
+            var sx = style.sx || 0;
+            var sy = style.sy || 0;
+            ctx.drawImage(image, sx, sy, style.sWidth, style.sHeight, x, y, width, height);
+        }
+        else if (style.sx && style.sy) {
+            var sx = style.sx;
+            var sy = style.sy;
+            var sWidth = width - sx;
+            var sHeight = height - sy;
+            ctx.drawImage(image, sx, sy, sWidth, sHeight, x, y, width, height);
+        }
+        else {
+            ctx.drawImage(image, x, y, width, height);
+        }
+    }
+    function brushText(ctx, el, style) {
+        var _a;
+        var text = style.text;
+        text != null && (text += '');
+        if (text) {
+            ctx.font = style.font || DEFAULT_FONT;
+            ctx.textAlign = style.textAlign;
+            ctx.textBaseline = style.textBaseline;
+            var lineDash = void 0;
+            var lineDashOffset = void 0;
+            if (ctx.setLineDash && style.lineDash) {
+                _a = getLineDash(el), lineDash = _a[0], lineDashOffset = _a[1];
+            }
+            if (lineDash) {
+                ctx.setLineDash(lineDash);
+                ctx.lineDashOffset = lineDashOffset;
+            }
+            if (style.strokeFirst) {
+                if (styleHasStroke(style)) {
+                    ctx.strokeText(text, style.x, style.y);
+                }
+                if (styleHasFill(style)) {
+                    ctx.fillText(text, style.x, style.y);
+                }
+            }
+            else {
+                if (styleHasFill(style)) {
+                    ctx.fillText(text, style.x, style.y);
+                }
+                if (styleHasStroke(style)) {
+                    ctx.strokeText(text, style.x, style.y);
+                }
+            }
+            if (lineDash) {
+                ctx.setLineDash([]);
+            }
+        }
+    }
+    var SHADOW_NUMBER_PROPS = ['shadowBlur', 'shadowOffsetX', 'shadowOffsetY'];
+    var STROKE_PROPS = [
+        ['lineCap', 'butt'], ['lineJoin', 'miter'], ['miterLimit', 10]
+    ];
+    function bindCommonProps(ctx, style, prevStyle, forceSetAll, scope) {
+        var styleChanged = false;
+        if (!forceSetAll) {
+            prevStyle = prevStyle || {};
+            if (style === prevStyle) {
+                return false;
+            }
+        }
+        if (forceSetAll || style.opacity !== prevStyle.opacity) {
+            flushPathDrawn(ctx, scope);
+            styleChanged = true;
+            var opacity = Math.max(Math.min(style.opacity, 1), 0);
+            ctx.globalAlpha = isNaN(opacity) ? DEFAULT_COMMON_STYLE.opacity : opacity;
+        }
+        if (forceSetAll || style.blend !== prevStyle.blend) {
+            if (!styleChanged) {
+                flushPathDrawn(ctx, scope);
+                styleChanged = true;
+            }
+            ctx.globalCompositeOperation = style.blend || DEFAULT_COMMON_STYLE.blend;
+        }
+        for (var i = 0; i < SHADOW_NUMBER_PROPS.length; i++) {
+            var propName = SHADOW_NUMBER_PROPS[i];
+            if (forceSetAll || style[propName] !== prevStyle[propName]) {
+                if (!styleChanged) {
+                    flushPathDrawn(ctx, scope);
+                    styleChanged = true;
+                }
+                ctx[propName] = ctx.dpr * (style[propName] || 0);
+            }
+        }
+        if (forceSetAll || style.shadowColor !== prevStyle.shadowColor) {
+            if (!styleChanged) {
+                flushPathDrawn(ctx, scope);
+                styleChanged = true;
+            }
+            ctx.shadowColor = style.shadowColor || DEFAULT_COMMON_STYLE.shadowColor;
+        }
+        return styleChanged;
+    }
+    function bindPathAndTextCommonStyle(ctx, el, prevEl, forceSetAll, scope) {
+        var style = getStyle(el, scope.inHover);
+        var prevStyle = forceSetAll
+            ? null
+            : (prevEl && getStyle(prevEl, scope.inHover) || {});
+        if (style === prevStyle) {
+            return false;
+        }
+        var styleChanged = bindCommonProps(ctx, style, prevStyle, forceSetAll, scope);
+        if (forceSetAll || style.fill !== prevStyle.fill) {
+            if (!styleChanged) {
+                flushPathDrawn(ctx, scope);
+                styleChanged = true;
+            }
+            isValidStrokeFillStyle(style.fill) && (ctx.fillStyle = style.fill);
+        }
+        if (forceSetAll || style.stroke !== prevStyle.stroke) {
+            if (!styleChanged) {
+                flushPathDrawn(ctx, scope);
+                styleChanged = true;
+            }
+            isValidStrokeFillStyle(style.stroke) && (ctx.strokeStyle = style.stroke);
+        }
+        if (forceSetAll || style.opacity !== prevStyle.opacity) {
+            if (!styleChanged) {
+                flushPathDrawn(ctx, scope);
+                styleChanged = true;
+            }
+            ctx.globalAlpha = style.opacity == null ? 1 : style.opacity;
+        }
+        if (el.hasStroke()) {
+            var lineWidth = style.lineWidth;
+            var newLineWidth = lineWidth / ((style.strokeNoScale && el.getLineScale) ? el.getLineScale() : 1);
+            if (ctx.lineWidth !== newLineWidth) {
+                if (!styleChanged) {
+                    flushPathDrawn(ctx, scope);
+                    styleChanged = true;
+                }
+                ctx.lineWidth = newLineWidth;
+            }
+        }
+        for (var i = 0; i < STROKE_PROPS.length; i++) {
+            var prop = STROKE_PROPS[i];
+            var propName = prop[0];
+            if (forceSetAll || style[propName] !== prevStyle[propName]) {
+                if (!styleChanged) {
+                    flushPathDrawn(ctx, scope);
+                    styleChanged = true;
+                }
+                ctx[propName] = style[propName] || prop[1];
+            }
+        }
+        return styleChanged;
+    }
+    function bindImageStyle(ctx, el, prevEl, forceSetAll, scope) {
+        return bindCommonProps(ctx, getStyle(el, scope.inHover), prevEl && getStyle(prevEl, scope.inHover), forceSetAll, scope);
+    }
+    function setContextTransform(ctx, el) {
+        var m = el.transform;
+        var dpr = ctx.dpr || 1;
+        if (m) {
+            ctx.setTransform(dpr * m[0], dpr * m[1], dpr * m[2], dpr * m[3], dpr * m[4], dpr * m[5]);
+        }
+        else {
+            ctx.setTransform(dpr, 0, 0, dpr, 0, 0);
+        }
+    }
+    function updateClipStatus(clipPaths, ctx, scope) {
+        var allClipped = false;
+        for (var i = 0; i < clipPaths.length; i++) {
+            var clipPath = clipPaths[i];
+            allClipped = allClipped || clipPath.isZeroArea();
+            setContextTransform(ctx, clipPath);
+            ctx.beginPath();
+            clipPath.buildPath(ctx, clipPath.shape);
+            ctx.clip();
+        }
+        scope.allClipped = allClipped;
+    }
+    function isTransformChanged(m0, m1) {
+        if (m0 && m1) {
+            return m0[0] !== m1[0]
+                || m0[1] !== m1[1]
+                || m0[2] !== m1[2]
+                || m0[3] !== m1[3]
+                || m0[4] !== m1[4]
+                || m0[5] !== m1[5];
+        }
+        else if (!m0 && !m1) {
+            return false;
+        }
+        return true;
+    }
+    var DRAW_TYPE_PATH = 1;
+    var DRAW_TYPE_IMAGE = 2;
+    var DRAW_TYPE_TEXT = 3;
+    var DRAW_TYPE_INCREMENTAL = 4;
+    function canPathBatch(style) {
+        var hasFill = styleHasFill(style);
+        var hasStroke = styleHasStroke(style);
+        return !(style.lineDash
+            || !(+hasFill ^ +hasStroke)
+            || (hasFill && typeof style.fill !== 'string')
+            || (hasStroke && typeof style.stroke !== 'string')
+            || style.strokePercent < 1
+            || style.strokeOpacity < 1
+            || style.fillOpacity < 1);
+    }
+    function flushPathDrawn(ctx, scope) {
+        scope.batchFill && ctx.fill();
+        scope.batchStroke && ctx.stroke();
+        scope.batchFill = '';
+        scope.batchStroke = '';
+    }
+    function getStyle(el, inHover) {
+        return inHover ? (el.__hoverStyle || el.style) : el.style;
+    }
+    function brushSingle(ctx, el) {
+        brush(ctx, el, { inHover: false, viewWidth: 0, viewHeight: 0 }, true);
+    }
+    function brush(ctx, el, scope, isLast) {
+        var m = el.transform;
+        if (!el.shouldBePainted(scope.viewWidth, scope.viewHeight, false, false)) {
+            el.__dirty &= ~REDRAW_BIT;
+            el.__isRendered = false;
+            return;
+        }
+        var clipPaths = el.__clipPaths;
+        var prevElClipPaths = scope.prevElClipPaths;
+        var forceSetTransform = false;
+        var forceSetStyle = false;
+        if (!prevElClipPaths || isClipPathChanged(clipPaths, prevElClipPaths)) {
+            if (prevElClipPaths && prevElClipPaths.length) {
+                flushPathDrawn(ctx, scope);
+                ctx.restore();
+                forceSetStyle = forceSetTransform = true;
+                scope.prevElClipPaths = null;
+                scope.allClipped = false;
+                scope.prevEl = null;
+            }
+            if (clipPaths && clipPaths.length) {
+                flushPathDrawn(ctx, scope);
+                ctx.save();
+                updateClipStatus(clipPaths, ctx, scope);
+                forceSetTransform = true;
+            }
+            scope.prevElClipPaths = clipPaths;
+        }
+        if (scope.allClipped) {
+            el.__isRendered = false;
+            return;
+        }
+        el.beforeBrush && el.beforeBrush();
+        el.innerBeforeBrush();
+        var prevEl = scope.prevEl;
+        if (!prevEl) {
+            forceSetStyle = forceSetTransform = true;
+        }
+        var canBatchPath = el instanceof Path
+            && el.autoBatch
+            && canPathBatch(el.style);
+        if (forceSetTransform || isTransformChanged(m, prevEl.transform)) {
+            flushPathDrawn(ctx, scope);
+            setContextTransform(ctx, el);
+        }
+        else if (!canBatchPath) {
+            flushPathDrawn(ctx, scope);
+        }
+        var style = getStyle(el, scope.inHover);
+        if (el instanceof Path) {
+            if (scope.lastDrawType !== DRAW_TYPE_PATH) {
+                forceSetStyle = true;
+                scope.lastDrawType = DRAW_TYPE_PATH;
+            }
+            bindPathAndTextCommonStyle(ctx, el, prevEl, forceSetStyle, scope);
+            if (!canBatchPath || (!scope.batchFill && !scope.batchStroke)) {
+                ctx.beginPath();
+            }
+            brushPath(ctx, el, style, canBatchPath);
+            if (canBatchPath) {
+                scope.batchFill = style.fill || '';
+                scope.batchStroke = style.stroke || '';
+            }
+        }
+        else {
+            if (el instanceof TSpan) {
+                if (scope.lastDrawType !== DRAW_TYPE_TEXT) {
+                    forceSetStyle = true;
+                    scope.lastDrawType = DRAW_TYPE_TEXT;
+                }
+                bindPathAndTextCommonStyle(ctx, el, prevEl, forceSetStyle, scope);
+                brushText(ctx, el, style);
+            }
+            else if (el instanceof ZRImage) {
+                if (scope.lastDrawType !== DRAW_TYPE_IMAGE) {
+                    forceSetStyle = true;
+                    scope.lastDrawType = DRAW_TYPE_IMAGE;
+                }
+                bindImageStyle(ctx, el, prevEl, forceSetStyle, scope);
+                brushImage(ctx, el, style);
+            }
+            else if (el.getTemporalDisplayables) {
+                if (scope.lastDrawType !== DRAW_TYPE_INCREMENTAL) {
+                    forceSetStyle = true;
+                    scope.lastDrawType = DRAW_TYPE_INCREMENTAL;
+                }
+                brushIncremental(ctx, el, scope);
+            }
+        }
+        if (canBatchPath && isLast) {
+            flushPathDrawn(ctx, scope);
+        }
+        el.innerAfterBrush();
+        el.afterBrush && el.afterBrush();
+        scope.prevEl = el;
+        el.__dirty = 0;
+        el.__isRendered = true;
+    }
+    function brushIncremental(ctx, el, scope) {
+        var displayables = el.getDisplayables();
+        var temporalDisplayables = el.getTemporalDisplayables();
+        ctx.save();
+        var innerScope = {
+            prevElClipPaths: null,
+            prevEl: null,
+            allClipped: false,
+            viewWidth: scope.viewWidth,
+            viewHeight: scope.viewHeight,
+            inHover: scope.inHover
+        };
+        var i;
+        var len;
+        for (i = el.getCursor(), len = displayables.length; i < len; i++) {
+            var displayable = displayables[i];
+            displayable.beforeBrush && displayable.beforeBrush();
+            displayable.innerBeforeBrush();
+            brush(ctx, displayable, innerScope, i === len - 1);
+            displayable.innerAfterBrush();
+            displayable.afterBrush && displayable.afterBrush();
+            innerScope.prevEl = displayable;
+        }
+        for (var i_1 = 0, len_1 = temporalDisplayables.length; i_1 < len_1; i_1++) {
+            var displayable = temporalDisplayables[i_1];
+            displayable.beforeBrush && displayable.beforeBrush();
+            displayable.innerBeforeBrush();
+            brush(ctx, displayable, innerScope, i_1 === len_1 - 1);
+            displayable.innerAfterBrush();
+            displayable.afterBrush && displayable.afterBrush();
+            innerScope.prevEl = displayable;
+        }
+        el.clearTemporalDisplayables();
+        el.notClear = true;
+        ctx.restore();
+    }
+
+    function createDom(id, painter, dpr) {
+        var newDom = platformApi.createCanvas();
+        var width = painter.getWidth();
+        var height = painter.getHeight();
+        var newDomStyle = newDom.style;
+        if (newDomStyle) {
+            newDomStyle.position = 'absolute';
+            newDomStyle.left = '0';
+            newDomStyle.top = '0';
+            newDomStyle.width = width + 'px';
+            newDomStyle.height = height + 'px';
+            newDom.setAttribute('data-zr-dom-id', id);
+        }
+        newDom.width = width * dpr;
+        newDom.height = height * dpr;
+        return newDom;
+    }
+    var Layer = (function (_super) {
+        __extends(Layer, _super);
+        function Layer(id, painter, dpr) {
+            var _this = _super.call(this) || this;
+            _this.motionBlur = false;
+            _this.lastFrameAlpha = 0.7;
+            _this.dpr = 1;
+            _this.virtual = false;
+            _this.config = {};
+            _this.incremental = false;
+            _this.zlevel = 0;
+            _this.maxRepaintRectCount = 5;
+            _this.__dirty = true;
+            _this.__firstTimePaint = true;
+            _this.__used = false;
+            _this.__drawIndex = 0;
+            _this.__startIndex = 0;
+            _this.__endIndex = 0;
+            _this.__prevStartIndex = null;
+            _this.__prevEndIndex = null;
+            var dom;
+            dpr = dpr || devicePixelRatio;
+            if (typeof id === 'string') {
+                dom = createDom(id, painter, dpr);
+            }
+            else if (isObject(id)) {
+                dom = id;
+                id = dom.id;
+            }
+            _this.id = id;
+            _this.dom = dom;
+            var domStyle = dom.style;
+            if (domStyle) {
+                disableUserSelect(dom);
+                dom.onselectstart = function () { return false; };
+                domStyle.padding = '0';
+                domStyle.margin = '0';
+                domStyle.borderWidth = '0';
+            }
+            _this.painter = painter;
+            _this.dpr = dpr;
+            return _this;
+        }
+        Layer.prototype.getElementCount = function () {
+            return this.__endIndex - this.__startIndex;
+        };
+        Layer.prototype.afterBrush = function () {
+            this.__prevStartIndex = this.__startIndex;
+            this.__prevEndIndex = this.__endIndex;
+        };
+        Layer.prototype.initContext = function () {
+            this.ctx = this.dom.getContext('2d');
+            this.ctx.dpr = this.dpr;
+        };
+        Layer.prototype.setUnpainted = function () {
+            this.__firstTimePaint = true;
+        };
+        Layer.prototype.createBackBuffer = function () {
+            var dpr = this.dpr;
+            this.domBack = createDom('back-' + this.id, this.painter, dpr);
+            this.ctxBack = this.domBack.getContext('2d');
+            if (dpr !== 1) {
+                this.ctxBack.scale(dpr, dpr);
+            }
+        };
+        Layer.prototype.createRepaintRects = function (displayList, prevList, viewWidth, viewHeight) {
+            if (this.__firstTimePaint) {
+                this.__firstTimePaint = false;
+                return null;
+            }
+            var mergedRepaintRects = [];
+            var maxRepaintRectCount = this.maxRepaintRectCount;
+            var full = false;
+            var pendingRect = new BoundingRect(0, 0, 0, 0);
+            function addRectToMergePool(rect) {
+                if (!rect.isFinite() || rect.isZero()) {
+                    return;
+                }
+                if (mergedRepaintRects.length === 0) {
+                    var boundingRect = new BoundingRect(0, 0, 0, 0);
+                    boundingRect.copy(rect);
+                    mergedRepaintRects.push(boundingRect);
+                }
+                else {
+                    var isMerged = false;
+                    var minDeltaArea = Infinity;
+                    var bestRectToMergeIdx = 0;
+                    for (var i = 0; i < mergedRepaintRects.length; ++i) {
+                        var mergedRect = mergedRepaintRects[i];
+                        if (mergedRect.intersect(rect)) {
+                            var pendingRect_1 = new BoundingRect(0, 0, 0, 0);
+                            pendingRect_1.copy(mergedRect);
+                            pendingRect_1.union(rect);
+                            mergedRepaintRects[i] = pendingRect_1;
+                            isMerged = true;
+                            break;
+                        }
+                        else if (full) {
+                            pendingRect.copy(rect);
+                            pendingRect.union(mergedRect);
+                            var aArea = rect.width * rect.height;
+                            var bArea = mergedRect.width * mergedRect.height;
+                            var pendingArea = pendingRect.width * pendingRect.height;
+                            var deltaArea = pendingArea - aArea - bArea;
+                            if (deltaArea < minDeltaArea) {
+                                minDeltaArea = deltaArea;
+                                bestRectToMergeIdx = i;
+                            }
+                        }
+                    }
+                    if (full) {
+                        mergedRepaintRects[bestRectToMergeIdx].union(rect);
+                        isMerged = true;
+                    }
+                    if (!isMerged) {
+                        var boundingRect = new BoundingRect(0, 0, 0, 0);
+                        boundingRect.copy(rect);
+                        mergedRepaintRects.push(boundingRect);
+                    }
+                    if (!full) {
+                        full = mergedRepaintRects.length >= maxRepaintRectCount;
+                    }
+                }
+            }
+            for (var i = this.__startIndex; i < this.__endIndex; ++i) {
+                var el = displayList[i];
+                if (el) {
+                    var shouldPaint = el.shouldBePainted(viewWidth, viewHeight, true, true);
+                    var prevRect = el.__isRendered && ((el.__dirty & REDRAW_BIT) || !shouldPaint)
+                        ? el.getPrevPaintRect()
+                        : null;
+                    if (prevRect) {
+                        addRectToMergePool(prevRect);
+                    }
+                    var curRect = shouldPaint && ((el.__dirty & REDRAW_BIT) || !el.__isRendered)
+                        ? el.getPaintRect()
+                        : null;
+                    if (curRect) {
+                        addRectToMergePool(curRect);
+                    }
+                }
+            }
+            for (var i = this.__prevStartIndex; i < this.__prevEndIndex; ++i) {
+                var el = prevList[i];
+                var shouldPaint = el && el.shouldBePainted(viewWidth, viewHeight, true, true);
+                if (el && (!shouldPaint || !el.__zr) && el.__isRendered) {
+                    var prevRect = el.getPrevPaintRect();
+                    if (prevRect) {
+                        addRectToMergePool(prevRect);
+                    }
+                }
+            }
+            var hasIntersections;
+            do {
+                hasIntersections = false;
+                for (var i = 0; i < mergedRepaintRects.length;) {
+                    if (mergedRepaintRects[i].isZero()) {
+                        mergedRepaintRects.splice(i, 1);
+                        continue;
+                    }
+                    for (var j = i + 1; j < mergedRepaintRects.length;) {
+                        if (mergedRepaintRects[i].intersect(mergedRepaintRects[j])) {
+                            hasIntersections = true;
+                            mergedRepaintRects[i].union(mergedRepaintRects[j]);
+                            mergedRepaintRects.splice(j, 1);
+                        }
+                        else {
+                            j++;
+                        }
+                    }
+                    i++;
+                }
+            } while (hasIntersections);
+            this._paintRects = mergedRepaintRects;
+            return mergedRepaintRects;
+        };
+        Layer.prototype.debugGetPaintRects = function () {
+            return (this._paintRects || []).slice();
+        };
+        Layer.prototype.resize = function (width, height) {
+            var dpr = this.dpr;
+            var dom = this.dom;
+            var domStyle = dom.style;
+            var domBack = this.domBack;
+            if (domStyle) {
+                domStyle.width = width + 'px';
+                domStyle.height = height + 'px';
+            }
+            dom.width = width * dpr;
+            dom.height = height * dpr;
+            if (domBack) {
+                domBack.width = width * dpr;
+                domBack.height = height * dpr;
+                if (dpr !== 1) {
+                    this.ctxBack.scale(dpr, dpr);
+                }
+            }
+        };
+        Layer.prototype.clear = function (clearAll, clearColor, repaintRects) {
+            var dom = this.dom;
+            var ctx = this.ctx;
+            var width = dom.width;
+            var height = dom.height;
+            clearColor = clearColor || this.clearColor;
+            var haveMotionBLur = this.motionBlur && !clearAll;
+            var lastFrameAlpha = this.lastFrameAlpha;
+            var dpr = this.dpr;
+            var self = this;
+            if (haveMotionBLur) {
+                if (!this.domBack) {
+                    this.createBackBuffer();
+                }
+                this.ctxBack.globalCompositeOperation = 'copy';
+                this.ctxBack.drawImage(dom, 0, 0, width / dpr, height / dpr);
+            }
+            var domBack = this.domBack;
+            function doClear(x, y, width, height) {
+                ctx.clearRect(x, y, width, height);
+                if (clearColor && clearColor !== 'transparent') {
+                    var clearColorGradientOrPattern = void 0;
+                    if (isGradientObject(clearColor)) {
+                        var shouldCache = clearColor.global || (clearColor.__width === width
+                            && clearColor.__height === height);
+                        clearColorGradientOrPattern = shouldCache
+                            && clearColor.__canvasGradient
+                            || getCanvasGradient(ctx, clearColor, {
+                                x: 0,
+                                y: 0,
+                                width: width,
+                                height: height
+                            });
+                        clearColor.__canvasGradient = clearColorGradientOrPattern;
+                        clearColor.__width = width;
+                        clearColor.__height = height;
+                    }
+                    else if (isImagePatternObject(clearColor)) {
+                        clearColor.scaleX = clearColor.scaleX || dpr;
+                        clearColor.scaleY = clearColor.scaleY || dpr;
+                        clearColorGradientOrPattern = createCanvasPattern(ctx, clearColor, {
+                            dirty: function () {
+                                self.setUnpainted();
+                                self.painter.refresh();
+                            }
+                        });
+                    }
+                    ctx.save();
+                    ctx.fillStyle = clearColorGradientOrPattern || clearColor;
+                    ctx.fillRect(x, y, width, height);
+                    ctx.restore();
+                }
+                if (haveMotionBLur) {
+                    ctx.save();
+                    ctx.globalAlpha = lastFrameAlpha;
+                    ctx.drawImage(domBack, x, y, width, height);
+                    ctx.restore();
+                }
+            }
+            if (!repaintRects || haveMotionBLur) {
+                doClear(0, 0, width, height);
+            }
+            else if (repaintRects.length) {
+                each(repaintRects, function (rect) {
+                    doClear(rect.x * dpr, rect.y * dpr, rect.width * dpr, rect.height * dpr);
+                });
+            }
+        };
+        return Layer;
+    }(Eventful));
+
+    var HOVER_LAYER_ZLEVEL = 1e5;
+    var CANVAS_ZLEVEL = 314159;
+    var EL_AFTER_INCREMENTAL_INC = 0.01;
+    var INCREMENTAL_INC = 0.001;
+    function isLayerValid(layer) {
+        if (!layer) {
+            return false;
+        }
+        if (layer.__builtin__) {
+            return true;
+        }
+        if (typeof (layer.resize) !== 'function'
+            || typeof (layer.refresh) !== 'function') {
+            return false;
+        }
+        return true;
+    }
+    function createRoot(width, height) {
+        var domRoot = document.createElement('div');
+        domRoot.style.cssText = [
+            'position:relative',
+            'width:' + width + 'px',
+            'height:' + height + 'px',
+            'padding:0',
+            'margin:0',
+            'border-width:0'
+        ].join(';') + ';';
+        return domRoot;
+    }
+    var CanvasPainter = (function () {
+        function CanvasPainter(root, storage, opts, id) {
+            this.type = 'canvas';
+            this._zlevelList = [];
+            this._prevDisplayList = [];
+            this._layers = {};
+            this._layerConfig = {};
+            this._needsManuallyCompositing = false;
+            this.type = 'canvas';
+            var singleCanvas = !root.nodeName
+                || root.nodeName.toUpperCase() === 'CANVAS';
+            this._opts = opts = extend({}, opts || {});
+            this.dpr = opts.devicePixelRatio || devicePixelRatio;
+            this._singleCanvas = singleCanvas;
+            this.root = root;
+            var rootStyle = root.style;
+            if (rootStyle) {
+                disableUserSelect(root);
+                root.innerHTML = '';
+            }
+            this.storage = storage;
+            var zlevelList = this._zlevelList;
+            this._prevDisplayList = [];
+            var layers = this._layers;
+            if (!singleCanvas) {
+                this._width = getSize(root, 0, opts);
+                this._height = getSize(root, 1, opts);
+                var domRoot = this._domRoot = createRoot(this._width, this._height);
+                root.appendChild(domRoot);
+            }
+            else {
+                var rootCanvas = root;
+                var width = rootCanvas.width;
+                var height = rootCanvas.height;
+                if (opts.width != null) {
+                    width = opts.width;
+                }
+                if (opts.height != null) {
+                    height = opts.height;
+                }
+                this.dpr = opts.devicePixelRatio || 1;
+                rootCanvas.width = width * this.dpr;
+                rootCanvas.height = height * this.dpr;
+                this._width = width;
+                this._height = height;
+                var mainLayer = new Layer(rootCanvas, this, this.dpr);
+                mainLayer.__builtin__ = true;
+                mainLayer.initContext();
+                layers[CANVAS_ZLEVEL] = mainLayer;
+                mainLayer.zlevel = CANVAS_ZLEVEL;
+                zlevelList.push(CANVAS_ZLEVEL);
+                this._domRoot = root;
+            }
+        }
+        CanvasPainter.prototype.getType = function () {
+            return 'canvas';
+        };
+        CanvasPainter.prototype.isSingleCanvas = function () {
+            return this._singleCanvas;
+        };
+        CanvasPainter.prototype.getViewportRoot = function () {
+            return this._domRoot;
+        };
+        CanvasPainter.prototype.getViewportRootOffset = function () {
+            var viewportRoot = this.getViewportRoot();
+            if (viewportRoot) {
+                return {
+                    offsetLeft: viewportRoot.offsetLeft || 0,
+                    offsetTop: viewportRoot.offsetTop || 0
+                };
+            }
+        };
+        CanvasPainter.prototype.refresh = function (paintAll) {
+            var list = this.storage.getDisplayList(true);
+            var prevList = this._prevDisplayList;
+            var zlevelList = this._zlevelList;
+            this._redrawId = Math.random();
+            this._paintList(list, prevList, paintAll, this._redrawId);
+            for (var i = 0; i < zlevelList.length; i++) {
+                var z = zlevelList[i];
+                var layer = this._layers[z];
+                if (!layer.__builtin__ && layer.refresh) {
+                    var clearColor = i === 0 ? this._backgroundColor : null;
+                    layer.refresh(clearColor);
+                }
+            }
+            if (this._opts.useDirtyRect) {
+                this._prevDisplayList = list.slice();
+            }
+            return this;
+        };
+        CanvasPainter.prototype.refreshHover = function () {
+            this._paintHoverList(this.storage.getDisplayList(false));
+        };
+        CanvasPainter.prototype._paintHoverList = function (list) {
+            var len = list.length;
+            var hoverLayer = this._hoverlayer;
+            hoverLayer && hoverLayer.clear();
+            if (!len) {
+                return;
+            }
+            var scope = {
+                inHover: true,
+                viewWidth: this._width,
+                viewHeight: this._height
+            };
+            var ctx;
+            for (var i = 0; i < len; i++) {
+                var el = list[i];
+                if (el.__inHover) {
+                    if (!hoverLayer) {
+                        hoverLayer = this._hoverlayer = this.getLayer(HOVER_LAYER_ZLEVEL);
+                    }
+                    if (!ctx) {
+                        ctx = hoverLayer.ctx;
+                        ctx.save();
+                    }
+                    brush(ctx, el, scope, i === len - 1);
+                }
+            }
+            if (ctx) {
+                ctx.restore();
+            }
+        };
+        CanvasPainter.prototype.getHoverLayer = function () {
+            return this.getLayer(HOVER_LAYER_ZLEVEL);
+        };
+        CanvasPainter.prototype.paintOne = function (ctx, el) {
+            brushSingle(ctx, el);
+        };
+        CanvasPainter.prototype._paintList = function (list, prevList, paintAll, redrawId) {
+            if (this._redrawId !== redrawId) {
+                return;
+            }
+            paintAll = paintAll || false;
+            this._updateLayerStatus(list);
+            var _a = this._doPaintList(list, prevList, paintAll), finished = _a.finished, needsRefreshHover = _a.needsRefreshHover;
+            if (this._needsManuallyCompositing) {
+                this._compositeManually();
+            }
+            if (needsRefreshHover) {
+                this._paintHoverList(list);
+            }
+            if (!finished) {
+                var self_1 = this;
+                requestAnimationFrame$1(function () {
+                    self_1._paintList(list, prevList, paintAll, redrawId);
+                });
+            }
+            else {
+                this.eachLayer(function (layer) {
+                    layer.afterBrush && layer.afterBrush();
+                });
+            }
+        };
+        CanvasPainter.prototype._compositeManually = function () {
+            var ctx = this.getLayer(CANVAS_ZLEVEL).ctx;
+            var width = this._domRoot.width;
+            var height = this._domRoot.height;
+            ctx.clearRect(0, 0, width, height);
+            this.eachBuiltinLayer(function (layer) {
+                if (layer.virtual) {
+                    ctx.drawImage(layer.dom, 0, 0, width, height);
+                }
+            });
+        };
+        CanvasPainter.prototype._doPaintList = function (list, prevList, paintAll) {
+            var _this = this;
+            var layerList = [];
+            var useDirtyRect = this._opts.useDirtyRect;
+            for (var zi = 0; zi < this._zlevelList.length; zi++) {
+                var zlevel = this._zlevelList[zi];
+                var layer = this._layers[zlevel];
+                if (layer.__builtin__
+                    && layer !== this._hoverlayer
+                    && (layer.__dirty || paintAll)) {
+                    layerList.push(layer);
+                }
+            }
+            var finished = true;
+            var needsRefreshHover = false;
+            var _loop_1 = function (k) {
+                var layer = layerList[k];
+                var ctx = layer.ctx;
+                var repaintRects = useDirtyRect
+                    && layer.createRepaintRects(list, prevList, this_1._width, this_1._height);
+                var start = paintAll ? layer.__startIndex : layer.__drawIndex;
+                var useTimer = !paintAll && layer.incremental && Date.now;
+                var startTime = useTimer && Date.now();
+                var clearColor = layer.zlevel === this_1._zlevelList[0]
+                    ? this_1._backgroundColor : null;
+                if (layer.__startIndex === layer.__endIndex) {
+                    layer.clear(false, clearColor, repaintRects);
+                }
+                else if (start === layer.__startIndex) {
+                    var firstEl = list[start];
+                    if (!firstEl.incremental || !firstEl.notClear || paintAll) {
+                        layer.clear(false, clearColor, repaintRects);
+                    }
+                }
+                if (start === -1) {
+                    console.error('For some unknown reason. drawIndex is -1');
+                    start = layer.__startIndex;
+                }
+                var i;
+                var repaint = function (repaintRect) {
+                    var scope = {
+                        inHover: false,
+                        allClipped: false,
+                        prevEl: null,
+                        viewWidth: _this._width,
+                        viewHeight: _this._height
+                    };
+                    for (i = start; i < layer.__endIndex; i++) {
+                        var el = list[i];
+                        if (el.__inHover) {
+                            needsRefreshHover = true;
+                        }
+                        _this._doPaintEl(el, layer, useDirtyRect, repaintRect, scope, i === layer.__endIndex - 1);
+                        if (useTimer) {
+                            var dTime = Date.now() - startTime;
+                            if (dTime > 15) {
+                                break;
+                            }
+                        }
+                    }
+                    if (scope.prevElClipPaths) {
+                        ctx.restore();
+                    }
+                };
+                if (repaintRects) {
+                    if (repaintRects.length === 0) {
+                        i = layer.__endIndex;
+                    }
+                    else {
+                        var dpr = this_1.dpr;
+                        for (var r = 0; r < repaintRects.length; ++r) {
+                            var rect = repaintRects[r];
+                            ctx.save();
+                            ctx.beginPath();
+                            ctx.rect(rect.x * dpr, rect.y * dpr, rect.width * dpr, rect.height * dpr);
+                            ctx.clip();
+                            repaint(rect);
+                            ctx.restore();
+                        }
+                    }
+                }
+                else {
+                    ctx.save();
+                    repaint();
+                    ctx.restore();
+                }
+                layer.__drawIndex = i;
+                if (layer.__drawIndex < layer.__endIndex) {
+                    finished = false;
+                }
+            };
+            var this_1 = this;
+            for (var k = 0; k < layerList.length; k++) {
+                _loop_1(k);
+            }
+            if (env.wxa) {
+                each(this._layers, function (layer) {
+                    if (layer && layer.ctx && layer.ctx.draw) {
+                        layer.ctx.draw();
+                    }
+                });
+            }
+            return {
+                finished: finished,
+                needsRefreshHover: needsRefreshHover
+            };
+        };
+        CanvasPainter.prototype._doPaintEl = function (el, currentLayer, useDirtyRect, repaintRect, scope, isLast) {
+            var ctx = currentLayer.ctx;
+            if (useDirtyRect) {
+                var paintRect = el.getPaintRect();
+                if (!repaintRect || paintRect && paintRect.intersect(repaintRect)) {
+                    brush(ctx, el, scope, isLast);
+                    el.setPrevPaintRect(paintRect);
+                }
+            }
+            else {
+                brush(ctx, el, scope, isLast);
+            }
+        };
+        CanvasPainter.prototype.getLayer = function (zlevel, virtual) {
+            if (this._singleCanvas && !this._needsManuallyCompositing) {
+                zlevel = CANVAS_ZLEVEL;
+            }
+            var layer = this._layers[zlevel];
+            if (!layer) {
+                layer = new Layer('zr_' + zlevel, this, this.dpr);
+                layer.zlevel = zlevel;
+                layer.__builtin__ = true;
+                if (this._layerConfig[zlevel]) {
+                    merge(layer, this._layerConfig[zlevel], true);
+                }
+                else if (this._layerConfig[zlevel - EL_AFTER_INCREMENTAL_INC]) {
+                    merge(layer, this._layerConfig[zlevel - EL_AFTER_INCREMENTAL_INC], true);
+                }
+                if (virtual) {
+                    layer.virtual = virtual;
+                }
+                this.insertLayer(zlevel, layer);
+                layer.initContext();
+            }
+            return layer;
+        };
+        CanvasPainter.prototype.insertLayer = function (zlevel, layer) {
+            var layersMap = this._layers;
+            var zlevelList = this._zlevelList;
+            var len = zlevelList.length;
+            var domRoot = this._domRoot;
+            var prevLayer = null;
+            var i = -1;
+            if (layersMap[zlevel]) {
+                {
+                    logError('ZLevel ' + zlevel + ' has been used already');
+                }
+                return;
+            }
+            if (!isLayerValid(layer)) {
+                {
+                    logError('Layer of zlevel ' + zlevel + ' is not valid');
+                }
+                return;
+            }
+            if (len > 0 && zlevel > zlevelList[0]) {
+                for (i = 0; i < len - 1; i++) {
+                    if (zlevelList[i] < zlevel
+                        && zlevelList[i + 1] > zlevel) {
+                        break;
+                    }
+                }
+                prevLayer = layersMap[zlevelList[i]];
+            }
+            zlevelList.splice(i + 1, 0, zlevel);
+            layersMap[zlevel] = layer;
+            if (!layer.virtual) {
+                if (prevLayer) {
+                    var prevDom = prevLayer.dom;
+                    if (prevDom.nextSibling) {
+                        domRoot.insertBefore(layer.dom, prevDom.nextSibling);
+                    }
+                    else {
+                        domRoot.appendChild(layer.dom);
+                    }
+                }
+                else {
+                    if (domRoot.firstChild) {
+                        domRoot.insertBefore(layer.dom, domRoot.firstChild);
+                    }
+                    else {
+                        domRoot.appendChild(layer.dom);
+                    }
+                }
+            }
+            layer.painter || (layer.painter = this);
+        };
+        CanvasPainter.prototype.eachLayer = function (cb, context) {
+            var zlevelList = this._zlevelList;
+            for (var i = 0; i < zlevelList.length; i++) {
+                var z = zlevelList[i];
+                cb.call(context, this._layers[z], z);
+            }
+        };
+        CanvasPainter.prototype.eachBuiltinLayer = function (cb, context) {
+            var zlevelList = this._zlevelList;
+            for (var i = 0; i < zlevelList.length; i++) {
+                var z = zlevelList[i];
+                var layer = this._layers[z];
+                if (layer.__builtin__) {
+                    cb.call(context, layer, z);
+                }
+            }
+        };
+        CanvasPainter.prototype.eachOtherLayer = function (cb, context) {
+            var zlevelList = this._zlevelList;
+            for (var i = 0; i < zlevelList.length; i++) {
+                var z = zlevelList[i];
+                var layer = this._layers[z];
+                if (!layer.__builtin__) {
+                    cb.call(context, layer, z);
+                }
+            }
+        };
+        CanvasPainter.prototype.getLayers = function () {
+            return this._layers;
+        };
+        CanvasPainter.prototype._updateLayerStatus = function (list) {
+            this.eachBuiltinLayer(function (layer, z) {
+                layer.__dirty = layer.__used = false;
+            });
+            function updatePrevLayer(idx) {
+                if (prevLayer) {
+                    if (prevLayer.__endIndex !== idx) {
+                        prevLayer.__dirty = true;
+                    }
+                    prevLayer.__endIndex = idx;
+                }
+            }
+            if (this._singleCanvas) {
+                for (var i_1 = 1; i_1 < list.length; i_1++) {
+                    var el = list[i_1];
+                    if (el.zlevel !== list[i_1 - 1].zlevel || el.incremental) {
+                        this._needsManuallyCompositing = true;
+                        break;
+                    }
+                }
+            }
+            var prevLayer = null;
+            var incrementalLayerCount = 0;
+            var prevZlevel;
+            var i;
+            for (i = 0; i < list.length; i++) {
+                var el = list[i];
+                var zlevel = el.zlevel;
+                var layer = void 0;
+                if (prevZlevel !== zlevel) {
+                    prevZlevel = zlevel;
+                    incrementalLayerCount = 0;
+                }
+                if (el.incremental) {
+                    layer = this.getLayer(zlevel + INCREMENTAL_INC, this._needsManuallyCompositing);
+                    layer.incremental = true;
+                    incrementalLayerCount = 1;
+                }
+                else {
+                    layer = this.getLayer(zlevel + (incrementalLayerCount > 0 ? EL_AFTER_INCREMENTAL_INC : 0), this._needsManuallyCompositing);
+                }
+                if (!layer.__builtin__) {
+                    logError('ZLevel ' + zlevel + ' has been used by unkown layer ' + layer.id);
+                }
+                if (layer !== prevLayer) {
+                    layer.__used = true;
+                    if (layer.__startIndex !== i) {
+                        layer.__dirty = true;
+                    }
+                    layer.__startIndex = i;
+                    if (!layer.incremental) {
+                        layer.__drawIndex = i;
+                    }
+                    else {
+                        layer.__drawIndex = -1;
+                    }
+                    updatePrevLayer(i);
+                    prevLayer = layer;
+                }
+                if ((el.__dirty & REDRAW_BIT) && !el.__inHover) {
+                    layer.__dirty = true;
+                    if (layer.incremental && layer.__drawIndex < 0) {
+                        layer.__drawIndex = i;
+                    }
+                }
+            }
+            updatePrevLayer(i);
+            this.eachBuiltinLayer(function (layer, z) {
+                if (!layer.__used && layer.getElementCount() > 0) {
+                    layer.__dirty = true;
+                    layer.__startIndex = layer.__endIndex = layer.__drawIndex = 0;
+                }
+                if (layer.__dirty && layer.__drawIndex < 0) {
+                    layer.__drawIndex = layer.__startIndex;
+                }
+            });
+        };
+        CanvasPainter.prototype.clear = function () {
+            this.eachBuiltinLayer(this._clearLayer);
+            return this;
+        };
+        CanvasPainter.prototype._clearLayer = function (layer) {
+            layer.clear();
+        };
+        CanvasPainter.prototype.setBackgroundColor = function (backgroundColor) {
+            this._backgroundColor = backgroundColor;
+            each(this._layers, function (layer) {
+                layer.setUnpainted();
+            });
+        };
+        CanvasPainter.prototype.configLayer = function (zlevel, config) {
+            if (config) {
+                var layerConfig = this._layerConfig;
+                if (!layerConfig[zlevel]) {
+                    layerConfig[zlevel] = config;
+                }
+                else {
+                    merge(layerConfig[zlevel], config, true);
+                }
+                for (var i = 0; i < this._zlevelList.length; i++) {
+                    var _zlevel = this._zlevelList[i];
+                    if (_zlevel === zlevel || _zlevel === zlevel + EL_AFTER_INCREMENTAL_INC) {
+                        var layer = this._layers[_zlevel];
+                        merge(layer, layerConfig[zlevel], true);
+                    }
+                }
+            }
+        };
+        CanvasPainter.prototype.delLayer = function (zlevel) {
+            var layers = this._layers;
+            var zlevelList = this._zlevelList;
+            var layer = layers[zlevel];
+            if (!layer) {
+                return;
+            }
+            layer.dom.parentNode.removeChild(layer.dom);
+            delete layers[zlevel];
+            zlevelList.splice(indexOf(zlevelList, zlevel), 1);
+        };
+        CanvasPainter.prototype.resize = function (width, height) {
+            if (!this._domRoot.style) {
+                if (width == null || height == null) {
+                    return;
+                }
+                this._width = width;
+                this._height = height;
+                this.getLayer(CANVAS_ZLEVEL).resize(width, height);
+            }
+            else {
+                var domRoot = this._domRoot;
+                domRoot.style.display = 'none';
+                var opts = this._opts;
+                var root = this.root;
+                width != null && (opts.width = width);
+                height != null && (opts.height = height);
+                width = getSize(root, 0, opts);
+                height = getSize(root, 1, opts);
+                domRoot.style.display = '';
+                if (this._width !== width || height !== this._height) {
+                    domRoot.style.width = width + 'px';
+                    domRoot.style.height = height + 'px';
+                    for (var id in this._layers) {
+                        if (this._layers.hasOwnProperty(id)) {
+                            this._layers[id].resize(width, height);
+                        }
+                    }
+                    this.refresh(true);
+                }
+                this._width = width;
+                this._height = height;
+            }
+            return this;
+        };
+        CanvasPainter.prototype.clearLayer = function (zlevel) {
+            var layer = this._layers[zlevel];
+            if (layer) {
+                layer.clear();
+            }
+        };
+        CanvasPainter.prototype.dispose = function () {
+            this.root.innerHTML = '';
+            this.root =
+                this.storage =
+                    this._domRoot =
+                        this._layers = null;
+        };
+        CanvasPainter.prototype.getRenderedCanvas = function (opts) {
+            opts = opts || {};
+            if (this._singleCanvas && !this._compositeManually) {
+                return this._layers[CANVAS_ZLEVEL].dom;
+            }
+            var imageLayer = new Layer('image', this, opts.pixelRatio || this.dpr);
+            imageLayer.initContext();
+            imageLayer.clear(false, opts.backgroundColor || this._backgroundColor);
+            var ctx = imageLayer.ctx;
+            if (opts.pixelRatio <= this.dpr) {
+                this.refresh();
+                var width_1 = imageLayer.dom.width;
+                var height_1 = imageLayer.dom.height;
+                this.eachLayer(function (layer) {
+                    if (layer.__builtin__) {
+                        ctx.drawImage(layer.dom, 0, 0, width_1, height_1);
+                    }
+                    else if (layer.renderToCanvas) {
+                        ctx.save();
+                        layer.renderToCanvas(ctx);
+                        ctx.restore();
+                    }
+                });
+            }
+            else {
+                var scope = {
+                    inHover: false,
+                    viewWidth: this._width,
+                    viewHeight: this._height
+                };
+                var displayList = this.storage.getDisplayList(true);
+                for (var i = 0, len = displayList.length; i < len; i++) {
+                    var el = displayList[i];
+                    brush(ctx, el, scope, i === len - 1);
+                }
+            }
+            return imageLayer.dom;
+        };
+        CanvasPainter.prototype.getWidth = function () {
+            return this._width;
+        };
+        CanvasPainter.prototype.getHeight = function () {
+            return this._height;
+        };
+        return CanvasPainter;
+    }());
+
+    var mathSin$4 = Math.sin;
+    var mathCos$4 = Math.cos;
+    var PI$5 = Math.PI;
+    var PI2$6 = Math.PI * 2;
+    var degree = 180 / PI$5;
+    var SVGPathRebuilder = (function () {
+        function SVGPathRebuilder() {
+        }
+        SVGPathRebuilder.prototype.reset = function (precision) {
+            this._start = true;
+            this._d = [];
+            this._str = '';
+            this._p = Math.pow(10, precision || 4);
+        };
+        SVGPathRebuilder.prototype.moveTo = function (x, y) {
+            this._add('M', x, y);
+        };
+        SVGPathRebuilder.prototype.lineTo = function (x, y) {
+            this._add('L', x, y);
+        };
+        SVGPathRebuilder.prototype.bezierCurveTo = function (x, y, x2, y2, x3, y3) {
+            this._add('C', x, y, x2, y2, x3, y3);
+        };
+        SVGPathRebuilder.prototype.quadraticCurveTo = function (x, y, x2, y2) {
+            this._add('Q', x, y, x2, y2);
+        };
+        SVGPathRebuilder.prototype.arc = function (cx, cy, r, startAngle, endAngle, anticlockwise) {
+            this.ellipse(cx, cy, r, r, 0, startAngle, endAngle, anticlockwise);
+        };
+        SVGPathRebuilder.prototype.ellipse = function (cx, cy, rx, ry, psi, startAngle, endAngle, anticlockwise) {
+            var dTheta = endAngle - startAngle;
+            var clockwise = !anticlockwise;
+            var dThetaPositive = Math.abs(dTheta);
+            var isCircle = isAroundZero$1(dThetaPositive - PI2$6)
+                || (clockwise ? dTheta >= PI2$6 : -dTheta >= PI2$6);
+            var unifiedTheta = dTheta > 0 ? dTheta % PI2$6 : (dTheta % PI2$6 + PI2$6);
+            var large = false;
+            if (isCircle) {
+                large = true;
+            }
+            else if (isAroundZero$1(dThetaPositive)) {
+                large = false;
+            }
+            else {
+                large = (unifiedTheta >= PI$5) === !!clockwise;
+            }
+            var x0 = cx + rx * mathCos$4(startAngle);
+            var y0 = cy + ry * mathSin$4(startAngle);
+            if (this._start) {
+                this._add('M', x0, y0);
+            }
+            var xRot = Math.round(psi * degree);
+            if (isCircle) {
+                var p = 1 / this._p;
+                var dTheta_1 = (clockwise ? 1 : -1) * (PI2$6 - p);
+                this._add('A', rx, ry, xRot, 1, +clockwise, cx + rx * mathCos$4(startAngle + dTheta_1), cy + ry * mathSin$4(startAngle + dTheta_1));
+                if (p > 1e-2) {
+                    this._add('A', rx, ry, xRot, 0, +clockwise, x0, y0);
+                }
+            }
+            else {
+                var x = cx + rx * mathCos$4(endAngle);
+                var y = cy + ry * mathSin$4(endAngle);
+                this._add('A', rx, ry, xRot, +large, +clockwise, x, y);
+            }
+        };
+        SVGPathRebuilder.prototype.rect = function (x, y, w, h) {
+            this._add('M', x, y);
+            this._add('l', w, 0);
+            this._add('l', 0, h);
+            this._add('l', -w, 0);
+            this._add('Z');
+        };
+        SVGPathRebuilder.prototype.closePath = function () {
+            if (this._d.length > 0) {
+                this._add('Z');
+            }
+        };
+        SVGPathRebuilder.prototype._add = function (cmd, a, b, c, d, e, f, g, h) {
+            var vals = [];
+            var p = this._p;
+            for (var i = 1; i < arguments.length; i++) {
+                var val = arguments[i];
+                if (isNaN(val)) {
+                    this._invalid = true;
+                    return;
+                }
+                vals.push(Math.round(val * p) / p);
+            }
+            this._d.push(cmd + vals.join(' '));
+            this._start = cmd === 'Z';
+        };
+        SVGPathRebuilder.prototype.generateStr = function () {
+            this._str = this._invalid ? '' : this._d.join('');
+            this._d = [];
+        };
+        SVGPathRebuilder.prototype.getStr = function () {
+            return this._str;
+        };
+        return SVGPathRebuilder;
+    }());
+
+    var NONE = 'none';
+    var mathRound$1 = Math.round;
+    function pathHasFill(style) {
+        var fill = style.fill;
+        return fill != null && fill !== NONE;
+    }
+    function pathHasStroke(style) {
+        var stroke = style.stroke;
+        return stroke != null && stroke !== NONE;
+    }
+    var strokeProps = ['lineCap', 'miterLimit', 'lineJoin'];
+    var svgStrokeProps = map(strokeProps, function (prop) { return "stroke-" + prop.toLowerCase(); });
+    function mapStyleToAttrs(updateAttr, style, el, forceUpdate) {
+        var opacity = style.opacity == null ? 1 : style.opacity;
+        if (el instanceof ZRImage) {
+            updateAttr('opacity', opacity);
+            return;
+        }
+        if (pathHasFill(style)) {
+            var fill = normalizeColor(style.fill);
+            updateAttr('fill', fill.color);
+            var fillOpacity = style.fillOpacity != null
+                ? style.fillOpacity * fill.opacity * opacity
+                : fill.opacity * opacity;
+            if (forceUpdate || fillOpacity < 1) {
+                updateAttr('fill-opacity', fillOpacity);
+            }
+        }
+        else {
+            updateAttr('fill', NONE);
+        }
+        if (pathHasStroke(style)) {
+            var stroke = normalizeColor(style.stroke);
+            updateAttr('stroke', stroke.color);
+            var strokeScale = style.strokeNoScale
+                ? el.getLineScale()
+                : 1;
+            var strokeWidth = (strokeScale ? (style.lineWidth || 0) / strokeScale : 0);
+            var strokeOpacity = style.strokeOpacity != null
+                ? style.strokeOpacity * stroke.opacity * opacity
+                : stroke.opacity * opacity;
+            var strokeFirst = style.strokeFirst;
+            if (forceUpdate || strokeWidth !== 1) {
+                updateAttr('stroke-width', strokeWidth);
+            }
+            if (forceUpdate || strokeFirst) {
+                updateAttr('paint-order', strokeFirst ? 'stroke' : 'fill');
+            }
+            if (forceUpdate || strokeOpacity < 1) {
+                updateAttr('stroke-opacity', strokeOpacity);
+            }
+            if (style.lineDash) {
+                var _a = getLineDash(el), lineDash = _a[0], lineDashOffset = _a[1];
+                if (lineDash) {
+                    lineDashOffset = mathRound$1(lineDashOffset || 0);
+                    updateAttr('stroke-dasharray', lineDash.join(','));
+                    if (lineDashOffset || forceUpdate) {
+                        updateAttr('stroke-dashoffset', lineDashOffset);
+                    }
+                }
+            }
+            else if (forceUpdate) {
+                updateAttr('stroke-dasharray', NONE);
+            }
+            for (var i = 0; i < strokeProps.length; i++) {
+                var propName = strokeProps[i];
+                if (forceUpdate || style[propName] !== DEFAULT_PATH_STYLE[propName]) {
+                    var val = style[propName] || DEFAULT_PATH_STYLE[propName];
+                    val && updateAttr(svgStrokeProps[i], val);
+                }
+            }
+        }
+        else if (forceUpdate) {
+            updateAttr('stroke', NONE);
+        }
+    }
+
+    var SVGNS = 'http://www.w3.org/2000/svg';
+    var XLINKNS = 'http://www.w3.org/1999/xlink';
+    var XMLNS = 'http://www.w3.org/2000/xmlns/';
+    var XML_NAMESPACE = 'http://www.w3.org/XML/1998/namespace';
+    var META_DATA_PREFIX = 'ecmeta_';
+    function createElement(name) {
+        return document.createElementNS(SVGNS, name);
+    }
+    function createVNode(tag, key, attrs, children, text) {
+        return {
+            tag: tag,
+            attrs: attrs || {},
+            children: children,
+            text: text,
+            key: key
+        };
+    }
+    function createElementOpen(name, attrs) {
+        var attrsStr = [];
+        if (attrs) {
+            for (var key in attrs) {
+                var val = attrs[key];
+                var part = key;
+                if (val === false) {
+                    continue;
+                }
+                else if (val !== true && val != null) {
+                    part += "=\"" + val + "\"";
+                }
+                attrsStr.push(part);
+            }
+        }
+        return "<" + name + " " + attrsStr.join(' ') + ">";
+    }
+    function createElementClose(name) {
+        return "</" + name + ">";
+    }
+    function vNodeToString(el, opts) {
+        opts = opts || {};
+        var S = opts.newline ? '\n' : '';
+        function convertElToString(el) {
+            var children = el.children, tag = el.tag, attrs = el.attrs, text = el.text;
+            return createElementOpen(tag, attrs)
+                + (tag !== 'style' ? encodeHTML(text) : text || '')
+                + (children ? "" + S + map(children, function (child) { return convertElToString(child); }).join(S) + S : '')
+                + createElementClose(tag);
+        }
+        return convertElToString(el);
+    }
+    function getCssString(selectorNodes, animationNodes, opts) {
+        opts = opts || {};
+        var S = opts.newline ? '\n' : '';
+        var bracketBegin = " {" + S;
+        var bracketEnd = S + "}";
+        var selectors = map(keys(selectorNodes), function (className) {
+            return className + bracketBegin + map(keys(selectorNodes[className]), function (attrName) {
+                return attrName + ":" + selectorNodes[className][attrName] + ";";
+            }).join(S) + bracketEnd;
+        }).join(S);
+        var animations = map(keys(animationNodes), function (animationName) {
+            return "@keyframes " + animationName + bracketBegin + map(keys(animationNodes[animationName]), function (percent) {
+                return percent + bracketBegin + map(keys(animationNodes[animationName][percent]), function (attrName) {
+                    var val = animationNodes[animationName][percent][attrName];
+                    if (attrName === 'd') {
+                        val = "path(\"" + val + "\")";
+                    }
+                    return attrName + ":" + val + ";";
+                }).join(S) + bracketEnd;
+            }).join(S) + bracketEnd;
+        }).join(S);
+        if (!selectors && !animations) {
+            return '';
+        }
+        return ['<![CDATA[', selectors, animations, ']]>'].join(S);
+    }
+    function createBrushScope(zrId) {
+        return {
+            zrId: zrId,
+            shadowCache: {},
+            patternCache: {},
+            gradientCache: {},
+            clipPathCache: {},
+            defs: {},
+            cssNodes: {},
+            cssAnims: {},
+            cssStyleCache: {},
+            cssAnimIdx: 0,
+            shadowIdx: 0,
+            gradientIdx: 0,
+            patternIdx: 0,
+            clipPathIdx: 0
+        };
+    }
+    function createSVGVNode(width, height, children, useViewBox) {
+        return createVNode('svg', 'root', {
+            'width': width,
+            'height': height,
+            'xmlns': SVGNS,
+            'xmlns:xlink': XLINKNS,
+            'version': '1.1',
+            'baseProfile': 'full',
+            'viewBox': useViewBox ? "0 0 " + width + " " + height : false
+        }, children);
+    }
+
+    var cssClassIdx = 0;
+    function getClassId() {
+        return cssClassIdx++;
+    }
+
+    var EASING_MAP = {
+        cubicIn: '0.32,0,0.67,0',
+        cubicOut: '0.33,1,0.68,1',
+        cubicInOut: '0.65,0,0.35,1',
+        quadraticIn: '0.11,0,0.5,0',
+        quadraticOut: '0.5,1,0.89,1',
+        quadraticInOut: '0.45,0,0.55,1',
+        quarticIn: '0.5,0,0.75,0',
+        quarticOut: '0.25,1,0.5,1',
+        quarticInOut: '0.76,0,0.24,1',
+        quinticIn: '0.64,0,0.78,0',
+        quinticOut: '0.22,1,0.36,1',
+        quinticInOut: '0.83,0,0.17,1',
+        sinusoidalIn: '0.12,0,0.39,0',
+        sinusoidalOut: '0.61,1,0.88,1',
+        sinusoidalInOut: '0.37,0,0.63,1',
+        exponentialIn: '0.7,0,0.84,0',
+        exponentialOut: '0.16,1,0.3,1',
+        exponentialInOut: '0.87,0,0.13,1',
+        circularIn: '0.55,0,1,0.45',
+        circularOut: '0,0.55,0.45,1',
+        circularInOut: '0.85,0,0.15,1'
+    };
+    var transformOriginKey = 'transform-origin';
+    function buildPathString(el, kfShape, path) {
+        var shape = extend({}, el.shape);
+        extend(shape, kfShape);
+        el.buildPath(path, shape);
+        var svgPathBuilder = new SVGPathRebuilder();
+        svgPathBuilder.reset(getPathPrecision(el));
+        path.rebuildPath(svgPathBuilder, 1);
+        svgPathBuilder.generateStr();
+        return svgPathBuilder.getStr();
+    }
+    function setTransformOrigin(target, transform) {
+        var originX = transform.originX, originY = transform.originY;
+        if (originX || originY) {
+            target[transformOriginKey] = originX + "px " + originY + "px";
+        }
+    }
+    var ANIMATE_STYLE_MAP = {
+        fill: 'fill',
+        opacity: 'opacity',
+        lineWidth: 'stroke-width',
+        lineDashOffset: 'stroke-dashoffset'
+    };
+    function addAnimation(cssAnim, scope) {
+        var animationName = scope.zrId + '-ani-' + scope.cssAnimIdx++;
+        scope.cssAnims[animationName] = cssAnim;
+        return animationName;
+    }
+    function createCompoundPathCSSAnimation(el, attrs, scope) {
+        var paths = el.shape.paths;
+        var composedAnim = {};
+        var cssAnimationCfg;
+        var cssAnimationName;
+        each(paths, function (path) {
+            var subScope = createBrushScope(scope.zrId);
+            subScope.animation = true;
+            createCSSAnimation(path, {}, subScope, true);
+            var cssAnims = subScope.cssAnims;
+            var cssNodes = subScope.cssNodes;
+            var animNames = keys(cssAnims);
+            var len = animNames.length;
+            if (!len) {
+                return;
+            }
+            cssAnimationName = animNames[len - 1];
+            var lastAnim = cssAnims[cssAnimationName];
+            for (var percent in lastAnim) {
+                var kf = lastAnim[percent];
+                composedAnim[percent] = composedAnim[percent] || { d: '' };
+                composedAnim[percent].d += kf.d || '';
+            }
+            for (var className in cssNodes) {
+                var val = cssNodes[className].animation;
+                if (val.indexOf(cssAnimationName) >= 0) {
+                    cssAnimationCfg = val;
+                }
+            }
+        });
+        if (!cssAnimationCfg) {
+            return;
+        }
+        attrs.d = false;
+        var animationName = addAnimation(composedAnim, scope);
+        return cssAnimationCfg.replace(cssAnimationName, animationName);
+    }
+    function getEasingFunc(easing) {
+        return isString(easing)
+            ? EASING_MAP[easing]
+                ? "cubic-bezier(" + EASING_MAP[easing] + ")"
+                : createCubicEasingFunc(easing) ? easing : ''
+            : '';
+    }
+    function createCSSAnimation(el, attrs, scope, onlyShape) {
+        var animators = el.animators;
+        var len = animators.length;
+        var cssAnimations = [];
+        if (el instanceof CompoundPath) {
+            var animationCfg = createCompoundPathCSSAnimation(el, attrs, scope);
+            if (animationCfg) {
+                cssAnimations.push(animationCfg);
+            }
+            else if (!len) {
+                return;
+            }
+        }
+        else if (!len) {
+            return;
+        }
+        var groupAnimators = {};
+        for (var i = 0; i < len; i++) {
+            var animator = animators[i];
+            var cfgArr = [animator.getMaxTime() / 1000 + 's'];
+            var easing = getEasingFunc(animator.getClip().easing);
+            var delay = animator.getDelay();
+            if (easing) {
+                cfgArr.push(easing);
+            }
+            else {
+                cfgArr.push('linear');
+            }
+            if (delay) {
+                cfgArr.push(delay / 1000 + 's');
+            }
+            if (animator.getLoop()) {
+                cfgArr.push('infinite');
+            }
+            var cfg = cfgArr.join(' ');
+            groupAnimators[cfg] = groupAnimators[cfg] || [cfg, []];
+            groupAnimators[cfg][1].push(animator);
+        }
+        function createSingleCSSAnimation(groupAnimator) {
+            var animators = groupAnimator[1];
+            var len = animators.length;
+            var transformKfs = {};
+            var shapeKfs = {};
+            var finalKfs = {};
+            var animationTimingFunctionAttrName = 'animation-timing-function';
+            function saveAnimatorTrackToCssKfs(animator, cssKfs, toCssAttrName) {
+                var tracks = animator.getTracks();
+                var maxTime = animator.getMaxTime();
+                for (var k = 0; k < tracks.length; k++) {
+                    var track = tracks[k];
+                    if (track.needsAnimate()) {
+                        var kfs = track.keyframes;
+                        var attrName = track.propName;
+                        toCssAttrName && (attrName = toCssAttrName(attrName));
+                        if (attrName) {
+                            for (var i = 0; i < kfs.length; i++) {
+                                var kf = kfs[i];
+                                var percent = Math.round(kf.time / maxTime * 100) + '%';
+                                var kfEasing = getEasingFunc(kf.easing);
+                                var rawValue = kf.rawValue;
+                                if (isString(rawValue) || isNumber(rawValue)) {
+                                    cssKfs[percent] = cssKfs[percent] || {};
+                                    cssKfs[percent][attrName] = kf.rawValue;
+                                    if (kfEasing) {
+                                        cssKfs[percent][animationTimingFunctionAttrName] = kfEasing;
+                                    }
+                                }
+                            }
+                        }
+                    }
+                }
+            }
+            for (var i = 0; i < len; i++) {
+                var animator = animators[i];
+                var targetProp = animator.targetName;
+                if (!targetProp) {
+                    !onlyShape && saveAnimatorTrackToCssKfs(animator, transformKfs);
+                }
+                else if (targetProp === 'shape') {
+                    saveAnimatorTrackToCssKfs(animator, shapeKfs);
+                }
+            }
+            for (var percent in transformKfs) {
+                var transform = {};
+                copyTransform(transform, el);
+                extend(transform, transformKfs[percent]);
+                var str = getSRTTransformString(transform);
+                var timingFunction = transformKfs[percent][animationTimingFunctionAttrName];
+                finalKfs[percent] = str ? {
+                    transform: str
+                } : {};
+                setTransformOrigin(finalKfs[percent], transform);
+                if (timingFunction) {
+                    finalKfs[percent][animationTimingFunctionAttrName] = timingFunction;
+                }
+            }
+            var path;
+            var canAnimateShape = true;
+            for (var percent in shapeKfs) {
+                finalKfs[percent] = finalKfs[percent] || {};
+                var isFirst = !path;
+                var timingFunction = shapeKfs[percent][animationTimingFunctionAttrName];
+                if (isFirst) {
+                    path = new PathProxy();
+                }
+                var len_1 = path.len();
+                path.reset();
+                finalKfs[percent].d = buildPathString(el, shapeKfs[percent], path);
+                var newLen = path.len();
+                if (!isFirst && len_1 !== newLen) {
+                    canAnimateShape = false;
+                    break;
+                }
+                if (timingFunction) {
+                    finalKfs[percent][animationTimingFunctionAttrName] = timingFunction;
+                }
+            }
+            if (!canAnimateShape) {
+                for (var percent in finalKfs) {
+                    delete finalKfs[percent].d;
+                }
+            }
+            if (!onlyShape) {
+                for (var i = 0; i < len; i++) {
+                    var animator = animators[i];
+                    var targetProp = animator.targetName;
+                    if (targetProp === 'style') {
+                        saveAnimatorTrackToCssKfs(animator, finalKfs, function (propName) { return ANIMATE_STYLE_MAP[propName]; });
+                    }
+                }
+            }
+            var percents = keys(finalKfs);
+            var allTransformOriginSame = true;
+            var transformOrigin;
+            for (var i = 1; i < percents.length; i++) {
+                var p0 = percents[i - 1];
+                var p1 = percents[i];
+                if (finalKfs[p0][transformOriginKey] !== finalKfs[p1][transformOriginKey]) {
+                    allTransformOriginSame = false;
+                    break;
+                }
+                transformOrigin = finalKfs[p0][transformOriginKey];
+            }
+            if (allTransformOriginSame && transformOrigin) {
+                for (var percent in finalKfs) {
+                    if (finalKfs[percent][transformOriginKey]) {
+                        delete finalKfs[percent][transformOriginKey];
+                    }
+                }
+                attrs[transformOriginKey] = transformOrigin;
+            }
+            if (filter(percents, function (percent) { return keys(finalKfs[percent]).length > 0; }).length) {
+                var animationName = addAnimation(finalKfs, scope);
+                return animationName + " " + groupAnimator[0] + " both";
+            }
+        }
+        for (var key in groupAnimators) {
+            var animationCfg = createSingleCSSAnimation(groupAnimators[key]);
+            if (animationCfg) {
+                cssAnimations.push(animationCfg);
+            }
+        }
+        if (cssAnimations.length) {
+            var className = scope.zrId + '-cls-' + getClassId();
+            scope.cssNodes['.' + className] = {
+                animation: cssAnimations.join(',')
+            };
+            attrs["class"] = className;
+        }
+    }
+
+    function createCSSEmphasis(el, attrs, scope) {
+        if (!el.ignore) {
+            if (el.isSilent()) {
+                var style = {
+                    'pointer-events': 'none'
+                };
+                setClassAttribute(style, attrs, scope, true);
+            }
+            else {
+                var emphasisStyle = el.states.emphasis && el.states.emphasis.style
+                    ? el.states.emphasis.style
+                    : {};
+                var fill = emphasisStyle.fill;
+                if (!fill) {
+                    var normalFill = el.style && el.style.fill;
+                    var selectFill = el.states.select
+                        && el.states.select.style
+                        && el.states.select.style.fill;
+                    var fromFill = el.currentStates.indexOf('select') >= 0
+                        ? (selectFill || normalFill)
+                        : normalFill;
+                    if (fromFill) {
+                        fill = liftColor(fromFill);
+                    }
+                }
+                var lineWidth = emphasisStyle.lineWidth;
+                if (lineWidth) {
+                    var scaleX = (!emphasisStyle.strokeNoScale && el.transform)
+                        ? el.transform[0]
+                        : 1;
+                    lineWidth = lineWidth / scaleX;
+                }
+                var style = {
+                    cursor: 'pointer',
+                };
+                if (fill) {
+                    style.fill = fill;
+                }
+                if (emphasisStyle.stroke) {
+                    style.stroke = emphasisStyle.stroke;
+                }
+                if (lineWidth) {
+                    style['stroke-width'] = lineWidth;
+                }
+                setClassAttribute(style, attrs, scope, true);
+            }
+        }
+    }
+    function setClassAttribute(style, attrs, scope, withHover) {
+        var styleKey = JSON.stringify(style);
+        var className = scope.cssStyleCache[styleKey];
+        if (!className) {
+            className = scope.zrId + '-cls-' + getClassId();
+            scope.cssStyleCache[styleKey] = className;
+            scope.cssNodes['.' + className + (withHover ? ':hover' : '')] = style;
+        }
+        attrs["class"] = attrs["class"] ? (attrs["class"] + ' ' + className) : className;
+    }
+
+    var round$1 = Math.round;
+    function isImageLike$1(val) {
+        return val && isString(val.src);
+    }
+    function isCanvasLike(val) {
+        return val && isFunction(val.toDataURL);
+    }
+    function setStyleAttrs(attrs, style, el, scope) {
+        mapStyleToAttrs(function (key, val) {
+            var isFillStroke = key === 'fill' || key === 'stroke';
+            if (isFillStroke && isGradient(val)) {
+                setGradient(style, attrs, key, scope);
+            }
+            else if (isFillStroke && isPattern(val)) {
+                setPattern(el, attrs, key, scope);
+            }
+            else if (isFillStroke && val === 'none') {
+                attrs[key] = 'transparent';
+            }
+            else {
+                attrs[key] = val;
+            }
+        }, style, el, false);
+        setShadow(el, attrs, scope);
+    }
+    function setMetaData(attrs, el) {
+        var metaData = getElementSSRData(el);
+        if (metaData) {
+            metaData.each(function (val, key) {
+                val != null && (attrs[(META_DATA_PREFIX + key).toLowerCase()] = val + '');
+            });
+            if (el.isSilent()) {
+                attrs[META_DATA_PREFIX + 'silent'] = 'true';
+            }
+        }
+    }
+    function noRotateScale(m) {
+        return isAroundZero$1(m[0] - 1)
+            && isAroundZero$1(m[1])
+            && isAroundZero$1(m[2])
+            && isAroundZero$1(m[3] - 1);
+    }
+    function noTranslate(m) {
+        return isAroundZero$1(m[4]) && isAroundZero$1(m[5]);
+    }
+    function setTransform(attrs, m, compress) {
+        if (m && !(noTranslate(m) && noRotateScale(m))) {
+            var mul = compress ? 10 : 1e4;
+            attrs.transform = noRotateScale(m)
+                ? "translate(" + round$1(m[4] * mul) / mul + " " + round$1(m[5] * mul) / mul + ")" : getMatrixStr(m);
+        }
+    }
+    function convertPolyShape(shape, attrs, mul) {
+        var points = shape.points;
+        var strArr = [];
+        for (var i = 0; i < points.length; i++) {
+            strArr.push(round$1(points[i][0] * mul) / mul);
+            strArr.push(round$1(points[i][1] * mul) / mul);
+        }
+        attrs.points = strArr.join(' ');
+    }
+    function validatePolyShape(shape) {
+        return !shape.smooth;
+    }
+    function createAttrsConvert(desc) {
+        var normalizedDesc = map(desc, function (item) {
+            return (typeof item === 'string' ? [item, item] : item);
+        });
+        return function (shape, attrs, mul) {
+            for (var i = 0; i < normalizedDesc.length; i++) {
+                var item = normalizedDesc[i];
+                var val = shape[item[0]];
+                if (val != null) {
+                    attrs[item[1]] = round$1(val * mul) / mul;
+                }
+            }
+        };
+    }
+    var builtinShapesDef = {
+        circle: [createAttrsConvert(['cx', 'cy', 'r'])],
+        polyline: [convertPolyShape, validatePolyShape],
+        polygon: [convertPolyShape, validatePolyShape]
+    };
+    function hasShapeAnimation(el) {
+        var animators = el.animators;
+        for (var i = 0; i < animators.length; i++) {
+            if (animators[i].targetName === 'shape') {
+                return true;
+            }
+        }
+        return false;
+    }
+    function brushSVGPath(el, scope) {
+        var style = el.style;
+        var shape = el.shape;
+        var builtinShpDef = builtinShapesDef[el.type];
+        var attrs = {};
+        var needsAnimate = scope.animation;
+        var svgElType = 'path';
+        var strokePercent = el.style.strokePercent;
+        var precision = (scope.compress && getPathPrecision(el)) || 4;
+        if (builtinShpDef
+            && !scope.willUpdate
+            && !(builtinShpDef[1] && !builtinShpDef[1](shape))
+            && !(needsAnimate && hasShapeAnimation(el))
+            && !(strokePercent < 1)) {
+            svgElType = el.type;
+            var mul = Math.pow(10, precision);
+            builtinShpDef[0](shape, attrs, mul);
+        }
+        else {
+            var needBuildPath = !el.path || el.shapeChanged();
+            if (!el.path) {
+                el.createPathProxy();
+            }
+            var path = el.path;
+            if (needBuildPath) {
+                path.beginPath();
+                el.buildPath(path, el.shape);
+                el.pathUpdated();
+            }
+            var pathVersion = path.getVersion();
+            var elExt = el;
+            var svgPathBuilder = elExt.__svgPathBuilder;
+            if (elExt.__svgPathVersion !== pathVersion
+                || !svgPathBuilder
+                || strokePercent !== elExt.__svgPathStrokePercent) {
+                if (!svgPathBuilder) {
+                    svgPathBuilder = elExt.__svgPathBuilder = new SVGPathRebuilder();
+                }
+                svgPathBuilder.reset(precision);
+                path.rebuildPath(svgPathBuilder, strokePercent);
+                svgPathBuilder.generateStr();
+                elExt.__svgPathVersion = pathVersion;
+                elExt.__svgPathStrokePercent = strokePercent;
+            }
+            attrs.d = svgPathBuilder.getStr();
+        }
+        setTransform(attrs, el.transform);
+        setStyleAttrs(attrs, style, el, scope);
+        setMetaData(attrs, el);
+        scope.animation && createCSSAnimation(el, attrs, scope);
+        scope.emphasis && createCSSEmphasis(el, attrs, scope);
+        return createVNode(svgElType, el.id + '', attrs);
+    }
+    function brushSVGImage(el, scope) {
+        var style = el.style;
+        var image = style.image;
+        if (image && !isString(image)) {
+            if (isImageLike$1(image)) {
+                image = image.src;
+            }
+            else if (isCanvasLike(image)) {
+                image = image.toDataURL();
+            }
+        }
+        if (!image) {
+            return;
+        }
+        var x = style.x || 0;
+        var y = style.y || 0;
+        var dw = style.width;
+        var dh = style.height;
+        var attrs = {
+            href: image,
+            width: dw,
+            height: dh
+        };
+        if (x) {
+            attrs.x = x;
+        }
+        if (y) {
+            attrs.y = y;
+        }
+        setTransform(attrs, el.transform);
+        setStyleAttrs(attrs, style, el, scope);
+        setMetaData(attrs, el);
+        scope.animation && createCSSAnimation(el, attrs, scope);
+        return createVNode('image', el.id + '', attrs);
+    }
+    function brushSVGTSpan(el, scope) {
+        var style = el.style;
+        var text = style.text;
+        text != null && (text += '');
+        if (!text || isNaN(style.x) || isNaN(style.y)) {
+            return;
+        }
+        var font = style.font || DEFAULT_FONT;
+        var x = style.x || 0;
+        var y = adjustTextY(style.y || 0, getLineHeight(font), style.textBaseline);
+        var textAlign = TEXT_ALIGN_TO_ANCHOR[style.textAlign]
+            || style.textAlign;
+        var attrs = {
+            'dominant-baseline': 'central',
+            'text-anchor': textAlign
+        };
+        if (hasSeparateFont(style)) {
+            var separatedFontStr = '';
+            var fontStyle = style.fontStyle;
+            var fontSize = parseFontSize(style.fontSize);
+            if (!parseFloat(fontSize)) {
+                return;
+            }
+            var fontFamily = style.fontFamily || DEFAULT_FONT_FAMILY;
+            var fontWeight = style.fontWeight;
+            separatedFontStr += "font-size:" + fontSize + ";font-family:" + fontFamily + ";";
+            if (fontStyle && fontStyle !== 'normal') {
+                separatedFontStr += "font-style:" + fontStyle + ";";
+            }
+            if (fontWeight && fontWeight !== 'normal') {
+                separatedFontStr += "font-weight:" + fontWeight + ";";
+            }
+            attrs.style = separatedFontStr;
+        }
+        else {
+            attrs.style = "font: " + font;
+        }
+        if (text.match(/\s/)) {
+            attrs['xml:space'] = 'preserve';
+        }
+        if (x) {
+            attrs.x = x;
+        }
+        if (y) {
+            attrs.y = y;
+        }
+        setTransform(attrs, el.transform);
+        setStyleAttrs(attrs, style, el, scope);
+        setMetaData(attrs, el);
+        scope.animation && createCSSAnimation(el, attrs, scope);
+        return createVNode('text', el.id + '', attrs, undefined, text);
+    }
+    function brush$1(el, scope) {
+        if (el instanceof Path) {
+            return brushSVGPath(el, scope);
+        }
+        else if (el instanceof ZRImage) {
+            return brushSVGImage(el, scope);
+        }
+        else if (el instanceof TSpan) {
+            return brushSVGTSpan(el, scope);
+        }
+    }
+    function setShadow(el, attrs, scope) {
+        var style = el.style;
+        if (hasShadow(style)) {
+            var shadowKey = getShadowKey(el);
+            var shadowCache = scope.shadowCache;
+            var shadowId = shadowCache[shadowKey];
+            if (!shadowId) {
+                var globalScale = el.getGlobalScale();
+                var scaleX = globalScale[0];
+                var scaleY = globalScale[1];
+                if (!scaleX || !scaleY) {
+                    return;
+                }
+                var offsetX = style.shadowOffsetX || 0;
+                var offsetY = style.shadowOffsetY || 0;
+                var blur_1 = style.shadowBlur;
+                var _a = normalizeColor(style.shadowColor), opacity = _a.opacity, color = _a.color;
+                var stdDx = blur_1 / 2 / scaleX;
+                var stdDy = blur_1 / 2 / scaleY;
+                var stdDeviation = stdDx + ' ' + stdDy;
+                shadowId = scope.zrId + '-s' + scope.shadowIdx++;
+                scope.defs[shadowId] = createVNode('filter', shadowId, {
+                    'id': shadowId,
+                    'x': '-100%',
+                    'y': '-100%',
+                    'width': '300%',
+                    'height': '300%'
+                }, [
+                    createVNode('feDropShadow', '', {
+                        'dx': offsetX / scaleX,
+                        'dy': offsetY / scaleY,
+                        'stdDeviation': stdDeviation,
+                        'flood-color': color,
+                        'flood-opacity': opacity
+                    })
+                ]);
+                shadowCache[shadowKey] = shadowId;
+            }
+            attrs.filter = getIdURL(shadowId);
+        }
+    }
+    function setGradient(style, attrs, target, scope) {
+        var val = style[target];
+        var gradientTag;
+        var gradientAttrs = {
+            'gradientUnits': val.global
+                ? 'userSpaceOnUse'
+                : 'objectBoundingBox'
+        };
+        if (isLinearGradient(val)) {
+            gradientTag = 'linearGradient';
+            gradientAttrs.x1 = val.x;
+            gradientAttrs.y1 = val.y;
+            gradientAttrs.x2 = val.x2;
+            gradientAttrs.y2 = val.y2;
+        }
+        else if (isRadialGradient(val)) {
+            gradientTag = 'radialGradient';
+            gradientAttrs.cx = retrieve2(val.x, 0.5);
+            gradientAttrs.cy = retrieve2(val.y, 0.5);
+            gradientAttrs.r = retrieve2(val.r, 0.5);
+        }
+        else {
+            {
+                logError('Illegal gradient type.');
+            }
+            return;
+        }
+        var colors = val.colorStops;
+        var colorStops = [];
+        for (var i = 0, len = colors.length; i < len; ++i) {
+            var offset = round4(colors[i].offset) * 100 + '%';
+            var stopColor = colors[i].color;
+            var _a = normalizeColor(stopColor), color = _a.color, opacity = _a.opacity;
+            var stopsAttrs = {
+                'offset': offset
+            };
+            stopsAttrs['stop-color'] = color;
+            if (opacity < 1) {
+                stopsAttrs['stop-opacity'] = opacity;
+            }
+            colorStops.push(createVNode('stop', i + '', stopsAttrs));
+        }
+        var gradientVNode = createVNode(gradientTag, '', gradientAttrs, colorStops);
+        var gradientKey = vNodeToString(gradientVNode);
+        var gradientCache = scope.gradientCache;
+        var gradientId = gradientCache[gradientKey];
+        if (!gradientId) {
+            gradientId = scope.zrId + '-g' + scope.gradientIdx++;
+            gradientCache[gradientKey] = gradientId;
+            gradientAttrs.id = gradientId;
+            scope.defs[gradientId] = createVNode(gradientTag, gradientId, gradientAttrs, colorStops);
+        }
+        attrs[target] = getIdURL(gradientId);
+    }
+    function setPattern(el, attrs, target, scope) {
+        var val = el.style[target];
+        var boundingRect = el.getBoundingRect();
+        var patternAttrs = {};
+        var repeat = val.repeat;
+        var noRepeat = repeat === 'no-repeat';
+        var repeatX = repeat === 'repeat-x';
+        var repeatY = repeat === 'repeat-y';
+        var child;
+        if (isImagePattern(val)) {
+            var imageWidth_1 = val.imageWidth;
+            var imageHeight_1 = val.imageHeight;
+            var imageSrc = void 0;
+            var patternImage = val.image;
+            if (isString(patternImage)) {
+                imageSrc = patternImage;
+            }
+            else if (isImageLike$1(patternImage)) {
+                imageSrc = patternImage.src;
+            }
+            else if (isCanvasLike(patternImage)) {
+                imageSrc = patternImage.toDataURL();
+            }
+            if (typeof Image === 'undefined') {
+                var errMsg = 'Image width/height must been given explictly in svg-ssr renderer.';
+                assert(imageWidth_1, errMsg);
+                assert(imageHeight_1, errMsg);
+            }
+            else if (imageWidth_1 == null || imageHeight_1 == null) {
+                var setSizeToVNode_1 = function (vNode, img) {
+                    if (vNode) {
+                        var svgEl = vNode.elm;
+                        var width = imageWidth_1 || img.width;
+                        var height = imageHeight_1 || img.height;
+                        if (vNode.tag === 'pattern') {
+                            if (repeatX) {
+                                height = 1;
+                                width /= boundingRect.width;
+                            }
+                            else if (repeatY) {
+                                width = 1;
+                                height /= boundingRect.height;
+                            }
+                        }
+                        vNode.attrs.width = width;
+                        vNode.attrs.height = height;
+                        if (svgEl) {
+                            svgEl.setAttribute('width', width);
+                            svgEl.setAttribute('height', height);
+                        }
+                    }
+                };
+                var createdImage = createOrUpdateImage(imageSrc, null, el, function (img) {
+                    noRepeat || setSizeToVNode_1(patternVNode, img);
+                    setSizeToVNode_1(child, img);
+                });
+                if (createdImage && createdImage.width && createdImage.height) {
+                    imageWidth_1 = imageWidth_1 || createdImage.width;
+                    imageHeight_1 = imageHeight_1 || createdImage.height;
+                }
+            }
+            child = createVNode('image', 'img', {
+                href: imageSrc,
+                width: imageWidth_1,
+                height: imageHeight_1
+            });
+            patternAttrs.width = imageWidth_1;
+            patternAttrs.height = imageHeight_1;
+        }
+        else if (val.svgElement) {
+            child = clone(val.svgElement);
+            patternAttrs.width = val.svgWidth;
+            patternAttrs.height = val.svgHeight;
+        }
+        if (!child) {
+            return;
+        }
+        var patternWidth;
+        var patternHeight;
+        if (noRepeat) {
+            patternWidth = patternHeight = 1;
+        }
+        else if (repeatX) {
+            patternHeight = 1;
+            patternWidth = patternAttrs.width / boundingRect.width;
+        }
+        else if (repeatY) {
+            patternWidth = 1;
+            patternHeight = patternAttrs.height / boundingRect.height;
+        }
+        else {
+            patternAttrs.patternUnits = 'userSpaceOnUse';
+        }
+        if (patternWidth != null && !isNaN(patternWidth)) {
+            patternAttrs.width = patternWidth;
+        }
+        if (patternHeight != null && !isNaN(patternHeight)) {
+            patternAttrs.height = patternHeight;
+        }
+        var patternTransform = getSRTTransformString(val);
+        patternTransform && (patternAttrs.patternTransform = patternTransform);
+        var patternVNode = createVNode('pattern', '', patternAttrs, [child]);
+        var patternKey = vNodeToString(patternVNode);
+        var patternCache = scope.patternCache;
+        var patternId = patternCache[patternKey];
+        if (!patternId) {
+            patternId = scope.zrId + '-p' + scope.patternIdx++;
+            patternCache[patternKey] = patternId;
+            patternAttrs.id = patternId;
+            patternVNode = scope.defs[patternId] = createVNode('pattern', patternId, patternAttrs, [child]);
+        }
+        attrs[target] = getIdURL(patternId);
+    }
+    function setClipPath(clipPath, attrs, scope) {
+        var clipPathCache = scope.clipPathCache, defs = scope.defs;
+        var clipPathId = clipPathCache[clipPath.id];
+        if (!clipPathId) {
+            clipPathId = scope.zrId + '-c' + scope.clipPathIdx++;
+            var clipPathAttrs = {
+                id: clipPathId
+            };
+            clipPathCache[clipPath.id] = clipPathId;
+            defs[clipPathId] = createVNode('clipPath', clipPathId, clipPathAttrs, [brushSVGPath(clipPath, scope)]);
+        }
+        attrs['clip-path'] = getIdURL(clipPathId);
+    }
+
+    function createTextNode(text) {
+        return document.createTextNode(text);
+    }
+    function insertBefore(parentNode, newNode, referenceNode) {
+        parentNode.insertBefore(newNode, referenceNode);
+    }
+    function removeChild(node, child) {
+        node.removeChild(child);
+    }
+    function appendChild(node, child) {
+        node.appendChild(child);
+    }
+    function parentNode(node) {
+        return node.parentNode;
+    }
+    function nextSibling(node) {
+        return node.nextSibling;
+    }
+    function setTextContent(node, text) {
+        node.textContent = text;
+    }
+
+    var colonChar = 58;
+    var xChar = 120;
+    var emptyNode = createVNode('', '');
+    function isUndef(s) {
+        return s === undefined;
+    }
+    function isDef(s) {
+        return s !== undefined;
+    }
+    function createKeyToOldIdx(children, beginIdx, endIdx) {
+        var map = {};
+        for (var i = beginIdx; i <= endIdx; ++i) {
+            var key = children[i].key;
+            if (key !== undefined) {
+                {
+                    if (map[key] != null) {
+                        console.error("Duplicate key " + key);
+                    }
+                }
+                map[key] = i;
+            }
+        }
+        return map;
+    }
+    function sameVnode(vnode1, vnode2) {
+        var isSameKey = vnode1.key === vnode2.key;
+        var isSameTag = vnode1.tag === vnode2.tag;
+        return isSameTag && isSameKey;
+    }
+    function createElm(vnode) {
+        var i;
+        var children = vnode.children;
+        var tag = vnode.tag;
+        if (isDef(tag)) {
+            var elm = (vnode.elm = createElement(tag));
+            updateAttrs(emptyNode, vnode);
+            if (isArray(children)) {
+                for (i = 0; i < children.length; ++i) {
+                    var ch = children[i];
+                    if (ch != null) {
+                        appendChild(elm, createElm(ch));
+                    }
+                }
+            }
+            else if (isDef(vnode.text) && !isObject(vnode.text)) {
+                appendChild(elm, createTextNode(vnode.text));
+            }
+        }
+        else {
+            vnode.elm = createTextNode(vnode.text);
+        }
+        return vnode.elm;
+    }
+    function addVnodes(parentElm, before, vnodes, startIdx, endIdx) {
+        for (; startIdx <= endIdx; ++startIdx) {
+            var ch = vnodes[startIdx];
+            if (ch != null) {
+                insertBefore(parentElm, createElm(ch), before);
+            }
+        }
+    }
+    function removeVnodes(parentElm, vnodes, startIdx, endIdx) {
+        for (; startIdx <= endIdx; ++startIdx) {
+            var ch = vnodes[startIdx];
+            if (ch != null) {
+                if (isDef(ch.tag)) {
+                    var parent_1 = parentNode(ch.elm);
+                    removeChild(parent_1, ch.elm);
+                }
+                else {
+                    removeChild(parentElm, ch.elm);
+                }
+            }
+        }
+    }
+    function updateAttrs(oldVnode, vnode) {
+        var key;
+        var elm = vnode.elm;
+        var oldAttrs = oldVnode && oldVnode.attrs || {};
+        var attrs = vnode.attrs || {};
+        if (oldAttrs === attrs) {
+            return;
+        }
+        for (key in attrs) {
+            var cur = attrs[key];
+            var old = oldAttrs[key];
+            if (old !== cur) {
+                if (cur === true) {
+                    elm.setAttribute(key, '');
+                }
+                else if (cur === false) {
+                    elm.removeAttribute(key);
+                }
+                else {
+                    if (key === 'style') {
+                        elm.style.cssText = cur;
+                    }
+                    else if (key.charCodeAt(0) !== xChar) {
+                        elm.setAttribute(key, cur);
+                    }
+                    else if (key === 'xmlns:xlink' || key === 'xmlns') {
+                        elm.setAttributeNS(XMLNS, key, cur);
+                    }
+                    else if (key.charCodeAt(3) === colonChar) {
+                        elm.setAttributeNS(XML_NAMESPACE, key, cur);
+                    }
+                    else if (key.charCodeAt(5) === colonChar) {
+                        elm.setAttributeNS(XLINKNS, key, cur);
+                    }
+                    else {
+                        elm.setAttribute(key, cur);
+                    }
+                }
+            }
+        }
+        for (key in oldAttrs) {
+            if (!(key in attrs)) {
+                elm.removeAttribute(key);
+            }
+        }
+    }
+    function updateChildren(parentElm, oldCh, newCh) {
+        var oldStartIdx = 0;
+        var newStartIdx = 0;
+        var oldEndIdx = oldCh.length - 1;
+        var oldStartVnode = oldCh[0];
+        var oldEndVnode = oldCh[oldEndIdx];
+        var newEndIdx = newCh.length - 1;
+        var newStartVnode = newCh[0];
+        var newEndVnode = newCh[newEndIdx];
+        var oldKeyToIdx;
+        var idxInOld;
+        var elmToMove;
+        var before;
+        while (oldStartIdx <= oldEndIdx && newStartIdx <= newEndIdx) {
+            if (oldStartVnode == null) {
+                oldStartVnode = oldCh[++oldStartIdx];
+            }
+            else if (oldEndVnode == null) {
+                oldEndVnode = oldCh[--oldEndIdx];
+            }
+            else if (newStartVnode == null) {
+                newStartVnode = newCh[++newStartIdx];
+            }
+            else if (newEndVnode == null) {
+                newEndVnode = newCh[--newEndIdx];
+            }
+            else if (sameVnode(oldStartVnode, newStartVnode)) {
+                patchVnode(oldStartVnode, newStartVnode);
+                oldStartVnode = oldCh[++oldStartIdx];
+                newStartVnode = newCh[++newStartIdx];
+            }
+            else if (sameVnode(oldEndVnode, newEndVnode)) {
+                patchVnode(oldEndVnode, newEndVnode);
+                oldEndVnode = oldCh[--oldEndIdx];
+                newEndVnode = newCh[--newEndIdx];
+            }
+            else if (sameVnode(oldStartVnode, newEndVnode)) {
+                patchVnode(oldStartVnode, newEndVnode);
+                insertBefore(parentElm, oldStartVnode.elm, nextSibling(oldEndVnode.elm));
+                oldStartVnode = oldCh[++oldStartIdx];
+                newEndVnode = newCh[--newEndIdx];
+            }
+            else if (sameVnode(oldEndVnode, newStartVnode)) {
+                patchVnode(oldEndVnode, newStartVnode);
+                insertBefore(parentElm, oldEndVnode.elm, oldStartVnode.elm);
+                oldEndVnode = oldCh[--oldEndIdx];
+                newStartVnode = newCh[++newStartIdx];
+            }
+            else {
+                if (isUndef(oldKeyToIdx)) {
+                    oldKeyToIdx = createKeyToOldIdx(oldCh, oldStartIdx, oldEndIdx);
+                }
+                idxInOld = oldKeyToIdx[newStartVnode.key];
+                if (isUndef(idxInOld)) {
+                    insertBefore(parentElm, createElm(newStartVnode), oldStartVnode.elm);
+                }
+                else {
+                    elmToMove = oldCh[idxInOld];
+                    if (elmToMove.tag !== newStartVnode.tag) {
+                        insertBefore(parentElm, createElm(newStartVnode), oldStartVnode.elm);
+                    }
+                    else {
+                        patchVnode(elmToMove, newStartVnode);
+                        oldCh[idxInOld] = undefined;
+                        insertBefore(parentElm, elmToMove.elm, oldStartVnode.elm);
+                    }
+                }
+                newStartVnode = newCh[++newStartIdx];
+            }
+        }
+        if (oldStartIdx <= oldEndIdx || newStartIdx <= newEndIdx) {
+            if (oldStartIdx > oldEndIdx) {
+                before = newCh[newEndIdx + 1] == null ? null : newCh[newEndIdx + 1].elm;
+                addVnodes(parentElm, before, newCh, newStartIdx, newEndIdx);
+            }
+            else {
+                removeVnodes(parentElm, oldCh, oldStartIdx, oldEndIdx);
+            }
+        }
+    }
+    function patchVnode(oldVnode, vnode) {
+        var elm = (vnode.elm = oldVnode.elm);
+        var oldCh = oldVnode.children;
+        var ch = vnode.children;
+        if (oldVnode === vnode) {
+            return;
+        }
+        updateAttrs(oldVnode, vnode);
+        if (isUndef(vnode.text)) {
+            if (isDef(oldCh) && isDef(ch)) {
+                if (oldCh !== ch) {
+                    updateChildren(elm, oldCh, ch);
+                }
+            }
+            else if (isDef(ch)) {
+                if (isDef(oldVnode.text)) {
+                    setTextContent(elm, '');
+                }
+                addVnodes(elm, null, ch, 0, ch.length - 1);
+            }
+            else if (isDef(oldCh)) {
+                removeVnodes(elm, oldCh, 0, oldCh.length - 1);
+            }
+            else if (isDef(oldVnode.text)) {
+                setTextContent(elm, '');
+            }
+        }
+        else if (oldVnode.text !== vnode.text) {
+            if (isDef(oldCh)) {
+                removeVnodes(elm, oldCh, 0, oldCh.length - 1);
+            }
+            setTextContent(elm, vnode.text);
+        }
+    }
+    function patch(oldVnode, vnode) {
+        if (sameVnode(oldVnode, vnode)) {
+            patchVnode(oldVnode, vnode);
+        }
+        else {
+            var elm = oldVnode.elm;
+            var parent_2 = parentNode(elm);
+            createElm(vnode);
+            if (parent_2 !== null) {
+                insertBefore(parent_2, vnode.elm, nextSibling(elm));
+                removeVnodes(parent_2, [oldVnode], 0, 0);
+            }
+        }
+        return vnode;
+    }
+
+    var svgId = 0;
+    var SVGPainter = (function () {
+        function SVGPainter(root, storage, opts) {
+            this.type = 'svg';
+            this.refreshHover = createMethodNotSupport('refreshHover');
+            this.configLayer = createMethodNotSupport('configLayer');
+            this.storage = storage;
+            this._opts = opts = extend({}, opts);
+            this.root = root;
+            this._id = 'zr' + svgId++;
+            this._oldVNode = createSVGVNode(opts.width, opts.height);
+            if (root && !opts.ssr) {
+                var viewport = this._viewport = document.createElement('div');
+                viewport.style.cssText = 'position:relative;overflow:hidden';
+                var svgDom = this._svgDom = this._oldVNode.elm = createElement('svg');
+                updateAttrs(null, this._oldVNode);
+                viewport.appendChild(svgDom);
+                root.appendChild(viewport);
+            }
+            this.resize(opts.width, opts.height);
+        }
+        SVGPainter.prototype.getType = function () {
+            return this.type;
+        };
+        SVGPainter.prototype.getViewportRoot = function () {
+            return this._viewport;
+        };
+        SVGPainter.prototype.getViewportRootOffset = function () {
+            var viewportRoot = this.getViewportRoot();
+            if (viewportRoot) {
+                return {
+                    offsetLeft: viewportRoot.offsetLeft || 0,
+                    offsetTop: viewportRoot.offsetTop || 0
+                };
+            }
+        };
+        SVGPainter.prototype.getSvgDom = function () {
+            return this._svgDom;
+        };
+        SVGPainter.prototype.refresh = function () {
+            if (this.root) {
+                var vnode = this.renderToVNode({
+                    willUpdate: true
+                });
+                vnode.attrs.style = 'position:absolute;left:0;top:0;user-select:none';
+                patch(this._oldVNode, vnode);
+                this._oldVNode = vnode;
+            }
+        };
+        SVGPainter.prototype.renderOneToVNode = function (el) {
+            return brush$1(el, createBrushScope(this._id));
+        };
+        SVGPainter.prototype.renderToVNode = function (opts) {
+            opts = opts || {};
+            var list = this.storage.getDisplayList(true);
+            var width = this._width;
+            var height = this._height;
+            var scope = createBrushScope(this._id);
+            scope.animation = opts.animation;
+            scope.willUpdate = opts.willUpdate;
+            scope.compress = opts.compress;
+            scope.emphasis = opts.emphasis;
+            var children = [];
+            var bgVNode = this._bgVNode = createBackgroundVNode(width, height, this._backgroundColor, scope);
+            bgVNode && children.push(bgVNode);
+            var mainVNode = !opts.compress
+                ? (this._mainVNode = createVNode('g', 'main', {}, [])) : null;
+            this._paintList(list, scope, mainVNode ? mainVNode.children : children);
+            mainVNode && children.push(mainVNode);
+            var defs = map(keys(scope.defs), function (id) { return scope.defs[id]; });
+            if (defs.length) {
+                children.push(createVNode('defs', 'defs', {}, defs));
+            }
+            if (opts.animation) {
+                var animationCssStr = getCssString(scope.cssNodes, scope.cssAnims, { newline: true });
+                if (animationCssStr) {
+                    var styleNode = createVNode('style', 'stl', {}, [], animationCssStr);
+                    children.push(styleNode);
+                }
+            }
+            return createSVGVNode(width, height, children, opts.useViewBox);
+        };
+        SVGPainter.prototype.renderToString = function (opts) {
+            opts = opts || {};
+            return vNodeToString(this.renderToVNode({
+                animation: retrieve2(opts.cssAnimation, true),
+                emphasis: retrieve2(opts.cssEmphasis, true),
+                willUpdate: false,
+                compress: true,
+                useViewBox: retrieve2(opts.useViewBox, true)
+            }), { newline: true });
+        };
+        SVGPainter.prototype.setBackgroundColor = function (backgroundColor) {
+            this._backgroundColor = backgroundColor;
+        };
+        SVGPainter.prototype.getSvgRoot = function () {
+            return this._mainVNode && this._mainVNode.elm;
+        };
+        SVGPainter.prototype._paintList = function (list, scope, out) {
+            var listLen = list.length;
+            var clipPathsGroupsStack = [];
+            var clipPathsGroupsStackDepth = 0;
+            var currentClipPathGroup;
+            var prevClipPaths;
+            var clipGroupNodeIdx = 0;
+            for (var i = 0; i < listLen; i++) {
+                var displayable = list[i];
+                if (!displayable.invisible) {
+                    var clipPaths = displayable.__clipPaths;
+                    var len = clipPaths && clipPaths.length || 0;
+                    var prevLen = prevClipPaths && prevClipPaths.length || 0;
+                    var lca = void 0;
+                    for (lca = Math.max(len - 1, prevLen - 1); lca >= 0; lca--) {
+                        if (clipPaths && prevClipPaths
+                            && clipPaths[lca] === prevClipPaths[lca]) {
+                            break;
+                        }
+                    }
+                    for (var i_1 = prevLen - 1; i_1 > lca; i_1--) {
+                        clipPathsGroupsStackDepth--;
+                        currentClipPathGroup = clipPathsGroupsStack[clipPathsGroupsStackDepth - 1];
+                    }
+                    for (var i_2 = lca + 1; i_2 < len; i_2++) {
+                        var groupAttrs = {};
+                        setClipPath(clipPaths[i_2], groupAttrs, scope);
+                        var g = createVNode('g', 'clip-g-' + clipGroupNodeIdx++, groupAttrs, []);
+                        (currentClipPathGroup ? currentClipPathGroup.children : out).push(g);
+                        clipPathsGroupsStack[clipPathsGroupsStackDepth++] = g;
+                        currentClipPathGroup = g;
+                    }
+                    prevClipPaths = clipPaths;
+                    var ret = brush$1(displayable, scope);
+                    if (ret) {
+                        (currentClipPathGroup ? currentClipPathGroup.children : out).push(ret);
+                    }
+                }
+            }
+        };
+        SVGPainter.prototype.resize = function (width, height) {
+            var opts = this._opts;
+            var root = this.root;
+            var viewport = this._viewport;
+            width != null && (opts.width = width);
+            height != null && (opts.height = height);
+            if (root && viewport) {
+                viewport.style.display = 'none';
+                width = getSize(root, 0, opts);
+                height = getSize(root, 1, opts);
+                viewport.style.display = '';
+            }
+            if (this._width !== width || this._height !== height) {
+                this._width = width;
+                this._height = height;
+                if (viewport) {
+                    var viewportStyle = viewport.style;
+                    viewportStyle.width = width + 'px';
+                    viewportStyle.height = height + 'px';
+                }
+                if (!isPattern(this._backgroundColor)) {
+                    var svgDom = this._svgDom;
+                    if (svgDom) {
+                        svgDom.setAttribute('width', width);
+                        svgDom.setAttribute('height', height);
+                    }
+                    var bgEl = this._bgVNode && this._bgVNode.elm;
+                    if (bgEl) {
+                        bgEl.setAttribute('width', width);
+                        bgEl.setAttribute('height', height);
+                    }
+                }
+                else {
+                    this.refresh();
+                }
+            }
+        };
+        SVGPainter.prototype.getWidth = function () {
+            return this._width;
+        };
+        SVGPainter.prototype.getHeight = function () {
+            return this._height;
+        };
+        SVGPainter.prototype.dispose = function () {
+            if (this.root) {
+                this.root.innerHTML = '';
+            }
+            this._svgDom =
+                this._viewport =
+                    this.storage =
+                        this._oldVNode =
+                            this._bgVNode =
+                                this._mainVNode = null;
+        };
+        SVGPainter.prototype.clear = function () {
+            if (this._svgDom) {
+                this._svgDom.innerHTML = null;
+            }
+            this._oldVNode = null;
+        };
+        SVGPainter.prototype.toDataURL = function (base64) {
+            var str = this.renderToString();
+            var prefix = 'data:image/svg+xml;';
+            if (base64) {
+                str = encodeBase64(str);
+                return str && prefix + 'base64,' + str;
+            }
+            return prefix + 'charset=UTF-8,' + encodeURIComponent(str);
+        };
+        return SVGPainter;
+    }());
+    function createMethodNotSupport(method) {
+        return function () {
+            {
+                logError('In SVG mode painter not support method "' + method + '"');
+            }
+        };
+    }
+    function createBackgroundVNode(width, height, backgroundColor, scope) {
+        var bgVNode;
+        if (backgroundColor && backgroundColor !== 'none') {
+            bgVNode = createVNode('rect', 'bg', {
+                width: width,
+                height: height,
+                x: '0',
+                y: '0'
+            });
+            if (isGradient(backgroundColor)) {
+                setGradient({ fill: backgroundColor }, bgVNode.attrs, 'fill', scope);
+            }
+            else if (isPattern(backgroundColor)) {
+                setPattern({
+                    style: {
+                        fill: backgroundColor
+                    },
+                    dirty: noop,
+                    getBoundingRect: function () { return ({ width: width, height: height }); }
+                }, bgVNode.attrs, 'fill', scope);
+            }
+            else {
+                var _a = normalizeColor(backgroundColor), color = _a.color, opacity = _a.opacity;
+                bgVNode.attrs.fill = color;
+                opacity < 1 && (bgVNode.attrs['fill-opacity'] = opacity);
+            }
+        }
+        return bgVNode;
+    }
+
+    registerPainter('canvas', CanvasPainter);
+    registerPainter('svg', SVGPainter);
+
+    exports.Arc = Arc;
+    exports.ArcShape = ArcShape;
+    exports.BezierCurve = BezierCurve;
+    exports.BezierCurveShape = BezierCurveShape;
+    exports.BoundingRect = BoundingRect;
+    exports.Circle = Circle;
+    exports.CircleShape = CircleShape;
+    exports.CompoundPath = CompoundPath;
+    exports.Displayable = Displayable;
+    exports.Droplet = Droplet;
+    exports.DropletShape = DropletShape;
+    exports.Element = Element;
+    exports.Ellipse = Ellipse;
+    exports.EllipseShape = EllipseShape;
+    exports.Group = Group;
+    exports.Heart = Heart;
+    exports.HeartShape = HeartShape;
+    exports.Image = ZRImage;
+    exports.IncrementalDisplayable = IncrementalDisplayable;
+    exports.Isogon = Isogon;
+    exports.IsogonShape = IsogonShape;
+    exports.Line = Line;
+    exports.LineShape = LineShape;
+    exports.LinearGradient = LinearGradient;
+    exports.OrientedBoundingRect = OrientedBoundingRect;
+    exports.Path = Path;
+    exports.Pattern = Pattern;
+    exports.Point = Point;
+    exports.Polygon = Polygon;
+    exports.PolygonShape = PolygonShape;
+    exports.Polyline = Polyline;
+    exports.PolylineShape = PolylineShape;
+    exports.RadialGradient = RadialGradient;
+    exports.Rect = Rect;
+    exports.RectShape = RectShape;
+    exports.Ring = Ring;
+    exports.RingShape = RingShape;
+    exports.Rose = Rose;
+    exports.RoseShape = RoseShape;
+    exports.Sector = Sector;
+    exports.SectorShape = SectorShape;
+    exports.Star = Star;
+    exports.StarShape = StarShape;
+    exports.TSpan = TSpan;
+    exports.Text = ZRText;
+    exports.Trochoid = Trochoid;
+    exports.TrochoidShape = TrochoidShape;
+    exports.color = color;
+    exports.dispose = dispose;
+    exports.disposeAll = disposeAll;
+    exports.getElementSSRData = getElementSSRData;
+    exports.getInstance = getInstance;
+    exports.init = init;
+    exports.matrix = matrix;
+    exports.morph = morphPath$1;
+    exports.parseSVG = parseSVG;
+    exports.path = path;
+    exports.registerPainter = registerPainter;
+    exports.registerSSRDataGetter = registerSSRDataGetter;
+    exports.setPlatformAPI = setPlatformAPI;
+    exports.showDebugDirtyRect = showDebugDirtyRect;
+    exports.util = util;
+    exports.vector = vector;
+    exports.version = version;
+
+    Object.defineProperty(exports, '__esModule', { value: true });
+
+})));
+//# sourceMappingURL=zrender.js.map

File diff ditekan karena terlalu besar
+ 0 - 0
node_modules/echarts/node_modules/zrender/dist/zrender.js.map


File diff ditekan karena terlalu besar
+ 0 - 0
node_modules/echarts/node_modules/zrender/dist/zrender.min.js


+ 2 - 0
node_modules/echarts/node_modules/zrender/index.d.ts

@@ -0,0 +1,2 @@
+export * from './lib/zrender';
+export * from './lib/export';

+ 1 - 0
node_modules/echarts/node_modules/zrender/index.js

@@ -0,0 +1 @@
+export * from './lib/all.js'

+ 1 - 0
node_modules/echarts/node_modules/zrender/index.ts

@@ -0,0 +1 @@
+export * from './src/all';

+ 206 - 0
node_modules/echarts/node_modules/zrender/lib/Element.d.ts

@@ -0,0 +1,206 @@
+import Transformable, { TransformProp } from './core/Transformable';
+import { AnimationEasing } from './animation/easing';
+import Animator from './animation/Animator';
+import { ZRenderType } from './zrender';
+import { Dictionary, ElementEventName, ZRRawEvent, BuiltinTextPosition, MapToType } from './core/types';
+import Path from './graphic/Path';
+import BoundingRect, { RectLike } from './core/BoundingRect';
+import Eventful from './core/Eventful';
+import ZRText from './graphic/Text';
+import { TextPositionCalculationResult } from './contain/text';
+import Polyline from './graphic/shape/Polyline';
+import Group from './graphic/Group';
+import Point from './core/Point';
+export interface ElementAnimateConfig {
+    duration?: number;
+    delay?: number;
+    easing?: AnimationEasing;
+    during?: (percent: number) => void;
+    done?: Function;
+    aborted?: Function;
+    scope?: string;
+    force?: boolean;
+    additive?: boolean;
+    setToFinal?: boolean;
+}
+export interface ElementTextConfig {
+    position?: BuiltinTextPosition | (number | string)[];
+    rotation?: number;
+    layoutRect?: RectLike;
+    offset?: number[];
+    origin?: (number | string)[] | 'center';
+    distance?: number;
+    local?: boolean;
+    insideFill?: string;
+    insideStroke?: string;
+    outsideFill?: string;
+    outsideStroke?: string;
+    inside?: boolean;
+}
+export interface ElementTextGuideLineConfig {
+    anchor?: Point;
+    showAbove?: boolean;
+    candidates?: ('left' | 'top' | 'right' | 'bottom')[];
+}
+export interface ElementEvent {
+    type: ElementEventName;
+    event: ZRRawEvent;
+    target: Element;
+    topTarget: Element;
+    cancelBubble: boolean;
+    offsetX: number;
+    offsetY: number;
+    gestureEvent: string;
+    pinchX: number;
+    pinchY: number;
+    pinchScale: number;
+    wheelDelta: number;
+    zrByTouch: boolean;
+    which: number;
+    stop: (this: ElementEvent) => void;
+}
+export declare type ElementEventCallback<Ctx, Impl> = (this: CbThis<Ctx, Impl>, e: ElementEvent) => boolean | void;
+declare type CbThis<Ctx, Impl> = unknown extends Ctx ? Impl : Ctx;
+interface ElementEventHandlerProps {
+    onclick: ElementEventCallback<unknown, unknown>;
+    ondblclick: ElementEventCallback<unknown, unknown>;
+    onmouseover: ElementEventCallback<unknown, unknown>;
+    onmouseout: ElementEventCallback<unknown, unknown>;
+    onmousemove: ElementEventCallback<unknown, unknown>;
+    onmousewheel: ElementEventCallback<unknown, unknown>;
+    onmousedown: ElementEventCallback<unknown, unknown>;
+    onmouseup: ElementEventCallback<unknown, unknown>;
+    oncontextmenu: ElementEventCallback<unknown, unknown>;
+    ondrag: ElementEventCallback<unknown, unknown>;
+    ondragstart: ElementEventCallback<unknown, unknown>;
+    ondragend: ElementEventCallback<unknown, unknown>;
+    ondragenter: ElementEventCallback<unknown, unknown>;
+    ondragleave: ElementEventCallback<unknown, unknown>;
+    ondragover: ElementEventCallback<unknown, unknown>;
+    ondrop: ElementEventCallback<unknown, unknown>;
+}
+export interface ElementProps extends Partial<ElementEventHandlerProps>, Partial<Pick<Transformable, TransformProp>> {
+    name?: string;
+    ignore?: boolean;
+    isGroup?: boolean;
+    draggable?: boolean | 'horizontal' | 'vertical';
+    silent?: boolean;
+    ignoreClip?: boolean;
+    globalScaleRatio?: number;
+    textConfig?: ElementTextConfig;
+    textContent?: ZRText;
+    clipPath?: Path;
+    drift?: Element['drift'];
+    extra?: Dictionary<unknown>;
+    anid?: string;
+}
+export declare const PRESERVED_NORMAL_STATE = "__zr_normal__";
+declare const PRIMARY_STATES_KEYS: ["x" | "y" | "originX" | "originY" | "anchorX" | "anchorY" | "rotation" | "scaleX" | "scaleY" | "skewX" | "skewY", "ignore"];
+export declare type ElementStatePropNames = (typeof PRIMARY_STATES_KEYS)[number] | 'textConfig';
+export declare type ElementState = Pick<ElementProps, ElementStatePropNames> & ElementCommonState;
+export declare type ElementCommonState = {
+    hoverLayer?: boolean;
+};
+export declare type ElementCalculateTextPosition = (out: TextPositionCalculationResult, style: ElementTextConfig, rect: RectLike) => TextPositionCalculationResult;
+interface Element<Props extends ElementProps = ElementProps> extends Transformable, Eventful<{
+    [key in ElementEventName]: (e: ElementEvent) => void | boolean;
+} & {
+    [key in string]: (...args: any) => void | boolean;
+}>, ElementEventHandlerProps {
+}
+declare class Element<Props extends ElementProps = ElementProps> {
+    id: number;
+    type: string;
+    name: string;
+    ignore: boolean;
+    silent: boolean;
+    isGroup: boolean;
+    draggable: boolean | 'horizontal' | 'vertical';
+    dragging: boolean;
+    parent: Group;
+    animators: Animator<any>[];
+    ignoreClip: boolean;
+    __hostTarget: Element;
+    __zr: ZRenderType;
+    __dirty: number;
+    __isRendered: boolean;
+    __inHover: boolean;
+    private _clipPath?;
+    private _textContent?;
+    private _textGuide?;
+    textConfig?: ElementTextConfig;
+    textGuideLineConfig?: ElementTextGuideLineConfig;
+    anid: string;
+    extra: Dictionary<unknown>;
+    currentStates?: string[];
+    prevStates?: string[];
+    states: Dictionary<ElementState>;
+    stateTransition: ElementAnimateConfig;
+    stateProxy?: (stateName: string, targetStates?: string[]) => ElementState;
+    protected _normalState: ElementState;
+    private _innerTextDefaultStyle;
+    constructor(props?: Props);
+    protected _init(props?: Props): void;
+    drift(dx: number, dy: number, e?: ElementEvent): void;
+    beforeUpdate(): void;
+    afterUpdate(): void;
+    update(): void;
+    updateInnerText(forceUpdate?: boolean): void;
+    protected canBeInsideText(): boolean;
+    protected getInsideTextFill(): string | undefined;
+    protected getInsideTextStroke(textFill: string): string | undefined;
+    protected getOutsideFill(): string | undefined;
+    protected getOutsideStroke(textFill: string): string;
+    traverse<Context>(cb: (this: Context, el: Element<Props>) => void, context?: Context): void;
+    protected attrKV(key: string, value: unknown): void;
+    hide(): void;
+    show(): void;
+    attr(keyOrObj: Props): this;
+    attr<T extends keyof Props>(keyOrObj: T, value: Props[T]): this;
+    saveCurrentToNormalState(toState: ElementState): void;
+    protected _innerSaveToNormal(toState: ElementState): void;
+    protected _savePrimaryToNormal(toState: Dictionary<any>, normalState: Dictionary<any>, primaryKeys: readonly string[]): void;
+    hasState(): boolean;
+    getState(name: string): ElementState;
+    ensureState(name: string): ElementState;
+    clearStates(noAnimation?: boolean): void;
+    useState(stateName: string, keepCurrentStates?: boolean, noAnimation?: boolean, forceUseHoverLayer?: boolean): ElementState;
+    useStates(states: string[], noAnimation?: boolean, forceUseHoverLayer?: boolean): void;
+    isSilent(): boolean;
+    private _updateAnimationTargets;
+    removeState(state: string): void;
+    replaceState(oldState: string, newState: string, forceAdd: boolean): void;
+    toggleState(state: string, enable: boolean): void;
+    protected _mergeStates(states: ElementState[]): ElementState;
+    protected _applyStateObj(stateName: string, state: ElementState, normalState: ElementState, keepCurrentStates: boolean, transition: boolean, animationCfg: ElementAnimateConfig): void;
+    private _attachComponent;
+    private _detachComponent;
+    getClipPath(): Path<import("./graphic/Path").PathProps>;
+    setClipPath(clipPath: Path): void;
+    removeClipPath(): void;
+    getTextContent(): ZRText;
+    setTextContent(textEl: ZRText): void;
+    setTextConfig(cfg: ElementTextConfig): void;
+    removeTextConfig(): void;
+    removeTextContent(): void;
+    getTextGuideLine(): Polyline;
+    setTextGuideLine(guideLine: Polyline): void;
+    removeTextGuideLine(): void;
+    markRedraw(): void;
+    dirty(): void;
+    private _toggleHoverLayerFlag;
+    addSelfToZr(zr: ZRenderType): void;
+    removeSelfFromZr(zr: ZRenderType): void;
+    animate(key?: string, loop?: boolean, allowDiscreteAnimation?: boolean): Animator<any>;
+    addAnimator(animator: Animator<any>, key: string): void;
+    updateDuringAnimation(key: string): void;
+    stopAnimation(scope?: string, forwardToLast?: boolean): this;
+    animateTo(target: Props, cfg?: ElementAnimateConfig, animationProps?: MapToType<Props, boolean>): void;
+    animateFrom(target: Props, cfg: ElementAnimateConfig, animationProps?: MapToType<Props, boolean>): void;
+    protected _transitionState(stateName: string, target: Props, cfg?: ElementAnimateConfig, animationProps?: MapToType<Props, boolean>): void;
+    getBoundingRect(): BoundingRect;
+    getPaintRect(): BoundingRect;
+    calculateTextPosition: ElementCalculateTextPosition;
+    protected static initDefaultProps: void;
+}
+export default Element;

+ 1050 - 0
node_modules/echarts/node_modules/zrender/lib/Element.js

@@ -0,0 +1,1050 @@
+import Transformable, { TRANSFORMABLE_PROPS } from './core/Transformable.js';
+import Animator, { cloneValue } from './animation/Animator.js';
+import BoundingRect from './core/BoundingRect.js';
+import Eventful from './core/Eventful.js';
+import { calculateTextPosition, parsePercent } from './contain/text.js';
+import { guid, isObject, keys, extend, indexOf, logError, mixin, isArrayLike, isTypedArray, isGradientObject, filter, reduce } from './core/util.js';
+import { LIGHT_LABEL_COLOR, DARK_LABEL_COLOR } from './config.js';
+import { parse, stringify } from './tool/color.js';
+import { REDRAW_BIT } from './graphic/constants.js';
+export var PRESERVED_NORMAL_STATE = '__zr_normal__';
+var PRIMARY_STATES_KEYS = TRANSFORMABLE_PROPS.concat(['ignore']);
+var DEFAULT_ANIMATABLE_MAP = reduce(TRANSFORMABLE_PROPS, function (obj, key) {
+    obj[key] = true;
+    return obj;
+}, { ignore: false });
+var tmpTextPosCalcRes = {};
+var tmpBoundingRect = new BoundingRect(0, 0, 0, 0);
+var Element = (function () {
+    function Element(props) {
+        this.id = guid();
+        this.animators = [];
+        this.currentStates = [];
+        this.states = {};
+        this._init(props);
+    }
+    Element.prototype._init = function (props) {
+        this.attr(props);
+    };
+    Element.prototype.drift = function (dx, dy, e) {
+        switch (this.draggable) {
+            case 'horizontal':
+                dy = 0;
+                break;
+            case 'vertical':
+                dx = 0;
+                break;
+        }
+        var m = this.transform;
+        if (!m) {
+            m = this.transform = [1, 0, 0, 1, 0, 0];
+        }
+        m[4] += dx;
+        m[5] += dy;
+        this.decomposeTransform();
+        this.markRedraw();
+    };
+    Element.prototype.beforeUpdate = function () { };
+    Element.prototype.afterUpdate = function () { };
+    Element.prototype.update = function () {
+        this.updateTransform();
+        if (this.__dirty) {
+            this.updateInnerText();
+        }
+    };
+    Element.prototype.updateInnerText = function (forceUpdate) {
+        var textEl = this._textContent;
+        if (textEl && (!textEl.ignore || forceUpdate)) {
+            if (!this.textConfig) {
+                this.textConfig = {};
+            }
+            var textConfig = this.textConfig;
+            var isLocal = textConfig.local;
+            var innerTransformable = textEl.innerTransformable;
+            var textAlign = void 0;
+            var textVerticalAlign = void 0;
+            var textStyleChanged = false;
+            innerTransformable.parent = isLocal ? this : null;
+            var innerOrigin = false;
+            innerTransformable.copyTransform(textEl);
+            if (textConfig.position != null) {
+                var layoutRect = tmpBoundingRect;
+                if (textConfig.layoutRect) {
+                    layoutRect.copy(textConfig.layoutRect);
+                }
+                else {
+                    layoutRect.copy(this.getBoundingRect());
+                }
+                if (!isLocal) {
+                    layoutRect.applyTransform(this.transform);
+                }
+                if (this.calculateTextPosition) {
+                    this.calculateTextPosition(tmpTextPosCalcRes, textConfig, layoutRect);
+                }
+                else {
+                    calculateTextPosition(tmpTextPosCalcRes, textConfig, layoutRect);
+                }
+                innerTransformable.x = tmpTextPosCalcRes.x;
+                innerTransformable.y = tmpTextPosCalcRes.y;
+                textAlign = tmpTextPosCalcRes.align;
+                textVerticalAlign = tmpTextPosCalcRes.verticalAlign;
+                var textOrigin = textConfig.origin;
+                if (textOrigin && textConfig.rotation != null) {
+                    var relOriginX = void 0;
+                    var relOriginY = void 0;
+                    if (textOrigin === 'center') {
+                        relOriginX = layoutRect.width * 0.5;
+                        relOriginY = layoutRect.height * 0.5;
+                    }
+                    else {
+                        relOriginX = parsePercent(textOrigin[0], layoutRect.width);
+                        relOriginY = parsePercent(textOrigin[1], layoutRect.height);
+                    }
+                    innerOrigin = true;
+                    innerTransformable.originX = -innerTransformable.x + relOriginX + (isLocal ? 0 : layoutRect.x);
+                    innerTransformable.originY = -innerTransformable.y + relOriginY + (isLocal ? 0 : layoutRect.y);
+                }
+            }
+            if (textConfig.rotation != null) {
+                innerTransformable.rotation = textConfig.rotation;
+            }
+            var textOffset = textConfig.offset;
+            if (textOffset) {
+                innerTransformable.x += textOffset[0];
+                innerTransformable.y += textOffset[1];
+                if (!innerOrigin) {
+                    innerTransformable.originX = -textOffset[0];
+                    innerTransformable.originY = -textOffset[1];
+                }
+            }
+            var isInside = textConfig.inside == null
+                ? (typeof textConfig.position === 'string' && textConfig.position.indexOf('inside') >= 0)
+                : textConfig.inside;
+            var innerTextDefaultStyle = this._innerTextDefaultStyle || (this._innerTextDefaultStyle = {});
+            var textFill = void 0;
+            var textStroke = void 0;
+            var autoStroke = void 0;
+            if (isInside && this.canBeInsideText()) {
+                textFill = textConfig.insideFill;
+                textStroke = textConfig.insideStroke;
+                if (textFill == null || textFill === 'auto') {
+                    textFill = this.getInsideTextFill();
+                }
+                if (textStroke == null || textStroke === 'auto') {
+                    textStroke = this.getInsideTextStroke(textFill);
+                    autoStroke = true;
+                }
+            }
+            else {
+                textFill = textConfig.outsideFill;
+                textStroke = textConfig.outsideStroke;
+                if (textFill == null || textFill === 'auto') {
+                    textFill = this.getOutsideFill();
+                }
+                if (textStroke == null || textStroke === 'auto') {
+                    textStroke = this.getOutsideStroke(textFill);
+                    autoStroke = true;
+                }
+            }
+            textFill = textFill || '#000';
+            if (textFill !== innerTextDefaultStyle.fill
+                || textStroke !== innerTextDefaultStyle.stroke
+                || autoStroke !== innerTextDefaultStyle.autoStroke
+                || textAlign !== innerTextDefaultStyle.align
+                || textVerticalAlign !== innerTextDefaultStyle.verticalAlign) {
+                textStyleChanged = true;
+                innerTextDefaultStyle.fill = textFill;
+                innerTextDefaultStyle.stroke = textStroke;
+                innerTextDefaultStyle.autoStroke = autoStroke;
+                innerTextDefaultStyle.align = textAlign;
+                innerTextDefaultStyle.verticalAlign = textVerticalAlign;
+                textEl.setDefaultTextStyle(innerTextDefaultStyle);
+            }
+            textEl.__dirty |= REDRAW_BIT;
+            if (textStyleChanged) {
+                textEl.dirtyStyle(true);
+            }
+        }
+    };
+    Element.prototype.canBeInsideText = function () {
+        return true;
+    };
+    Element.prototype.getInsideTextFill = function () {
+        return '#fff';
+    };
+    Element.prototype.getInsideTextStroke = function (textFill) {
+        return '#000';
+    };
+    Element.prototype.getOutsideFill = function () {
+        return this.__zr && this.__zr.isDarkMode() ? LIGHT_LABEL_COLOR : DARK_LABEL_COLOR;
+    };
+    Element.prototype.getOutsideStroke = function (textFill) {
+        var backgroundColor = this.__zr && this.__zr.getBackgroundColor();
+        var colorArr = typeof backgroundColor === 'string' && parse(backgroundColor);
+        if (!colorArr) {
+            colorArr = [255, 255, 255, 1];
+        }
+        var alpha = colorArr[3];
+        var isDark = this.__zr.isDarkMode();
+        for (var i = 0; i < 3; i++) {
+            colorArr[i] = colorArr[i] * alpha + (isDark ? 0 : 255) * (1 - alpha);
+        }
+        colorArr[3] = 1;
+        return stringify(colorArr, 'rgba');
+    };
+    Element.prototype.traverse = function (cb, context) { };
+    Element.prototype.attrKV = function (key, value) {
+        if (key === 'textConfig') {
+            this.setTextConfig(value);
+        }
+        else if (key === 'textContent') {
+            this.setTextContent(value);
+        }
+        else if (key === 'clipPath') {
+            this.setClipPath(value);
+        }
+        else if (key === 'extra') {
+            this.extra = this.extra || {};
+            extend(this.extra, value);
+        }
+        else {
+            this[key] = value;
+        }
+    };
+    Element.prototype.hide = function () {
+        this.ignore = true;
+        this.markRedraw();
+    };
+    Element.prototype.show = function () {
+        this.ignore = false;
+        this.markRedraw();
+    };
+    Element.prototype.attr = function (keyOrObj, value) {
+        if (typeof keyOrObj === 'string') {
+            this.attrKV(keyOrObj, value);
+        }
+        else if (isObject(keyOrObj)) {
+            var obj = keyOrObj;
+            var keysArr = keys(obj);
+            for (var i = 0; i < keysArr.length; i++) {
+                var key = keysArr[i];
+                this.attrKV(key, keyOrObj[key]);
+            }
+        }
+        this.markRedraw();
+        return this;
+    };
+    Element.prototype.saveCurrentToNormalState = function (toState) {
+        this._innerSaveToNormal(toState);
+        var normalState = this._normalState;
+        for (var i = 0; i < this.animators.length; i++) {
+            var animator = this.animators[i];
+            var fromStateTransition = animator.__fromStateTransition;
+            if (animator.getLoop() || fromStateTransition && fromStateTransition !== PRESERVED_NORMAL_STATE) {
+                continue;
+            }
+            var targetName = animator.targetName;
+            var target = targetName
+                ? normalState[targetName] : normalState;
+            animator.saveTo(target);
+        }
+    };
+    Element.prototype._innerSaveToNormal = function (toState) {
+        var normalState = this._normalState;
+        if (!normalState) {
+            normalState = this._normalState = {};
+        }
+        if (toState.textConfig && !normalState.textConfig) {
+            normalState.textConfig = this.textConfig;
+        }
+        this._savePrimaryToNormal(toState, normalState, PRIMARY_STATES_KEYS);
+    };
+    Element.prototype._savePrimaryToNormal = function (toState, normalState, primaryKeys) {
+        for (var i = 0; i < primaryKeys.length; i++) {
+            var key = primaryKeys[i];
+            if (toState[key] != null && !(key in normalState)) {
+                normalState[key] = this[key];
+            }
+        }
+    };
+    Element.prototype.hasState = function () {
+        return this.currentStates.length > 0;
+    };
+    Element.prototype.getState = function (name) {
+        return this.states[name];
+    };
+    Element.prototype.ensureState = function (name) {
+        var states = this.states;
+        if (!states[name]) {
+            states[name] = {};
+        }
+        return states[name];
+    };
+    Element.prototype.clearStates = function (noAnimation) {
+        this.useState(PRESERVED_NORMAL_STATE, false, noAnimation);
+    };
+    Element.prototype.useState = function (stateName, keepCurrentStates, noAnimation, forceUseHoverLayer) {
+        var toNormalState = stateName === PRESERVED_NORMAL_STATE;
+        var hasStates = this.hasState();
+        if (!hasStates && toNormalState) {
+            return;
+        }
+        var currentStates = this.currentStates;
+        var animationCfg = this.stateTransition;
+        if (indexOf(currentStates, stateName) >= 0 && (keepCurrentStates || currentStates.length === 1)) {
+            return;
+        }
+        var state;
+        if (this.stateProxy && !toNormalState) {
+            state = this.stateProxy(stateName);
+        }
+        if (!state) {
+            state = (this.states && this.states[stateName]);
+        }
+        if (!state && !toNormalState) {
+            logError("State " + stateName + " not exists.");
+            return;
+        }
+        if (!toNormalState) {
+            this.saveCurrentToNormalState(state);
+        }
+        var useHoverLayer = !!((state && state.hoverLayer) || forceUseHoverLayer);
+        if (useHoverLayer) {
+            this._toggleHoverLayerFlag(true);
+        }
+        this._applyStateObj(stateName, state, this._normalState, keepCurrentStates, !noAnimation && !this.__inHover && animationCfg && animationCfg.duration > 0, animationCfg);
+        var textContent = this._textContent;
+        var textGuide = this._textGuide;
+        if (textContent) {
+            textContent.useState(stateName, keepCurrentStates, noAnimation, useHoverLayer);
+        }
+        if (textGuide) {
+            textGuide.useState(stateName, keepCurrentStates, noAnimation, useHoverLayer);
+        }
+        if (toNormalState) {
+            this.currentStates = [];
+            this._normalState = {};
+        }
+        else {
+            if (!keepCurrentStates) {
+                this.currentStates = [stateName];
+            }
+            else {
+                this.currentStates.push(stateName);
+            }
+        }
+        this._updateAnimationTargets();
+        this.markRedraw();
+        if (!useHoverLayer && this.__inHover) {
+            this._toggleHoverLayerFlag(false);
+            this.__dirty &= ~REDRAW_BIT;
+        }
+        return state;
+    };
+    Element.prototype.useStates = function (states, noAnimation, forceUseHoverLayer) {
+        if (!states.length) {
+            this.clearStates();
+        }
+        else {
+            var stateObjects = [];
+            var currentStates = this.currentStates;
+            var len = states.length;
+            var notChange = len === currentStates.length;
+            if (notChange) {
+                for (var i = 0; i < len; i++) {
+                    if (states[i] !== currentStates[i]) {
+                        notChange = false;
+                        break;
+                    }
+                }
+            }
+            if (notChange) {
+                return;
+            }
+            for (var i = 0; i < len; i++) {
+                var stateName = states[i];
+                var stateObj = void 0;
+                if (this.stateProxy) {
+                    stateObj = this.stateProxy(stateName, states);
+                }
+                if (!stateObj) {
+                    stateObj = this.states[stateName];
+                }
+                if (stateObj) {
+                    stateObjects.push(stateObj);
+                }
+            }
+            var lastStateObj = stateObjects[len - 1];
+            var useHoverLayer = !!((lastStateObj && lastStateObj.hoverLayer) || forceUseHoverLayer);
+            if (useHoverLayer) {
+                this._toggleHoverLayerFlag(true);
+            }
+            var mergedState = this._mergeStates(stateObjects);
+            var animationCfg = this.stateTransition;
+            this.saveCurrentToNormalState(mergedState);
+            this._applyStateObj(states.join(','), mergedState, this._normalState, false, !noAnimation && !this.__inHover && animationCfg && animationCfg.duration > 0, animationCfg);
+            var textContent = this._textContent;
+            var textGuide = this._textGuide;
+            if (textContent) {
+                textContent.useStates(states, noAnimation, useHoverLayer);
+            }
+            if (textGuide) {
+                textGuide.useStates(states, noAnimation, useHoverLayer);
+            }
+            this._updateAnimationTargets();
+            this.currentStates = states.slice();
+            this.markRedraw();
+            if (!useHoverLayer && this.__inHover) {
+                this._toggleHoverLayerFlag(false);
+                this.__dirty &= ~REDRAW_BIT;
+            }
+        }
+    };
+    Element.prototype.isSilent = function () {
+        var isSilent = this.silent;
+        var ancestor = this.parent;
+        while (!isSilent && ancestor) {
+            if (ancestor.silent) {
+                isSilent = true;
+                break;
+            }
+            ancestor = ancestor.parent;
+        }
+        return isSilent;
+    };
+    Element.prototype._updateAnimationTargets = function () {
+        for (var i = 0; i < this.animators.length; i++) {
+            var animator = this.animators[i];
+            if (animator.targetName) {
+                animator.changeTarget(this[animator.targetName]);
+            }
+        }
+    };
+    Element.prototype.removeState = function (state) {
+        var idx = indexOf(this.currentStates, state);
+        if (idx >= 0) {
+            var currentStates = this.currentStates.slice();
+            currentStates.splice(idx, 1);
+            this.useStates(currentStates);
+        }
+    };
+    Element.prototype.replaceState = function (oldState, newState, forceAdd) {
+        var currentStates = this.currentStates.slice();
+        var idx = indexOf(currentStates, oldState);
+        var newStateExists = indexOf(currentStates, newState) >= 0;
+        if (idx >= 0) {
+            if (!newStateExists) {
+                currentStates[idx] = newState;
+            }
+            else {
+                currentStates.splice(idx, 1);
+            }
+        }
+        else if (forceAdd && !newStateExists) {
+            currentStates.push(newState);
+        }
+        this.useStates(currentStates);
+    };
+    Element.prototype.toggleState = function (state, enable) {
+        if (enable) {
+            this.useState(state, true);
+        }
+        else {
+            this.removeState(state);
+        }
+    };
+    Element.prototype._mergeStates = function (states) {
+        var mergedState = {};
+        var mergedTextConfig;
+        for (var i = 0; i < states.length; i++) {
+            var state = states[i];
+            extend(mergedState, state);
+            if (state.textConfig) {
+                mergedTextConfig = mergedTextConfig || {};
+                extend(mergedTextConfig, state.textConfig);
+            }
+        }
+        if (mergedTextConfig) {
+            mergedState.textConfig = mergedTextConfig;
+        }
+        return mergedState;
+    };
+    Element.prototype._applyStateObj = function (stateName, state, normalState, keepCurrentStates, transition, animationCfg) {
+        var needsRestoreToNormal = !(state && keepCurrentStates);
+        if (state && state.textConfig) {
+            this.textConfig = extend({}, keepCurrentStates ? this.textConfig : normalState.textConfig);
+            extend(this.textConfig, state.textConfig);
+        }
+        else if (needsRestoreToNormal) {
+            if (normalState.textConfig) {
+                this.textConfig = normalState.textConfig;
+            }
+        }
+        var transitionTarget = {};
+        var hasTransition = false;
+        for (var i = 0; i < PRIMARY_STATES_KEYS.length; i++) {
+            var key = PRIMARY_STATES_KEYS[i];
+            var propNeedsTransition = transition && DEFAULT_ANIMATABLE_MAP[key];
+            if (state && state[key] != null) {
+                if (propNeedsTransition) {
+                    hasTransition = true;
+                    transitionTarget[key] = state[key];
+                }
+                else {
+                    this[key] = state[key];
+                }
+            }
+            else if (needsRestoreToNormal) {
+                if (normalState[key] != null) {
+                    if (propNeedsTransition) {
+                        hasTransition = true;
+                        transitionTarget[key] = normalState[key];
+                    }
+                    else {
+                        this[key] = normalState[key];
+                    }
+                }
+            }
+        }
+        if (!transition) {
+            for (var i = 0; i < this.animators.length; i++) {
+                var animator = this.animators[i];
+                var targetName = animator.targetName;
+                if (!animator.getLoop()) {
+                    animator.__changeFinalValue(targetName
+                        ? (state || normalState)[targetName]
+                        : (state || normalState));
+                }
+            }
+        }
+        if (hasTransition) {
+            this._transitionState(stateName, transitionTarget, animationCfg);
+        }
+    };
+    Element.prototype._attachComponent = function (componentEl) {
+        if (componentEl.__zr && !componentEl.__hostTarget) {
+            if (process.env.NODE_ENV !== 'production') {
+                throw new Error('Text element has been added to zrender.');
+            }
+            return;
+        }
+        if (componentEl === this) {
+            if (process.env.NODE_ENV !== 'production') {
+                throw new Error('Recursive component attachment.');
+            }
+            return;
+        }
+        var zr = this.__zr;
+        if (zr) {
+            componentEl.addSelfToZr(zr);
+        }
+        componentEl.__zr = zr;
+        componentEl.__hostTarget = this;
+    };
+    Element.prototype._detachComponent = function (componentEl) {
+        if (componentEl.__zr) {
+            componentEl.removeSelfFromZr(componentEl.__zr);
+        }
+        componentEl.__zr = null;
+        componentEl.__hostTarget = null;
+    };
+    Element.prototype.getClipPath = function () {
+        return this._clipPath;
+    };
+    Element.prototype.setClipPath = function (clipPath) {
+        if (this._clipPath && this._clipPath !== clipPath) {
+            this.removeClipPath();
+        }
+        this._attachComponent(clipPath);
+        this._clipPath = clipPath;
+        this.markRedraw();
+    };
+    Element.prototype.removeClipPath = function () {
+        var clipPath = this._clipPath;
+        if (clipPath) {
+            this._detachComponent(clipPath);
+            this._clipPath = null;
+            this.markRedraw();
+        }
+    };
+    Element.prototype.getTextContent = function () {
+        return this._textContent;
+    };
+    Element.prototype.setTextContent = function (textEl) {
+        var previousTextContent = this._textContent;
+        if (previousTextContent === textEl) {
+            return;
+        }
+        if (previousTextContent && previousTextContent !== textEl) {
+            this.removeTextContent();
+        }
+        if (process.env.NODE_ENV !== 'production') {
+            if (textEl.__zr && !textEl.__hostTarget) {
+                throw new Error('Text element has been added to zrender.');
+            }
+        }
+        textEl.innerTransformable = new Transformable();
+        this._attachComponent(textEl);
+        this._textContent = textEl;
+        this.markRedraw();
+    };
+    Element.prototype.setTextConfig = function (cfg) {
+        if (!this.textConfig) {
+            this.textConfig = {};
+        }
+        extend(this.textConfig, cfg);
+        this.markRedraw();
+    };
+    Element.prototype.removeTextConfig = function () {
+        this.textConfig = null;
+        this.markRedraw();
+    };
+    Element.prototype.removeTextContent = function () {
+        var textEl = this._textContent;
+        if (textEl) {
+            textEl.innerTransformable = null;
+            this._detachComponent(textEl);
+            this._textContent = null;
+            this._innerTextDefaultStyle = null;
+            this.markRedraw();
+        }
+    };
+    Element.prototype.getTextGuideLine = function () {
+        return this._textGuide;
+    };
+    Element.prototype.setTextGuideLine = function (guideLine) {
+        if (this._textGuide && this._textGuide !== guideLine) {
+            this.removeTextGuideLine();
+        }
+        this._attachComponent(guideLine);
+        this._textGuide = guideLine;
+        this.markRedraw();
+    };
+    Element.prototype.removeTextGuideLine = function () {
+        var textGuide = this._textGuide;
+        if (textGuide) {
+            this._detachComponent(textGuide);
+            this._textGuide = null;
+            this.markRedraw();
+        }
+    };
+    Element.prototype.markRedraw = function () {
+        this.__dirty |= REDRAW_BIT;
+        var zr = this.__zr;
+        if (zr) {
+            if (this.__inHover) {
+                zr.refreshHover();
+            }
+            else {
+                zr.refresh();
+            }
+        }
+        if (this.__hostTarget) {
+            this.__hostTarget.markRedraw();
+        }
+    };
+    Element.prototype.dirty = function () {
+        this.markRedraw();
+    };
+    Element.prototype._toggleHoverLayerFlag = function (inHover) {
+        this.__inHover = inHover;
+        var textContent = this._textContent;
+        var textGuide = this._textGuide;
+        if (textContent) {
+            textContent.__inHover = inHover;
+        }
+        if (textGuide) {
+            textGuide.__inHover = inHover;
+        }
+    };
+    Element.prototype.addSelfToZr = function (zr) {
+        if (this.__zr === zr) {
+            return;
+        }
+        this.__zr = zr;
+        var animators = this.animators;
+        if (animators) {
+            for (var i = 0; i < animators.length; i++) {
+                zr.animation.addAnimator(animators[i]);
+            }
+        }
+        if (this._clipPath) {
+            this._clipPath.addSelfToZr(zr);
+        }
+        if (this._textContent) {
+            this._textContent.addSelfToZr(zr);
+        }
+        if (this._textGuide) {
+            this._textGuide.addSelfToZr(zr);
+        }
+    };
+    Element.prototype.removeSelfFromZr = function (zr) {
+        if (!this.__zr) {
+            return;
+        }
+        this.__zr = null;
+        var animators = this.animators;
+        if (animators) {
+            for (var i = 0; i < animators.length; i++) {
+                zr.animation.removeAnimator(animators[i]);
+            }
+        }
+        if (this._clipPath) {
+            this._clipPath.removeSelfFromZr(zr);
+        }
+        if (this._textContent) {
+            this._textContent.removeSelfFromZr(zr);
+        }
+        if (this._textGuide) {
+            this._textGuide.removeSelfFromZr(zr);
+        }
+    };
+    Element.prototype.animate = function (key, loop, allowDiscreteAnimation) {
+        var target = key ? this[key] : this;
+        if (process.env.NODE_ENV !== 'production') {
+            if (!target) {
+                logError('Property "'
+                    + key
+                    + '" is not existed in element '
+                    + this.id);
+                return;
+            }
+        }
+        var animator = new Animator(target, loop, allowDiscreteAnimation);
+        key && (animator.targetName = key);
+        this.addAnimator(animator, key);
+        return animator;
+    };
+    Element.prototype.addAnimator = function (animator, key) {
+        var zr = this.__zr;
+        var el = this;
+        animator.during(function () {
+            el.updateDuringAnimation(key);
+        }).done(function () {
+            var animators = el.animators;
+            var idx = indexOf(animators, animator);
+            if (idx >= 0) {
+                animators.splice(idx, 1);
+            }
+        });
+        this.animators.push(animator);
+        if (zr) {
+            zr.animation.addAnimator(animator);
+        }
+        zr && zr.wakeUp();
+    };
+    Element.prototype.updateDuringAnimation = function (key) {
+        this.markRedraw();
+    };
+    Element.prototype.stopAnimation = function (scope, forwardToLast) {
+        var animators = this.animators;
+        var len = animators.length;
+        var leftAnimators = [];
+        for (var i = 0; i < len; i++) {
+            var animator = animators[i];
+            if (!scope || scope === animator.scope) {
+                animator.stop(forwardToLast);
+            }
+            else {
+                leftAnimators.push(animator);
+            }
+        }
+        this.animators = leftAnimators;
+        return this;
+    };
+    Element.prototype.animateTo = function (target, cfg, animationProps) {
+        animateTo(this, target, cfg, animationProps);
+    };
+    Element.prototype.animateFrom = function (target, cfg, animationProps) {
+        animateTo(this, target, cfg, animationProps, true);
+    };
+    Element.prototype._transitionState = function (stateName, target, cfg, animationProps) {
+        var animators = animateTo(this, target, cfg, animationProps);
+        for (var i = 0; i < animators.length; i++) {
+            animators[i].__fromStateTransition = stateName;
+        }
+    };
+    Element.prototype.getBoundingRect = function () {
+        return null;
+    };
+    Element.prototype.getPaintRect = function () {
+        return null;
+    };
+    Element.initDefaultProps = (function () {
+        var elProto = Element.prototype;
+        elProto.type = 'element';
+        elProto.name = '';
+        elProto.ignore =
+            elProto.silent =
+                elProto.isGroup =
+                    elProto.draggable =
+                        elProto.dragging =
+                            elProto.ignoreClip =
+                                elProto.__inHover = false;
+        elProto.__dirty = REDRAW_BIT;
+        var logs = {};
+        function logDeprecatedError(key, xKey, yKey) {
+            if (!logs[key + xKey + yKey]) {
+                console.warn("DEPRECATED: '" + key + "' has been deprecated. use '" + xKey + "', '" + yKey + "' instead");
+                logs[key + xKey + yKey] = true;
+            }
+        }
+        function createLegacyProperty(key, privateKey, xKey, yKey) {
+            Object.defineProperty(elProto, key, {
+                get: function () {
+                    if (process.env.NODE_ENV !== 'production') {
+                        logDeprecatedError(key, xKey, yKey);
+                    }
+                    if (!this[privateKey]) {
+                        var pos = this[privateKey] = [];
+                        enhanceArray(this, pos);
+                    }
+                    return this[privateKey];
+                },
+                set: function (pos) {
+                    if (process.env.NODE_ENV !== 'production') {
+                        logDeprecatedError(key, xKey, yKey);
+                    }
+                    this[xKey] = pos[0];
+                    this[yKey] = pos[1];
+                    this[privateKey] = pos;
+                    enhanceArray(this, pos);
+                }
+            });
+            function enhanceArray(self, pos) {
+                Object.defineProperty(pos, 0, {
+                    get: function () {
+                        return self[xKey];
+                    },
+                    set: function (val) {
+                        self[xKey] = val;
+                    }
+                });
+                Object.defineProperty(pos, 1, {
+                    get: function () {
+                        return self[yKey];
+                    },
+                    set: function (val) {
+                        self[yKey] = val;
+                    }
+                });
+            }
+        }
+        if (Object.defineProperty) {
+            createLegacyProperty('position', '_legacyPos', 'x', 'y');
+            createLegacyProperty('scale', '_legacyScale', 'scaleX', 'scaleY');
+            createLegacyProperty('origin', '_legacyOrigin', 'originX', 'originY');
+        }
+    })();
+    return Element;
+}());
+mixin(Element, Eventful);
+mixin(Element, Transformable);
+function animateTo(animatable, target, cfg, animationProps, reverse) {
+    cfg = cfg || {};
+    var animators = [];
+    animateToShallow(animatable, '', animatable, target, cfg, animationProps, animators, reverse);
+    var finishCount = animators.length;
+    var doneHappened = false;
+    var cfgDone = cfg.done;
+    var cfgAborted = cfg.aborted;
+    var doneCb = function () {
+        doneHappened = true;
+        finishCount--;
+        if (finishCount <= 0) {
+            doneHappened
+                ? (cfgDone && cfgDone())
+                : (cfgAborted && cfgAborted());
+        }
+    };
+    var abortedCb = function () {
+        finishCount--;
+        if (finishCount <= 0) {
+            doneHappened
+                ? (cfgDone && cfgDone())
+                : (cfgAborted && cfgAborted());
+        }
+    };
+    if (!finishCount) {
+        cfgDone && cfgDone();
+    }
+    if (animators.length > 0 && cfg.during) {
+        animators[0].during(function (target, percent) {
+            cfg.during(percent);
+        });
+    }
+    for (var i = 0; i < animators.length; i++) {
+        var animator = animators[i];
+        if (doneCb) {
+            animator.done(doneCb);
+        }
+        if (abortedCb) {
+            animator.aborted(abortedCb);
+        }
+        if (cfg.force) {
+            animator.duration(cfg.duration);
+        }
+        animator.start(cfg.easing);
+    }
+    return animators;
+}
+function copyArrShallow(source, target, len) {
+    for (var i = 0; i < len; i++) {
+        source[i] = target[i];
+    }
+}
+function is2DArray(value) {
+    return isArrayLike(value[0]);
+}
+function copyValue(target, source, key) {
+    if (isArrayLike(source[key])) {
+        if (!isArrayLike(target[key])) {
+            target[key] = [];
+        }
+        if (isTypedArray(source[key])) {
+            var len = source[key].length;
+            if (target[key].length !== len) {
+                target[key] = new (source[key].constructor)(len);
+                copyArrShallow(target[key], source[key], len);
+            }
+        }
+        else {
+            var sourceArr = source[key];
+            var targetArr = target[key];
+            var len0 = sourceArr.length;
+            if (is2DArray(sourceArr)) {
+                var len1 = sourceArr[0].length;
+                for (var i = 0; i < len0; i++) {
+                    if (!targetArr[i]) {
+                        targetArr[i] = Array.prototype.slice.call(sourceArr[i]);
+                    }
+                    else {
+                        copyArrShallow(targetArr[i], sourceArr[i], len1);
+                    }
+                }
+            }
+            else {
+                copyArrShallow(targetArr, sourceArr, len0);
+            }
+            targetArr.length = sourceArr.length;
+        }
+    }
+    else {
+        target[key] = source[key];
+    }
+}
+function isValueSame(val1, val2) {
+    return val1 === val2
+        || isArrayLike(val1) && isArrayLike(val2) && is1DArraySame(val1, val2);
+}
+function is1DArraySame(arr0, arr1) {
+    var len = arr0.length;
+    if (len !== arr1.length) {
+        return false;
+    }
+    for (var i = 0; i < len; i++) {
+        if (arr0[i] !== arr1[i]) {
+            return false;
+        }
+    }
+    return true;
+}
+function animateToShallow(animatable, topKey, animateObj, target, cfg, animationProps, animators, reverse) {
+    var targetKeys = keys(target);
+    var duration = cfg.duration;
+    var delay = cfg.delay;
+    var additive = cfg.additive;
+    var setToFinal = cfg.setToFinal;
+    var animateAll = !isObject(animationProps);
+    var existsAnimators = animatable.animators;
+    var animationKeys = [];
+    for (var k = 0; k < targetKeys.length; k++) {
+        var innerKey = targetKeys[k];
+        var targetVal = target[innerKey];
+        if (targetVal != null && animateObj[innerKey] != null
+            && (animateAll || animationProps[innerKey])) {
+            if (isObject(targetVal)
+                && !isArrayLike(targetVal)
+                && !isGradientObject(targetVal)) {
+                if (topKey) {
+                    if (!reverse) {
+                        animateObj[innerKey] = targetVal;
+                        animatable.updateDuringAnimation(topKey);
+                    }
+                    continue;
+                }
+                animateToShallow(animatable, innerKey, animateObj[innerKey], targetVal, cfg, animationProps && animationProps[innerKey], animators, reverse);
+            }
+            else {
+                animationKeys.push(innerKey);
+            }
+        }
+        else if (!reverse) {
+            animateObj[innerKey] = targetVal;
+            animatable.updateDuringAnimation(topKey);
+            animationKeys.push(innerKey);
+        }
+    }
+    var keyLen = animationKeys.length;
+    if (!additive && keyLen) {
+        for (var i = 0; i < existsAnimators.length; i++) {
+            var animator = existsAnimators[i];
+            if (animator.targetName === topKey) {
+                var allAborted = animator.stopTracks(animationKeys);
+                if (allAborted) {
+                    var idx = indexOf(existsAnimators, animator);
+                    existsAnimators.splice(idx, 1);
+                }
+            }
+        }
+    }
+    if (!cfg.force) {
+        animationKeys = filter(animationKeys, function (key) { return !isValueSame(target[key], animateObj[key]); });
+        keyLen = animationKeys.length;
+    }
+    if (keyLen > 0
+        || (cfg.force && !animators.length)) {
+        var revertedSource = void 0;
+        var reversedTarget = void 0;
+        var sourceClone = void 0;
+        if (reverse) {
+            reversedTarget = {};
+            if (setToFinal) {
+                revertedSource = {};
+            }
+            for (var i = 0; i < keyLen; i++) {
+                var innerKey = animationKeys[i];
+                reversedTarget[innerKey] = animateObj[innerKey];
+                if (setToFinal) {
+                    revertedSource[innerKey] = target[innerKey];
+                }
+                else {
+                    animateObj[innerKey] = target[innerKey];
+                }
+            }
+        }
+        else if (setToFinal) {
+            sourceClone = {};
+            for (var i = 0; i < keyLen; i++) {
+                var innerKey = animationKeys[i];
+                sourceClone[innerKey] = cloneValue(animateObj[innerKey]);
+                copyValue(animateObj, target, innerKey);
+            }
+        }
+        var animator = new Animator(animateObj, false, false, additive ? filter(existsAnimators, function (animator) { return animator.targetName === topKey; }) : null);
+        animator.targetName = topKey;
+        if (cfg.scope) {
+            animator.scope = cfg.scope;
+        }
+        if (setToFinal && revertedSource) {
+            animator.whenWithKeys(0, revertedSource, animationKeys);
+        }
+        if (sourceClone) {
+            animator.whenWithKeys(0, sourceClone, animationKeys);
+        }
+        animator.whenWithKeys(duration == null ? 500 : duration, reverse ? reversedTarget : target, animationKeys).delay(delay || 0);
+        animatable.addAnimator(animator, topKey);
+        animators.push(animator);
+    }
+}
+export default Element;

+ 49 - 0
node_modules/echarts/node_modules/zrender/lib/Handler.d.ts

@@ -0,0 +1,49 @@
+import Eventful from './core/Eventful';
+import Displayable from './graphic/Displayable';
+import { PainterBase } from './PainterBase';
+import { HandlerProxyInterface } from './dom/HandlerProxy';
+import { ZRRawEvent, ElementEventName } from './core/types';
+import Storage from './Storage';
+import Element from './Element';
+declare class HoveredResult {
+    x: number;
+    y: number;
+    target: Displayable;
+    topTarget: Displayable;
+    constructor(x?: number, y?: number);
+}
+declare type HandlerName = 'click' | 'dblclick' | 'mousewheel' | 'mouseout' | 'mouseup' | 'mousedown' | 'mousemove' | 'contextmenu';
+declare class Handler extends Eventful {
+    storage: Storage;
+    painter: PainterBase;
+    painterRoot: HTMLElement;
+    proxy: HandlerProxyInterface;
+    private _hovered;
+    private _gestureMgr;
+    private _draggingMgr;
+    private _pointerSize;
+    _downEl: Element;
+    _upEl: Element;
+    _downPoint: [number, number];
+    constructor(storage: Storage, painter: PainterBase, proxy: HandlerProxyInterface, painterRoot: HTMLElement, pointerSize: number);
+    setHandlerProxy(proxy: HandlerProxyInterface): void;
+    mousemove(event: ZRRawEvent): void;
+    mouseout(event: ZRRawEvent): void;
+    resize(): void;
+    dispatch(eventName: HandlerName, eventArgs?: any): void;
+    dispose(): void;
+    setCursorStyle(cursorStyle: string): void;
+    dispatchToElement(targetInfo: {
+        target?: Element;
+        topTarget?: Element;
+    }, eventName: ElementEventName, event: ZRRawEvent): void;
+    findHover(x: number, y: number, exclude?: Displayable): HoveredResult;
+    processGesture(event: ZRRawEvent, stage?: 'start' | 'end' | 'change'): void;
+    click: (event: ZRRawEvent) => void;
+    mousedown: (event: ZRRawEvent) => void;
+    mouseup: (event: ZRRawEvent) => void;
+    mousewheel: (event: ZRRawEvent) => void;
+    dblclick: (event: ZRRawEvent) => void;
+    contextmenu: (event: ZRRawEvent) => void;
+}
+export default Handler;

+ 295 - 0
node_modules/echarts/node_modules/zrender/lib/Handler.js

@@ -0,0 +1,295 @@
+import { __extends } from "tslib";
+import * as util from './core/util.js';
+import * as vec2 from './core/vector.js';
+import Draggable from './mixin/Draggable.js';
+import Eventful from './core/Eventful.js';
+import * as eventTool from './core/event.js';
+import { GestureMgr } from './core/GestureMgr.js';
+import BoundingRect from './core/BoundingRect.js';
+var SILENT = 'silent';
+function makeEventPacket(eveType, targetInfo, event) {
+    return {
+        type: eveType,
+        event: event,
+        target: targetInfo.target,
+        topTarget: targetInfo.topTarget,
+        cancelBubble: false,
+        offsetX: event.zrX,
+        offsetY: event.zrY,
+        gestureEvent: event.gestureEvent,
+        pinchX: event.pinchX,
+        pinchY: event.pinchY,
+        pinchScale: event.pinchScale,
+        wheelDelta: event.zrDelta,
+        zrByTouch: event.zrByTouch,
+        which: event.which,
+        stop: stopEvent
+    };
+}
+function stopEvent() {
+    eventTool.stop(this.event);
+}
+var EmptyProxy = (function (_super) {
+    __extends(EmptyProxy, _super);
+    function EmptyProxy() {
+        var _this = _super !== null && _super.apply(this, arguments) || this;
+        _this.handler = null;
+        return _this;
+    }
+    EmptyProxy.prototype.dispose = function () { };
+    EmptyProxy.prototype.setCursor = function () { };
+    return EmptyProxy;
+}(Eventful));
+var HoveredResult = (function () {
+    function HoveredResult(x, y) {
+        this.x = x;
+        this.y = y;
+    }
+    return HoveredResult;
+}());
+var handlerNames = [
+    'click', 'dblclick', 'mousewheel', 'mouseout',
+    'mouseup', 'mousedown', 'mousemove', 'contextmenu'
+];
+var tmpRect = new BoundingRect(0, 0, 0, 0);
+var Handler = (function (_super) {
+    __extends(Handler, _super);
+    function Handler(storage, painter, proxy, painterRoot, pointerSize) {
+        var _this = _super.call(this) || this;
+        _this._hovered = new HoveredResult(0, 0);
+        _this.storage = storage;
+        _this.painter = painter;
+        _this.painterRoot = painterRoot;
+        _this._pointerSize = pointerSize;
+        proxy = proxy || new EmptyProxy();
+        _this.proxy = null;
+        _this.setHandlerProxy(proxy);
+        _this._draggingMgr = new Draggable(_this);
+        return _this;
+    }
+    Handler.prototype.setHandlerProxy = function (proxy) {
+        if (this.proxy) {
+            this.proxy.dispose();
+        }
+        if (proxy) {
+            util.each(handlerNames, function (name) {
+                proxy.on && proxy.on(name, this[name], this);
+            }, this);
+            proxy.handler = this;
+        }
+        this.proxy = proxy;
+    };
+    Handler.prototype.mousemove = function (event) {
+        var x = event.zrX;
+        var y = event.zrY;
+        var isOutside = isOutsideBoundary(this, x, y);
+        var lastHovered = this._hovered;
+        var lastHoveredTarget = lastHovered.target;
+        if (lastHoveredTarget && !lastHoveredTarget.__zr) {
+            lastHovered = this.findHover(lastHovered.x, lastHovered.y);
+            lastHoveredTarget = lastHovered.target;
+        }
+        var hovered = this._hovered = isOutside ? new HoveredResult(x, y) : this.findHover(x, y);
+        var hoveredTarget = hovered.target;
+        var proxy = this.proxy;
+        proxy.setCursor && proxy.setCursor(hoveredTarget ? hoveredTarget.cursor : 'default');
+        if (lastHoveredTarget && hoveredTarget !== lastHoveredTarget) {
+            this.dispatchToElement(lastHovered, 'mouseout', event);
+        }
+        this.dispatchToElement(hovered, 'mousemove', event);
+        if (hoveredTarget && hoveredTarget !== lastHoveredTarget) {
+            this.dispatchToElement(hovered, 'mouseover', event);
+        }
+    };
+    Handler.prototype.mouseout = function (event) {
+        var eventControl = event.zrEventControl;
+        if (eventControl !== 'only_globalout') {
+            this.dispatchToElement(this._hovered, 'mouseout', event);
+        }
+        if (eventControl !== 'no_globalout') {
+            this.trigger('globalout', { type: 'globalout', event: event });
+        }
+    };
+    Handler.prototype.resize = function () {
+        this._hovered = new HoveredResult(0, 0);
+    };
+    Handler.prototype.dispatch = function (eventName, eventArgs) {
+        var handler = this[eventName];
+        handler && handler.call(this, eventArgs);
+    };
+    Handler.prototype.dispose = function () {
+        this.proxy.dispose();
+        this.storage = null;
+        this.proxy = null;
+        this.painter = null;
+    };
+    Handler.prototype.setCursorStyle = function (cursorStyle) {
+        var proxy = this.proxy;
+        proxy.setCursor && proxy.setCursor(cursorStyle);
+    };
+    Handler.prototype.dispatchToElement = function (targetInfo, eventName, event) {
+        targetInfo = targetInfo || {};
+        var el = targetInfo.target;
+        if (el && el.silent) {
+            return;
+        }
+        var eventKey = ('on' + eventName);
+        var eventPacket = makeEventPacket(eventName, targetInfo, event);
+        while (el) {
+            el[eventKey]
+                && (eventPacket.cancelBubble = !!el[eventKey].call(el, eventPacket));
+            el.trigger(eventName, eventPacket);
+            el = el.__hostTarget ? el.__hostTarget : el.parent;
+            if (eventPacket.cancelBubble) {
+                break;
+            }
+        }
+        if (!eventPacket.cancelBubble) {
+            this.trigger(eventName, eventPacket);
+            if (this.painter && this.painter.eachOtherLayer) {
+                this.painter.eachOtherLayer(function (layer) {
+                    if (typeof (layer[eventKey]) === 'function') {
+                        layer[eventKey].call(layer, eventPacket);
+                    }
+                    if (layer.trigger) {
+                        layer.trigger(eventName, eventPacket);
+                    }
+                });
+            }
+        }
+    };
+    Handler.prototype.findHover = function (x, y, exclude) {
+        var list = this.storage.getDisplayList();
+        var out = new HoveredResult(x, y);
+        setHoverTarget(list, out, x, y, exclude);
+        if (this._pointerSize && !out.target) {
+            var candidates = [];
+            var pointerSize = this._pointerSize;
+            var targetSizeHalf = pointerSize / 2;
+            var pointerRect = new BoundingRect(x - targetSizeHalf, y - targetSizeHalf, pointerSize, pointerSize);
+            for (var i = list.length - 1; i >= 0; i--) {
+                var el = list[i];
+                if (el !== exclude
+                    && !el.ignore
+                    && !el.ignoreCoarsePointer
+                    && (!el.parent || !el.parent.ignoreCoarsePointer)) {
+                    tmpRect.copy(el.getBoundingRect());
+                    if (el.transform) {
+                        tmpRect.applyTransform(el.transform);
+                    }
+                    if (tmpRect.intersect(pointerRect)) {
+                        candidates.push(el);
+                    }
+                }
+            }
+            if (candidates.length) {
+                var rStep = 4;
+                var thetaStep = Math.PI / 12;
+                var PI2 = Math.PI * 2;
+                for (var r = 0; r < targetSizeHalf; r += rStep) {
+                    for (var theta = 0; theta < PI2; theta += thetaStep) {
+                        var x1 = x + r * Math.cos(theta);
+                        var y1 = y + r * Math.sin(theta);
+                        setHoverTarget(candidates, out, x1, y1, exclude);
+                        if (out.target) {
+                            return out;
+                        }
+                    }
+                }
+            }
+        }
+        return out;
+    };
+    Handler.prototype.processGesture = function (event, stage) {
+        if (!this._gestureMgr) {
+            this._gestureMgr = new GestureMgr();
+        }
+        var gestureMgr = this._gestureMgr;
+        stage === 'start' && gestureMgr.clear();
+        var gestureInfo = gestureMgr.recognize(event, this.findHover(event.zrX, event.zrY, null).target, this.proxy.dom);
+        stage === 'end' && gestureMgr.clear();
+        if (gestureInfo) {
+            var type = gestureInfo.type;
+            event.gestureEvent = type;
+            var res = new HoveredResult();
+            res.target = gestureInfo.target;
+            this.dispatchToElement(res, type, gestureInfo.event);
+        }
+    };
+    return Handler;
+}(Eventful));
+util.each(['click', 'mousedown', 'mouseup', 'mousewheel', 'dblclick', 'contextmenu'], function (name) {
+    Handler.prototype[name] = function (event) {
+        var x = event.zrX;
+        var y = event.zrY;
+        var isOutside = isOutsideBoundary(this, x, y);
+        var hovered;
+        var hoveredTarget;
+        if (name !== 'mouseup' || !isOutside) {
+            hovered = this.findHover(x, y);
+            hoveredTarget = hovered.target;
+        }
+        if (name === 'mousedown') {
+            this._downEl = hoveredTarget;
+            this._downPoint = [event.zrX, event.zrY];
+            this._upEl = hoveredTarget;
+        }
+        else if (name === 'mouseup') {
+            this._upEl = hoveredTarget;
+        }
+        else if (name === 'click') {
+            if (this._downEl !== this._upEl
+                || !this._downPoint
+                || vec2.dist(this._downPoint, [event.zrX, event.zrY]) > 4) {
+                return;
+            }
+            this._downPoint = null;
+        }
+        this.dispatchToElement(hovered, name, event);
+    };
+});
+function isHover(displayable, x, y) {
+    if (displayable[displayable.rectHover ? 'rectContain' : 'contain'](x, y)) {
+        var el = displayable;
+        var isSilent = void 0;
+        var ignoreClip = false;
+        while (el) {
+            if (el.ignoreClip) {
+                ignoreClip = true;
+            }
+            if (!ignoreClip) {
+                var clipPath = el.getClipPath();
+                if (clipPath && !clipPath.contain(x, y)) {
+                    return false;
+                }
+            }
+            if (el.silent) {
+                isSilent = true;
+            }
+            var hostEl = el.__hostTarget;
+            el = hostEl ? hostEl : el.parent;
+        }
+        return isSilent ? SILENT : true;
+    }
+    return false;
+}
+function setHoverTarget(list, out, x, y, exclude) {
+    for (var i = list.length - 1; i >= 0; i--) {
+        var el = list[i];
+        var hoverCheckResult = void 0;
+        if (el !== exclude
+            && !el.ignore
+            && (hoverCheckResult = isHover(el, x, y))) {
+            !out.topTarget && (out.topTarget = el);
+            if (hoverCheckResult !== SILENT) {
+                out.target = el;
+                break;
+            }
+        }
+    }
+}
+function isOutsideBoundary(handlerInstance, x, y) {
+    var painter = handlerInstance.painter;
+    return x < 0 || x > painter.getWidth() || y < 0 || y > painter.getHeight();
+}
+export default Handler;

+ 24 - 0
node_modules/echarts/node_modules/zrender/lib/PainterBase.d.ts

@@ -0,0 +1,24 @@
+import { GradientObject } from './graphic/Gradient';
+import { PatternObject } from './graphic/Pattern';
+import { Dictionary } from './core/types';
+export interface PainterBase {
+    type: string;
+    root?: HTMLElement;
+    ssrOnly?: boolean;
+    resize(width?: number | string, height?: number | string): void;
+    refresh(): void;
+    clear(): void;
+    renderToString?(): string;
+    getType: () => string;
+    getWidth(): number;
+    getHeight(): number;
+    dispose(): void;
+    getViewportRoot: () => HTMLElement;
+    getViewportRootOffset: () => {
+        offsetLeft: number;
+        offsetTop: number;
+    };
+    refreshHover(): void;
+    configLayer(zlevel: number, config: Dictionary<any>): void;
+    setBackgroundColor(backgroundColor: string | GradientObject | PatternObject): void;
+}

+ 1 - 0
node_modules/echarts/node_modules/zrender/lib/PainterBase.js

@@ -0,0 +1 @@
+export {};

+ 19 - 0
node_modules/echarts/node_modules/zrender/lib/Storage.d.ts

@@ -0,0 +1,19 @@
+import Element from './Element';
+import Displayable from './graphic/Displayable';
+declare function shapeCompareFunc(a: Displayable, b: Displayable): number;
+export default class Storage {
+    private _roots;
+    private _displayList;
+    private _displayListLen;
+    traverse<T>(cb: (this: T, el: Element) => void, context?: T): void;
+    getDisplayList(update?: boolean, includeIgnore?: boolean): Displayable[];
+    updateDisplayList(includeIgnore?: boolean): void;
+    private _updateAndAddDisplayable;
+    addRoot(el: Element): void;
+    delRoot(el: Element | Element[]): void;
+    delAllRoots(): void;
+    getRoots(): Element<import("./Element").ElementProps>[];
+    dispose(): void;
+    displayableSortFunc: typeof shapeCompareFunc;
+}
+export {};

+ 158 - 0
node_modules/echarts/node_modules/zrender/lib/Storage.js

@@ -0,0 +1,158 @@
+import * as util from './core/util.js';
+import timsort from './core/timsort.js';
+import { REDRAW_BIT } from './graphic/constants.js';
+var invalidZErrorLogged = false;
+function logInvalidZError() {
+    if (invalidZErrorLogged) {
+        return;
+    }
+    invalidZErrorLogged = true;
+    console.warn('z / z2 / zlevel of displayable is invalid, which may cause unexpected errors');
+}
+function shapeCompareFunc(a, b) {
+    if (a.zlevel === b.zlevel) {
+        if (a.z === b.z) {
+            return a.z2 - b.z2;
+        }
+        return a.z - b.z;
+    }
+    return a.zlevel - b.zlevel;
+}
+var Storage = (function () {
+    function Storage() {
+        this._roots = [];
+        this._displayList = [];
+        this._displayListLen = 0;
+        this.displayableSortFunc = shapeCompareFunc;
+    }
+    Storage.prototype.traverse = function (cb, context) {
+        for (var i = 0; i < this._roots.length; i++) {
+            this._roots[i].traverse(cb, context);
+        }
+    };
+    Storage.prototype.getDisplayList = function (update, includeIgnore) {
+        includeIgnore = includeIgnore || false;
+        var displayList = this._displayList;
+        if (update || !displayList.length) {
+            this.updateDisplayList(includeIgnore);
+        }
+        return displayList;
+    };
+    Storage.prototype.updateDisplayList = function (includeIgnore) {
+        this._displayListLen = 0;
+        var roots = this._roots;
+        var displayList = this._displayList;
+        for (var i = 0, len = roots.length; i < len; i++) {
+            this._updateAndAddDisplayable(roots[i], null, includeIgnore);
+        }
+        displayList.length = this._displayListLen;
+        timsort(displayList, shapeCompareFunc);
+    };
+    Storage.prototype._updateAndAddDisplayable = function (el, clipPaths, includeIgnore) {
+        if (el.ignore && !includeIgnore) {
+            return;
+        }
+        el.beforeUpdate();
+        el.update();
+        el.afterUpdate();
+        var userSetClipPath = el.getClipPath();
+        if (el.ignoreClip) {
+            clipPaths = null;
+        }
+        else if (userSetClipPath) {
+            if (clipPaths) {
+                clipPaths = clipPaths.slice();
+            }
+            else {
+                clipPaths = [];
+            }
+            var currentClipPath = userSetClipPath;
+            var parentClipPath = el;
+            while (currentClipPath) {
+                currentClipPath.parent = parentClipPath;
+                currentClipPath.updateTransform();
+                clipPaths.push(currentClipPath);
+                parentClipPath = currentClipPath;
+                currentClipPath = currentClipPath.getClipPath();
+            }
+        }
+        if (el.childrenRef) {
+            var children = el.childrenRef();
+            for (var i = 0; i < children.length; i++) {
+                var child = children[i];
+                if (el.__dirty) {
+                    child.__dirty |= REDRAW_BIT;
+                }
+                this._updateAndAddDisplayable(child, clipPaths, includeIgnore);
+            }
+            el.__dirty = 0;
+        }
+        else {
+            var disp = el;
+            if (clipPaths && clipPaths.length) {
+                disp.__clipPaths = clipPaths;
+            }
+            else if (disp.__clipPaths && disp.__clipPaths.length > 0) {
+                disp.__clipPaths = [];
+            }
+            if (isNaN(disp.z)) {
+                logInvalidZError();
+                disp.z = 0;
+            }
+            if (isNaN(disp.z2)) {
+                logInvalidZError();
+                disp.z2 = 0;
+            }
+            if (isNaN(disp.zlevel)) {
+                logInvalidZError();
+                disp.zlevel = 0;
+            }
+            this._displayList[this._displayListLen++] = disp;
+        }
+        var decalEl = el.getDecalElement && el.getDecalElement();
+        if (decalEl) {
+            this._updateAndAddDisplayable(decalEl, clipPaths, includeIgnore);
+        }
+        var textGuide = el.getTextGuideLine();
+        if (textGuide) {
+            this._updateAndAddDisplayable(textGuide, clipPaths, includeIgnore);
+        }
+        var textEl = el.getTextContent();
+        if (textEl) {
+            this._updateAndAddDisplayable(textEl, clipPaths, includeIgnore);
+        }
+    };
+    Storage.prototype.addRoot = function (el) {
+        if (el.__zr && el.__zr.storage === this) {
+            return;
+        }
+        this._roots.push(el);
+    };
+    Storage.prototype.delRoot = function (el) {
+        if (el instanceof Array) {
+            for (var i = 0, l = el.length; i < l; i++) {
+                this.delRoot(el[i]);
+            }
+            return;
+        }
+        var idx = util.indexOf(this._roots, el);
+        if (idx >= 0) {
+            this._roots.splice(idx, 1);
+        }
+    };
+    Storage.prototype.delAllRoots = function () {
+        this._roots = [];
+        this._displayList = [];
+        this._displayListLen = 0;
+        return;
+    };
+    Storage.prototype.getRoots = function () {
+        return this._roots;
+    };
+    Storage.prototype.dispose = function () {
+        this._displayList = null;
+        this._roots = null;
+    };
+    return Storage;
+}());
+export default Storage;

+ 2 - 0
node_modules/echarts/node_modules/zrender/lib/all.d.ts

@@ -0,0 +1,2 @@
+export * from './zrender';
+export * from './export';

+ 7 - 0
node_modules/echarts/node_modules/zrender/lib/all.js

@@ -0,0 +1,7 @@
+export * from './zrender.js';
+export * from './export.js';
+import { registerPainter } from './zrender.js';
+import CanvasPainter from './canvas/Painter.js';
+import SVGPainter from './svg/Painter.js';
+registerPainter('canvas', CanvasPainter);
+registerPainter('svg', SVGPainter);

+ 37 - 0
node_modules/echarts/node_modules/zrender/lib/animation/Animation.d.ts

@@ -0,0 +1,37 @@
+import Eventful from '../core/Eventful';
+import Animator from './Animator';
+import Clip from './Clip';
+export declare function getTime(): number;
+interface Stage {
+    update?: () => void;
+}
+interface AnimationOption {
+    stage?: Stage;
+}
+export default class Animation extends Eventful {
+    stage: Stage;
+    private _head;
+    private _tail;
+    private _running;
+    private _time;
+    private _pausedTime;
+    private _pauseStart;
+    private _paused;
+    constructor(opts?: AnimationOption);
+    addClip(clip: Clip): void;
+    addAnimator(animator: Animator<any>): void;
+    removeClip(clip: Clip): void;
+    removeAnimator(animator: Animator<any>): void;
+    update(notTriggerFrameAndStageUpdate?: boolean): void;
+    _startLoop(): void;
+    start(): void;
+    stop(): void;
+    pause(): void;
+    resume(): void;
+    clear(): void;
+    isFinished(): boolean;
+    animate<T>(target: T, options: {
+        loop?: boolean;
+    }): Animator<T>;
+}
+export {};

+ 147 - 0
node_modules/echarts/node_modules/zrender/lib/animation/Animation.js

@@ -0,0 +1,147 @@
+import { __extends } from "tslib";
+import Eventful from '../core/Eventful.js';
+import requestAnimationFrame from './requestAnimationFrame.js';
+import Animator from './Animator.js';
+export function getTime() {
+    return new Date().getTime();
+}
+var Animation = (function (_super) {
+    __extends(Animation, _super);
+    function Animation(opts) {
+        var _this = _super.call(this) || this;
+        _this._running = false;
+        _this._time = 0;
+        _this._pausedTime = 0;
+        _this._pauseStart = 0;
+        _this._paused = false;
+        opts = opts || {};
+        _this.stage = opts.stage || {};
+        return _this;
+    }
+    Animation.prototype.addClip = function (clip) {
+        if (clip.animation) {
+            this.removeClip(clip);
+        }
+        if (!this._head) {
+            this._head = this._tail = clip;
+        }
+        else {
+            this._tail.next = clip;
+            clip.prev = this._tail;
+            clip.next = null;
+            this._tail = clip;
+        }
+        clip.animation = this;
+    };
+    Animation.prototype.addAnimator = function (animator) {
+        animator.animation = this;
+        var clip = animator.getClip();
+        if (clip) {
+            this.addClip(clip);
+        }
+    };
+    Animation.prototype.removeClip = function (clip) {
+        if (!clip.animation) {
+            return;
+        }
+        var prev = clip.prev;
+        var next = clip.next;
+        if (prev) {
+            prev.next = next;
+        }
+        else {
+            this._head = next;
+        }
+        if (next) {
+            next.prev = prev;
+        }
+        else {
+            this._tail = prev;
+        }
+        clip.next = clip.prev = clip.animation = null;
+    };
+    Animation.prototype.removeAnimator = function (animator) {
+        var clip = animator.getClip();
+        if (clip) {
+            this.removeClip(clip);
+        }
+        animator.animation = null;
+    };
+    Animation.prototype.update = function (notTriggerFrameAndStageUpdate) {
+        var time = getTime() - this._pausedTime;
+        var delta = time - this._time;
+        var clip = this._head;
+        while (clip) {
+            var nextClip = clip.next;
+            var finished = clip.step(time, delta);
+            if (finished) {
+                clip.ondestroy();
+                this.removeClip(clip);
+                clip = nextClip;
+            }
+            else {
+                clip = nextClip;
+            }
+        }
+        this._time = time;
+        if (!notTriggerFrameAndStageUpdate) {
+            this.trigger('frame', delta);
+            this.stage.update && this.stage.update();
+        }
+    };
+    Animation.prototype._startLoop = function () {
+        var self = this;
+        this._running = true;
+        function step() {
+            if (self._running) {
+                requestAnimationFrame(step);
+                !self._paused && self.update();
+            }
+        }
+        requestAnimationFrame(step);
+    };
+    Animation.prototype.start = function () {
+        if (this._running) {
+            return;
+        }
+        this._time = getTime();
+        this._pausedTime = 0;
+        this._startLoop();
+    };
+    Animation.prototype.stop = function () {
+        this._running = false;
+    };
+    Animation.prototype.pause = function () {
+        if (!this._paused) {
+            this._pauseStart = getTime();
+            this._paused = true;
+        }
+    };
+    Animation.prototype.resume = function () {
+        if (this._paused) {
+            this._pausedTime += getTime() - this._pauseStart;
+            this._paused = false;
+        }
+    };
+    Animation.prototype.clear = function () {
+        var clip = this._head;
+        while (clip) {
+            var nextClip = clip.next;
+            clip.prev = clip.next = clip.animation = null;
+            clip = nextClip;
+        }
+        this._head = this._tail = null;
+    };
+    Animation.prototype.isFinished = function () {
+        return this._head == null;
+    };
+    Animation.prototype.animate = function (target, options) {
+        options = options || {};
+        this.start();
+        var animator = new Animator(target, options.loop);
+        this.addAnimator(animator);
+        return animator;
+    };
+    return Animation;
+}(Eventful));
+export default Animation;

+ 95 - 0
node_modules/echarts/node_modules/zrender/lib/animation/Animator.d.ts

@@ -0,0 +1,95 @@
+import Clip from './Clip';
+import { ArrayLike, Dictionary } from '../core/types';
+import { AnimationEasing } from './easing';
+import Animation from './Animation';
+declare type NumberArray = ArrayLike<number>;
+declare type InterpolatableType = string | number | NumberArray | NumberArray[];
+export declare function cloneValue(value: InterpolatableType): number | any[];
+declare type ValueType = 0 | 1 | 2 | 3 | 4 | 5 | 6;
+declare type Keyframe = {
+    time: number;
+    value: unknown;
+    percent: number;
+    rawValue: unknown;
+    easing?: AnimationEasing;
+    easingFunc?: (percent: number) => number;
+    additiveValue?: unknown;
+};
+declare class Track {
+    keyframes: Keyframe[];
+    propName: string;
+    valType: ValueType;
+    discrete: boolean;
+    _invalid: boolean;
+    private _finished;
+    private _needsSort;
+    private _additiveTrack;
+    private _additiveValue;
+    private _lastFr;
+    private _lastFrP;
+    constructor(propName: string);
+    isFinished(): boolean;
+    setFinished(): void;
+    needsAnimate(): boolean;
+    getAdditiveTrack(): Track;
+    addKeyframe(time: number, rawValue: unknown, easing?: AnimationEasing): Keyframe;
+    prepare(maxTime: number, additiveTrack?: Track): void;
+    step(target: any, percent: number): void;
+    private _addToTarget;
+}
+declare type DoneCallback = () => void;
+declare type AbortCallback = () => void;
+export declare type OnframeCallback<T> = (target: T, percent: number) => void;
+export declare type AnimationPropGetter<T> = (target: T, key: string) => InterpolatableType;
+export declare type AnimationPropSetter<T> = (target: T, key: string, value: InterpolatableType) => void;
+export default class Animator<T> {
+    animation?: Animation;
+    targetName?: string;
+    scope?: string;
+    __fromStateTransition?: string;
+    private _tracks;
+    private _trackKeys;
+    private _target;
+    private _loop;
+    private _delay;
+    private _maxTime;
+    private _force;
+    private _paused;
+    private _started;
+    private _allowDiscrete;
+    private _additiveAnimators;
+    private _doneCbs;
+    private _onframeCbs;
+    private _abortedCbs;
+    private _clip;
+    constructor(target: T, loop: boolean, allowDiscreteAnimation?: boolean, additiveTo?: Animator<any>[]);
+    getMaxTime(): number;
+    getDelay(): number;
+    getLoop(): boolean;
+    getTarget(): T;
+    changeTarget(target: T): void;
+    when(time: number, props: Dictionary<any>, easing?: AnimationEasing): this;
+    whenWithKeys(time: number, props: Dictionary<any>, propNames: string[], easing?: AnimationEasing): this;
+    pause(): void;
+    resume(): void;
+    isPaused(): boolean;
+    duration(duration: number): this;
+    private _doneCallback;
+    private _abortedCallback;
+    private _setTracksFinished;
+    private _getAdditiveTrack;
+    start(easing?: AnimationEasing): this;
+    stop(forwardToLast?: boolean): void;
+    delay(time: number): this;
+    during(cb: OnframeCallback<T>): this;
+    done(cb: DoneCallback): this;
+    aborted(cb: AbortCallback): this;
+    getClip(): Clip;
+    getTrack(propName: string): Track;
+    getTracks(): Track[];
+    stopTracks(propNames: string[], forwardToLast?: boolean): boolean;
+    saveTo(target: T, trackKeys?: readonly string[], firstOrLast?: boolean): void;
+    __changeFinalValue(finalProps: Dictionary<any>, trackKeys?: readonly string[]): void;
+}
+export declare type AnimatorTrack = Track;
+export {};

+ 737 - 0
node_modules/echarts/node_modules/zrender/lib/animation/Animator.js

@@ -0,0 +1,737 @@
+import Clip from './Clip.js';
+import * as color from '../tool/color.js';
+import { eqNaN, extend, isArrayLike, isFunction, isGradientObject, isNumber, isString, keys, logError, map } from '../core/util.js';
+import easingFuncs from './easing.js';
+import { createCubicEasingFunc } from './cubicEasing.js';
+import { isLinearGradient, isRadialGradient } from '../svg/helper.js';
+;
+var arraySlice = Array.prototype.slice;
+function interpolateNumber(p0, p1, percent) {
+    return (p1 - p0) * percent + p0;
+}
+function interpolate1DArray(out, p0, p1, percent) {
+    var len = p0.length;
+    for (var i = 0; i < len; i++) {
+        out[i] = interpolateNumber(p0[i], p1[i], percent);
+    }
+    return out;
+}
+function interpolate2DArray(out, p0, p1, percent) {
+    var len = p0.length;
+    var len2 = len && p0[0].length;
+    for (var i = 0; i < len; i++) {
+        if (!out[i]) {
+            out[i] = [];
+        }
+        for (var j = 0; j < len2; j++) {
+            out[i][j] = interpolateNumber(p0[i][j], p1[i][j], percent);
+        }
+    }
+    return out;
+}
+function add1DArray(out, p0, p1, sign) {
+    var len = p0.length;
+    for (var i = 0; i < len; i++) {
+        out[i] = p0[i] + p1[i] * sign;
+    }
+    return out;
+}
+function add2DArray(out, p0, p1, sign) {
+    var len = p0.length;
+    var len2 = len && p0[0].length;
+    for (var i = 0; i < len; i++) {
+        if (!out[i]) {
+            out[i] = [];
+        }
+        for (var j = 0; j < len2; j++) {
+            out[i][j] = p0[i][j] + p1[i][j] * sign;
+        }
+    }
+    return out;
+}
+function fillColorStops(val0, val1) {
+    var len0 = val0.length;
+    var len1 = val1.length;
+    var shorterArr = len0 > len1 ? val1 : val0;
+    var shorterLen = Math.min(len0, len1);
+    var last = shorterArr[shorterLen - 1] || { color: [0, 0, 0, 0], offset: 0 };
+    for (var i = shorterLen; i < Math.max(len0, len1); i++) {
+        shorterArr.push({
+            offset: last.offset,
+            color: last.color.slice()
+        });
+    }
+}
+function fillArray(val0, val1, arrDim) {
+    var arr0 = val0;
+    var arr1 = val1;
+    if (!arr0.push || !arr1.push) {
+        return;
+    }
+    var arr0Len = arr0.length;
+    var arr1Len = arr1.length;
+    if (arr0Len !== arr1Len) {
+        var isPreviousLarger = arr0Len > arr1Len;
+        if (isPreviousLarger) {
+            arr0.length = arr1Len;
+        }
+        else {
+            for (var i = arr0Len; i < arr1Len; i++) {
+                arr0.push(arrDim === 1 ? arr1[i] : arraySlice.call(arr1[i]));
+            }
+        }
+    }
+    var len2 = arr0[0] && arr0[0].length;
+    for (var i = 0; i < arr0.length; i++) {
+        if (arrDim === 1) {
+            if (isNaN(arr0[i])) {
+                arr0[i] = arr1[i];
+            }
+        }
+        else {
+            for (var j = 0; j < len2; j++) {
+                if (isNaN(arr0[i][j])) {
+                    arr0[i][j] = arr1[i][j];
+                }
+            }
+        }
+    }
+}
+export function cloneValue(value) {
+    if (isArrayLike(value)) {
+        var len = value.length;
+        if (isArrayLike(value[0])) {
+            var ret = [];
+            for (var i = 0; i < len; i++) {
+                ret.push(arraySlice.call(value[i]));
+            }
+            return ret;
+        }
+        return arraySlice.call(value);
+    }
+    return value;
+}
+function rgba2String(rgba) {
+    rgba[0] = Math.floor(rgba[0]) || 0;
+    rgba[1] = Math.floor(rgba[1]) || 0;
+    rgba[2] = Math.floor(rgba[2]) || 0;
+    rgba[3] = rgba[3] == null ? 1 : rgba[3];
+    return 'rgba(' + rgba.join(',') + ')';
+}
+function guessArrayDim(value) {
+    return isArrayLike(value && value[0]) ? 2 : 1;
+}
+var VALUE_TYPE_NUMBER = 0;
+var VALUE_TYPE_1D_ARRAY = 1;
+var VALUE_TYPE_2D_ARRAY = 2;
+var VALUE_TYPE_COLOR = 3;
+var VALUE_TYPE_LINEAR_GRADIENT = 4;
+var VALUE_TYPE_RADIAL_GRADIENT = 5;
+var VALUE_TYPE_UNKOWN = 6;
+function isGradientValueType(valType) {
+    return valType === VALUE_TYPE_LINEAR_GRADIENT || valType === VALUE_TYPE_RADIAL_GRADIENT;
+}
+function isArrayValueType(valType) {
+    return valType === VALUE_TYPE_1D_ARRAY || valType === VALUE_TYPE_2D_ARRAY;
+}
+var tmpRgba = [0, 0, 0, 0];
+var Track = (function () {
+    function Track(propName) {
+        this.keyframes = [];
+        this.discrete = false;
+        this._invalid = false;
+        this._needsSort = false;
+        this._lastFr = 0;
+        this._lastFrP = 0;
+        this.propName = propName;
+    }
+    Track.prototype.isFinished = function () {
+        return this._finished;
+    };
+    Track.prototype.setFinished = function () {
+        this._finished = true;
+        if (this._additiveTrack) {
+            this._additiveTrack.setFinished();
+        }
+    };
+    Track.prototype.needsAnimate = function () {
+        return this.keyframes.length >= 1;
+    };
+    Track.prototype.getAdditiveTrack = function () {
+        return this._additiveTrack;
+    };
+    Track.prototype.addKeyframe = function (time, rawValue, easing) {
+        this._needsSort = true;
+        var keyframes = this.keyframes;
+        var len = keyframes.length;
+        var discrete = false;
+        var valType = VALUE_TYPE_UNKOWN;
+        var value = rawValue;
+        if (isArrayLike(rawValue)) {
+            var arrayDim = guessArrayDim(rawValue);
+            valType = arrayDim;
+            if (arrayDim === 1 && !isNumber(rawValue[0])
+                || arrayDim === 2 && !isNumber(rawValue[0][0])) {
+                discrete = true;
+            }
+        }
+        else {
+            if (isNumber(rawValue) && !eqNaN(rawValue)) {
+                valType = VALUE_TYPE_NUMBER;
+            }
+            else if (isString(rawValue)) {
+                if (!isNaN(+rawValue)) {
+                    valType = VALUE_TYPE_NUMBER;
+                }
+                else {
+                    var colorArray = color.parse(rawValue);
+                    if (colorArray) {
+                        value = colorArray;
+                        valType = VALUE_TYPE_COLOR;
+                    }
+                }
+            }
+            else if (isGradientObject(rawValue)) {
+                var parsedGradient = extend({}, value);
+                parsedGradient.colorStops = map(rawValue.colorStops, function (colorStop) { return ({
+                    offset: colorStop.offset,
+                    color: color.parse(colorStop.color)
+                }); });
+                if (isLinearGradient(rawValue)) {
+                    valType = VALUE_TYPE_LINEAR_GRADIENT;
+                }
+                else if (isRadialGradient(rawValue)) {
+                    valType = VALUE_TYPE_RADIAL_GRADIENT;
+                }
+                value = parsedGradient;
+            }
+        }
+        if (len === 0) {
+            this.valType = valType;
+        }
+        else if (valType !== this.valType || valType === VALUE_TYPE_UNKOWN) {
+            discrete = true;
+        }
+        this.discrete = this.discrete || discrete;
+        var kf = {
+            time: time,
+            value: value,
+            rawValue: rawValue,
+            percent: 0
+        };
+        if (easing) {
+            kf.easing = easing;
+            kf.easingFunc = isFunction(easing)
+                ? easing
+                : easingFuncs[easing] || createCubicEasingFunc(easing);
+        }
+        keyframes.push(kf);
+        return kf;
+    };
+    Track.prototype.prepare = function (maxTime, additiveTrack) {
+        var kfs = this.keyframes;
+        if (this._needsSort) {
+            kfs.sort(function (a, b) {
+                return a.time - b.time;
+            });
+        }
+        var valType = this.valType;
+        var kfsLen = kfs.length;
+        var lastKf = kfs[kfsLen - 1];
+        var isDiscrete = this.discrete;
+        var isArr = isArrayValueType(valType);
+        var isGradient = isGradientValueType(valType);
+        for (var i = 0; i < kfsLen; i++) {
+            var kf = kfs[i];
+            var value = kf.value;
+            var lastValue = lastKf.value;
+            kf.percent = kf.time / maxTime;
+            if (!isDiscrete) {
+                if (isArr && i !== kfsLen - 1) {
+                    fillArray(value, lastValue, valType);
+                }
+                else if (isGradient) {
+                    fillColorStops(value.colorStops, lastValue.colorStops);
+                }
+            }
+        }
+        if (!isDiscrete
+            && valType !== VALUE_TYPE_RADIAL_GRADIENT
+            && additiveTrack
+            && this.needsAnimate()
+            && additiveTrack.needsAnimate()
+            && valType === additiveTrack.valType
+            && !additiveTrack._finished) {
+            this._additiveTrack = additiveTrack;
+            var startValue = kfs[0].value;
+            for (var i = 0; i < kfsLen; i++) {
+                if (valType === VALUE_TYPE_NUMBER) {
+                    kfs[i].additiveValue = kfs[i].value - startValue;
+                }
+                else if (valType === VALUE_TYPE_COLOR) {
+                    kfs[i].additiveValue =
+                        add1DArray([], kfs[i].value, startValue, -1);
+                }
+                else if (isArrayValueType(valType)) {
+                    kfs[i].additiveValue = valType === VALUE_TYPE_1D_ARRAY
+                        ? add1DArray([], kfs[i].value, startValue, -1)
+                        : add2DArray([], kfs[i].value, startValue, -1);
+                }
+            }
+        }
+    };
+    Track.prototype.step = function (target, percent) {
+        if (this._finished) {
+            return;
+        }
+        if (this._additiveTrack && this._additiveTrack._finished) {
+            this._additiveTrack = null;
+        }
+        var isAdditive = this._additiveTrack != null;
+        var valueKey = isAdditive ? 'additiveValue' : 'value';
+        var valType = this.valType;
+        var keyframes = this.keyframes;
+        var kfsNum = keyframes.length;
+        var propName = this.propName;
+        var isValueColor = valType === VALUE_TYPE_COLOR;
+        var frameIdx;
+        var lastFrame = this._lastFr;
+        var mathMin = Math.min;
+        var frame;
+        var nextFrame;
+        if (kfsNum === 1) {
+            frame = nextFrame = keyframes[0];
+        }
+        else {
+            if (percent < 0) {
+                frameIdx = 0;
+            }
+            else if (percent < this._lastFrP) {
+                var start = mathMin(lastFrame + 1, kfsNum - 1);
+                for (frameIdx = start; frameIdx >= 0; frameIdx--) {
+                    if (keyframes[frameIdx].percent <= percent) {
+                        break;
+                    }
+                }
+                frameIdx = mathMin(frameIdx, kfsNum - 2);
+            }
+            else {
+                for (frameIdx = lastFrame; frameIdx < kfsNum; frameIdx++) {
+                    if (keyframes[frameIdx].percent > percent) {
+                        break;
+                    }
+                }
+                frameIdx = mathMin(frameIdx - 1, kfsNum - 2);
+            }
+            nextFrame = keyframes[frameIdx + 1];
+            frame = keyframes[frameIdx];
+        }
+        if (!(frame && nextFrame)) {
+            return;
+        }
+        this._lastFr = frameIdx;
+        this._lastFrP = percent;
+        var interval = (nextFrame.percent - frame.percent);
+        var w = interval === 0 ? 1 : mathMin((percent - frame.percent) / interval, 1);
+        if (nextFrame.easingFunc) {
+            w = nextFrame.easingFunc(w);
+        }
+        var targetArr = isAdditive ? this._additiveValue
+            : (isValueColor ? tmpRgba : target[propName]);
+        if ((isArrayValueType(valType) || isValueColor) && !targetArr) {
+            targetArr = this._additiveValue = [];
+        }
+        if (this.discrete) {
+            target[propName] = w < 1 ? frame.rawValue : nextFrame.rawValue;
+        }
+        else if (isArrayValueType(valType)) {
+            valType === VALUE_TYPE_1D_ARRAY
+                ? interpolate1DArray(targetArr, frame[valueKey], nextFrame[valueKey], w)
+                : interpolate2DArray(targetArr, frame[valueKey], nextFrame[valueKey], w);
+        }
+        else if (isGradientValueType(valType)) {
+            var val = frame[valueKey];
+            var nextVal_1 = nextFrame[valueKey];
+            var isLinearGradient_1 = valType === VALUE_TYPE_LINEAR_GRADIENT;
+            target[propName] = {
+                type: isLinearGradient_1 ? 'linear' : 'radial',
+                x: interpolateNumber(val.x, nextVal_1.x, w),
+                y: interpolateNumber(val.y, nextVal_1.y, w),
+                colorStops: map(val.colorStops, function (colorStop, idx) {
+                    var nextColorStop = nextVal_1.colorStops[idx];
+                    return {
+                        offset: interpolateNumber(colorStop.offset, nextColorStop.offset, w),
+                        color: rgba2String(interpolate1DArray([], colorStop.color, nextColorStop.color, w))
+                    };
+                }),
+                global: nextVal_1.global
+            };
+            if (isLinearGradient_1) {
+                target[propName].x2 = interpolateNumber(val.x2, nextVal_1.x2, w);
+                target[propName].y2 = interpolateNumber(val.y2, nextVal_1.y2, w);
+            }
+            else {
+                target[propName].r = interpolateNumber(val.r, nextVal_1.r, w);
+            }
+        }
+        else if (isValueColor) {
+            interpolate1DArray(targetArr, frame[valueKey], nextFrame[valueKey], w);
+            if (!isAdditive) {
+                target[propName] = rgba2String(targetArr);
+            }
+        }
+        else {
+            var value = interpolateNumber(frame[valueKey], nextFrame[valueKey], w);
+            if (isAdditive) {
+                this._additiveValue = value;
+            }
+            else {
+                target[propName] = value;
+            }
+        }
+        if (isAdditive) {
+            this._addToTarget(target);
+        }
+    };
+    Track.prototype._addToTarget = function (target) {
+        var valType = this.valType;
+        var propName = this.propName;
+        var additiveValue = this._additiveValue;
+        if (valType === VALUE_TYPE_NUMBER) {
+            target[propName] = target[propName] + additiveValue;
+        }
+        else if (valType === VALUE_TYPE_COLOR) {
+            color.parse(target[propName], tmpRgba);
+            add1DArray(tmpRgba, tmpRgba, additiveValue, 1);
+            target[propName] = rgba2String(tmpRgba);
+        }
+        else if (valType === VALUE_TYPE_1D_ARRAY) {
+            add1DArray(target[propName], target[propName], additiveValue, 1);
+        }
+        else if (valType === VALUE_TYPE_2D_ARRAY) {
+            add2DArray(target[propName], target[propName], additiveValue, 1);
+        }
+    };
+    return Track;
+}());
+var Animator = (function () {
+    function Animator(target, loop, allowDiscreteAnimation, additiveTo) {
+        this._tracks = {};
+        this._trackKeys = [];
+        this._maxTime = 0;
+        this._started = 0;
+        this._clip = null;
+        this._target = target;
+        this._loop = loop;
+        if (loop && additiveTo) {
+            logError('Can\' use additive animation on looped animation.');
+            return;
+        }
+        this._additiveAnimators = additiveTo;
+        this._allowDiscrete = allowDiscreteAnimation;
+    }
+    Animator.prototype.getMaxTime = function () {
+        return this._maxTime;
+    };
+    Animator.prototype.getDelay = function () {
+        return this._delay;
+    };
+    Animator.prototype.getLoop = function () {
+        return this._loop;
+    };
+    Animator.prototype.getTarget = function () {
+        return this._target;
+    };
+    Animator.prototype.changeTarget = function (target) {
+        this._target = target;
+    };
+    Animator.prototype.when = function (time, props, easing) {
+        return this.whenWithKeys(time, props, keys(props), easing);
+    };
+    Animator.prototype.whenWithKeys = function (time, props, propNames, easing) {
+        var tracks = this._tracks;
+        for (var i = 0; i < propNames.length; i++) {
+            var propName = propNames[i];
+            var track = tracks[propName];
+            if (!track) {
+                track = tracks[propName] = new Track(propName);
+                var initialValue = void 0;
+                var additiveTrack = this._getAdditiveTrack(propName);
+                if (additiveTrack) {
+                    var addtiveTrackKfs = additiveTrack.keyframes;
+                    var lastFinalKf = addtiveTrackKfs[addtiveTrackKfs.length - 1];
+                    initialValue = lastFinalKf && lastFinalKf.value;
+                    if (additiveTrack.valType === VALUE_TYPE_COLOR && initialValue) {
+                        initialValue = rgba2String(initialValue);
+                    }
+                }
+                else {
+                    initialValue = this._target[propName];
+                }
+                if (initialValue == null) {
+                    continue;
+                }
+                if (time > 0) {
+                    track.addKeyframe(0, cloneValue(initialValue), easing);
+                }
+                this._trackKeys.push(propName);
+            }
+            track.addKeyframe(time, cloneValue(props[propName]), easing);
+        }
+        this._maxTime = Math.max(this._maxTime, time);
+        return this;
+    };
+    Animator.prototype.pause = function () {
+        this._clip.pause();
+        this._paused = true;
+    };
+    Animator.prototype.resume = function () {
+        this._clip.resume();
+        this._paused = false;
+    };
+    Animator.prototype.isPaused = function () {
+        return !!this._paused;
+    };
+    Animator.prototype.duration = function (duration) {
+        this._maxTime = duration;
+        this._force = true;
+        return this;
+    };
+    Animator.prototype._doneCallback = function () {
+        this._setTracksFinished();
+        this._clip = null;
+        var doneList = this._doneCbs;
+        if (doneList) {
+            var len = doneList.length;
+            for (var i = 0; i < len; i++) {
+                doneList[i].call(this);
+            }
+        }
+    };
+    Animator.prototype._abortedCallback = function () {
+        this._setTracksFinished();
+        var animation = this.animation;
+        var abortedList = this._abortedCbs;
+        if (animation) {
+            animation.removeClip(this._clip);
+        }
+        this._clip = null;
+        if (abortedList) {
+            for (var i = 0; i < abortedList.length; i++) {
+                abortedList[i].call(this);
+            }
+        }
+    };
+    Animator.prototype._setTracksFinished = function () {
+        var tracks = this._tracks;
+        var tracksKeys = this._trackKeys;
+        for (var i = 0; i < tracksKeys.length; i++) {
+            tracks[tracksKeys[i]].setFinished();
+        }
+    };
+    Animator.prototype._getAdditiveTrack = function (trackName) {
+        var additiveTrack;
+        var additiveAnimators = this._additiveAnimators;
+        if (additiveAnimators) {
+            for (var i = 0; i < additiveAnimators.length; i++) {
+                var track = additiveAnimators[i].getTrack(trackName);
+                if (track) {
+                    additiveTrack = track;
+                }
+            }
+        }
+        return additiveTrack;
+    };
+    Animator.prototype.start = function (easing) {
+        if (this._started > 0) {
+            return;
+        }
+        this._started = 1;
+        var self = this;
+        var tracks = [];
+        var maxTime = this._maxTime || 0;
+        for (var i = 0; i < this._trackKeys.length; i++) {
+            var propName = this._trackKeys[i];
+            var track = this._tracks[propName];
+            var additiveTrack = this._getAdditiveTrack(propName);
+            var kfs = track.keyframes;
+            var kfsNum = kfs.length;
+            track.prepare(maxTime, additiveTrack);
+            if (track.needsAnimate()) {
+                if (!this._allowDiscrete && track.discrete) {
+                    var lastKf = kfs[kfsNum - 1];
+                    if (lastKf) {
+                        self._target[track.propName] = lastKf.rawValue;
+                    }
+                    track.setFinished();
+                }
+                else {
+                    tracks.push(track);
+                }
+            }
+        }
+        if (tracks.length || this._force) {
+            var clip = new Clip({
+                life: maxTime,
+                loop: this._loop,
+                delay: this._delay || 0,
+                onframe: function (percent) {
+                    self._started = 2;
+                    var additiveAnimators = self._additiveAnimators;
+                    if (additiveAnimators) {
+                        var stillHasAdditiveAnimator = false;
+                        for (var i = 0; i < additiveAnimators.length; i++) {
+                            if (additiveAnimators[i]._clip) {
+                                stillHasAdditiveAnimator = true;
+                                break;
+                            }
+                        }
+                        if (!stillHasAdditiveAnimator) {
+                            self._additiveAnimators = null;
+                        }
+                    }
+                    for (var i = 0; i < tracks.length; i++) {
+                        tracks[i].step(self._target, percent);
+                    }
+                    var onframeList = self._onframeCbs;
+                    if (onframeList) {
+                        for (var i = 0; i < onframeList.length; i++) {
+                            onframeList[i](self._target, percent);
+                        }
+                    }
+                },
+                ondestroy: function () {
+                    self._doneCallback();
+                }
+            });
+            this._clip = clip;
+            if (this.animation) {
+                this.animation.addClip(clip);
+            }
+            if (easing) {
+                clip.setEasing(easing);
+            }
+        }
+        else {
+            this._doneCallback();
+        }
+        return this;
+    };
+    Animator.prototype.stop = function (forwardToLast) {
+        if (!this._clip) {
+            return;
+        }
+        var clip = this._clip;
+        if (forwardToLast) {
+            clip.onframe(1);
+        }
+        this._abortedCallback();
+    };
+    Animator.prototype.delay = function (time) {
+        this._delay = time;
+        return this;
+    };
+    Animator.prototype.during = function (cb) {
+        if (cb) {
+            if (!this._onframeCbs) {
+                this._onframeCbs = [];
+            }
+            this._onframeCbs.push(cb);
+        }
+        return this;
+    };
+    Animator.prototype.done = function (cb) {
+        if (cb) {
+            if (!this._doneCbs) {
+                this._doneCbs = [];
+            }
+            this._doneCbs.push(cb);
+        }
+        return this;
+    };
+    Animator.prototype.aborted = function (cb) {
+        if (cb) {
+            if (!this._abortedCbs) {
+                this._abortedCbs = [];
+            }
+            this._abortedCbs.push(cb);
+        }
+        return this;
+    };
+    Animator.prototype.getClip = function () {
+        return this._clip;
+    };
+    Animator.prototype.getTrack = function (propName) {
+        return this._tracks[propName];
+    };
+    Animator.prototype.getTracks = function () {
+        var _this = this;
+        return map(this._trackKeys, function (key) { return _this._tracks[key]; });
+    };
+    Animator.prototype.stopTracks = function (propNames, forwardToLast) {
+        if (!propNames.length || !this._clip) {
+            return true;
+        }
+        var tracks = this._tracks;
+        var tracksKeys = this._trackKeys;
+        for (var i = 0; i < propNames.length; i++) {
+            var track = tracks[propNames[i]];
+            if (track && !track.isFinished()) {
+                if (forwardToLast) {
+                    track.step(this._target, 1);
+                }
+                else if (this._started === 1) {
+                    track.step(this._target, 0);
+                }
+                track.setFinished();
+            }
+        }
+        var allAborted = true;
+        for (var i = 0; i < tracksKeys.length; i++) {
+            if (!tracks[tracksKeys[i]].isFinished()) {
+                allAborted = false;
+                break;
+            }
+        }
+        if (allAborted) {
+            this._abortedCallback();
+        }
+        return allAborted;
+    };
+    Animator.prototype.saveTo = function (target, trackKeys, firstOrLast) {
+        if (!target) {
+            return;
+        }
+        trackKeys = trackKeys || this._trackKeys;
+        for (var i = 0; i < trackKeys.length; i++) {
+            var propName = trackKeys[i];
+            var track = this._tracks[propName];
+            if (!track || track.isFinished()) {
+                continue;
+            }
+            var kfs = track.keyframes;
+            var kf = kfs[firstOrLast ? 0 : kfs.length - 1];
+            if (kf) {
+                target[propName] = cloneValue(kf.rawValue);
+            }
+        }
+    };
+    Animator.prototype.__changeFinalValue = function (finalProps, trackKeys) {
+        trackKeys = trackKeys || keys(finalProps);
+        for (var i = 0; i < trackKeys.length; i++) {
+            var propName = trackKeys[i];
+            var track = this._tracks[propName];
+            if (!track) {
+                continue;
+            }
+            var kfs = track.keyframes;
+            if (kfs.length > 1) {
+                var lastKf = kfs.pop();
+                track.addKeyframe(lastKf.time, finalProps[propName]);
+                track.prepare(this._maxTime, track.getAdditiveTrack());
+            }
+        }
+    };
+    return Animator;
+}());
+export default Animator;

+ 38 - 0
node_modules/echarts/node_modules/zrender/lib/animation/Clip.d.ts

@@ -0,0 +1,38 @@
+import { AnimationEasing } from './easing';
+import type Animation from './Animation';
+declare type OnframeCallback = (percent: number) => void;
+declare type ondestroyCallback = () => void;
+declare type onrestartCallback = () => void;
+export declare type DeferredEventTypes = 'destroy' | 'restart';
+export interface ClipProps {
+    life?: number;
+    delay?: number;
+    loop?: boolean;
+    easing?: AnimationEasing;
+    onframe?: OnframeCallback;
+    ondestroy?: ondestroyCallback;
+    onrestart?: onrestartCallback;
+}
+export default class Clip {
+    private _life;
+    private _delay;
+    private _inited;
+    private _startTime;
+    private _pausedTime;
+    private _paused;
+    animation: Animation;
+    loop: boolean;
+    easing: AnimationEasing;
+    easingFunc: (p: number) => number;
+    next: Clip;
+    prev: Clip;
+    onframe: OnframeCallback;
+    ondestroy: ondestroyCallback;
+    onrestart: onrestartCallback;
+    constructor(opts: ClipProps);
+    step(globalTime: number, deltaTime: number): boolean;
+    pause(): void;
+    resume(): void;
+    setEasing(easing: AnimationEasing): void;
+}
+export {};

+ 64 - 0
node_modules/echarts/node_modules/zrender/lib/animation/Clip.js

@@ -0,0 +1,64 @@
+import easingFuncs from './easing.js';
+import { isFunction, noop } from '../core/util.js';
+import { createCubicEasingFunc } from './cubicEasing.js';
+var Clip = (function () {
+    function Clip(opts) {
+        this._inited = false;
+        this._startTime = 0;
+        this._pausedTime = 0;
+        this._paused = false;
+        this._life = opts.life || 1000;
+        this._delay = opts.delay || 0;
+        this.loop = opts.loop || false;
+        this.onframe = opts.onframe || noop;
+        this.ondestroy = opts.ondestroy || noop;
+        this.onrestart = opts.onrestart || noop;
+        opts.easing && this.setEasing(opts.easing);
+    }
+    Clip.prototype.step = function (globalTime, deltaTime) {
+        if (!this._inited) {
+            this._startTime = globalTime + this._delay;
+            this._inited = true;
+        }
+        if (this._paused) {
+            this._pausedTime += deltaTime;
+            return;
+        }
+        var life = this._life;
+        var elapsedTime = globalTime - this._startTime - this._pausedTime;
+        var percent = elapsedTime / life;
+        if (percent < 0) {
+            percent = 0;
+        }
+        percent = Math.min(percent, 1);
+        var easingFunc = this.easingFunc;
+        var schedule = easingFunc ? easingFunc(percent) : percent;
+        this.onframe(schedule);
+        if (percent === 1) {
+            if (this.loop) {
+                var remainder = elapsedTime % life;
+                this._startTime = globalTime - remainder;
+                this._pausedTime = 0;
+                this.onrestart();
+            }
+            else {
+                return true;
+            }
+        }
+        return false;
+    };
+    Clip.prototype.pause = function () {
+        this._paused = true;
+    };
+    Clip.prototype.resume = function () {
+        this._paused = false;
+    };
+    Clip.prototype.setEasing = function (easing) {
+        this.easing = easing;
+        this.easingFunc = isFunction(easing)
+            ? easing
+            : easingFuncs[easing] || createCubicEasingFunc(easing);
+    };
+    return Clip;
+}());
+export default Clip;

+ 1 - 0
node_modules/echarts/node_modules/zrender/lib/animation/cubicEasing.d.ts

@@ -0,0 +1 @@
+export declare function createCubicEasingFunc(cubicEasingStr: string): (p: number) => number;

+ 23 - 0
node_modules/echarts/node_modules/zrender/lib/animation/cubicEasing.js

@@ -0,0 +1,23 @@
+import { cubicAt, cubicRootAt } from '../core/curve.js';
+import { trim } from '../core/util.js';
+var regexp = /cubic-bezier\(([0-9,\.e ]+)\)/;
+export function createCubicEasingFunc(cubicEasingStr) {
+    var cubic = cubicEasingStr && regexp.exec(cubicEasingStr);
+    if (cubic) {
+        var points = cubic[1].split(',');
+        var a_1 = +trim(points[0]);
+        var b_1 = +trim(points[1]);
+        var c_1 = +trim(points[2]);
+        var d_1 = +trim(points[3]);
+        if (isNaN(a_1 + b_1 + c_1 + d_1)) {
+            return;
+        }
+        var roots_1 = [];
+        return function (p) {
+            return p <= 0
+                ? 0 : p >= 1
+                ? 1
+                : cubicRootAt(0, a_1, c_1, 1, p, roots_1) && cubicAt(0, b_1, d_1, 1, roots_1[0]);
+        };
+    }
+}

+ 36 - 0
node_modules/echarts/node_modules/zrender/lib/animation/easing.d.ts

@@ -0,0 +1,36 @@
+declare type easingFunc = (percent: number) => number;
+export declare type AnimationEasing = keyof typeof easingFuncs | easingFunc;
+declare const easingFuncs: {
+    linear(k: number): number;
+    quadraticIn(k: number): number;
+    quadraticOut(k: number): number;
+    quadraticInOut(k: number): number;
+    cubicIn(k: number): number;
+    cubicOut(k: number): number;
+    cubicInOut(k: number): number;
+    quarticIn(k: number): number;
+    quarticOut(k: number): number;
+    quarticInOut(k: number): number;
+    quinticIn(k: number): number;
+    quinticOut(k: number): number;
+    quinticInOut(k: number): number;
+    sinusoidalIn(k: number): number;
+    sinusoidalOut(k: number): number;
+    sinusoidalInOut(k: number): number;
+    exponentialIn(k: number): number;
+    exponentialOut(k: number): number;
+    exponentialInOut(k: number): number;
+    circularIn(k: number): number;
+    circularOut(k: number): number;
+    circularInOut(k: number): number;
+    elasticIn(k: number): number;
+    elasticOut(k: number): number;
+    elasticInOut(k: number): number;
+    backIn(k: number): number;
+    backOut(k: number): number;
+    backInOut(k: number): number;
+    bounceIn(k: number): number;
+    bounceOut(k: number): number;
+    bounceInOut(k: number): number;
+};
+export default easingFuncs;

+ 195 - 0
node_modules/echarts/node_modules/zrender/lib/animation/easing.js

@@ -0,0 +1,195 @@
+var easingFuncs = {
+    linear: function (k) {
+        return k;
+    },
+    quadraticIn: function (k) {
+        return k * k;
+    },
+    quadraticOut: function (k) {
+        return k * (2 - k);
+    },
+    quadraticInOut: function (k) {
+        if ((k *= 2) < 1) {
+            return 0.5 * k * k;
+        }
+        return -0.5 * (--k * (k - 2) - 1);
+    },
+    cubicIn: function (k) {
+        return k * k * k;
+    },
+    cubicOut: function (k) {
+        return --k * k * k + 1;
+    },
+    cubicInOut: function (k) {
+        if ((k *= 2) < 1) {
+            return 0.5 * k * k * k;
+        }
+        return 0.5 * ((k -= 2) * k * k + 2);
+    },
+    quarticIn: function (k) {
+        return k * k * k * k;
+    },
+    quarticOut: function (k) {
+        return 1 - (--k * k * k * k);
+    },
+    quarticInOut: function (k) {
+        if ((k *= 2) < 1) {
+            return 0.5 * k * k * k * k;
+        }
+        return -0.5 * ((k -= 2) * k * k * k - 2);
+    },
+    quinticIn: function (k) {
+        return k * k * k * k * k;
+    },
+    quinticOut: function (k) {
+        return --k * k * k * k * k + 1;
+    },
+    quinticInOut: function (k) {
+        if ((k *= 2) < 1) {
+            return 0.5 * k * k * k * k * k;
+        }
+        return 0.5 * ((k -= 2) * k * k * k * k + 2);
+    },
+    sinusoidalIn: function (k) {
+        return 1 - Math.cos(k * Math.PI / 2);
+    },
+    sinusoidalOut: function (k) {
+        return Math.sin(k * Math.PI / 2);
+    },
+    sinusoidalInOut: function (k) {
+        return 0.5 * (1 - Math.cos(Math.PI * k));
+    },
+    exponentialIn: function (k) {
+        return k === 0 ? 0 : Math.pow(1024, k - 1);
+    },
+    exponentialOut: function (k) {
+        return k === 1 ? 1 : 1 - Math.pow(2, -10 * k);
+    },
+    exponentialInOut: function (k) {
+        if (k === 0) {
+            return 0;
+        }
+        if (k === 1) {
+            return 1;
+        }
+        if ((k *= 2) < 1) {
+            return 0.5 * Math.pow(1024, k - 1);
+        }
+        return 0.5 * (-Math.pow(2, -10 * (k - 1)) + 2);
+    },
+    circularIn: function (k) {
+        return 1 - Math.sqrt(1 - k * k);
+    },
+    circularOut: function (k) {
+        return Math.sqrt(1 - (--k * k));
+    },
+    circularInOut: function (k) {
+        if ((k *= 2) < 1) {
+            return -0.5 * (Math.sqrt(1 - k * k) - 1);
+        }
+        return 0.5 * (Math.sqrt(1 - (k -= 2) * k) + 1);
+    },
+    elasticIn: function (k) {
+        var s;
+        var a = 0.1;
+        var p = 0.4;
+        if (k === 0) {
+            return 0;
+        }
+        if (k === 1) {
+            return 1;
+        }
+        if (!a || a < 1) {
+            a = 1;
+            s = p / 4;
+        }
+        else {
+            s = p * Math.asin(1 / a) / (2 * Math.PI);
+        }
+        return -(a * Math.pow(2, 10 * (k -= 1))
+            * Math.sin((k - s) * (2 * Math.PI) / p));
+    },
+    elasticOut: function (k) {
+        var s;
+        var a = 0.1;
+        var p = 0.4;
+        if (k === 0) {
+            return 0;
+        }
+        if (k === 1) {
+            return 1;
+        }
+        if (!a || a < 1) {
+            a = 1;
+            s = p / 4;
+        }
+        else {
+            s = p * Math.asin(1 / a) / (2 * Math.PI);
+        }
+        return (a * Math.pow(2, -10 * k)
+            * Math.sin((k - s) * (2 * Math.PI) / p) + 1);
+    },
+    elasticInOut: function (k) {
+        var s;
+        var a = 0.1;
+        var p = 0.4;
+        if (k === 0) {
+            return 0;
+        }
+        if (k === 1) {
+            return 1;
+        }
+        if (!a || a < 1) {
+            a = 1;
+            s = p / 4;
+        }
+        else {
+            s = p * Math.asin(1 / a) / (2 * Math.PI);
+        }
+        if ((k *= 2) < 1) {
+            return -0.5 * (a * Math.pow(2, 10 * (k -= 1))
+                * Math.sin((k - s) * (2 * Math.PI) / p));
+        }
+        return a * Math.pow(2, -10 * (k -= 1))
+            * Math.sin((k - s) * (2 * Math.PI) / p) * 0.5 + 1;
+    },
+    backIn: function (k) {
+        var s = 1.70158;
+        return k * k * ((s + 1) * k - s);
+    },
+    backOut: function (k) {
+        var s = 1.70158;
+        return --k * k * ((s + 1) * k + s) + 1;
+    },
+    backInOut: function (k) {
+        var s = 1.70158 * 1.525;
+        if ((k *= 2) < 1) {
+            return 0.5 * (k * k * ((s + 1) * k - s));
+        }
+        return 0.5 * ((k -= 2) * k * ((s + 1) * k + s) + 2);
+    },
+    bounceIn: function (k) {
+        return 1 - easingFuncs.bounceOut(1 - k);
+    },
+    bounceOut: function (k) {
+        if (k < (1 / 2.75)) {
+            return 7.5625 * k * k;
+        }
+        else if (k < (2 / 2.75)) {
+            return 7.5625 * (k -= (1.5 / 2.75)) * k + 0.75;
+        }
+        else if (k < (2.5 / 2.75)) {
+            return 7.5625 * (k -= (2.25 / 2.75)) * k + 0.9375;
+        }
+        else {
+            return 7.5625 * (k -= (2.625 / 2.75)) * k + 0.984375;
+        }
+    },
+    bounceInOut: function (k) {
+        if (k < 0.5) {
+            return easingFuncs.bounceIn(k * 2) * 0.5;
+        }
+        return easingFuncs.bounceOut(k * 2 - 1) * 0.5 + 0.5;
+    }
+};
+export default easingFuncs;

+ 3 - 0
node_modules/echarts/node_modules/zrender/lib/animation/requestAnimationFrame.d.ts

@@ -0,0 +1,3 @@
+declare type RequestAnimationFrameType = typeof window.requestAnimationFrame;
+declare let requestAnimationFrame: RequestAnimationFrameType;
+export default requestAnimationFrame;

+ 10 - 0
node_modules/echarts/node_modules/zrender/lib/animation/requestAnimationFrame.js

@@ -0,0 +1,10 @@
+import env from '../core/env.js';
+var requestAnimationFrame;
+requestAnimationFrame = (env.hasGlobalWindow
+    && ((window.requestAnimationFrame && window.requestAnimationFrame.bind(window))
+        || (window.msRequestAnimationFrame && window.msRequestAnimationFrame.bind(window))
+        || window.mozRequestAnimationFrame
+        || window.webkitRequestAnimationFrame)) || function (func) {
+    return setTimeout(func, 16);
+};
+export default requestAnimationFrame;

+ 67 - 0
node_modules/echarts/node_modules/zrender/lib/canvas/Layer.d.ts

@@ -0,0 +1,67 @@
+import { ImagePatternObject } from '../graphic/Pattern';
+import CanvasPainter from './Painter';
+import { GradientObject } from '../graphic/Gradient';
+import Eventful from '../core/Eventful';
+import { ElementEventCallback } from '../Element';
+import Displayable from '../graphic/Displayable';
+import BoundingRect from '../core/BoundingRect';
+export interface LayerConfig {
+    clearColor?: string | GradientObject | ImagePatternObject;
+    motionBlur?: boolean;
+    lastFrameAlpha?: number;
+}
+export default class Layer extends Eventful {
+    id: string;
+    dom: HTMLCanvasElement;
+    domBack: HTMLCanvasElement;
+    ctx: CanvasRenderingContext2D;
+    ctxBack: CanvasRenderingContext2D;
+    painter: CanvasPainter;
+    clearColor: string | GradientObject | ImagePatternObject;
+    motionBlur: boolean;
+    lastFrameAlpha: number;
+    dpr: number;
+    virtual: boolean;
+    config: {};
+    incremental: boolean;
+    zlevel: number;
+    maxRepaintRectCount: number;
+    private _paintRects;
+    __dirty: boolean;
+    __firstTimePaint: boolean;
+    __used: boolean;
+    __drawIndex: number;
+    __startIndex: number;
+    __endIndex: number;
+    __prevStartIndex: number;
+    __prevEndIndex: number;
+    __builtin__: boolean;
+    constructor(id: string | HTMLCanvasElement, painter: CanvasPainter, dpr?: number);
+    getElementCount(): number;
+    afterBrush(): void;
+    initContext(): void;
+    setUnpainted(): void;
+    createBackBuffer(): void;
+    createRepaintRects(displayList: Displayable[], prevList: Displayable[], viewWidth: number, viewHeight: number): BoundingRect[];
+    debugGetPaintRects(): BoundingRect[];
+    resize(width: number, height: number): void;
+    clear(clearAll?: boolean, clearColor?: string | GradientObject | ImagePatternObject, repaintRects?: BoundingRect[]): void;
+    refresh: (clearColor?: string | GradientObject | ImagePatternObject) => void;
+    renderToCanvas: (ctx: CanvasRenderingContext2D) => void;
+    onclick: ElementEventCallback<unknown, this>;
+    ondblclick: ElementEventCallback<unknown, this>;
+    onmouseover: ElementEventCallback<unknown, this>;
+    onmouseout: ElementEventCallback<unknown, this>;
+    onmousemove: ElementEventCallback<unknown, this>;
+    onmousewheel: ElementEventCallback<unknown, this>;
+    onmousedown: ElementEventCallback<unknown, this>;
+    onmouseup: ElementEventCallback<unknown, this>;
+    oncontextmenu: ElementEventCallback<unknown, this>;
+    ondrag: ElementEventCallback<unknown, this>;
+    ondragstart: ElementEventCallback<unknown, this>;
+    ondragend: ElementEventCallback<unknown, this>;
+    ondragenter: ElementEventCallback<unknown, this>;
+    ondragleave: ElementEventCallback<unknown, this>;
+    ondragover: ElementEventCallback<unknown, this>;
+    ondrop: ElementEventCallback<unknown, this>;
+}

+ 297 - 0
node_modules/echarts/node_modules/zrender/lib/canvas/Layer.js

@@ -0,0 +1,297 @@
+import { __extends } from "tslib";
+import * as util from '../core/util.js';
+import { devicePixelRatio } from '../config.js';
+import Eventful from '../core/Eventful.js';
+import { getCanvasGradient } from './helper.js';
+import { createCanvasPattern } from './graphic.js';
+import BoundingRect from '../core/BoundingRect.js';
+import { REDRAW_BIT } from '../graphic/constants.js';
+import { platformApi } from '../core/platform.js';
+function createDom(id, painter, dpr) {
+    var newDom = platformApi.createCanvas();
+    var width = painter.getWidth();
+    var height = painter.getHeight();
+    var newDomStyle = newDom.style;
+    if (newDomStyle) {
+        newDomStyle.position = 'absolute';
+        newDomStyle.left = '0';
+        newDomStyle.top = '0';
+        newDomStyle.width = width + 'px';
+        newDomStyle.height = height + 'px';
+        newDom.setAttribute('data-zr-dom-id', id);
+    }
+    newDom.width = width * dpr;
+    newDom.height = height * dpr;
+    return newDom;
+}
+;
+var Layer = (function (_super) {
+    __extends(Layer, _super);
+    function Layer(id, painter, dpr) {
+        var _this = _super.call(this) || this;
+        _this.motionBlur = false;
+        _this.lastFrameAlpha = 0.7;
+        _this.dpr = 1;
+        _this.virtual = false;
+        _this.config = {};
+        _this.incremental = false;
+        _this.zlevel = 0;
+        _this.maxRepaintRectCount = 5;
+        _this.__dirty = true;
+        _this.__firstTimePaint = true;
+        _this.__used = false;
+        _this.__drawIndex = 0;
+        _this.__startIndex = 0;
+        _this.__endIndex = 0;
+        _this.__prevStartIndex = null;
+        _this.__prevEndIndex = null;
+        var dom;
+        dpr = dpr || devicePixelRatio;
+        if (typeof id === 'string') {
+            dom = createDom(id, painter, dpr);
+        }
+        else if (util.isObject(id)) {
+            dom = id;
+            id = dom.id;
+        }
+        _this.id = id;
+        _this.dom = dom;
+        var domStyle = dom.style;
+        if (domStyle) {
+            util.disableUserSelect(dom);
+            dom.onselectstart = function () { return false; };
+            domStyle.padding = '0';
+            domStyle.margin = '0';
+            domStyle.borderWidth = '0';
+        }
+        _this.painter = painter;
+        _this.dpr = dpr;
+        return _this;
+    }
+    Layer.prototype.getElementCount = function () {
+        return this.__endIndex - this.__startIndex;
+    };
+    Layer.prototype.afterBrush = function () {
+        this.__prevStartIndex = this.__startIndex;
+        this.__prevEndIndex = this.__endIndex;
+    };
+    Layer.prototype.initContext = function () {
+        this.ctx = this.dom.getContext('2d');
+        this.ctx.dpr = this.dpr;
+    };
+    Layer.prototype.setUnpainted = function () {
+        this.__firstTimePaint = true;
+    };
+    Layer.prototype.createBackBuffer = function () {
+        var dpr = this.dpr;
+        this.domBack = createDom('back-' + this.id, this.painter, dpr);
+        this.ctxBack = this.domBack.getContext('2d');
+        if (dpr !== 1) {
+            this.ctxBack.scale(dpr, dpr);
+        }
+    };
+    Layer.prototype.createRepaintRects = function (displayList, prevList, viewWidth, viewHeight) {
+        if (this.__firstTimePaint) {
+            this.__firstTimePaint = false;
+            return null;
+        }
+        var mergedRepaintRects = [];
+        var maxRepaintRectCount = this.maxRepaintRectCount;
+        var full = false;
+        var pendingRect = new BoundingRect(0, 0, 0, 0);
+        function addRectToMergePool(rect) {
+            if (!rect.isFinite() || rect.isZero()) {
+                return;
+            }
+            if (mergedRepaintRects.length === 0) {
+                var boundingRect = new BoundingRect(0, 0, 0, 0);
+                boundingRect.copy(rect);
+                mergedRepaintRects.push(boundingRect);
+            }
+            else {
+                var isMerged = false;
+                var minDeltaArea = Infinity;
+                var bestRectToMergeIdx = 0;
+                for (var i = 0; i < mergedRepaintRects.length; ++i) {
+                    var mergedRect = mergedRepaintRects[i];
+                    if (mergedRect.intersect(rect)) {
+                        var pendingRect_1 = new BoundingRect(0, 0, 0, 0);
+                        pendingRect_1.copy(mergedRect);
+                        pendingRect_1.union(rect);
+                        mergedRepaintRects[i] = pendingRect_1;
+                        isMerged = true;
+                        break;
+                    }
+                    else if (full) {
+                        pendingRect.copy(rect);
+                        pendingRect.union(mergedRect);
+                        var aArea = rect.width * rect.height;
+                        var bArea = mergedRect.width * mergedRect.height;
+                        var pendingArea = pendingRect.width * pendingRect.height;
+                        var deltaArea = pendingArea - aArea - bArea;
+                        if (deltaArea < minDeltaArea) {
+                            minDeltaArea = deltaArea;
+                            bestRectToMergeIdx = i;
+                        }
+                    }
+                }
+                if (full) {
+                    mergedRepaintRects[bestRectToMergeIdx].union(rect);
+                    isMerged = true;
+                }
+                if (!isMerged) {
+                    var boundingRect = new BoundingRect(0, 0, 0, 0);
+                    boundingRect.copy(rect);
+                    mergedRepaintRects.push(boundingRect);
+                }
+                if (!full) {
+                    full = mergedRepaintRects.length >= maxRepaintRectCount;
+                }
+            }
+        }
+        for (var i = this.__startIndex; i < this.__endIndex; ++i) {
+            var el = displayList[i];
+            if (el) {
+                var shouldPaint = el.shouldBePainted(viewWidth, viewHeight, true, true);
+                var prevRect = el.__isRendered && ((el.__dirty & REDRAW_BIT) || !shouldPaint)
+                    ? el.getPrevPaintRect()
+                    : null;
+                if (prevRect) {
+                    addRectToMergePool(prevRect);
+                }
+                var curRect = shouldPaint && ((el.__dirty & REDRAW_BIT) || !el.__isRendered)
+                    ? el.getPaintRect()
+                    : null;
+                if (curRect) {
+                    addRectToMergePool(curRect);
+                }
+            }
+        }
+        for (var i = this.__prevStartIndex; i < this.__prevEndIndex; ++i) {
+            var el = prevList[i];
+            var shouldPaint = el && el.shouldBePainted(viewWidth, viewHeight, true, true);
+            if (el && (!shouldPaint || !el.__zr) && el.__isRendered) {
+                var prevRect = el.getPrevPaintRect();
+                if (prevRect) {
+                    addRectToMergePool(prevRect);
+                }
+            }
+        }
+        var hasIntersections;
+        do {
+            hasIntersections = false;
+            for (var i = 0; i < mergedRepaintRects.length;) {
+                if (mergedRepaintRects[i].isZero()) {
+                    mergedRepaintRects.splice(i, 1);
+                    continue;
+                }
+                for (var j = i + 1; j < mergedRepaintRects.length;) {
+                    if (mergedRepaintRects[i].intersect(mergedRepaintRects[j])) {
+                        hasIntersections = true;
+                        mergedRepaintRects[i].union(mergedRepaintRects[j]);
+                        mergedRepaintRects.splice(j, 1);
+                    }
+                    else {
+                        j++;
+                    }
+                }
+                i++;
+            }
+        } while (hasIntersections);
+        this._paintRects = mergedRepaintRects;
+        return mergedRepaintRects;
+    };
+    Layer.prototype.debugGetPaintRects = function () {
+        return (this._paintRects || []).slice();
+    };
+    Layer.prototype.resize = function (width, height) {
+        var dpr = this.dpr;
+        var dom = this.dom;
+        var domStyle = dom.style;
+        var domBack = this.domBack;
+        if (domStyle) {
+            domStyle.width = width + 'px';
+            domStyle.height = height + 'px';
+        }
+        dom.width = width * dpr;
+        dom.height = height * dpr;
+        if (domBack) {
+            domBack.width = width * dpr;
+            domBack.height = height * dpr;
+            if (dpr !== 1) {
+                this.ctxBack.scale(dpr, dpr);
+            }
+        }
+    };
+    Layer.prototype.clear = function (clearAll, clearColor, repaintRects) {
+        var dom = this.dom;
+        var ctx = this.ctx;
+        var width = dom.width;
+        var height = dom.height;
+        clearColor = clearColor || this.clearColor;
+        var haveMotionBLur = this.motionBlur && !clearAll;
+        var lastFrameAlpha = this.lastFrameAlpha;
+        var dpr = this.dpr;
+        var self = this;
+        if (haveMotionBLur) {
+            if (!this.domBack) {
+                this.createBackBuffer();
+            }
+            this.ctxBack.globalCompositeOperation = 'copy';
+            this.ctxBack.drawImage(dom, 0, 0, width / dpr, height / dpr);
+        }
+        var domBack = this.domBack;
+        function doClear(x, y, width, height) {
+            ctx.clearRect(x, y, width, height);
+            if (clearColor && clearColor !== 'transparent') {
+                var clearColorGradientOrPattern = void 0;
+                if (util.isGradientObject(clearColor)) {
+                    var shouldCache = clearColor.global || (clearColor.__width === width
+                        && clearColor.__height === height);
+                    clearColorGradientOrPattern = shouldCache
+                        && clearColor.__canvasGradient
+                        || getCanvasGradient(ctx, clearColor, {
+                            x: 0,
+                            y: 0,
+                            width: width,
+                            height: height
+                        });
+                    clearColor.__canvasGradient = clearColorGradientOrPattern;
+                    clearColor.__width = width;
+                    clearColor.__height = height;
+                }
+                else if (util.isImagePatternObject(clearColor)) {
+                    clearColor.scaleX = clearColor.scaleX || dpr;
+                    clearColor.scaleY = clearColor.scaleY || dpr;
+                    clearColorGradientOrPattern = createCanvasPattern(ctx, clearColor, {
+                        dirty: function () {
+                            self.setUnpainted();
+                            self.painter.refresh();
+                        }
+                    });
+                }
+                ctx.save();
+                ctx.fillStyle = clearColorGradientOrPattern || clearColor;
+                ctx.fillRect(x, y, width, height);
+                ctx.restore();
+            }
+            if (haveMotionBLur) {
+                ctx.save();
+                ctx.globalAlpha = lastFrameAlpha;
+                ctx.drawImage(domBack, x, y, width, height);
+                ctx.restore();
+            }
+        }
+        ;
+        if (!repaintRects || haveMotionBLur) {
+            doClear(0, 0, width, height);
+        }
+        else if (repaintRects.length) {
+            util.each(repaintRects, function (rect) {
+                doClear(rect.x * dpr, rect.y * dpr, rect.width * dpr, rect.height * dpr);
+            });
+        }
+    };
+    return Layer;
+}(Eventful));
+export default Layer;

+ 72 - 0
node_modules/echarts/node_modules/zrender/lib/canvas/Painter.d.ts

@@ -0,0 +1,72 @@
+import Layer, { LayerConfig } from './Layer';
+import Displayable from '../graphic/Displayable';
+import { GradientObject } from '../graphic/Gradient';
+import { ImagePatternObject } from '../graphic/Pattern';
+import Storage from '../Storage';
+import { PainterBase } from '../PainterBase';
+interface CanvasPainterOption {
+    devicePixelRatio?: number;
+    width?: number | string;
+    height?: number | string;
+    useDirtyRect?: boolean;
+}
+export default class CanvasPainter implements PainterBase {
+    type: string;
+    root: HTMLElement;
+    dpr: number;
+    storage: Storage;
+    private _singleCanvas;
+    private _opts;
+    private _zlevelList;
+    private _prevDisplayList;
+    private _layers;
+    private _layerConfig;
+    private _needsManuallyCompositing;
+    private _width;
+    private _height;
+    private _domRoot;
+    private _hoverlayer;
+    private _redrawId;
+    private _backgroundColor;
+    constructor(root: HTMLElement, storage: Storage, opts: CanvasPainterOption, id: number);
+    getType(): string;
+    isSingleCanvas(): boolean;
+    getViewportRoot(): HTMLElement;
+    getViewportRootOffset(): {
+        offsetLeft: number;
+        offsetTop: number;
+    };
+    refresh(paintAll?: boolean): this;
+    refreshHover(): void;
+    private _paintHoverList;
+    getHoverLayer(): Layer;
+    paintOne(ctx: CanvasRenderingContext2D, el: Displayable): void;
+    private _paintList;
+    private _compositeManually;
+    private _doPaintList;
+    private _doPaintEl;
+    getLayer(zlevel: number, virtual?: boolean): Layer;
+    insertLayer(zlevel: number, layer: Layer): void;
+    eachLayer<T>(cb: (this: T, layer: Layer, z: number) => void, context?: T): void;
+    eachBuiltinLayer<T>(cb: (this: T, layer: Layer, z: number) => void, context?: T): void;
+    eachOtherLayer<T>(cb: (this: T, layer: Layer, z: number) => void, context?: T): void;
+    getLayers(): {
+        [key: number]: Layer;
+    };
+    _updateLayerStatus(list: Displayable[]): void;
+    clear(): this;
+    _clearLayer(layer: Layer): void;
+    setBackgroundColor(backgroundColor: string | GradientObject | ImagePatternObject): void;
+    configLayer(zlevel: number, config: LayerConfig): void;
+    delLayer(zlevel: number): void;
+    resize(width?: number | string, height?: number | string): this;
+    clearLayer(zlevel: number): void;
+    dispose(): void;
+    getRenderedCanvas(opts?: {
+        backgroundColor?: string | GradientObject | ImagePatternObject;
+        pixelRatio?: number;
+    }): HTMLCanvasElement;
+    getWidth(): number;
+    getHeight(): number;
+}
+export {};

+ 641 - 0
node_modules/echarts/node_modules/zrender/lib/canvas/Painter.js

@@ -0,0 +1,641 @@
+import { devicePixelRatio } from '../config.js';
+import * as util from '../core/util.js';
+import Layer from './Layer.js';
+import requestAnimationFrame from '../animation/requestAnimationFrame.js';
+import env from '../core/env.js';
+import { brush, brushSingle } from './graphic.js';
+import { REDRAW_BIT } from '../graphic/constants.js';
+import { getSize } from './helper.js';
+var HOVER_LAYER_ZLEVEL = 1e5;
+var CANVAS_ZLEVEL = 314159;
+var EL_AFTER_INCREMENTAL_INC = 0.01;
+var INCREMENTAL_INC = 0.001;
+function isLayerValid(layer) {
+    if (!layer) {
+        return false;
+    }
+    if (layer.__builtin__) {
+        return true;
+    }
+    if (typeof (layer.resize) !== 'function'
+        || typeof (layer.refresh) !== 'function') {
+        return false;
+    }
+    return true;
+}
+function createRoot(width, height) {
+    var domRoot = document.createElement('div');
+    domRoot.style.cssText = [
+        'position:relative',
+        'width:' + width + 'px',
+        'height:' + height + 'px',
+        'padding:0',
+        'margin:0',
+        'border-width:0'
+    ].join(';') + ';';
+    return domRoot;
+}
+var CanvasPainter = (function () {
+    function CanvasPainter(root, storage, opts, id) {
+        this.type = 'canvas';
+        this._zlevelList = [];
+        this._prevDisplayList = [];
+        this._layers = {};
+        this._layerConfig = {};
+        this._needsManuallyCompositing = false;
+        this.type = 'canvas';
+        var singleCanvas = !root.nodeName
+            || root.nodeName.toUpperCase() === 'CANVAS';
+        this._opts = opts = util.extend({}, opts || {});
+        this.dpr = opts.devicePixelRatio || devicePixelRatio;
+        this._singleCanvas = singleCanvas;
+        this.root = root;
+        var rootStyle = root.style;
+        if (rootStyle) {
+            util.disableUserSelect(root);
+            root.innerHTML = '';
+        }
+        this.storage = storage;
+        var zlevelList = this._zlevelList;
+        this._prevDisplayList = [];
+        var layers = this._layers;
+        if (!singleCanvas) {
+            this._width = getSize(root, 0, opts);
+            this._height = getSize(root, 1, opts);
+            var domRoot = this._domRoot = createRoot(this._width, this._height);
+            root.appendChild(domRoot);
+        }
+        else {
+            var rootCanvas = root;
+            var width = rootCanvas.width;
+            var height = rootCanvas.height;
+            if (opts.width != null) {
+                width = opts.width;
+            }
+            if (opts.height != null) {
+                height = opts.height;
+            }
+            this.dpr = opts.devicePixelRatio || 1;
+            rootCanvas.width = width * this.dpr;
+            rootCanvas.height = height * this.dpr;
+            this._width = width;
+            this._height = height;
+            var mainLayer = new Layer(rootCanvas, this, this.dpr);
+            mainLayer.__builtin__ = true;
+            mainLayer.initContext();
+            layers[CANVAS_ZLEVEL] = mainLayer;
+            mainLayer.zlevel = CANVAS_ZLEVEL;
+            zlevelList.push(CANVAS_ZLEVEL);
+            this._domRoot = root;
+        }
+    }
+    CanvasPainter.prototype.getType = function () {
+        return 'canvas';
+    };
+    CanvasPainter.prototype.isSingleCanvas = function () {
+        return this._singleCanvas;
+    };
+    CanvasPainter.prototype.getViewportRoot = function () {
+        return this._domRoot;
+    };
+    CanvasPainter.prototype.getViewportRootOffset = function () {
+        var viewportRoot = this.getViewportRoot();
+        if (viewportRoot) {
+            return {
+                offsetLeft: viewportRoot.offsetLeft || 0,
+                offsetTop: viewportRoot.offsetTop || 0
+            };
+        }
+    };
+    CanvasPainter.prototype.refresh = function (paintAll) {
+        var list = this.storage.getDisplayList(true);
+        var prevList = this._prevDisplayList;
+        var zlevelList = this._zlevelList;
+        this._redrawId = Math.random();
+        this._paintList(list, prevList, paintAll, this._redrawId);
+        for (var i = 0; i < zlevelList.length; i++) {
+            var z = zlevelList[i];
+            var layer = this._layers[z];
+            if (!layer.__builtin__ && layer.refresh) {
+                var clearColor = i === 0 ? this._backgroundColor : null;
+                layer.refresh(clearColor);
+            }
+        }
+        if (this._opts.useDirtyRect) {
+            this._prevDisplayList = list.slice();
+        }
+        return this;
+    };
+    CanvasPainter.prototype.refreshHover = function () {
+        this._paintHoverList(this.storage.getDisplayList(false));
+    };
+    CanvasPainter.prototype._paintHoverList = function (list) {
+        var len = list.length;
+        var hoverLayer = this._hoverlayer;
+        hoverLayer && hoverLayer.clear();
+        if (!len) {
+            return;
+        }
+        var scope = {
+            inHover: true,
+            viewWidth: this._width,
+            viewHeight: this._height
+        };
+        var ctx;
+        for (var i = 0; i < len; i++) {
+            var el = list[i];
+            if (el.__inHover) {
+                if (!hoverLayer) {
+                    hoverLayer = this._hoverlayer = this.getLayer(HOVER_LAYER_ZLEVEL);
+                }
+                if (!ctx) {
+                    ctx = hoverLayer.ctx;
+                    ctx.save();
+                }
+                brush(ctx, el, scope, i === len - 1);
+            }
+        }
+        if (ctx) {
+            ctx.restore();
+        }
+    };
+    CanvasPainter.prototype.getHoverLayer = function () {
+        return this.getLayer(HOVER_LAYER_ZLEVEL);
+    };
+    CanvasPainter.prototype.paintOne = function (ctx, el) {
+        brushSingle(ctx, el);
+    };
+    CanvasPainter.prototype._paintList = function (list, prevList, paintAll, redrawId) {
+        if (this._redrawId !== redrawId) {
+            return;
+        }
+        paintAll = paintAll || false;
+        this._updateLayerStatus(list);
+        var _a = this._doPaintList(list, prevList, paintAll), finished = _a.finished, needsRefreshHover = _a.needsRefreshHover;
+        if (this._needsManuallyCompositing) {
+            this._compositeManually();
+        }
+        if (needsRefreshHover) {
+            this._paintHoverList(list);
+        }
+        if (!finished) {
+            var self_1 = this;
+            requestAnimationFrame(function () {
+                self_1._paintList(list, prevList, paintAll, redrawId);
+            });
+        }
+        else {
+            this.eachLayer(function (layer) {
+                layer.afterBrush && layer.afterBrush();
+            });
+        }
+    };
+    CanvasPainter.prototype._compositeManually = function () {
+        var ctx = this.getLayer(CANVAS_ZLEVEL).ctx;
+        var width = this._domRoot.width;
+        var height = this._domRoot.height;
+        ctx.clearRect(0, 0, width, height);
+        this.eachBuiltinLayer(function (layer) {
+            if (layer.virtual) {
+                ctx.drawImage(layer.dom, 0, 0, width, height);
+            }
+        });
+    };
+    CanvasPainter.prototype._doPaintList = function (list, prevList, paintAll) {
+        var _this = this;
+        var layerList = [];
+        var useDirtyRect = this._opts.useDirtyRect;
+        for (var zi = 0; zi < this._zlevelList.length; zi++) {
+            var zlevel = this._zlevelList[zi];
+            var layer = this._layers[zlevel];
+            if (layer.__builtin__
+                && layer !== this._hoverlayer
+                && (layer.__dirty || paintAll)) {
+                layerList.push(layer);
+            }
+        }
+        var finished = true;
+        var needsRefreshHover = false;
+        var _loop_1 = function (k) {
+            var layer = layerList[k];
+            var ctx = layer.ctx;
+            var repaintRects = useDirtyRect
+                && layer.createRepaintRects(list, prevList, this_1._width, this_1._height);
+            var start = paintAll ? layer.__startIndex : layer.__drawIndex;
+            var useTimer = !paintAll && layer.incremental && Date.now;
+            var startTime = useTimer && Date.now();
+            var clearColor = layer.zlevel === this_1._zlevelList[0]
+                ? this_1._backgroundColor : null;
+            if (layer.__startIndex === layer.__endIndex) {
+                layer.clear(false, clearColor, repaintRects);
+            }
+            else if (start === layer.__startIndex) {
+                var firstEl = list[start];
+                if (!firstEl.incremental || !firstEl.notClear || paintAll) {
+                    layer.clear(false, clearColor, repaintRects);
+                }
+            }
+            if (start === -1) {
+                console.error('For some unknown reason. drawIndex is -1');
+                start = layer.__startIndex;
+            }
+            var i;
+            var repaint = function (repaintRect) {
+                var scope = {
+                    inHover: false,
+                    allClipped: false,
+                    prevEl: null,
+                    viewWidth: _this._width,
+                    viewHeight: _this._height
+                };
+                for (i = start; i < layer.__endIndex; i++) {
+                    var el = list[i];
+                    if (el.__inHover) {
+                        needsRefreshHover = true;
+                    }
+                    _this._doPaintEl(el, layer, useDirtyRect, repaintRect, scope, i === layer.__endIndex - 1);
+                    if (useTimer) {
+                        var dTime = Date.now() - startTime;
+                        if (dTime > 15) {
+                            break;
+                        }
+                    }
+                }
+                if (scope.prevElClipPaths) {
+                    ctx.restore();
+                }
+            };
+            if (repaintRects) {
+                if (repaintRects.length === 0) {
+                    i = layer.__endIndex;
+                }
+                else {
+                    var dpr = this_1.dpr;
+                    for (var r = 0; r < repaintRects.length; ++r) {
+                        var rect = repaintRects[r];
+                        ctx.save();
+                        ctx.beginPath();
+                        ctx.rect(rect.x * dpr, rect.y * dpr, rect.width * dpr, rect.height * dpr);
+                        ctx.clip();
+                        repaint(rect);
+                        ctx.restore();
+                    }
+                }
+            }
+            else {
+                ctx.save();
+                repaint();
+                ctx.restore();
+            }
+            layer.__drawIndex = i;
+            if (layer.__drawIndex < layer.__endIndex) {
+                finished = false;
+            }
+        };
+        var this_1 = this;
+        for (var k = 0; k < layerList.length; k++) {
+            _loop_1(k);
+        }
+        if (env.wxa) {
+            util.each(this._layers, function (layer) {
+                if (layer && layer.ctx && layer.ctx.draw) {
+                    layer.ctx.draw();
+                }
+            });
+        }
+        return {
+            finished: finished,
+            needsRefreshHover: needsRefreshHover
+        };
+    };
+    CanvasPainter.prototype._doPaintEl = function (el, currentLayer, useDirtyRect, repaintRect, scope, isLast) {
+        var ctx = currentLayer.ctx;
+        if (useDirtyRect) {
+            var paintRect = el.getPaintRect();
+            if (!repaintRect || paintRect && paintRect.intersect(repaintRect)) {
+                brush(ctx, el, scope, isLast);
+                el.setPrevPaintRect(paintRect);
+            }
+        }
+        else {
+            brush(ctx, el, scope, isLast);
+        }
+    };
+    CanvasPainter.prototype.getLayer = function (zlevel, virtual) {
+        if (this._singleCanvas && !this._needsManuallyCompositing) {
+            zlevel = CANVAS_ZLEVEL;
+        }
+        var layer = this._layers[zlevel];
+        if (!layer) {
+            layer = new Layer('zr_' + zlevel, this, this.dpr);
+            layer.zlevel = zlevel;
+            layer.__builtin__ = true;
+            if (this._layerConfig[zlevel]) {
+                util.merge(layer, this._layerConfig[zlevel], true);
+            }
+            else if (this._layerConfig[zlevel - EL_AFTER_INCREMENTAL_INC]) {
+                util.merge(layer, this._layerConfig[zlevel - EL_AFTER_INCREMENTAL_INC], true);
+            }
+            if (virtual) {
+                layer.virtual = virtual;
+            }
+            this.insertLayer(zlevel, layer);
+            layer.initContext();
+        }
+        return layer;
+    };
+    CanvasPainter.prototype.insertLayer = function (zlevel, layer) {
+        var layersMap = this._layers;
+        var zlevelList = this._zlevelList;
+        var len = zlevelList.length;
+        var domRoot = this._domRoot;
+        var prevLayer = null;
+        var i = -1;
+        if (layersMap[zlevel]) {
+            if (process.env.NODE_ENV !== 'production') {
+                util.logError('ZLevel ' + zlevel + ' has been used already');
+            }
+            return;
+        }
+        if (!isLayerValid(layer)) {
+            if (process.env.NODE_ENV !== 'production') {
+                util.logError('Layer of zlevel ' + zlevel + ' is not valid');
+            }
+            return;
+        }
+        if (len > 0 && zlevel > zlevelList[0]) {
+            for (i = 0; i < len - 1; i++) {
+                if (zlevelList[i] < zlevel
+                    && zlevelList[i + 1] > zlevel) {
+                    break;
+                }
+            }
+            prevLayer = layersMap[zlevelList[i]];
+        }
+        zlevelList.splice(i + 1, 0, zlevel);
+        layersMap[zlevel] = layer;
+        if (!layer.virtual) {
+            if (prevLayer) {
+                var prevDom = prevLayer.dom;
+                if (prevDom.nextSibling) {
+                    domRoot.insertBefore(layer.dom, prevDom.nextSibling);
+                }
+                else {
+                    domRoot.appendChild(layer.dom);
+                }
+            }
+            else {
+                if (domRoot.firstChild) {
+                    domRoot.insertBefore(layer.dom, domRoot.firstChild);
+                }
+                else {
+                    domRoot.appendChild(layer.dom);
+                }
+            }
+        }
+        layer.painter || (layer.painter = this);
+    };
+    CanvasPainter.prototype.eachLayer = function (cb, context) {
+        var zlevelList = this._zlevelList;
+        for (var i = 0; i < zlevelList.length; i++) {
+            var z = zlevelList[i];
+            cb.call(context, this._layers[z], z);
+        }
+    };
+    CanvasPainter.prototype.eachBuiltinLayer = function (cb, context) {
+        var zlevelList = this._zlevelList;
+        for (var i = 0; i < zlevelList.length; i++) {
+            var z = zlevelList[i];
+            var layer = this._layers[z];
+            if (layer.__builtin__) {
+                cb.call(context, layer, z);
+            }
+        }
+    };
+    CanvasPainter.prototype.eachOtherLayer = function (cb, context) {
+        var zlevelList = this._zlevelList;
+        for (var i = 0; i < zlevelList.length; i++) {
+            var z = zlevelList[i];
+            var layer = this._layers[z];
+            if (!layer.__builtin__) {
+                cb.call(context, layer, z);
+            }
+        }
+    };
+    CanvasPainter.prototype.getLayers = function () {
+        return this._layers;
+    };
+    CanvasPainter.prototype._updateLayerStatus = function (list) {
+        this.eachBuiltinLayer(function (layer, z) {
+            layer.__dirty = layer.__used = false;
+        });
+        function updatePrevLayer(idx) {
+            if (prevLayer) {
+                if (prevLayer.__endIndex !== idx) {
+                    prevLayer.__dirty = true;
+                }
+                prevLayer.__endIndex = idx;
+            }
+        }
+        if (this._singleCanvas) {
+            for (var i_1 = 1; i_1 < list.length; i_1++) {
+                var el = list[i_1];
+                if (el.zlevel !== list[i_1 - 1].zlevel || el.incremental) {
+                    this._needsManuallyCompositing = true;
+                    break;
+                }
+            }
+        }
+        var prevLayer = null;
+        var incrementalLayerCount = 0;
+        var prevZlevel;
+        var i;
+        for (i = 0; i < list.length; i++) {
+            var el = list[i];
+            var zlevel = el.zlevel;
+            var layer = void 0;
+            if (prevZlevel !== zlevel) {
+                prevZlevel = zlevel;
+                incrementalLayerCount = 0;
+            }
+            if (el.incremental) {
+                layer = this.getLayer(zlevel + INCREMENTAL_INC, this._needsManuallyCompositing);
+                layer.incremental = true;
+                incrementalLayerCount = 1;
+            }
+            else {
+                layer = this.getLayer(zlevel + (incrementalLayerCount > 0 ? EL_AFTER_INCREMENTAL_INC : 0), this._needsManuallyCompositing);
+            }
+            if (!layer.__builtin__) {
+                util.logError('ZLevel ' + zlevel + ' has been used by unkown layer ' + layer.id);
+            }
+            if (layer !== prevLayer) {
+                layer.__used = true;
+                if (layer.__startIndex !== i) {
+                    layer.__dirty = true;
+                }
+                layer.__startIndex = i;
+                if (!layer.incremental) {
+                    layer.__drawIndex = i;
+                }
+                else {
+                    layer.__drawIndex = -1;
+                }
+                updatePrevLayer(i);
+                prevLayer = layer;
+            }
+            if ((el.__dirty & REDRAW_BIT) && !el.__inHover) {
+                layer.__dirty = true;
+                if (layer.incremental && layer.__drawIndex < 0) {
+                    layer.__drawIndex = i;
+                }
+            }
+        }
+        updatePrevLayer(i);
+        this.eachBuiltinLayer(function (layer, z) {
+            if (!layer.__used && layer.getElementCount() > 0) {
+                layer.__dirty = true;
+                layer.__startIndex = layer.__endIndex = layer.__drawIndex = 0;
+            }
+            if (layer.__dirty && layer.__drawIndex < 0) {
+                layer.__drawIndex = layer.__startIndex;
+            }
+        });
+    };
+    CanvasPainter.prototype.clear = function () {
+        this.eachBuiltinLayer(this._clearLayer);
+        return this;
+    };
+    CanvasPainter.prototype._clearLayer = function (layer) {
+        layer.clear();
+    };
+    CanvasPainter.prototype.setBackgroundColor = function (backgroundColor) {
+        this._backgroundColor = backgroundColor;
+        util.each(this._layers, function (layer) {
+            layer.setUnpainted();
+        });
+    };
+    CanvasPainter.prototype.configLayer = function (zlevel, config) {
+        if (config) {
+            var layerConfig = this._layerConfig;
+            if (!layerConfig[zlevel]) {
+                layerConfig[zlevel] = config;
+            }
+            else {
+                util.merge(layerConfig[zlevel], config, true);
+            }
+            for (var i = 0; i < this._zlevelList.length; i++) {
+                var _zlevel = this._zlevelList[i];
+                if (_zlevel === zlevel || _zlevel === zlevel + EL_AFTER_INCREMENTAL_INC) {
+                    var layer = this._layers[_zlevel];
+                    util.merge(layer, layerConfig[zlevel], true);
+                }
+            }
+        }
+    };
+    CanvasPainter.prototype.delLayer = function (zlevel) {
+        var layers = this._layers;
+        var zlevelList = this._zlevelList;
+        var layer = layers[zlevel];
+        if (!layer) {
+            return;
+        }
+        layer.dom.parentNode.removeChild(layer.dom);
+        delete layers[zlevel];
+        zlevelList.splice(util.indexOf(zlevelList, zlevel), 1);
+    };
+    CanvasPainter.prototype.resize = function (width, height) {
+        if (!this._domRoot.style) {
+            if (width == null || height == null) {
+                return;
+            }
+            this._width = width;
+            this._height = height;
+            this.getLayer(CANVAS_ZLEVEL).resize(width, height);
+        }
+        else {
+            var domRoot = this._domRoot;
+            domRoot.style.display = 'none';
+            var opts = this._opts;
+            var root = this.root;
+            width != null && (opts.width = width);
+            height != null && (opts.height = height);
+            width = getSize(root, 0, opts);
+            height = getSize(root, 1, opts);
+            domRoot.style.display = '';
+            if (this._width !== width || height !== this._height) {
+                domRoot.style.width = width + 'px';
+                domRoot.style.height = height + 'px';
+                for (var id in this._layers) {
+                    if (this._layers.hasOwnProperty(id)) {
+                        this._layers[id].resize(width, height);
+                    }
+                }
+                this.refresh(true);
+            }
+            this._width = width;
+            this._height = height;
+        }
+        return this;
+    };
+    CanvasPainter.prototype.clearLayer = function (zlevel) {
+        var layer = this._layers[zlevel];
+        if (layer) {
+            layer.clear();
+        }
+    };
+    CanvasPainter.prototype.dispose = function () {
+        this.root.innerHTML = '';
+        this.root =
+            this.storage =
+                this._domRoot =
+                    this._layers = null;
+    };
+    CanvasPainter.prototype.getRenderedCanvas = function (opts) {
+        opts = opts || {};
+        if (this._singleCanvas && !this._compositeManually) {
+            return this._layers[CANVAS_ZLEVEL].dom;
+        }
+        var imageLayer = new Layer('image', this, opts.pixelRatio || this.dpr);
+        imageLayer.initContext();
+        imageLayer.clear(false, opts.backgroundColor || this._backgroundColor);
+        var ctx = imageLayer.ctx;
+        if (opts.pixelRatio <= this.dpr) {
+            this.refresh();
+            var width_1 = imageLayer.dom.width;
+            var height_1 = imageLayer.dom.height;
+            this.eachLayer(function (layer) {
+                if (layer.__builtin__) {
+                    ctx.drawImage(layer.dom, 0, 0, width_1, height_1);
+                }
+                else if (layer.renderToCanvas) {
+                    ctx.save();
+                    layer.renderToCanvas(ctx);
+                    ctx.restore();
+                }
+            });
+        }
+        else {
+            var scope = {
+                inHover: false,
+                viewWidth: this._width,
+                viewHeight: this._height
+            };
+            var displayList = this.storage.getDisplayList(true);
+            for (var i = 0, len = displayList.length; i < len; i++) {
+                var el = displayList[i];
+                brush(ctx, el, scope, i === len - 1);
+            }
+        }
+        return imageLayer.dom;
+    };
+    CanvasPainter.prototype.getWidth = function () {
+        return this._width;
+    };
+    CanvasPainter.prototype.getHeight = function () {
+        return this._height;
+    };
+    return CanvasPainter;
+}());
+export default CanvasPainter;
+;

+ 1 - 0
node_modules/echarts/node_modules/zrender/lib/canvas/canvas.d.ts

@@ -0,0 +1 @@
+export {};

+ 3 - 0
node_modules/echarts/node_modules/zrender/lib/canvas/canvas.js

@@ -0,0 +1,3 @@
+import { registerPainter } from '../zrender.js';
+import Painter from './Painter.js';
+registerPainter('canvas', Painter);

+ 4 - 0
node_modules/echarts/node_modules/zrender/lib/canvas/dashStyle.d.ts

@@ -0,0 +1,4 @@
+import Path from '../graphic/Path';
+import TSpan from '../graphic/TSpan';
+export declare function normalizeLineDash(lineType: any, lineWidth?: number): number[] | false;
+export declare function getLineDash(el: Path | TSpan): [number[] | false, number];

+ 27 - 0
node_modules/echarts/node_modules/zrender/lib/canvas/dashStyle.js

@@ -0,0 +1,27 @@
+import { isArray, isNumber, map } from '../core/util.js';
+export function normalizeLineDash(lineType, lineWidth) {
+    if (!lineType || lineType === 'solid' || !(lineWidth > 0)) {
+        return null;
+    }
+    return lineType === 'dashed'
+        ? [4 * lineWidth, 2 * lineWidth]
+        : lineType === 'dotted'
+            ? [lineWidth]
+            : isNumber(lineType)
+                ? [lineType] : isArray(lineType) ? lineType : null;
+}
+export function getLineDash(el) {
+    var style = el.style;
+    var lineDash = style.lineDash && style.lineWidth > 0 && normalizeLineDash(style.lineDash, style.lineWidth);
+    var lineDashOffset = style.lineDashOffset;
+    if (lineDash) {
+        var lineScale_1 = (style.strokeNoScale && el.getLineScale) ? el.getLineScale() : 1;
+        if (lineScale_1 && lineScale_1 !== 1) {
+            lineDash = map(lineDash, function (rawVal) {
+                return rawVal / lineScale_1;
+            });
+            lineDashOffset /= lineScale_1;
+        }
+    }
+    return [lineDash, lineDashOffset];
+}

+ 19 - 0
node_modules/echarts/node_modules/zrender/lib/canvas/graphic.d.ts

@@ -0,0 +1,19 @@
+import Displayable from '../graphic/Displayable';
+import { ImagePatternObject } from '../graphic/Pattern';
+import Path from '../graphic/Path';
+export declare function createCanvasPattern(this: void, ctx: CanvasRenderingContext2D, pattern: ImagePatternObject, el: {
+    dirty: () => void;
+}): CanvasPattern;
+export declare type BrushScope = {
+    inHover: boolean;
+    viewWidth: number;
+    viewHeight: number;
+    prevElClipPaths?: Path[];
+    prevEl?: Displayable;
+    allClipped?: boolean;
+    batchFill?: string;
+    batchStroke?: string;
+    lastDrawType?: number;
+};
+export declare function brushSingle(ctx: CanvasRenderingContext2D, el: Displayable): void;
+export declare function brush(ctx: CanvasRenderingContext2D, el: Displayable, scope: BrushScope, isLast: boolean): void;

+ 558 - 0
node_modules/echarts/node_modules/zrender/lib/canvas/graphic.js

@@ -0,0 +1,558 @@
+import { DEFAULT_COMMON_STYLE } from '../graphic/Displayable.js';
+import PathProxy from '../core/PathProxy.js';
+import { createOrUpdateImage, isImageReady } from '../graphic/helper/image.js';
+import { getCanvasGradient, isClipPathChanged } from './helper.js';
+import Path from '../graphic/Path.js';
+import ZRImage from '../graphic/Image.js';
+import TSpan from '../graphic/TSpan.js';
+import { RADIAN_TO_DEGREE } from '../core/util.js';
+import { getLineDash } from './dashStyle.js';
+import { REDRAW_BIT, SHAPE_CHANGED_BIT } from '../graphic/constants.js';
+import { DEFAULT_FONT } from '../core/platform.js';
+var pathProxyForDraw = new PathProxy(true);
+function styleHasStroke(style) {
+    var stroke = style.stroke;
+    return !(stroke == null || stroke === 'none' || !(style.lineWidth > 0));
+}
+function isValidStrokeFillStyle(strokeOrFill) {
+    return typeof strokeOrFill === 'string' && strokeOrFill !== 'none';
+}
+function styleHasFill(style) {
+    var fill = style.fill;
+    return fill != null && fill !== 'none';
+}
+function doFillPath(ctx, style) {
+    if (style.fillOpacity != null && style.fillOpacity !== 1) {
+        var originalGlobalAlpha = ctx.globalAlpha;
+        ctx.globalAlpha = style.fillOpacity * style.opacity;
+        ctx.fill();
+        ctx.globalAlpha = originalGlobalAlpha;
+    }
+    else {
+        ctx.fill();
+    }
+}
+function doStrokePath(ctx, style) {
+    if (style.strokeOpacity != null && style.strokeOpacity !== 1) {
+        var originalGlobalAlpha = ctx.globalAlpha;
+        ctx.globalAlpha = style.strokeOpacity * style.opacity;
+        ctx.stroke();
+        ctx.globalAlpha = originalGlobalAlpha;
+    }
+    else {
+        ctx.stroke();
+    }
+}
+export function createCanvasPattern(ctx, pattern, el) {
+    var image = createOrUpdateImage(pattern.image, pattern.__image, el);
+    if (isImageReady(image)) {
+        var canvasPattern = ctx.createPattern(image, pattern.repeat || 'repeat');
+        if (typeof DOMMatrix === 'function'
+            && canvasPattern
+            && canvasPattern.setTransform) {
+            var matrix = new DOMMatrix();
+            matrix.translateSelf((pattern.x || 0), (pattern.y || 0));
+            matrix.rotateSelf(0, 0, (pattern.rotation || 0) * RADIAN_TO_DEGREE);
+            matrix.scaleSelf((pattern.scaleX || 1), (pattern.scaleY || 1));
+            canvasPattern.setTransform(matrix);
+        }
+        return canvasPattern;
+    }
+}
+function brushPath(ctx, el, style, inBatch) {
+    var _a;
+    var hasStroke = styleHasStroke(style);
+    var hasFill = styleHasFill(style);
+    var strokePercent = style.strokePercent;
+    var strokePart = strokePercent < 1;
+    var firstDraw = !el.path;
+    if ((!el.silent || strokePart) && firstDraw) {
+        el.createPathProxy();
+    }
+    var path = el.path || pathProxyForDraw;
+    var dirtyFlag = el.__dirty;
+    if (!inBatch) {
+        var fill = style.fill;
+        var stroke = style.stroke;
+        var hasFillGradient = hasFill && !!fill.colorStops;
+        var hasStrokeGradient = hasStroke && !!stroke.colorStops;
+        var hasFillPattern = hasFill && !!fill.image;
+        var hasStrokePattern = hasStroke && !!stroke.image;
+        var fillGradient = void 0;
+        var strokeGradient = void 0;
+        var fillPattern = void 0;
+        var strokePattern = void 0;
+        var rect = void 0;
+        if (hasFillGradient || hasStrokeGradient) {
+            rect = el.getBoundingRect();
+        }
+        if (hasFillGradient) {
+            fillGradient = dirtyFlag
+                ? getCanvasGradient(ctx, fill, rect)
+                : el.__canvasFillGradient;
+            el.__canvasFillGradient = fillGradient;
+        }
+        if (hasStrokeGradient) {
+            strokeGradient = dirtyFlag
+                ? getCanvasGradient(ctx, stroke, rect)
+                : el.__canvasStrokeGradient;
+            el.__canvasStrokeGradient = strokeGradient;
+        }
+        if (hasFillPattern) {
+            fillPattern = (dirtyFlag || !el.__canvasFillPattern)
+                ? createCanvasPattern(ctx, fill, el)
+                : el.__canvasFillPattern;
+            el.__canvasFillPattern = fillPattern;
+        }
+        if (hasStrokePattern) {
+            strokePattern = (dirtyFlag || !el.__canvasStrokePattern)
+                ? createCanvasPattern(ctx, stroke, el)
+                : el.__canvasStrokePattern;
+            el.__canvasStrokePattern = fillPattern;
+        }
+        if (hasFillGradient) {
+            ctx.fillStyle = fillGradient;
+        }
+        else if (hasFillPattern) {
+            if (fillPattern) {
+                ctx.fillStyle = fillPattern;
+            }
+            else {
+                hasFill = false;
+            }
+        }
+        if (hasStrokeGradient) {
+            ctx.strokeStyle = strokeGradient;
+        }
+        else if (hasStrokePattern) {
+            if (strokePattern) {
+                ctx.strokeStyle = strokePattern;
+            }
+            else {
+                hasStroke = false;
+            }
+        }
+    }
+    var scale = el.getGlobalScale();
+    path.setScale(scale[0], scale[1], el.segmentIgnoreThreshold);
+    var lineDash;
+    var lineDashOffset;
+    if (ctx.setLineDash && style.lineDash) {
+        _a = getLineDash(el), lineDash = _a[0], lineDashOffset = _a[1];
+    }
+    var needsRebuild = true;
+    if (firstDraw || (dirtyFlag & SHAPE_CHANGED_BIT)) {
+        path.setDPR(ctx.dpr);
+        if (strokePart) {
+            path.setContext(null);
+        }
+        else {
+            path.setContext(ctx);
+            needsRebuild = false;
+        }
+        path.reset();
+        el.buildPath(path, el.shape, inBatch);
+        path.toStatic();
+        el.pathUpdated();
+    }
+    if (needsRebuild) {
+        path.rebuildPath(ctx, strokePart ? strokePercent : 1);
+    }
+    if (lineDash) {
+        ctx.setLineDash(lineDash);
+        ctx.lineDashOffset = lineDashOffset;
+    }
+    if (!inBatch) {
+        if (style.strokeFirst) {
+            if (hasStroke) {
+                doStrokePath(ctx, style);
+            }
+            if (hasFill) {
+                doFillPath(ctx, style);
+            }
+        }
+        else {
+            if (hasFill) {
+                doFillPath(ctx, style);
+            }
+            if (hasStroke) {
+                doStrokePath(ctx, style);
+            }
+        }
+    }
+    if (lineDash) {
+        ctx.setLineDash([]);
+    }
+}
+function brushImage(ctx, el, style) {
+    var image = el.__image = createOrUpdateImage(style.image, el.__image, el, el.onload);
+    if (!image || !isImageReady(image)) {
+        return;
+    }
+    var x = style.x || 0;
+    var y = style.y || 0;
+    var width = el.getWidth();
+    var height = el.getHeight();
+    var aspect = image.width / image.height;
+    if (width == null && height != null) {
+        width = height * aspect;
+    }
+    else if (height == null && width != null) {
+        height = width / aspect;
+    }
+    else if (width == null && height == null) {
+        width = image.width;
+        height = image.height;
+    }
+    if (style.sWidth && style.sHeight) {
+        var sx = style.sx || 0;
+        var sy = style.sy || 0;
+        ctx.drawImage(image, sx, sy, style.sWidth, style.sHeight, x, y, width, height);
+    }
+    else if (style.sx && style.sy) {
+        var sx = style.sx;
+        var sy = style.sy;
+        var sWidth = width - sx;
+        var sHeight = height - sy;
+        ctx.drawImage(image, sx, sy, sWidth, sHeight, x, y, width, height);
+    }
+    else {
+        ctx.drawImage(image, x, y, width, height);
+    }
+}
+function brushText(ctx, el, style) {
+    var _a;
+    var text = style.text;
+    text != null && (text += '');
+    if (text) {
+        ctx.font = style.font || DEFAULT_FONT;
+        ctx.textAlign = style.textAlign;
+        ctx.textBaseline = style.textBaseline;
+        var lineDash = void 0;
+        var lineDashOffset = void 0;
+        if (ctx.setLineDash && style.lineDash) {
+            _a = getLineDash(el), lineDash = _a[0], lineDashOffset = _a[1];
+        }
+        if (lineDash) {
+            ctx.setLineDash(lineDash);
+            ctx.lineDashOffset = lineDashOffset;
+        }
+        if (style.strokeFirst) {
+            if (styleHasStroke(style)) {
+                ctx.strokeText(text, style.x, style.y);
+            }
+            if (styleHasFill(style)) {
+                ctx.fillText(text, style.x, style.y);
+            }
+        }
+        else {
+            if (styleHasFill(style)) {
+                ctx.fillText(text, style.x, style.y);
+            }
+            if (styleHasStroke(style)) {
+                ctx.strokeText(text, style.x, style.y);
+            }
+        }
+        if (lineDash) {
+            ctx.setLineDash([]);
+        }
+    }
+}
+var SHADOW_NUMBER_PROPS = ['shadowBlur', 'shadowOffsetX', 'shadowOffsetY'];
+var STROKE_PROPS = [
+    ['lineCap', 'butt'], ['lineJoin', 'miter'], ['miterLimit', 10]
+];
+function bindCommonProps(ctx, style, prevStyle, forceSetAll, scope) {
+    var styleChanged = false;
+    if (!forceSetAll) {
+        prevStyle = prevStyle || {};
+        if (style === prevStyle) {
+            return false;
+        }
+    }
+    if (forceSetAll || style.opacity !== prevStyle.opacity) {
+        flushPathDrawn(ctx, scope);
+        styleChanged = true;
+        var opacity = Math.max(Math.min(style.opacity, 1), 0);
+        ctx.globalAlpha = isNaN(opacity) ? DEFAULT_COMMON_STYLE.opacity : opacity;
+    }
+    if (forceSetAll || style.blend !== prevStyle.blend) {
+        if (!styleChanged) {
+            flushPathDrawn(ctx, scope);
+            styleChanged = true;
+        }
+        ctx.globalCompositeOperation = style.blend || DEFAULT_COMMON_STYLE.blend;
+    }
+    for (var i = 0; i < SHADOW_NUMBER_PROPS.length; i++) {
+        var propName = SHADOW_NUMBER_PROPS[i];
+        if (forceSetAll || style[propName] !== prevStyle[propName]) {
+            if (!styleChanged) {
+                flushPathDrawn(ctx, scope);
+                styleChanged = true;
+            }
+            ctx[propName] = ctx.dpr * (style[propName] || 0);
+        }
+    }
+    if (forceSetAll || style.shadowColor !== prevStyle.shadowColor) {
+        if (!styleChanged) {
+            flushPathDrawn(ctx, scope);
+            styleChanged = true;
+        }
+        ctx.shadowColor = style.shadowColor || DEFAULT_COMMON_STYLE.shadowColor;
+    }
+    return styleChanged;
+}
+function bindPathAndTextCommonStyle(ctx, el, prevEl, forceSetAll, scope) {
+    var style = getStyle(el, scope.inHover);
+    var prevStyle = forceSetAll
+        ? null
+        : (prevEl && getStyle(prevEl, scope.inHover) || {});
+    if (style === prevStyle) {
+        return false;
+    }
+    var styleChanged = bindCommonProps(ctx, style, prevStyle, forceSetAll, scope);
+    if (forceSetAll || style.fill !== prevStyle.fill) {
+        if (!styleChanged) {
+            flushPathDrawn(ctx, scope);
+            styleChanged = true;
+        }
+        isValidStrokeFillStyle(style.fill) && (ctx.fillStyle = style.fill);
+    }
+    if (forceSetAll || style.stroke !== prevStyle.stroke) {
+        if (!styleChanged) {
+            flushPathDrawn(ctx, scope);
+            styleChanged = true;
+        }
+        isValidStrokeFillStyle(style.stroke) && (ctx.strokeStyle = style.stroke);
+    }
+    if (forceSetAll || style.opacity !== prevStyle.opacity) {
+        if (!styleChanged) {
+            flushPathDrawn(ctx, scope);
+            styleChanged = true;
+        }
+        ctx.globalAlpha = style.opacity == null ? 1 : style.opacity;
+    }
+    if (el.hasStroke()) {
+        var lineWidth = style.lineWidth;
+        var newLineWidth = lineWidth / ((style.strokeNoScale && el.getLineScale) ? el.getLineScale() : 1);
+        if (ctx.lineWidth !== newLineWidth) {
+            if (!styleChanged) {
+                flushPathDrawn(ctx, scope);
+                styleChanged = true;
+            }
+            ctx.lineWidth = newLineWidth;
+        }
+    }
+    for (var i = 0; i < STROKE_PROPS.length; i++) {
+        var prop = STROKE_PROPS[i];
+        var propName = prop[0];
+        if (forceSetAll || style[propName] !== prevStyle[propName]) {
+            if (!styleChanged) {
+                flushPathDrawn(ctx, scope);
+                styleChanged = true;
+            }
+            ctx[propName] = style[propName] || prop[1];
+        }
+    }
+    return styleChanged;
+}
+function bindImageStyle(ctx, el, prevEl, forceSetAll, scope) {
+    return bindCommonProps(ctx, getStyle(el, scope.inHover), prevEl && getStyle(prevEl, scope.inHover), forceSetAll, scope);
+}
+function setContextTransform(ctx, el) {
+    var m = el.transform;
+    var dpr = ctx.dpr || 1;
+    if (m) {
+        ctx.setTransform(dpr * m[0], dpr * m[1], dpr * m[2], dpr * m[3], dpr * m[4], dpr * m[5]);
+    }
+    else {
+        ctx.setTransform(dpr, 0, 0, dpr, 0, 0);
+    }
+}
+function updateClipStatus(clipPaths, ctx, scope) {
+    var allClipped = false;
+    for (var i = 0; i < clipPaths.length; i++) {
+        var clipPath = clipPaths[i];
+        allClipped = allClipped || clipPath.isZeroArea();
+        setContextTransform(ctx, clipPath);
+        ctx.beginPath();
+        clipPath.buildPath(ctx, clipPath.shape);
+        ctx.clip();
+    }
+    scope.allClipped = allClipped;
+}
+function isTransformChanged(m0, m1) {
+    if (m0 && m1) {
+        return m0[0] !== m1[0]
+            || m0[1] !== m1[1]
+            || m0[2] !== m1[2]
+            || m0[3] !== m1[3]
+            || m0[4] !== m1[4]
+            || m0[5] !== m1[5];
+    }
+    else if (!m0 && !m1) {
+        return false;
+    }
+    return true;
+}
+var DRAW_TYPE_PATH = 1;
+var DRAW_TYPE_IMAGE = 2;
+var DRAW_TYPE_TEXT = 3;
+var DRAW_TYPE_INCREMENTAL = 4;
+function canPathBatch(style) {
+    var hasFill = styleHasFill(style);
+    var hasStroke = styleHasStroke(style);
+    return !(style.lineDash
+        || !(+hasFill ^ +hasStroke)
+        || (hasFill && typeof style.fill !== 'string')
+        || (hasStroke && typeof style.stroke !== 'string')
+        || style.strokePercent < 1
+        || style.strokeOpacity < 1
+        || style.fillOpacity < 1);
+}
+function flushPathDrawn(ctx, scope) {
+    scope.batchFill && ctx.fill();
+    scope.batchStroke && ctx.stroke();
+    scope.batchFill = '';
+    scope.batchStroke = '';
+}
+function getStyle(el, inHover) {
+    return inHover ? (el.__hoverStyle || el.style) : el.style;
+}
+export function brushSingle(ctx, el) {
+    brush(ctx, el, { inHover: false, viewWidth: 0, viewHeight: 0 }, true);
+}
+export function brush(ctx, el, scope, isLast) {
+    var m = el.transform;
+    if (!el.shouldBePainted(scope.viewWidth, scope.viewHeight, false, false)) {
+        el.__dirty &= ~REDRAW_BIT;
+        el.__isRendered = false;
+        return;
+    }
+    var clipPaths = el.__clipPaths;
+    var prevElClipPaths = scope.prevElClipPaths;
+    var forceSetTransform = false;
+    var forceSetStyle = false;
+    if (!prevElClipPaths || isClipPathChanged(clipPaths, prevElClipPaths)) {
+        if (prevElClipPaths && prevElClipPaths.length) {
+            flushPathDrawn(ctx, scope);
+            ctx.restore();
+            forceSetStyle = forceSetTransform = true;
+            scope.prevElClipPaths = null;
+            scope.allClipped = false;
+            scope.prevEl = null;
+        }
+        if (clipPaths && clipPaths.length) {
+            flushPathDrawn(ctx, scope);
+            ctx.save();
+            updateClipStatus(clipPaths, ctx, scope);
+            forceSetTransform = true;
+        }
+        scope.prevElClipPaths = clipPaths;
+    }
+    if (scope.allClipped) {
+        el.__isRendered = false;
+        return;
+    }
+    el.beforeBrush && el.beforeBrush();
+    el.innerBeforeBrush();
+    var prevEl = scope.prevEl;
+    if (!prevEl) {
+        forceSetStyle = forceSetTransform = true;
+    }
+    var canBatchPath = el instanceof Path
+        && el.autoBatch
+        && canPathBatch(el.style);
+    if (forceSetTransform || isTransformChanged(m, prevEl.transform)) {
+        flushPathDrawn(ctx, scope);
+        setContextTransform(ctx, el);
+    }
+    else if (!canBatchPath) {
+        flushPathDrawn(ctx, scope);
+    }
+    var style = getStyle(el, scope.inHover);
+    if (el instanceof Path) {
+        if (scope.lastDrawType !== DRAW_TYPE_PATH) {
+            forceSetStyle = true;
+            scope.lastDrawType = DRAW_TYPE_PATH;
+        }
+        bindPathAndTextCommonStyle(ctx, el, prevEl, forceSetStyle, scope);
+        if (!canBatchPath || (!scope.batchFill && !scope.batchStroke)) {
+            ctx.beginPath();
+        }
+        brushPath(ctx, el, style, canBatchPath);
+        if (canBatchPath) {
+            scope.batchFill = style.fill || '';
+            scope.batchStroke = style.stroke || '';
+        }
+    }
+    else {
+        if (el instanceof TSpan) {
+            if (scope.lastDrawType !== DRAW_TYPE_TEXT) {
+                forceSetStyle = true;
+                scope.lastDrawType = DRAW_TYPE_TEXT;
+            }
+            bindPathAndTextCommonStyle(ctx, el, prevEl, forceSetStyle, scope);
+            brushText(ctx, el, style);
+        }
+        else if (el instanceof ZRImage) {
+            if (scope.lastDrawType !== DRAW_TYPE_IMAGE) {
+                forceSetStyle = true;
+                scope.lastDrawType = DRAW_TYPE_IMAGE;
+            }
+            bindImageStyle(ctx, el, prevEl, forceSetStyle, scope);
+            brushImage(ctx, el, style);
+        }
+        else if (el.getTemporalDisplayables) {
+            if (scope.lastDrawType !== DRAW_TYPE_INCREMENTAL) {
+                forceSetStyle = true;
+                scope.lastDrawType = DRAW_TYPE_INCREMENTAL;
+            }
+            brushIncremental(ctx, el, scope);
+        }
+    }
+    if (canBatchPath && isLast) {
+        flushPathDrawn(ctx, scope);
+    }
+    el.innerAfterBrush();
+    el.afterBrush && el.afterBrush();
+    scope.prevEl = el;
+    el.__dirty = 0;
+    el.__isRendered = true;
+}
+function brushIncremental(ctx, el, scope) {
+    var displayables = el.getDisplayables();
+    var temporalDisplayables = el.getTemporalDisplayables();
+    ctx.save();
+    var innerScope = {
+        prevElClipPaths: null,
+        prevEl: null,
+        allClipped: false,
+        viewWidth: scope.viewWidth,
+        viewHeight: scope.viewHeight,
+        inHover: scope.inHover
+    };
+    var i;
+    var len;
+    for (i = el.getCursor(), len = displayables.length; i < len; i++) {
+        var displayable = displayables[i];
+        displayable.beforeBrush && displayable.beforeBrush();
+        displayable.innerBeforeBrush();
+        brush(ctx, displayable, innerScope, i === len - 1);
+        displayable.innerAfterBrush();
+        displayable.afterBrush && displayable.afterBrush();
+        innerScope.prevEl = displayable;
+    }
+    for (var i_1 = 0, len_1 = temporalDisplayables.length; i_1 < len_1; i_1++) {
+        var displayable = temporalDisplayables[i_1];
+        displayable.beforeBrush && displayable.beforeBrush();
+        displayable.innerBeforeBrush();
+        brush(ctx, displayable, innerScope, i_1 === len_1 - 1);
+        displayable.innerAfterBrush();
+        displayable.afterBrush && displayable.afterBrush();
+        innerScope.prevEl = displayable;
+    }
+    el.clearTemporalDisplayables();
+    el.notClear = true;
+    ctx.restore();
+}

+ 13 - 0
node_modules/echarts/node_modules/zrender/lib/canvas/helper.d.ts

@@ -0,0 +1,13 @@
+import { LinearGradientObject } from '../graphic/LinearGradient';
+import { RadialGradientObject } from '../graphic/RadialGradient';
+import { GradientObject } from '../graphic/Gradient';
+import { RectLike } from '../core/BoundingRect';
+import Path from '../graphic/Path';
+export declare function createLinearGradient(this: void, ctx: CanvasRenderingContext2D, obj: LinearGradientObject, rect: RectLike): CanvasGradient;
+export declare function createRadialGradient(this: void, ctx: CanvasRenderingContext2D, obj: RadialGradientObject, rect: RectLike): CanvasGradient;
+export declare function getCanvasGradient(this: void, ctx: CanvasRenderingContext2D, obj: GradientObject, rect: RectLike): CanvasGradient;
+export declare function isClipPathChanged(clipPaths: Path[], prevClipPaths: Path[]): boolean;
+export declare function getSize(root: HTMLElement, whIdx: number, opts: {
+    width?: number | string;
+    height?: number | string;
+}): number;

+ 79 - 0
node_modules/echarts/node_modules/zrender/lib/canvas/helper.js

@@ -0,0 +1,79 @@
+function isSafeNum(num) {
+    return isFinite(num);
+}
+export function createLinearGradient(ctx, obj, rect) {
+    var x = obj.x == null ? 0 : obj.x;
+    var x2 = obj.x2 == null ? 1 : obj.x2;
+    var y = obj.y == null ? 0 : obj.y;
+    var y2 = obj.y2 == null ? 0 : obj.y2;
+    if (!obj.global) {
+        x = x * rect.width + rect.x;
+        x2 = x2 * rect.width + rect.x;
+        y = y * rect.height + rect.y;
+        y2 = y2 * rect.height + rect.y;
+    }
+    x = isSafeNum(x) ? x : 0;
+    x2 = isSafeNum(x2) ? x2 : 1;
+    y = isSafeNum(y) ? y : 0;
+    y2 = isSafeNum(y2) ? y2 : 0;
+    var canvasGradient = ctx.createLinearGradient(x, y, x2, y2);
+    return canvasGradient;
+}
+export function createRadialGradient(ctx, obj, rect) {
+    var width = rect.width;
+    var height = rect.height;
+    var min = Math.min(width, height);
+    var x = obj.x == null ? 0.5 : obj.x;
+    var y = obj.y == null ? 0.5 : obj.y;
+    var r = obj.r == null ? 0.5 : obj.r;
+    if (!obj.global) {
+        x = x * width + rect.x;
+        y = y * height + rect.y;
+        r = r * min;
+    }
+    x = isSafeNum(x) ? x : 0.5;
+    y = isSafeNum(y) ? y : 0.5;
+    r = r >= 0 && isSafeNum(r) ? r : 0.5;
+    var canvasGradient = ctx.createRadialGradient(x, y, 0, x, y, r);
+    return canvasGradient;
+}
+export function getCanvasGradient(ctx, obj, rect) {
+    var canvasGradient = obj.type === 'radial'
+        ? createRadialGradient(ctx, obj, rect)
+        : createLinearGradient(ctx, obj, rect);
+    var colorStops = obj.colorStops;
+    for (var i = 0; i < colorStops.length; i++) {
+        canvasGradient.addColorStop(colorStops[i].offset, colorStops[i].color);
+    }
+    return canvasGradient;
+}
+export function isClipPathChanged(clipPaths, prevClipPaths) {
+    if (clipPaths === prevClipPaths || (!clipPaths && !prevClipPaths)) {
+        return false;
+    }
+    if (!clipPaths || !prevClipPaths || (clipPaths.length !== prevClipPaths.length)) {
+        return true;
+    }
+    for (var i = 0; i < clipPaths.length; i++) {
+        if (clipPaths[i] !== prevClipPaths[i]) {
+            return true;
+        }
+    }
+    return false;
+}
+function parseInt10(val) {
+    return parseInt(val, 10);
+}
+export function getSize(root, whIdx, opts) {
+    var wh = ['width', 'height'][whIdx];
+    var cwh = ['clientWidth', 'clientHeight'][whIdx];
+    var plt = ['paddingLeft', 'paddingTop'][whIdx];
+    var prb = ['paddingRight', 'paddingBottom'][whIdx];
+    if (opts[wh] != null && opts[wh] !== 'auto') {
+        return parseFloat(opts[wh]);
+    }
+    var stl = document.defaultView.getComputedStyle(root);
+    return ((root[cwh] || parseInt10(stl[wh]) || parseInt10(root.style[wh]))
+        - (parseInt10(stl[plt]) || 0)
+        - (parseInt10(stl[prb]) || 0)) | 0;
+}

+ 6 - 0
node_modules/echarts/node_modules/zrender/lib/config.d.ts

@@ -0,0 +1,6 @@
+export declare const debugMode = 0;
+export declare const devicePixelRatio: number;
+export declare const DARK_MODE_THRESHOLD = 0.4;
+export declare const DARK_LABEL_COLOR = "#333";
+export declare const LIGHT_LABEL_COLOR = "#ccc";
+export declare const LIGHTER_LABEL_COLOR = "#eee";

+ 13 - 0
node_modules/echarts/node_modules/zrender/lib/config.js

@@ -0,0 +1,13 @@
+import env from './core/env.js';
+var dpr = 1;
+if (env.hasGlobalWindow) {
+    dpr = Math.max(window.devicePixelRatio
+        || (window.screen && window.screen.deviceXDPI / window.screen.logicalXDPI)
+        || 1, 1);
+}
+export var debugMode = 0;
+export var devicePixelRatio = dpr;
+export var DARK_MODE_THRESHOLD = 0.4;
+export var DARK_LABEL_COLOR = '#333';
+export var LIGHT_LABEL_COLOR = '#ccc';
+export var LIGHTER_LABEL_COLOR = '#eee';

+ 1 - 0
node_modules/echarts/node_modules/zrender/lib/contain/arc.d.ts

@@ -0,0 +1 @@
+export declare function containStroke(cx: number, cy: number, r: number, startAngle: number, endAngle: number, anticlockwise: boolean, lineWidth: number, x: number, y: number): boolean;

+ 35 - 0
node_modules/echarts/node_modules/zrender/lib/contain/arc.js

@@ -0,0 +1,35 @@
+import { normalizeRadian } from './util.js';
+var PI2 = Math.PI * 2;
+export function containStroke(cx, cy, r, startAngle, endAngle, anticlockwise, lineWidth, x, y) {
+    if (lineWidth === 0) {
+        return false;
+    }
+    var _l = lineWidth;
+    x -= cx;
+    y -= cy;
+    var d = Math.sqrt(x * x + y * y);
+    if ((d - _l > r) || (d + _l < r)) {
+        return false;
+    }
+    if (Math.abs(startAngle - endAngle) % PI2 < 1e-4) {
+        return true;
+    }
+    if (anticlockwise) {
+        var tmp = startAngle;
+        startAngle = normalizeRadian(endAngle);
+        endAngle = normalizeRadian(tmp);
+    }
+    else {
+        startAngle = normalizeRadian(startAngle);
+        endAngle = normalizeRadian(endAngle);
+    }
+    if (startAngle > endAngle) {
+        endAngle += PI2;
+    }
+    var angle = Math.atan2(y, x);
+    if (angle < 0) {
+        angle += PI2;
+    }
+    return (angle >= startAngle && angle <= endAngle)
+        || (angle + PI2 >= startAngle && angle + PI2 <= endAngle);
+}

+ 1 - 0
node_modules/echarts/node_modules/zrender/lib/contain/cubic.d.ts

@@ -0,0 +1 @@
+export declare function containStroke(x0: number, y0: number, x1: number, y1: number, x2: number, y2: number, x3: number, y3: number, lineWidth: number, x: number, y: number): boolean;

+ 15 - 0
node_modules/echarts/node_modules/zrender/lib/contain/cubic.js

@@ -0,0 +1,15 @@
+import * as curve from '../core/curve.js';
+export function containStroke(x0, y0, x1, y1, x2, y2, x3, y3, lineWidth, x, y) {
+    if (lineWidth === 0) {
+        return false;
+    }
+    var _l = lineWidth;
+    if ((y > y0 + _l && y > y1 + _l && y > y2 + _l && y > y3 + _l)
+        || (y < y0 - _l && y < y1 - _l && y < y2 - _l && y < y3 - _l)
+        || (x > x0 + _l && x > x1 + _l && x > x2 + _l && x > x3 + _l)
+        || (x < x0 - _l && x < x1 - _l && x < x2 - _l && x < x3 - _l)) {
+        return false;
+    }
+    var d = curve.cubicProjectPoint(x0, y0, x1, y1, x2, y2, x3, y3, x, y, null);
+    return d <= _l / 2;
+}

+ 1 - 0
node_modules/echarts/node_modules/zrender/lib/contain/line.d.ts

@@ -0,0 +1 @@
+export declare function containStroke(x0: number, y0: number, x1: number, y1: number, lineWidth: number, x: number, y: number): boolean;

+ 24 - 0
node_modules/echarts/node_modules/zrender/lib/contain/line.js

@@ -0,0 +1,24 @@
+export function containStroke(x0, y0, x1, y1, lineWidth, x, y) {
+    if (lineWidth === 0) {
+        return false;
+    }
+    var _l = lineWidth;
+    var _a = 0;
+    var _b = x0;
+    if ((y > y0 + _l && y > y1 + _l)
+        || (y < y0 - _l && y < y1 - _l)
+        || (x > x0 + _l && x > x1 + _l)
+        || (x < x0 - _l && x < x1 - _l)) {
+        return false;
+    }
+    if (x0 !== x1) {
+        _a = (y0 - y1) / (x0 - x1);
+        _b = (x0 * y1 - x1 * y0) / (x0 - x1);
+    }
+    else {
+        return Math.abs(x - x0) <= _l / 2;
+    }
+    var tmp = _a * x - y + _b;
+    var _s = tmp * tmp / (_a * _a + 1);
+    return _s <= _l / 2 * _l / 2;
+}

+ 3 - 0
node_modules/echarts/node_modules/zrender/lib/contain/path.d.ts

@@ -0,0 +1,3 @@
+import PathProxy from '../core/PathProxy';
+export declare function contain(pathProxy: PathProxy, x: number, y: number): boolean;
+export declare function containStroke(pathProxy: PathProxy, lineWidth: number, x: number, y: number): boolean;

+ 307 - 0
node_modules/echarts/node_modules/zrender/lib/contain/path.js

@@ -0,0 +1,307 @@
+import PathProxy from '../core/PathProxy.js';
+import * as line from './line.js';
+import * as cubic from './cubic.js';
+import * as quadratic from './quadratic.js';
+import * as arc from './arc.js';
+import * as curve from '../core/curve.js';
+import windingLine from './windingLine.js';
+var CMD = PathProxy.CMD;
+var PI2 = Math.PI * 2;
+var EPSILON = 1e-4;
+function isAroundEqual(a, b) {
+    return Math.abs(a - b) < EPSILON;
+}
+var roots = [-1, -1, -1];
+var extrema = [-1, -1];
+function swapExtrema() {
+    var tmp = extrema[0];
+    extrema[0] = extrema[1];
+    extrema[1] = tmp;
+}
+function windingCubic(x0, y0, x1, y1, x2, y2, x3, y3, x, y) {
+    if ((y > y0 && y > y1 && y > y2 && y > y3)
+        || (y < y0 && y < y1 && y < y2 && y < y3)) {
+        return 0;
+    }
+    var nRoots = curve.cubicRootAt(y0, y1, y2, y3, y, roots);
+    if (nRoots === 0) {
+        return 0;
+    }
+    else {
+        var w = 0;
+        var nExtrema = -1;
+        var y0_ = void 0;
+        var y1_ = void 0;
+        for (var i = 0; i < nRoots; i++) {
+            var t = roots[i];
+            var unit = (t === 0 || t === 1) ? 0.5 : 1;
+            var x_ = curve.cubicAt(x0, x1, x2, x3, t);
+            if (x_ < x) {
+                continue;
+            }
+            if (nExtrema < 0) {
+                nExtrema = curve.cubicExtrema(y0, y1, y2, y3, extrema);
+                if (extrema[1] < extrema[0] && nExtrema > 1) {
+                    swapExtrema();
+                }
+                y0_ = curve.cubicAt(y0, y1, y2, y3, extrema[0]);
+                if (nExtrema > 1) {
+                    y1_ = curve.cubicAt(y0, y1, y2, y3, extrema[1]);
+                }
+            }
+            if (nExtrema === 2) {
+                if (t < extrema[0]) {
+                    w += y0_ < y0 ? unit : -unit;
+                }
+                else if (t < extrema[1]) {
+                    w += y1_ < y0_ ? unit : -unit;
+                }
+                else {
+                    w += y3 < y1_ ? unit : -unit;
+                }
+            }
+            else {
+                if (t < extrema[0]) {
+                    w += y0_ < y0 ? unit : -unit;
+                }
+                else {
+                    w += y3 < y0_ ? unit : -unit;
+                }
+            }
+        }
+        return w;
+    }
+}
+function windingQuadratic(x0, y0, x1, y1, x2, y2, x, y) {
+    if ((y > y0 && y > y1 && y > y2)
+        || (y < y0 && y < y1 && y < y2)) {
+        return 0;
+    }
+    var nRoots = curve.quadraticRootAt(y0, y1, y2, y, roots);
+    if (nRoots === 0) {
+        return 0;
+    }
+    else {
+        var t = curve.quadraticExtremum(y0, y1, y2);
+        if (t >= 0 && t <= 1) {
+            var w = 0;
+            var y_ = curve.quadraticAt(y0, y1, y2, t);
+            for (var i = 0; i < nRoots; i++) {
+                var unit = (roots[i] === 0 || roots[i] === 1) ? 0.5 : 1;
+                var x_ = curve.quadraticAt(x0, x1, x2, roots[i]);
+                if (x_ < x) {
+                    continue;
+                }
+                if (roots[i] < t) {
+                    w += y_ < y0 ? unit : -unit;
+                }
+                else {
+                    w += y2 < y_ ? unit : -unit;
+                }
+            }
+            return w;
+        }
+        else {
+            var unit = (roots[0] === 0 || roots[0] === 1) ? 0.5 : 1;
+            var x_ = curve.quadraticAt(x0, x1, x2, roots[0]);
+            if (x_ < x) {
+                return 0;
+            }
+            return y2 < y0 ? unit : -unit;
+        }
+    }
+}
+function windingArc(cx, cy, r, startAngle, endAngle, anticlockwise, x, y) {
+    y -= cy;
+    if (y > r || y < -r) {
+        return 0;
+    }
+    var tmp = Math.sqrt(r * r - y * y);
+    roots[0] = -tmp;
+    roots[1] = tmp;
+    var dTheta = Math.abs(startAngle - endAngle);
+    if (dTheta < 1e-4) {
+        return 0;
+    }
+    if (dTheta >= PI2 - 1e-4) {
+        startAngle = 0;
+        endAngle = PI2;
+        var dir = anticlockwise ? 1 : -1;
+        if (x >= roots[0] + cx && x <= roots[1] + cx) {
+            return dir;
+        }
+        else {
+            return 0;
+        }
+    }
+    if (startAngle > endAngle) {
+        var tmp_1 = startAngle;
+        startAngle = endAngle;
+        endAngle = tmp_1;
+    }
+    if (startAngle < 0) {
+        startAngle += PI2;
+        endAngle += PI2;
+    }
+    var w = 0;
+    for (var i = 0; i < 2; i++) {
+        var x_ = roots[i];
+        if (x_ + cx > x) {
+            var angle = Math.atan2(y, x_);
+            var dir = anticlockwise ? 1 : -1;
+            if (angle < 0) {
+                angle = PI2 + angle;
+            }
+            if ((angle >= startAngle && angle <= endAngle)
+                || (angle + PI2 >= startAngle && angle + PI2 <= endAngle)) {
+                if (angle > Math.PI / 2 && angle < Math.PI * 1.5) {
+                    dir = -dir;
+                }
+                w += dir;
+            }
+        }
+    }
+    return w;
+}
+function containPath(path, lineWidth, isStroke, x, y) {
+    var data = path.data;
+    var len = path.len();
+    var w = 0;
+    var xi = 0;
+    var yi = 0;
+    var x0 = 0;
+    var y0 = 0;
+    var x1;
+    var y1;
+    for (var i = 0; i < len;) {
+        var cmd = data[i++];
+        var isFirst = i === 1;
+        if (cmd === CMD.M && i > 1) {
+            if (!isStroke) {
+                w += windingLine(xi, yi, x0, y0, x, y);
+            }
+        }
+        if (isFirst) {
+            xi = data[i];
+            yi = data[i + 1];
+            x0 = xi;
+            y0 = yi;
+        }
+        switch (cmd) {
+            case CMD.M:
+                x0 = data[i++];
+                y0 = data[i++];
+                xi = x0;
+                yi = y0;
+                break;
+            case CMD.L:
+                if (isStroke) {
+                    if (line.containStroke(xi, yi, data[i], data[i + 1], lineWidth, x, y)) {
+                        return true;
+                    }
+                }
+                else {
+                    w += windingLine(xi, yi, data[i], data[i + 1], x, y) || 0;
+                }
+                xi = data[i++];
+                yi = data[i++];
+                break;
+            case CMD.C:
+                if (isStroke) {
+                    if (cubic.containStroke(xi, yi, data[i++], data[i++], data[i++], data[i++], data[i], data[i + 1], lineWidth, x, y)) {
+                        return true;
+                    }
+                }
+                else {
+                    w += windingCubic(xi, yi, data[i++], data[i++], data[i++], data[i++], data[i], data[i + 1], x, y) || 0;
+                }
+                xi = data[i++];
+                yi = data[i++];
+                break;
+            case CMD.Q:
+                if (isStroke) {
+                    if (quadratic.containStroke(xi, yi, data[i++], data[i++], data[i], data[i + 1], lineWidth, x, y)) {
+                        return true;
+                    }
+                }
+                else {
+                    w += windingQuadratic(xi, yi, data[i++], data[i++], data[i], data[i + 1], x, y) || 0;
+                }
+                xi = data[i++];
+                yi = data[i++];
+                break;
+            case CMD.A:
+                var cx = data[i++];
+                var cy = data[i++];
+                var rx = data[i++];
+                var ry = data[i++];
+                var theta = data[i++];
+                var dTheta = data[i++];
+                i += 1;
+                var anticlockwise = !!(1 - data[i++]);
+                x1 = Math.cos(theta) * rx + cx;
+                y1 = Math.sin(theta) * ry + cy;
+                if (!isFirst) {
+                    w += windingLine(xi, yi, x1, y1, x, y);
+                }
+                else {
+                    x0 = x1;
+                    y0 = y1;
+                }
+                var _x = (x - cx) * ry / rx + cx;
+                if (isStroke) {
+                    if (arc.containStroke(cx, cy, ry, theta, theta + dTheta, anticlockwise, lineWidth, _x, y)) {
+                        return true;
+                    }
+                }
+                else {
+                    w += windingArc(cx, cy, ry, theta, theta + dTheta, anticlockwise, _x, y);
+                }
+                xi = Math.cos(theta + dTheta) * rx + cx;
+                yi = Math.sin(theta + dTheta) * ry + cy;
+                break;
+            case CMD.R:
+                x0 = xi = data[i++];
+                y0 = yi = data[i++];
+                var width = data[i++];
+                var height = data[i++];
+                x1 = x0 + width;
+                y1 = y0 + height;
+                if (isStroke) {
+                    if (line.containStroke(x0, y0, x1, y0, lineWidth, x, y)
+                        || line.containStroke(x1, y0, x1, y1, lineWidth, x, y)
+                        || line.containStroke(x1, y1, x0, y1, lineWidth, x, y)
+                        || line.containStroke(x0, y1, x0, y0, lineWidth, x, y)) {
+                        return true;
+                    }
+                }
+                else {
+                    w += windingLine(x1, y0, x1, y1, x, y);
+                    w += windingLine(x0, y1, x0, y0, x, y);
+                }
+                break;
+            case CMD.Z:
+                if (isStroke) {
+                    if (line.containStroke(xi, yi, x0, y0, lineWidth, x, y)) {
+                        return true;
+                    }
+                }
+                else {
+                    w += windingLine(xi, yi, x0, y0, x, y);
+                }
+                xi = x0;
+                yi = y0;
+                break;
+        }
+    }
+    if (!isStroke && !isAroundEqual(yi, y0)) {
+        w += windingLine(xi, yi, x0, y0, x, y) || 0;
+    }
+    return w !== 0;
+}
+export function contain(pathProxy, x, y) {
+    return containPath(pathProxy, 0, false, x, y);
+}
+export function containStroke(pathProxy, lineWidth, x, y) {
+    return containPath(pathProxy, lineWidth, true, x, y);
+}

+ 2 - 0
node_modules/echarts/node_modules/zrender/lib/contain/polygon.d.ts

@@ -0,0 +1,2 @@
+import { VectorArray } from '../core/vector';
+export declare function contain(points: VectorArray[], x: number, y: number): boolean;

+ 22 - 0
node_modules/echarts/node_modules/zrender/lib/contain/polygon.js

@@ -0,0 +1,22 @@
+import windingLine from './windingLine.js';
+var EPSILON = 1e-8;
+function isAroundEqual(a, b) {
+    return Math.abs(a - b) < EPSILON;
+}
+export function contain(points, x, y) {
+    var w = 0;
+    var p = points[0];
+    if (!p) {
+        return false;
+    }
+    for (var i = 1; i < points.length; i++) {
+        var p2 = points[i];
+        w += windingLine(p[0], p[1], p2[0], p2[1], x, y);
+        p = p2;
+    }
+    var p0 = points[0];
+    if (!isAroundEqual(p[0], p0[0]) || !isAroundEqual(p[1], p0[1])) {
+        w += windingLine(p[0], p[1], p0[0], p0[1], x, y);
+    }
+    return w !== 0;
+}

+ 1 - 0
node_modules/echarts/node_modules/zrender/lib/contain/quadratic.d.ts

@@ -0,0 +1 @@
+export declare function containStroke(x0: number, y0: number, x1: number, y1: number, x2: number, y2: number, lineWidth: number, x: number, y: number): boolean;

+ 15 - 0
node_modules/echarts/node_modules/zrender/lib/contain/quadratic.js

@@ -0,0 +1,15 @@
+import { quadraticProjectPoint } from '../core/curve.js';
+export function containStroke(x0, y0, x1, y1, x2, y2, lineWidth, x, y) {
+    if (lineWidth === 0) {
+        return false;
+    }
+    var _l = lineWidth;
+    if ((y > y0 + _l && y > y1 + _l && y > y2 + _l)
+        || (y < y0 - _l && y < y1 - _l && y < y2 - _l)
+        || (x > x0 + _l && x > x1 + _l && x > x2 + _l)
+        || (x < x0 - _l && x < x1 - _l && x < x2 - _l)) {
+        return false;
+    }
+    var d = quadraticProjectPoint(x0, y0, x1, y1, x2, y2, x, y, null);
+    return d <= _l / 2;
+}

+ 23 - 0
node_modules/echarts/node_modules/zrender/lib/contain/text.d.ts

@@ -0,0 +1,23 @@
+import BoundingRect, { RectLike } from '../core/BoundingRect';
+import { TextAlign, TextVerticalAlign, BuiltinTextPosition } from '../core/types';
+export declare function getWidth(text: string, font: string): number;
+export declare function innerGetBoundingRect(text: string, font: string, textAlign?: TextAlign, textBaseline?: TextVerticalAlign): BoundingRect;
+export declare function getBoundingRect(text: string, font: string, textAlign?: TextAlign, textBaseline?: TextVerticalAlign): BoundingRect;
+export declare function adjustTextX(x: number, width: number, textAlign: TextAlign): number;
+export declare function adjustTextY(y: number, height: number, verticalAlign: TextVerticalAlign): number;
+export declare function getLineHeight(font?: string): number;
+export declare function measureText(text: string, font?: string): {
+    width: number;
+};
+export declare function parsePercent(value: number | string, maxValue: number): number;
+export interface TextPositionCalculationResult {
+    x: number;
+    y: number;
+    align: TextAlign;
+    verticalAlign: TextVerticalAlign;
+}
+export declare function calculateTextPosition(out: TextPositionCalculationResult, opts: {
+    position?: BuiltinTextPosition | (number | string)[];
+    distance?: number;
+    global?: boolean;
+}, rect: RectLike): TextPositionCalculationResult;

+ 170 - 0
node_modules/echarts/node_modules/zrender/lib/contain/text.js

@@ -0,0 +1,170 @@
+import BoundingRect from '../core/BoundingRect.js';
+import LRU from '../core/LRU.js';
+import { DEFAULT_FONT, platformApi } from '../core/platform.js';
+var textWidthCache = {};
+export function getWidth(text, font) {
+    font = font || DEFAULT_FONT;
+    var cacheOfFont = textWidthCache[font];
+    if (!cacheOfFont) {
+        cacheOfFont = textWidthCache[font] = new LRU(500);
+    }
+    var width = cacheOfFont.get(text);
+    if (width == null) {
+        width = platformApi.measureText(text, font).width;
+        cacheOfFont.put(text, width);
+    }
+    return width;
+}
+export function innerGetBoundingRect(text, font, textAlign, textBaseline) {
+    var width = getWidth(text, font);
+    var height = getLineHeight(font);
+    var x = adjustTextX(0, width, textAlign);
+    var y = adjustTextY(0, height, textBaseline);
+    var rect = new BoundingRect(x, y, width, height);
+    return rect;
+}
+export function getBoundingRect(text, font, textAlign, textBaseline) {
+    var textLines = ((text || '') + '').split('\n');
+    var len = textLines.length;
+    if (len === 1) {
+        return innerGetBoundingRect(textLines[0], font, textAlign, textBaseline);
+    }
+    else {
+        var uniondRect = new BoundingRect(0, 0, 0, 0);
+        for (var i = 0; i < textLines.length; i++) {
+            var rect = innerGetBoundingRect(textLines[i], font, textAlign, textBaseline);
+            i === 0 ? uniondRect.copy(rect) : uniondRect.union(rect);
+        }
+        return uniondRect;
+    }
+}
+export function adjustTextX(x, width, textAlign) {
+    if (textAlign === 'right') {
+        x -= width;
+    }
+    else if (textAlign === 'center') {
+        x -= width / 2;
+    }
+    return x;
+}
+export function adjustTextY(y, height, verticalAlign) {
+    if (verticalAlign === 'middle') {
+        y -= height / 2;
+    }
+    else if (verticalAlign === 'bottom') {
+        y -= height;
+    }
+    return y;
+}
+export function getLineHeight(font) {
+    return getWidth('国', font);
+}
+export function measureText(text, font) {
+    return platformApi.measureText(text, font);
+}
+export function parsePercent(value, maxValue) {
+    if (typeof value === 'string') {
+        if (value.lastIndexOf('%') >= 0) {
+            return parseFloat(value) / 100 * maxValue;
+        }
+        return parseFloat(value);
+    }
+    return value;
+}
+export function calculateTextPosition(out, opts, rect) {
+    var textPosition = opts.position || 'inside';
+    var distance = opts.distance != null ? opts.distance : 5;
+    var height = rect.height;
+    var width = rect.width;
+    var halfHeight = height / 2;
+    var x = rect.x;
+    var y = rect.y;
+    var textAlign = 'left';
+    var textVerticalAlign = 'top';
+    if (textPosition instanceof Array) {
+        x += parsePercent(textPosition[0], rect.width);
+        y += parsePercent(textPosition[1], rect.height);
+        textAlign = null;
+        textVerticalAlign = null;
+    }
+    else {
+        switch (textPosition) {
+            case 'left':
+                x -= distance;
+                y += halfHeight;
+                textAlign = 'right';
+                textVerticalAlign = 'middle';
+                break;
+            case 'right':
+                x += distance + width;
+                y += halfHeight;
+                textVerticalAlign = 'middle';
+                break;
+            case 'top':
+                x += width / 2;
+                y -= distance;
+                textAlign = 'center';
+                textVerticalAlign = 'bottom';
+                break;
+            case 'bottom':
+                x += width / 2;
+                y += height + distance;
+                textAlign = 'center';
+                break;
+            case 'inside':
+                x += width / 2;
+                y += halfHeight;
+                textAlign = 'center';
+                textVerticalAlign = 'middle';
+                break;
+            case 'insideLeft':
+                x += distance;
+                y += halfHeight;
+                textVerticalAlign = 'middle';
+                break;
+            case 'insideRight':
+                x += width - distance;
+                y += halfHeight;
+                textAlign = 'right';
+                textVerticalAlign = 'middle';
+                break;
+            case 'insideTop':
+                x += width / 2;
+                y += distance;
+                textAlign = 'center';
+                break;
+            case 'insideBottom':
+                x += width / 2;
+                y += height - distance;
+                textAlign = 'center';
+                textVerticalAlign = 'bottom';
+                break;
+            case 'insideTopLeft':
+                x += distance;
+                y += distance;
+                break;
+            case 'insideTopRight':
+                x += width - distance;
+                y += distance;
+                textAlign = 'right';
+                break;
+            case 'insideBottomLeft':
+                x += distance;
+                y += height - distance;
+                textVerticalAlign = 'bottom';
+                break;
+            case 'insideBottomRight':
+                x += width - distance;
+                y += height - distance;
+                textAlign = 'right';
+                textVerticalAlign = 'bottom';
+                break;
+        }
+    }
+    out = out || {};
+    out.x = x;
+    out.y = y;
+    out.align = textAlign;
+    out.verticalAlign = textVerticalAlign;
+    return out;
+}

+ 1 - 0
node_modules/echarts/node_modules/zrender/lib/contain/util.d.ts

@@ -0,0 +1 @@
+export declare function normalizeRadian(angle: number): number;

+ 8 - 0
node_modules/echarts/node_modules/zrender/lib/contain/util.js

@@ -0,0 +1,8 @@
+var PI2 = Math.PI * 2;
+export function normalizeRadian(angle) {
+    angle %= PI2;
+    if (angle < 0) {
+        angle += PI2;
+    }
+    return angle;
+}

+ 1 - 0
node_modules/echarts/node_modules/zrender/lib/contain/windingLine.d.ts

@@ -0,0 +1 @@
+export default function windingLine(x0: number, y0: number, x1: number, y1: number, x: number, y: number): number;

+ 15 - 0
node_modules/echarts/node_modules/zrender/lib/contain/windingLine.js

@@ -0,0 +1,15 @@
+export default function windingLine(x0, y0, x1, y1, x, y) {
+    if ((y > y0 && y > y1) || (y < y0 && y < y1)) {
+        return 0;
+    }
+    if (y1 === y0) {
+        return 0;
+    }
+    var t = (y - y0) / (y1 - y0);
+    var dir = y1 < y0 ? 1 : -1;
+    if (t === 1 || t === 0) {
+        dir = y1 < y0 ? 0.5 : -0.5;
+    }
+    var x_ = t * (x1 - x0) + x0;
+    return x_ === x ? Infinity : x_ > x ? dir : 0;
+}

+ 29 - 0
node_modules/echarts/node_modules/zrender/lib/core/BoundingRect.d.ts

@@ -0,0 +1,29 @@
+import * as matrix from './matrix';
+import { PointLike } from './Point';
+declare class BoundingRect {
+    x: number;
+    y: number;
+    width: number;
+    height: number;
+    constructor(x: number, y: number, width: number, height: number);
+    union(other: BoundingRect): void;
+    applyTransform(m: matrix.MatrixArray): void;
+    calculateTransform(b: RectLike): matrix.MatrixArray;
+    intersect(b: RectLike, mtv?: PointLike): boolean;
+    contain(x: number, y: number): boolean;
+    clone(): BoundingRect;
+    copy(other: RectLike): void;
+    plain(): RectLike;
+    isFinite(): boolean;
+    isZero(): boolean;
+    static create(rect: RectLike): BoundingRect;
+    static copy(target: RectLike, source: RectLike): void;
+    static applyTransform(target: RectLike, source: RectLike, m: matrix.MatrixArray): void;
+}
+export declare type RectLike = {
+    x: number;
+    y: number;
+    width: number;
+    height: number;
+};
+export default BoundingRect;

+ 215 - 0
node_modules/echarts/node_modules/zrender/lib/core/BoundingRect.js

@@ -0,0 +1,215 @@
+import * as matrix from './matrix.js';
+import Point from './Point.js';
+var mathMin = Math.min;
+var mathMax = Math.max;
+var lt = new Point();
+var rb = new Point();
+var lb = new Point();
+var rt = new Point();
+var minTv = new Point();
+var maxTv = new Point();
+var BoundingRect = (function () {
+    function BoundingRect(x, y, width, height) {
+        if (width < 0) {
+            x = x + width;
+            width = -width;
+        }
+        if (height < 0) {
+            y = y + height;
+            height = -height;
+        }
+        this.x = x;
+        this.y = y;
+        this.width = width;
+        this.height = height;
+    }
+    BoundingRect.prototype.union = function (other) {
+        var x = mathMin(other.x, this.x);
+        var y = mathMin(other.y, this.y);
+        if (isFinite(this.x) && isFinite(this.width)) {
+            this.width = mathMax(other.x + other.width, this.x + this.width) - x;
+        }
+        else {
+            this.width = other.width;
+        }
+        if (isFinite(this.y) && isFinite(this.height)) {
+            this.height = mathMax(other.y + other.height, this.y + this.height) - y;
+        }
+        else {
+            this.height = other.height;
+        }
+        this.x = x;
+        this.y = y;
+    };
+    BoundingRect.prototype.applyTransform = function (m) {
+        BoundingRect.applyTransform(this, this, m);
+    };
+    BoundingRect.prototype.calculateTransform = function (b) {
+        var a = this;
+        var sx = b.width / a.width;
+        var sy = b.height / a.height;
+        var m = matrix.create();
+        matrix.translate(m, m, [-a.x, -a.y]);
+        matrix.scale(m, m, [sx, sy]);
+        matrix.translate(m, m, [b.x, b.y]);
+        return m;
+    };
+    BoundingRect.prototype.intersect = function (b, mtv) {
+        if (!b) {
+            return false;
+        }
+        if (!(b instanceof BoundingRect)) {
+            b = BoundingRect.create(b);
+        }
+        var a = this;
+        var ax0 = a.x;
+        var ax1 = a.x + a.width;
+        var ay0 = a.y;
+        var ay1 = a.y + a.height;
+        var bx0 = b.x;
+        var bx1 = b.x + b.width;
+        var by0 = b.y;
+        var by1 = b.y + b.height;
+        var overlap = !(ax1 < bx0 || bx1 < ax0 || ay1 < by0 || by1 < ay0);
+        if (mtv) {
+            var dMin = Infinity;
+            var dMax = 0;
+            var d0 = Math.abs(ax1 - bx0);
+            var d1 = Math.abs(bx1 - ax0);
+            var d2 = Math.abs(ay1 - by0);
+            var d3 = Math.abs(by1 - ay0);
+            var dx = Math.min(d0, d1);
+            var dy = Math.min(d2, d3);
+            if (ax1 < bx0 || bx1 < ax0) {
+                if (dx > dMax) {
+                    dMax = dx;
+                    if (d0 < d1) {
+                        Point.set(maxTv, -d0, 0);
+                    }
+                    else {
+                        Point.set(maxTv, d1, 0);
+                    }
+                }
+            }
+            else {
+                if (dx < dMin) {
+                    dMin = dx;
+                    if (d0 < d1) {
+                        Point.set(minTv, d0, 0);
+                    }
+                    else {
+                        Point.set(minTv, -d1, 0);
+                    }
+                }
+            }
+            if (ay1 < by0 || by1 < ay0) {
+                if (dy > dMax) {
+                    dMax = dy;
+                    if (d2 < d3) {
+                        Point.set(maxTv, 0, -d2);
+                    }
+                    else {
+                        Point.set(maxTv, 0, d3);
+                    }
+                }
+            }
+            else {
+                if (dx < dMin) {
+                    dMin = dx;
+                    if (d2 < d3) {
+                        Point.set(minTv, 0, d2);
+                    }
+                    else {
+                        Point.set(minTv, 0, -d3);
+                    }
+                }
+            }
+        }
+        if (mtv) {
+            Point.copy(mtv, overlap ? minTv : maxTv);
+        }
+        return overlap;
+    };
+    BoundingRect.prototype.contain = function (x, y) {
+        var rect = this;
+        return x >= rect.x
+            && x <= (rect.x + rect.width)
+            && y >= rect.y
+            && y <= (rect.y + rect.height);
+    };
+    BoundingRect.prototype.clone = function () {
+        return new BoundingRect(this.x, this.y, this.width, this.height);
+    };
+    BoundingRect.prototype.copy = function (other) {
+        BoundingRect.copy(this, other);
+    };
+    BoundingRect.prototype.plain = function () {
+        return {
+            x: this.x,
+            y: this.y,
+            width: this.width,
+            height: this.height
+        };
+    };
+    BoundingRect.prototype.isFinite = function () {
+        return isFinite(this.x)
+            && isFinite(this.y)
+            && isFinite(this.width)
+            && isFinite(this.height);
+    };
+    BoundingRect.prototype.isZero = function () {
+        return this.width === 0 || this.height === 0;
+    };
+    BoundingRect.create = function (rect) {
+        return new BoundingRect(rect.x, rect.y, rect.width, rect.height);
+    };
+    BoundingRect.copy = function (target, source) {
+        target.x = source.x;
+        target.y = source.y;
+        target.width = source.width;
+        target.height = source.height;
+    };
+    BoundingRect.applyTransform = function (target, source, m) {
+        if (!m) {
+            if (target !== source) {
+                BoundingRect.copy(target, source);
+            }
+            return;
+        }
+        if (m[1] < 1e-5 && m[1] > -1e-5 && m[2] < 1e-5 && m[2] > -1e-5) {
+            var sx = m[0];
+            var sy = m[3];
+            var tx = m[4];
+            var ty = m[5];
+            target.x = source.x * sx + tx;
+            target.y = source.y * sy + ty;
+            target.width = source.width * sx;
+            target.height = source.height * sy;
+            if (target.width < 0) {
+                target.x += target.width;
+                target.width = -target.width;
+            }
+            if (target.height < 0) {
+                target.y += target.height;
+                target.height = -target.height;
+            }
+            return;
+        }
+        lt.x = lb.x = source.x;
+        lt.y = rt.y = source.y;
+        rb.x = rt.x = source.x + source.width;
+        rb.y = lb.y = source.y + source.height;
+        lt.transform(m);
+        rt.transform(m);
+        rb.transform(m);
+        lb.transform(m);
+        target.x = mathMin(lt.x, rb.x, lb.x, rt.x);
+        target.y = mathMin(lt.y, rb.y, lb.y, rt.y);
+        var maxX = mathMax(lt.x, rb.x, lb.x, rt.x);
+        var maxY = mathMax(lt.y, rb.y, lb.y, rt.y);
+        target.width = maxX - target.x;
+        target.height = maxY - target.y;
+    };
+    return BoundingRect;
+}());
+export default BoundingRect;

+ 23 - 0
node_modules/echarts/node_modules/zrender/lib/core/Eventful.d.ts

@@ -0,0 +1,23 @@
+import { Dictionary, WithThisType } from './types';
+export declare type EventCallbackSingleParam<EvtParam = any> = EvtParam extends any ? (params: EvtParam) => boolean | void : never;
+export declare type EventCallback<EvtParams = any[]> = EvtParams extends any[] ? (...args: EvtParams) => boolean | void : never;
+export declare type EventQuery = string | Object;
+declare type CbThis<Ctx, Impl> = unknown extends Ctx ? Impl : Ctx;
+declare type DefaultEventDefinition = Dictionary<EventCallback<any[]>>;
+export interface EventProcessor<EvtDef = DefaultEventDefinition> {
+    normalizeQuery?: (query: EventQuery) => EventQuery;
+    filter?: (eventType: keyof EvtDef, query: EventQuery) => boolean;
+    afterTrigger?: (eventType: keyof EvtDef) => void;
+}
+export default class Eventful<EvtDef extends DefaultEventDefinition = DefaultEventDefinition> {
+    private _$handlers;
+    protected _$eventProcessor: EventProcessor<EvtDef>;
+    constructor(eventProcessors?: EventProcessor<EvtDef>);
+    on<Ctx, EvtNm extends keyof EvtDef>(event: EvtNm, handler: WithThisType<EvtDef[EvtNm], CbThis<Ctx, this>>, context?: Ctx): this;
+    on<Ctx, EvtNm extends keyof EvtDef>(event: EvtNm, query: EventQuery, handler: WithThisType<EvtDef[EvtNm], CbThis<Ctx, this>>, context?: Ctx): this;
+    isSilent(eventName: keyof EvtDef): boolean;
+    off(eventType?: keyof EvtDef, handler?: Function): this;
+    trigger<EvtNm extends keyof EvtDef>(eventType: EvtNm, ...args: Parameters<EvtDef[EvtNm]>): this;
+    triggerWithContext(type: keyof EvtDef, ...args: any[]): this;
+}
+export {};

+ 162 - 0
node_modules/echarts/node_modules/zrender/lib/core/Eventful.js

@@ -0,0 +1,162 @@
+var Eventful = (function () {
+    function Eventful(eventProcessors) {
+        if (eventProcessors) {
+            this._$eventProcessor = eventProcessors;
+        }
+    }
+    Eventful.prototype.on = function (event, query, handler, context) {
+        if (!this._$handlers) {
+            this._$handlers = {};
+        }
+        var _h = this._$handlers;
+        if (typeof query === 'function') {
+            context = handler;
+            handler = query;
+            query = null;
+        }
+        if (!handler || !event) {
+            return this;
+        }
+        var eventProcessor = this._$eventProcessor;
+        if (query != null && eventProcessor && eventProcessor.normalizeQuery) {
+            query = eventProcessor.normalizeQuery(query);
+        }
+        if (!_h[event]) {
+            _h[event] = [];
+        }
+        for (var i = 0; i < _h[event].length; i++) {
+            if (_h[event][i].h === handler) {
+                return this;
+            }
+        }
+        var wrap = {
+            h: handler,
+            query: query,
+            ctx: (context || this),
+            callAtLast: handler.zrEventfulCallAtLast
+        };
+        var lastIndex = _h[event].length - 1;
+        var lastWrap = _h[event][lastIndex];
+        (lastWrap && lastWrap.callAtLast)
+            ? _h[event].splice(lastIndex, 0, wrap)
+            : _h[event].push(wrap);
+        return this;
+    };
+    Eventful.prototype.isSilent = function (eventName) {
+        var _h = this._$handlers;
+        return !_h || !_h[eventName] || !_h[eventName].length;
+    };
+    Eventful.prototype.off = function (eventType, handler) {
+        var _h = this._$handlers;
+        if (!_h) {
+            return this;
+        }
+        if (!eventType) {
+            this._$handlers = {};
+            return this;
+        }
+        if (handler) {
+            if (_h[eventType]) {
+                var newList = [];
+                for (var i = 0, l = _h[eventType].length; i < l; i++) {
+                    if (_h[eventType][i].h !== handler) {
+                        newList.push(_h[eventType][i]);
+                    }
+                }
+                _h[eventType] = newList;
+            }
+            if (_h[eventType] && _h[eventType].length === 0) {
+                delete _h[eventType];
+            }
+        }
+        else {
+            delete _h[eventType];
+        }
+        return this;
+    };
+    Eventful.prototype.trigger = function (eventType) {
+        var args = [];
+        for (var _i = 1; _i < arguments.length; _i++) {
+            args[_i - 1] = arguments[_i];
+        }
+        if (!this._$handlers) {
+            return this;
+        }
+        var _h = this._$handlers[eventType];
+        var eventProcessor = this._$eventProcessor;
+        if (_h) {
+            var argLen = args.length;
+            var len = _h.length;
+            for (var i = 0; i < len; i++) {
+                var hItem = _h[i];
+                if (eventProcessor
+                    && eventProcessor.filter
+                    && hItem.query != null
+                    && !eventProcessor.filter(eventType, hItem.query)) {
+                    continue;
+                }
+                switch (argLen) {
+                    case 0:
+                        hItem.h.call(hItem.ctx);
+                        break;
+                    case 1:
+                        hItem.h.call(hItem.ctx, args[0]);
+                        break;
+                    case 2:
+                        hItem.h.call(hItem.ctx, args[0], args[1]);
+                        break;
+                    default:
+                        hItem.h.apply(hItem.ctx, args);
+                        break;
+                }
+            }
+        }
+        eventProcessor && eventProcessor.afterTrigger
+            && eventProcessor.afterTrigger(eventType);
+        return this;
+    };
+    Eventful.prototype.triggerWithContext = function (type) {
+        var args = [];
+        for (var _i = 1; _i < arguments.length; _i++) {
+            args[_i - 1] = arguments[_i];
+        }
+        if (!this._$handlers) {
+            return this;
+        }
+        var _h = this._$handlers[type];
+        var eventProcessor = this._$eventProcessor;
+        if (_h) {
+            var argLen = args.length;
+            var ctx = args[argLen - 1];
+            var len = _h.length;
+            for (var i = 0; i < len; i++) {
+                var hItem = _h[i];
+                if (eventProcessor
+                    && eventProcessor.filter
+                    && hItem.query != null
+                    && !eventProcessor.filter(type, hItem.query)) {
+                    continue;
+                }
+                switch (argLen) {
+                    case 0:
+                        hItem.h.call(ctx);
+                        break;
+                    case 1:
+                        hItem.h.call(ctx, args[0]);
+                        break;
+                    case 2:
+                        hItem.h.call(ctx, args[0], args[1]);
+                        break;
+                    default:
+                        hItem.h.apply(ctx, args.slice(1, argLen - 1));
+                        break;
+                }
+            }
+        }
+        eventProcessor && eventProcessor.afterTrigger
+            && eventProcessor.afterTrigger(type);
+        return this;
+    };
+    return Eventful;
+}());
+export default Eventful;

+ 18 - 0
node_modules/echarts/node_modules/zrender/lib/core/GestureMgr.d.ts

@@ -0,0 +1,18 @@
+import { ZRRawTouchEvent } from './types';
+import Displayable from '../graphic/Displayable';
+export declare class GestureMgr {
+    private _track;
+    constructor();
+    recognize(event: ZRRawTouchEvent, target: Displayable, root: HTMLElement): {
+        type: string;
+        target: Displayable<import("../graphic/Displayable").DisplayableProps>;
+        event: ZRRawTouchEvent;
+    };
+    clear(): this;
+    _doTrack(event: ZRRawTouchEvent, target: Displayable, root: HTMLElement): void;
+    _recognize(event: ZRRawTouchEvent): {
+        type: string;
+        target: Displayable<import("../graphic/Displayable").DisplayableProps>;
+        event: ZRRawTouchEvent;
+    };
+}

+ 82 - 0
node_modules/echarts/node_modules/zrender/lib/core/GestureMgr.js

@@ -0,0 +1,82 @@
+import * as eventUtil from './event.js';
+var GestureMgr = (function () {
+    function GestureMgr() {
+        this._track = [];
+    }
+    GestureMgr.prototype.recognize = function (event, target, root) {
+        this._doTrack(event, target, root);
+        return this._recognize(event);
+    };
+    GestureMgr.prototype.clear = function () {
+        this._track.length = 0;
+        return this;
+    };
+    GestureMgr.prototype._doTrack = function (event, target, root) {
+        var touches = event.touches;
+        if (!touches) {
+            return;
+        }
+        var trackItem = {
+            points: [],
+            touches: [],
+            target: target,
+            event: event
+        };
+        for (var i = 0, len = touches.length; i < len; i++) {
+            var touch = touches[i];
+            var pos = eventUtil.clientToLocal(root, touch, {});
+            trackItem.points.push([pos.zrX, pos.zrY]);
+            trackItem.touches.push(touch);
+        }
+        this._track.push(trackItem);
+    };
+    GestureMgr.prototype._recognize = function (event) {
+        for (var eventName in recognizers) {
+            if (recognizers.hasOwnProperty(eventName)) {
+                var gestureInfo = recognizers[eventName](this._track, event);
+                if (gestureInfo) {
+                    return gestureInfo;
+                }
+            }
+        }
+    };
+    return GestureMgr;
+}());
+export { GestureMgr };
+function dist(pointPair) {
+    var dx = pointPair[1][0] - pointPair[0][0];
+    var dy = pointPair[1][1] - pointPair[0][1];
+    return Math.sqrt(dx * dx + dy * dy);
+}
+function center(pointPair) {
+    return [
+        (pointPair[0][0] + pointPair[1][0]) / 2,
+        (pointPair[0][1] + pointPair[1][1]) / 2
+    ];
+}
+var recognizers = {
+    pinch: function (tracks, event) {
+        var trackLen = tracks.length;
+        if (!trackLen) {
+            return;
+        }
+        var pinchEnd = (tracks[trackLen - 1] || {}).points;
+        var pinchPre = (tracks[trackLen - 2] || {}).points || pinchEnd;
+        if (pinchPre
+            && pinchPre.length > 1
+            && pinchEnd
+            && pinchEnd.length > 1) {
+            var pinchScale = dist(pinchEnd) / dist(pinchPre);
+            !isFinite(pinchScale) && (pinchScale = 1);
+            event.pinchScale = pinchScale;
+            var pinchCenter = center(pinchEnd);
+            event.pinchX = pinchCenter[0];
+            event.pinchY = pinchCenter[1];
+            return {
+                type: 'pinch',
+                target: tracks[0].target,
+                event: event
+            };
+        }
+    }
+};

+ 28 - 0
node_modules/echarts/node_modules/zrender/lib/core/LRU.d.ts

@@ -0,0 +1,28 @@
+export declare class Entry<T> {
+    value: T;
+    key: string | number;
+    next: Entry<T>;
+    prev: Entry<T>;
+    constructor(val: T);
+}
+export declare class LinkedList<T> {
+    head: Entry<T>;
+    tail: Entry<T>;
+    private _len;
+    insert(val: T): Entry<T>;
+    insertEntry(entry: Entry<T>): void;
+    remove(entry: Entry<T>): void;
+    len(): number;
+    clear(): void;
+}
+export default class LRU<T> {
+    private _list;
+    private _maxSize;
+    private _lastRemovedEntry;
+    private _map;
+    constructor(maxSize: number);
+    put(key: string | number, value: T): T;
+    get(key: string | number): T;
+    clear(): void;
+    len(): number;
+}

+ 110 - 0
node_modules/echarts/node_modules/zrender/lib/core/LRU.js

@@ -0,0 +1,110 @@
+var Entry = (function () {
+    function Entry(val) {
+        this.value = val;
+    }
+    return Entry;
+}());
+export { Entry };
+var LinkedList = (function () {
+    function LinkedList() {
+        this._len = 0;
+    }
+    LinkedList.prototype.insert = function (val) {
+        var entry = new Entry(val);
+        this.insertEntry(entry);
+        return entry;
+    };
+    LinkedList.prototype.insertEntry = function (entry) {
+        if (!this.head) {
+            this.head = this.tail = entry;
+        }
+        else {
+            this.tail.next = entry;
+            entry.prev = this.tail;
+            entry.next = null;
+            this.tail = entry;
+        }
+        this._len++;
+    };
+    LinkedList.prototype.remove = function (entry) {
+        var prev = entry.prev;
+        var next = entry.next;
+        if (prev) {
+            prev.next = next;
+        }
+        else {
+            this.head = next;
+        }
+        if (next) {
+            next.prev = prev;
+        }
+        else {
+            this.tail = prev;
+        }
+        entry.next = entry.prev = null;
+        this._len--;
+    };
+    LinkedList.prototype.len = function () {
+        return this._len;
+    };
+    LinkedList.prototype.clear = function () {
+        this.head = this.tail = null;
+        this._len = 0;
+    };
+    return LinkedList;
+}());
+export { LinkedList };
+var LRU = (function () {
+    function LRU(maxSize) {
+        this._list = new LinkedList();
+        this._maxSize = 10;
+        this._map = {};
+        this._maxSize = maxSize;
+    }
+    LRU.prototype.put = function (key, value) {
+        var list = this._list;
+        var map = this._map;
+        var removed = null;
+        if (map[key] == null) {
+            var len = list.len();
+            var entry = this._lastRemovedEntry;
+            if (len >= this._maxSize && len > 0) {
+                var leastUsedEntry = list.head;
+                list.remove(leastUsedEntry);
+                delete map[leastUsedEntry.key];
+                removed = leastUsedEntry.value;
+                this._lastRemovedEntry = leastUsedEntry;
+            }
+            if (entry) {
+                entry.value = value;
+            }
+            else {
+                entry = new Entry(value);
+            }
+            entry.key = key;
+            list.insertEntry(entry);
+            map[key] = entry;
+        }
+        return removed;
+    };
+    LRU.prototype.get = function (key) {
+        var entry = this._map[key];
+        var list = this._list;
+        if (entry != null) {
+            if (entry !== list.tail) {
+                list.remove(entry);
+                list.insertEntry(entry);
+            }
+            return entry.value;
+        }
+    };
+    LRU.prototype.clear = function () {
+        this._list.clear();
+        this._map = {};
+    };
+    LRU.prototype.len = function () {
+        return this._list.len();
+    };
+    return LRU;
+}());
+export default LRU;

+ 14 - 0
node_modules/echarts/node_modules/zrender/lib/core/OrientedBoundingRect.d.ts

@@ -0,0 +1,14 @@
+import { PointLike } from './Point';
+import BoundingRect from './BoundingRect';
+import { MatrixArray } from './matrix';
+declare class OrientedBoundingRect {
+    private _corners;
+    private _axes;
+    private _origin;
+    constructor(rect?: BoundingRect, transform?: MatrixArray);
+    fromBoundingRect(rect: BoundingRect, transform?: MatrixArray): void;
+    intersect(other: OrientedBoundingRect, mtv?: PointLike): boolean;
+    private _intersectCheckOneSide;
+    private _getProjMinMaxOnAxis;
+}
+export default OrientedBoundingRect;

+ 120 - 0
node_modules/echarts/node_modules/zrender/lib/core/OrientedBoundingRect.js

@@ -0,0 +1,120 @@
+import Point from './Point.js';
+var extent = [0, 0];
+var extent2 = [0, 0];
+var minTv = new Point();
+var maxTv = new Point();
+var OrientedBoundingRect = (function () {
+    function OrientedBoundingRect(rect, transform) {
+        this._corners = [];
+        this._axes = [];
+        this._origin = [0, 0];
+        for (var i = 0; i < 4; i++) {
+            this._corners[i] = new Point();
+        }
+        for (var i = 0; i < 2; i++) {
+            this._axes[i] = new Point();
+        }
+        if (rect) {
+            this.fromBoundingRect(rect, transform);
+        }
+    }
+    OrientedBoundingRect.prototype.fromBoundingRect = function (rect, transform) {
+        var corners = this._corners;
+        var axes = this._axes;
+        var x = rect.x;
+        var y = rect.y;
+        var x2 = x + rect.width;
+        var y2 = y + rect.height;
+        corners[0].set(x, y);
+        corners[1].set(x2, y);
+        corners[2].set(x2, y2);
+        corners[3].set(x, y2);
+        if (transform) {
+            for (var i = 0; i < 4; i++) {
+                corners[i].transform(transform);
+            }
+        }
+        Point.sub(axes[0], corners[1], corners[0]);
+        Point.sub(axes[1], corners[3], corners[0]);
+        axes[0].normalize();
+        axes[1].normalize();
+        for (var i = 0; i < 2; i++) {
+            this._origin[i] = axes[i].dot(corners[0]);
+        }
+    };
+    OrientedBoundingRect.prototype.intersect = function (other, mtv) {
+        var overlapped = true;
+        var noMtv = !mtv;
+        minTv.set(Infinity, Infinity);
+        maxTv.set(0, 0);
+        if (!this._intersectCheckOneSide(this, other, minTv, maxTv, noMtv, 1)) {
+            overlapped = false;
+            if (noMtv) {
+                return overlapped;
+            }
+        }
+        if (!this._intersectCheckOneSide(other, this, minTv, maxTv, noMtv, -1)) {
+            overlapped = false;
+            if (noMtv) {
+                return overlapped;
+            }
+        }
+        if (!noMtv) {
+            Point.copy(mtv, overlapped ? minTv : maxTv);
+        }
+        return overlapped;
+    };
+    OrientedBoundingRect.prototype._intersectCheckOneSide = function (self, other, minTv, maxTv, noMtv, inverse) {
+        var overlapped = true;
+        for (var i = 0; i < 2; i++) {
+            var axis = this._axes[i];
+            this._getProjMinMaxOnAxis(i, self._corners, extent);
+            this._getProjMinMaxOnAxis(i, other._corners, extent2);
+            if (extent[1] < extent2[0] || extent[0] > extent2[1]) {
+                overlapped = false;
+                if (noMtv) {
+                    return overlapped;
+                }
+                var dist0 = Math.abs(extent2[0] - extent[1]);
+                var dist1 = Math.abs(extent[0] - extent2[1]);
+                if (Math.min(dist0, dist1) > maxTv.len()) {
+                    if (dist0 < dist1) {
+                        Point.scale(maxTv, axis, -dist0 * inverse);
+                    }
+                    else {
+                        Point.scale(maxTv, axis, dist1 * inverse);
+                    }
+                }
+            }
+            else if (minTv) {
+                var dist0 = Math.abs(extent2[0] - extent[1]);
+                var dist1 = Math.abs(extent[0] - extent2[1]);
+                if (Math.min(dist0, dist1) < minTv.len()) {
+                    if (dist0 < dist1) {
+                        Point.scale(minTv, axis, dist0 * inverse);
+                    }
+                    else {
+                        Point.scale(minTv, axis, -dist1 * inverse);
+                    }
+                }
+            }
+        }
+        return overlapped;
+    };
+    OrientedBoundingRect.prototype._getProjMinMaxOnAxis = function (dim, corners, out) {
+        var axis = this._axes[dim];
+        var origin = this._origin;
+        var proj = corners[0].dot(axis) + origin[dim];
+        var min = proj;
+        var max = proj;
+        for (var i = 1; i < corners.length; i++) {
+            var proj_1 = corners[i].dot(axis) + origin[dim];
+            min = Math.min(proj_1, min);
+            max = Math.max(proj_1, max);
+        }
+        out[0] = min;
+        out[1] = max;
+    };
+    return OrientedBoundingRect;
+}());
+export default OrientedBoundingRect;

+ 75 - 0
node_modules/echarts/node_modules/zrender/lib/core/PathProxy.d.ts

@@ -0,0 +1,75 @@
+import BoundingRect from './BoundingRect';
+interface ExtendedCanvasRenderingContext2D extends CanvasRenderingContext2D {
+    dpr?: number;
+}
+export declare function normalizeArcAngles(angles: number[], anticlockwise: boolean): void;
+export default class PathProxy {
+    dpr: number;
+    data: number[] | Float32Array;
+    private _version;
+    private _saveData;
+    private _pendingPtX;
+    private _pendingPtY;
+    private _pendingPtDist;
+    private _ctx;
+    private _xi;
+    private _yi;
+    private _x0;
+    private _y0;
+    private _len;
+    private _pathSegLen;
+    private _pathLen;
+    private _ux;
+    private _uy;
+    static CMD: {
+        M: number;
+        L: number;
+        C: number;
+        Q: number;
+        A: number;
+        Z: number;
+        R: number;
+    };
+    constructor(notSaveData?: boolean);
+    increaseVersion(): void;
+    getVersion(): number;
+    setScale(sx: number, sy: number, segmentIgnoreThreshold?: number): void;
+    setDPR(dpr: number): void;
+    setContext(ctx: ExtendedCanvasRenderingContext2D): void;
+    getContext(): ExtendedCanvasRenderingContext2D;
+    beginPath(): this;
+    reset(): void;
+    moveTo(x: number, y: number): this;
+    lineTo(x: number, y: number): this;
+    bezierCurveTo(x1: number, y1: number, x2: number, y2: number, x3: number, y3: number): this;
+    quadraticCurveTo(x1: number, y1: number, x2: number, y2: number): this;
+    arc(cx: number, cy: number, r: number, startAngle: number, endAngle: number, anticlockwise?: boolean): this;
+    arcTo(x1: number, y1: number, x2: number, y2: number, radius: number): this;
+    rect(x: number, y: number, w: number, h: number): this;
+    closePath(): this;
+    fill(ctx: CanvasRenderingContext2D): void;
+    stroke(ctx: CanvasRenderingContext2D): void;
+    len(): number;
+    setData(data: Float32Array | number[]): void;
+    appendPath(path: PathProxy | PathProxy[]): void;
+    addData(cmd: number, a?: number, b?: number, c?: number, d?: number, e?: number, f?: number, g?: number, h?: number): void;
+    private _drawPendingPt;
+    private _expandData;
+    toStatic(): void;
+    getBoundingRect(): BoundingRect;
+    private _calculateLength;
+    rebuildPath(ctx: PathRebuilder, percent: number): void;
+    clone(): PathProxy;
+    private static initDefaultProps;
+}
+export interface PathRebuilder {
+    moveTo(x: number, y: number): void;
+    lineTo(x: number, y: number): void;
+    bezierCurveTo(x: number, y: number, x2: number, y2: number, x3: number, y3: number): void;
+    quadraticCurveTo(x: number, y: number, x2: number, y2: number): void;
+    arc(cx: number, cy: number, r: number, startAngle: number, endAngle: number, anticlockwise: boolean): void;
+    ellipse(cx: number, cy: number, radiusX: number, radiusY: number, rotation: number, startAngle: number, endAngle: number, anticlockwise: boolean): void;
+    rect(x: number, y: number, width: number, height: number): void;
+    closePath(): void;
+}
+export {};

+ 697 - 0
node_modules/echarts/node_modules/zrender/lib/core/PathProxy.js

@@ -0,0 +1,697 @@
+import * as vec2 from './vector.js';
+import BoundingRect from './BoundingRect.js';
+import { devicePixelRatio as dpr } from '../config.js';
+import { fromLine, fromCubic, fromQuadratic, fromArc } from './bbox.js';
+import { cubicLength, cubicSubdivide, quadraticLength, quadraticSubdivide } from './curve.js';
+var CMD = {
+    M: 1,
+    L: 2,
+    C: 3,
+    Q: 4,
+    A: 5,
+    Z: 6,
+    R: 7
+};
+var tmpOutX = [];
+var tmpOutY = [];
+var min = [];
+var max = [];
+var min2 = [];
+var max2 = [];
+var mathMin = Math.min;
+var mathMax = Math.max;
+var mathCos = Math.cos;
+var mathSin = Math.sin;
+var mathAbs = Math.abs;
+var PI = Math.PI;
+var PI2 = PI * 2;
+var hasTypedArray = typeof Float32Array !== 'undefined';
+var tmpAngles = [];
+function modPI2(radian) {
+    var n = Math.round(radian / PI * 1e8) / 1e8;
+    return (n % 2) * PI;
+}
+export function normalizeArcAngles(angles, anticlockwise) {
+    var newStartAngle = modPI2(angles[0]);
+    if (newStartAngle < 0) {
+        newStartAngle += PI2;
+    }
+    var delta = newStartAngle - angles[0];
+    var newEndAngle = angles[1];
+    newEndAngle += delta;
+    if (!anticlockwise && newEndAngle - newStartAngle >= PI2) {
+        newEndAngle = newStartAngle + PI2;
+    }
+    else if (anticlockwise && newStartAngle - newEndAngle >= PI2) {
+        newEndAngle = newStartAngle - PI2;
+    }
+    else if (!anticlockwise && newStartAngle > newEndAngle) {
+        newEndAngle = newStartAngle + (PI2 - modPI2(newStartAngle - newEndAngle));
+    }
+    else if (anticlockwise && newStartAngle < newEndAngle) {
+        newEndAngle = newStartAngle - (PI2 - modPI2(newEndAngle - newStartAngle));
+    }
+    angles[0] = newStartAngle;
+    angles[1] = newEndAngle;
+}
+var PathProxy = (function () {
+    function PathProxy(notSaveData) {
+        this.dpr = 1;
+        this._xi = 0;
+        this._yi = 0;
+        this._x0 = 0;
+        this._y0 = 0;
+        this._len = 0;
+        if (notSaveData) {
+            this._saveData = false;
+        }
+        if (this._saveData) {
+            this.data = [];
+        }
+    }
+    PathProxy.prototype.increaseVersion = function () {
+        this._version++;
+    };
+    PathProxy.prototype.getVersion = function () {
+        return this._version;
+    };
+    PathProxy.prototype.setScale = function (sx, sy, segmentIgnoreThreshold) {
+        segmentIgnoreThreshold = segmentIgnoreThreshold || 0;
+        if (segmentIgnoreThreshold > 0) {
+            this._ux = mathAbs(segmentIgnoreThreshold / dpr / sx) || 0;
+            this._uy = mathAbs(segmentIgnoreThreshold / dpr / sy) || 0;
+        }
+    };
+    PathProxy.prototype.setDPR = function (dpr) {
+        this.dpr = dpr;
+    };
+    PathProxy.prototype.setContext = function (ctx) {
+        this._ctx = ctx;
+    };
+    PathProxy.prototype.getContext = function () {
+        return this._ctx;
+    };
+    PathProxy.prototype.beginPath = function () {
+        this._ctx && this._ctx.beginPath();
+        this.reset();
+        return this;
+    };
+    PathProxy.prototype.reset = function () {
+        if (this._saveData) {
+            this._len = 0;
+        }
+        if (this._pathSegLen) {
+            this._pathSegLen = null;
+            this._pathLen = 0;
+        }
+        this._version++;
+    };
+    PathProxy.prototype.moveTo = function (x, y) {
+        this._drawPendingPt();
+        this.addData(CMD.M, x, y);
+        this._ctx && this._ctx.moveTo(x, y);
+        this._x0 = x;
+        this._y0 = y;
+        this._xi = x;
+        this._yi = y;
+        return this;
+    };
+    PathProxy.prototype.lineTo = function (x, y) {
+        var dx = mathAbs(x - this._xi);
+        var dy = mathAbs(y - this._yi);
+        var exceedUnit = dx > this._ux || dy > this._uy;
+        this.addData(CMD.L, x, y);
+        if (this._ctx && exceedUnit) {
+            this._ctx.lineTo(x, y);
+        }
+        if (exceedUnit) {
+            this._xi = x;
+            this._yi = y;
+            this._pendingPtDist = 0;
+        }
+        else {
+            var d2 = dx * dx + dy * dy;
+            if (d2 > this._pendingPtDist) {
+                this._pendingPtX = x;
+                this._pendingPtY = y;
+                this._pendingPtDist = d2;
+            }
+        }
+        return this;
+    };
+    PathProxy.prototype.bezierCurveTo = function (x1, y1, x2, y2, x3, y3) {
+        this._drawPendingPt();
+        this.addData(CMD.C, x1, y1, x2, y2, x3, y3);
+        if (this._ctx) {
+            this._ctx.bezierCurveTo(x1, y1, x2, y2, x3, y3);
+        }
+        this._xi = x3;
+        this._yi = y3;
+        return this;
+    };
+    PathProxy.prototype.quadraticCurveTo = function (x1, y1, x2, y2) {
+        this._drawPendingPt();
+        this.addData(CMD.Q, x1, y1, x2, y2);
+        if (this._ctx) {
+            this._ctx.quadraticCurveTo(x1, y1, x2, y2);
+        }
+        this._xi = x2;
+        this._yi = y2;
+        return this;
+    };
+    PathProxy.prototype.arc = function (cx, cy, r, startAngle, endAngle, anticlockwise) {
+        this._drawPendingPt();
+        tmpAngles[0] = startAngle;
+        tmpAngles[1] = endAngle;
+        normalizeArcAngles(tmpAngles, anticlockwise);
+        startAngle = tmpAngles[0];
+        endAngle = tmpAngles[1];
+        var delta = endAngle - startAngle;
+        this.addData(CMD.A, cx, cy, r, r, startAngle, delta, 0, anticlockwise ? 0 : 1);
+        this._ctx && this._ctx.arc(cx, cy, r, startAngle, endAngle, anticlockwise);
+        this._xi = mathCos(endAngle) * r + cx;
+        this._yi = mathSin(endAngle) * r + cy;
+        return this;
+    };
+    PathProxy.prototype.arcTo = function (x1, y1, x2, y2, radius) {
+        this._drawPendingPt();
+        if (this._ctx) {
+            this._ctx.arcTo(x1, y1, x2, y2, radius);
+        }
+        return this;
+    };
+    PathProxy.prototype.rect = function (x, y, w, h) {
+        this._drawPendingPt();
+        this._ctx && this._ctx.rect(x, y, w, h);
+        this.addData(CMD.R, x, y, w, h);
+        return this;
+    };
+    PathProxy.prototype.closePath = function () {
+        this._drawPendingPt();
+        this.addData(CMD.Z);
+        var ctx = this._ctx;
+        var x0 = this._x0;
+        var y0 = this._y0;
+        if (ctx) {
+            ctx.closePath();
+        }
+        this._xi = x0;
+        this._yi = y0;
+        return this;
+    };
+    PathProxy.prototype.fill = function (ctx) {
+        ctx && ctx.fill();
+        this.toStatic();
+    };
+    PathProxy.prototype.stroke = function (ctx) {
+        ctx && ctx.stroke();
+        this.toStatic();
+    };
+    PathProxy.prototype.len = function () {
+        return this._len;
+    };
+    PathProxy.prototype.setData = function (data) {
+        var len = data.length;
+        if (!(this.data && this.data.length === len) && hasTypedArray) {
+            this.data = new Float32Array(len);
+        }
+        for (var i = 0; i < len; i++) {
+            this.data[i] = data[i];
+        }
+        this._len = len;
+    };
+    PathProxy.prototype.appendPath = function (path) {
+        if (!(path instanceof Array)) {
+            path = [path];
+        }
+        var len = path.length;
+        var appendSize = 0;
+        var offset = this._len;
+        for (var i = 0; i < len; i++) {
+            appendSize += path[i].len();
+        }
+        if (hasTypedArray && (this.data instanceof Float32Array)) {
+            this.data = new Float32Array(offset + appendSize);
+        }
+        for (var i = 0; i < len; i++) {
+            var appendPathData = path[i].data;
+            for (var k = 0; k < appendPathData.length; k++) {
+                this.data[offset++] = appendPathData[k];
+            }
+        }
+        this._len = offset;
+    };
+    PathProxy.prototype.addData = function (cmd, a, b, c, d, e, f, g, h) {
+        if (!this._saveData) {
+            return;
+        }
+        var data = this.data;
+        if (this._len + arguments.length > data.length) {
+            this._expandData();
+            data = this.data;
+        }
+        for (var i = 0; i < arguments.length; i++) {
+            data[this._len++] = arguments[i];
+        }
+    };
+    PathProxy.prototype._drawPendingPt = function () {
+        if (this._pendingPtDist > 0) {
+            this._ctx && this._ctx.lineTo(this._pendingPtX, this._pendingPtY);
+            this._pendingPtDist = 0;
+        }
+    };
+    PathProxy.prototype._expandData = function () {
+        if (!(this.data instanceof Array)) {
+            var newData = [];
+            for (var i = 0; i < this._len; i++) {
+                newData[i] = this.data[i];
+            }
+            this.data = newData;
+        }
+    };
+    PathProxy.prototype.toStatic = function () {
+        if (!this._saveData) {
+            return;
+        }
+        this._drawPendingPt();
+        var data = this.data;
+        if (data instanceof Array) {
+            data.length = this._len;
+            if (hasTypedArray && this._len > 11) {
+                this.data = new Float32Array(data);
+            }
+        }
+    };
+    PathProxy.prototype.getBoundingRect = function () {
+        min[0] = min[1] = min2[0] = min2[1] = Number.MAX_VALUE;
+        max[0] = max[1] = max2[0] = max2[1] = -Number.MAX_VALUE;
+        var data = this.data;
+        var xi = 0;
+        var yi = 0;
+        var x0 = 0;
+        var y0 = 0;
+        var i;
+        for (i = 0; i < this._len;) {
+            var cmd = data[i++];
+            var isFirst = i === 1;
+            if (isFirst) {
+                xi = data[i];
+                yi = data[i + 1];
+                x0 = xi;
+                y0 = yi;
+            }
+            switch (cmd) {
+                case CMD.M:
+                    xi = x0 = data[i++];
+                    yi = y0 = data[i++];
+                    min2[0] = x0;
+                    min2[1] = y0;
+                    max2[0] = x0;
+                    max2[1] = y0;
+                    break;
+                case CMD.L:
+                    fromLine(xi, yi, data[i], data[i + 1], min2, max2);
+                    xi = data[i++];
+                    yi = data[i++];
+                    break;
+                case CMD.C:
+                    fromCubic(xi, yi, data[i++], data[i++], data[i++], data[i++], data[i], data[i + 1], min2, max2);
+                    xi = data[i++];
+                    yi = data[i++];
+                    break;
+                case CMD.Q:
+                    fromQuadratic(xi, yi, data[i++], data[i++], data[i], data[i + 1], min2, max2);
+                    xi = data[i++];
+                    yi = data[i++];
+                    break;
+                case CMD.A:
+                    var cx = data[i++];
+                    var cy = data[i++];
+                    var rx = data[i++];
+                    var ry = data[i++];
+                    var startAngle = data[i++];
+                    var endAngle = data[i++] + startAngle;
+                    i += 1;
+                    var anticlockwise = !data[i++];
+                    if (isFirst) {
+                        x0 = mathCos(startAngle) * rx + cx;
+                        y0 = mathSin(startAngle) * ry + cy;
+                    }
+                    fromArc(cx, cy, rx, ry, startAngle, endAngle, anticlockwise, min2, max2);
+                    xi = mathCos(endAngle) * rx + cx;
+                    yi = mathSin(endAngle) * ry + cy;
+                    break;
+                case CMD.R:
+                    x0 = xi = data[i++];
+                    y0 = yi = data[i++];
+                    var width = data[i++];
+                    var height = data[i++];
+                    fromLine(x0, y0, x0 + width, y0 + height, min2, max2);
+                    break;
+                case CMD.Z:
+                    xi = x0;
+                    yi = y0;
+                    break;
+            }
+            vec2.min(min, min, min2);
+            vec2.max(max, max, max2);
+        }
+        if (i === 0) {
+            min[0] = min[1] = max[0] = max[1] = 0;
+        }
+        return new BoundingRect(min[0], min[1], max[0] - min[0], max[1] - min[1]);
+    };
+    PathProxy.prototype._calculateLength = function () {
+        var data = this.data;
+        var len = this._len;
+        var ux = this._ux;
+        var uy = this._uy;
+        var xi = 0;
+        var yi = 0;
+        var x0 = 0;
+        var y0 = 0;
+        if (!this._pathSegLen) {
+            this._pathSegLen = [];
+        }
+        var pathSegLen = this._pathSegLen;
+        var pathTotalLen = 0;
+        var segCount = 0;
+        for (var i = 0; i < len;) {
+            var cmd = data[i++];
+            var isFirst = i === 1;
+            if (isFirst) {
+                xi = data[i];
+                yi = data[i + 1];
+                x0 = xi;
+                y0 = yi;
+            }
+            var l = -1;
+            switch (cmd) {
+                case CMD.M:
+                    xi = x0 = data[i++];
+                    yi = y0 = data[i++];
+                    break;
+                case CMD.L: {
+                    var x2 = data[i++];
+                    var y2 = data[i++];
+                    var dx = x2 - xi;
+                    var dy = y2 - yi;
+                    if (mathAbs(dx) > ux || mathAbs(dy) > uy || i === len - 1) {
+                        l = Math.sqrt(dx * dx + dy * dy);
+                        xi = x2;
+                        yi = y2;
+                    }
+                    break;
+                }
+                case CMD.C: {
+                    var x1 = data[i++];
+                    var y1 = data[i++];
+                    var x2 = data[i++];
+                    var y2 = data[i++];
+                    var x3 = data[i++];
+                    var y3 = data[i++];
+                    l = cubicLength(xi, yi, x1, y1, x2, y2, x3, y3, 10);
+                    xi = x3;
+                    yi = y3;
+                    break;
+                }
+                case CMD.Q: {
+                    var x1 = data[i++];
+                    var y1 = data[i++];
+                    var x2 = data[i++];
+                    var y2 = data[i++];
+                    l = quadraticLength(xi, yi, x1, y1, x2, y2, 10);
+                    xi = x2;
+                    yi = y2;
+                    break;
+                }
+                case CMD.A:
+                    var cx = data[i++];
+                    var cy = data[i++];
+                    var rx = data[i++];
+                    var ry = data[i++];
+                    var startAngle = data[i++];
+                    var delta = data[i++];
+                    var endAngle = delta + startAngle;
+                    i += 1;
+                    if (isFirst) {
+                        x0 = mathCos(startAngle) * rx + cx;
+                        y0 = mathSin(startAngle) * ry + cy;
+                    }
+                    l = mathMax(rx, ry) * mathMin(PI2, Math.abs(delta));
+                    xi = mathCos(endAngle) * rx + cx;
+                    yi = mathSin(endAngle) * ry + cy;
+                    break;
+                case CMD.R: {
+                    x0 = xi = data[i++];
+                    y0 = yi = data[i++];
+                    var width = data[i++];
+                    var height = data[i++];
+                    l = width * 2 + height * 2;
+                    break;
+                }
+                case CMD.Z: {
+                    var dx = x0 - xi;
+                    var dy = y0 - yi;
+                    l = Math.sqrt(dx * dx + dy * dy);
+                    xi = x0;
+                    yi = y0;
+                    break;
+                }
+            }
+            if (l >= 0) {
+                pathSegLen[segCount++] = l;
+                pathTotalLen += l;
+            }
+        }
+        this._pathLen = pathTotalLen;
+        return pathTotalLen;
+    };
+    PathProxy.prototype.rebuildPath = function (ctx, percent) {
+        var d = this.data;
+        var ux = this._ux;
+        var uy = this._uy;
+        var len = this._len;
+        var x0;
+        var y0;
+        var xi;
+        var yi;
+        var x;
+        var y;
+        var drawPart = percent < 1;
+        var pathSegLen;
+        var pathTotalLen;
+        var accumLength = 0;
+        var segCount = 0;
+        var displayedLength;
+        var pendingPtDist = 0;
+        var pendingPtX;
+        var pendingPtY;
+        if (drawPart) {
+            if (!this._pathSegLen) {
+                this._calculateLength();
+            }
+            pathSegLen = this._pathSegLen;
+            pathTotalLen = this._pathLen;
+            displayedLength = percent * pathTotalLen;
+            if (!displayedLength) {
+                return;
+            }
+        }
+        lo: for (var i = 0; i < len;) {
+            var cmd = d[i++];
+            var isFirst = i === 1;
+            if (isFirst) {
+                xi = d[i];
+                yi = d[i + 1];
+                x0 = xi;
+                y0 = yi;
+            }
+            if (cmd !== CMD.L && pendingPtDist > 0) {
+                ctx.lineTo(pendingPtX, pendingPtY);
+                pendingPtDist = 0;
+            }
+            switch (cmd) {
+                case CMD.M:
+                    x0 = xi = d[i++];
+                    y0 = yi = d[i++];
+                    ctx.moveTo(xi, yi);
+                    break;
+                case CMD.L: {
+                    x = d[i++];
+                    y = d[i++];
+                    var dx = mathAbs(x - xi);
+                    var dy = mathAbs(y - yi);
+                    if (dx > ux || dy > uy) {
+                        if (drawPart) {
+                            var l = pathSegLen[segCount++];
+                            if (accumLength + l > displayedLength) {
+                                var t = (displayedLength - accumLength) / l;
+                                ctx.lineTo(xi * (1 - t) + x * t, yi * (1 - t) + y * t);
+                                break lo;
+                            }
+                            accumLength += l;
+                        }
+                        ctx.lineTo(x, y);
+                        xi = x;
+                        yi = y;
+                        pendingPtDist = 0;
+                    }
+                    else {
+                        var d2 = dx * dx + dy * dy;
+                        if (d2 > pendingPtDist) {
+                            pendingPtX = x;
+                            pendingPtY = y;
+                            pendingPtDist = d2;
+                        }
+                    }
+                    break;
+                }
+                case CMD.C: {
+                    var x1 = d[i++];
+                    var y1 = d[i++];
+                    var x2 = d[i++];
+                    var y2 = d[i++];
+                    var x3 = d[i++];
+                    var y3 = d[i++];
+                    if (drawPart) {
+                        var l = pathSegLen[segCount++];
+                        if (accumLength + l > displayedLength) {
+                            var t = (displayedLength - accumLength) / l;
+                            cubicSubdivide(xi, x1, x2, x3, t, tmpOutX);
+                            cubicSubdivide(yi, y1, y2, y3, t, tmpOutY);
+                            ctx.bezierCurveTo(tmpOutX[1], tmpOutY[1], tmpOutX[2], tmpOutY[2], tmpOutX[3], tmpOutY[3]);
+                            break lo;
+                        }
+                        accumLength += l;
+                    }
+                    ctx.bezierCurveTo(x1, y1, x2, y2, x3, y3);
+                    xi = x3;
+                    yi = y3;
+                    break;
+                }
+                case CMD.Q: {
+                    var x1 = d[i++];
+                    var y1 = d[i++];
+                    var x2 = d[i++];
+                    var y2 = d[i++];
+                    if (drawPart) {
+                        var l = pathSegLen[segCount++];
+                        if (accumLength + l > displayedLength) {
+                            var t = (displayedLength - accumLength) / l;
+                            quadraticSubdivide(xi, x1, x2, t, tmpOutX);
+                            quadraticSubdivide(yi, y1, y2, t, tmpOutY);
+                            ctx.quadraticCurveTo(tmpOutX[1], tmpOutY[1], tmpOutX[2], tmpOutY[2]);
+                            break lo;
+                        }
+                        accumLength += l;
+                    }
+                    ctx.quadraticCurveTo(x1, y1, x2, y2);
+                    xi = x2;
+                    yi = y2;
+                    break;
+                }
+                case CMD.A:
+                    var cx = d[i++];
+                    var cy = d[i++];
+                    var rx = d[i++];
+                    var ry = d[i++];
+                    var startAngle = d[i++];
+                    var delta = d[i++];
+                    var psi = d[i++];
+                    var anticlockwise = !d[i++];
+                    var r = (rx > ry) ? rx : ry;
+                    var isEllipse = mathAbs(rx - ry) > 1e-3;
+                    var endAngle = startAngle + delta;
+                    var breakBuild = false;
+                    if (drawPart) {
+                        var l = pathSegLen[segCount++];
+                        if (accumLength + l > displayedLength) {
+                            endAngle = startAngle + delta * (displayedLength - accumLength) / l;
+                            breakBuild = true;
+                        }
+                        accumLength += l;
+                    }
+                    if (isEllipse && ctx.ellipse) {
+                        ctx.ellipse(cx, cy, rx, ry, psi, startAngle, endAngle, anticlockwise);
+                    }
+                    else {
+                        ctx.arc(cx, cy, r, startAngle, endAngle, anticlockwise);
+                    }
+                    if (breakBuild) {
+                        break lo;
+                    }
+                    if (isFirst) {
+                        x0 = mathCos(startAngle) * rx + cx;
+                        y0 = mathSin(startAngle) * ry + cy;
+                    }
+                    xi = mathCos(endAngle) * rx + cx;
+                    yi = mathSin(endAngle) * ry + cy;
+                    break;
+                case CMD.R:
+                    x0 = xi = d[i];
+                    y0 = yi = d[i + 1];
+                    x = d[i++];
+                    y = d[i++];
+                    var width = d[i++];
+                    var height = d[i++];
+                    if (drawPart) {
+                        var l = pathSegLen[segCount++];
+                        if (accumLength + l > displayedLength) {
+                            var d_1 = displayedLength - accumLength;
+                            ctx.moveTo(x, y);
+                            ctx.lineTo(x + mathMin(d_1, width), y);
+                            d_1 -= width;
+                            if (d_1 > 0) {
+                                ctx.lineTo(x + width, y + mathMin(d_1, height));
+                            }
+                            d_1 -= height;
+                            if (d_1 > 0) {
+                                ctx.lineTo(x + mathMax(width - d_1, 0), y + height);
+                            }
+                            d_1 -= width;
+                            if (d_1 > 0) {
+                                ctx.lineTo(x, y + mathMax(height - d_1, 0));
+                            }
+                            break lo;
+                        }
+                        accumLength += l;
+                    }
+                    ctx.rect(x, y, width, height);
+                    break;
+                case CMD.Z:
+                    if (drawPart) {
+                        var l = pathSegLen[segCount++];
+                        if (accumLength + l > displayedLength) {
+                            var t = (displayedLength - accumLength) / l;
+                            ctx.lineTo(xi * (1 - t) + x0 * t, yi * (1 - t) + y0 * t);
+                            break lo;
+                        }
+                        accumLength += l;
+                    }
+                    ctx.closePath();
+                    xi = x0;
+                    yi = y0;
+            }
+        }
+    };
+    PathProxy.prototype.clone = function () {
+        var newProxy = new PathProxy();
+        var data = this.data;
+        newProxy.data = data.slice ? data.slice()
+            : Array.prototype.slice.call(data);
+        newProxy._len = this._len;
+        return newProxy;
+    };
+    PathProxy.CMD = CMD;
+    PathProxy.initDefaultProps = (function () {
+        var proto = PathProxy.prototype;
+        proto._saveData = true;
+        proto._ux = 0;
+        proto._uy = 0;
+        proto._pendingPtDist = 0;
+        proto._version = 0;
+    })();
+    return PathProxy;
+}());
+export default PathProxy;

+ 38 - 0
node_modules/echarts/node_modules/zrender/lib/core/Point.d.ts

@@ -0,0 +1,38 @@
+import { MatrixArray } from './matrix';
+export interface PointLike {
+    x: number;
+    y: number;
+}
+export default class Point {
+    x: number;
+    y: number;
+    constructor(x?: number, y?: number);
+    copy(other: PointLike): this;
+    clone(): Point;
+    set(x: number, y: number): this;
+    equal(other: PointLike): boolean;
+    add(other: PointLike): this;
+    scale(scalar: number): void;
+    scaleAndAdd(other: PointLike, scalar: number): void;
+    sub(other: PointLike): this;
+    dot(other: PointLike): number;
+    len(): number;
+    lenSquare(): number;
+    normalize(): this;
+    distance(other: PointLike): number;
+    distanceSquare(other: Point): number;
+    negate(): this;
+    transform(m: MatrixArray): this;
+    toArray(out: number[]): number[];
+    fromArray(input: number[]): void;
+    static set(p: PointLike, x: number, y: number): void;
+    static copy(p: PointLike, p2: PointLike): void;
+    static len(p: PointLike): number;
+    static lenSquare(p: PointLike): number;
+    static dot(p0: PointLike, p1: PointLike): number;
+    static add(out: PointLike, p0: PointLike, p1: PointLike): void;
+    static sub(out: PointLike, p0: PointLike, p1: PointLike): void;
+    static scale(out: PointLike, p0: PointLike, scalar: number): void;
+    static scaleAndAdd(out: PointLike, p0: PointLike, p1: PointLike, scalar: number): void;
+    static lerp(out: PointLike, p0: PointLike, p1: PointLike, t: number): void;
+}

+ 129 - 0
node_modules/echarts/node_modules/zrender/lib/core/Point.js

@@ -0,0 +1,129 @@
+var Point = (function () {
+    function Point(x, y) {
+        this.x = x || 0;
+        this.y = y || 0;
+    }
+    Point.prototype.copy = function (other) {
+        this.x = other.x;
+        this.y = other.y;
+        return this;
+    };
+    Point.prototype.clone = function () {
+        return new Point(this.x, this.y);
+    };
+    Point.prototype.set = function (x, y) {
+        this.x = x;
+        this.y = y;
+        return this;
+    };
+    Point.prototype.equal = function (other) {
+        return other.x === this.x && other.y === this.y;
+    };
+    Point.prototype.add = function (other) {
+        this.x += other.x;
+        this.y += other.y;
+        return this;
+    };
+    Point.prototype.scale = function (scalar) {
+        this.x *= scalar;
+        this.y *= scalar;
+    };
+    Point.prototype.scaleAndAdd = function (other, scalar) {
+        this.x += other.x * scalar;
+        this.y += other.y * scalar;
+    };
+    Point.prototype.sub = function (other) {
+        this.x -= other.x;
+        this.y -= other.y;
+        return this;
+    };
+    Point.prototype.dot = function (other) {
+        return this.x * other.x + this.y * other.y;
+    };
+    Point.prototype.len = function () {
+        return Math.sqrt(this.x * this.x + this.y * this.y);
+    };
+    Point.prototype.lenSquare = function () {
+        return this.x * this.x + this.y * this.y;
+    };
+    Point.prototype.normalize = function () {
+        var len = this.len();
+        this.x /= len;
+        this.y /= len;
+        return this;
+    };
+    Point.prototype.distance = function (other) {
+        var dx = this.x - other.x;
+        var dy = this.y - other.y;
+        return Math.sqrt(dx * dx + dy * dy);
+    };
+    Point.prototype.distanceSquare = function (other) {
+        var dx = this.x - other.x;
+        var dy = this.y - other.y;
+        return dx * dx + dy * dy;
+    };
+    Point.prototype.negate = function () {
+        this.x = -this.x;
+        this.y = -this.y;
+        return this;
+    };
+    Point.prototype.transform = function (m) {
+        if (!m) {
+            return;
+        }
+        var x = this.x;
+        var y = this.y;
+        this.x = m[0] * x + m[2] * y + m[4];
+        this.y = m[1] * x + m[3] * y + m[5];
+        return this;
+    };
+    Point.prototype.toArray = function (out) {
+        out[0] = this.x;
+        out[1] = this.y;
+        return out;
+    };
+    Point.prototype.fromArray = function (input) {
+        this.x = input[0];
+        this.y = input[1];
+    };
+    Point.set = function (p, x, y) {
+        p.x = x;
+        p.y = y;
+    };
+    Point.copy = function (p, p2) {
+        p.x = p2.x;
+        p.y = p2.y;
+    };
+    Point.len = function (p) {
+        return Math.sqrt(p.x * p.x + p.y * p.y);
+    };
+    Point.lenSquare = function (p) {
+        return p.x * p.x + p.y * p.y;
+    };
+    Point.dot = function (p0, p1) {
+        return p0.x * p1.x + p0.y * p1.y;
+    };
+    Point.add = function (out, p0, p1) {
+        out.x = p0.x + p1.x;
+        out.y = p0.y + p1.y;
+    };
+    Point.sub = function (out, p0, p1) {
+        out.x = p0.x - p1.x;
+        out.y = p0.y - p1.y;
+    };
+    Point.scale = function (out, p0, scalar) {
+        out.x = p0.x * scalar;
+        out.y = p0.y * scalar;
+    };
+    Point.scaleAndAdd = function (out, p0, p1, scalar) {
+        out.x = p0.x + p1.x * scalar;
+        out.y = p0.y + p1.y * scalar;
+    };
+    Point.lerp = function (out, p0, p1, t) {
+        var onet = 1 - t;
+        out.x = onet * p0.x + t * p1.x;
+        out.y = onet * p0.y + t * p1.y;
+    };
+    return Point;
+}());
+export default Point;

+ 41 - 0
node_modules/echarts/node_modules/zrender/lib/core/Transformable.d.ts

@@ -0,0 +1,41 @@
+import * as matrix from './matrix';
+import * as vector from './vector';
+declare class Transformable {
+    parent: Transformable;
+    x: number;
+    y: number;
+    scaleX: number;
+    scaleY: number;
+    skewX: number;
+    skewY: number;
+    rotation: number;
+    anchorX: number;
+    anchorY: number;
+    originX: number;
+    originY: number;
+    globalScaleRatio: number;
+    transform: matrix.MatrixArray;
+    invTransform: matrix.MatrixArray;
+    getLocalTransform(m?: matrix.MatrixArray): matrix.MatrixArray;
+    setPosition(arr: number[]): void;
+    setScale(arr: number[]): void;
+    setSkew(arr: number[]): void;
+    setOrigin(arr: number[]): void;
+    needLocalTransform(): boolean;
+    updateTransform(): void;
+    private _resolveGlobalScaleRatio;
+    getComputedTransform(): matrix.MatrixArray;
+    setLocalTransform(m: vector.VectorArray): void;
+    decomposeTransform(): void;
+    getGlobalScale(out?: vector.VectorArray): vector.VectorArray;
+    transformCoordToLocal(x: number, y: number): number[];
+    transformCoordToGlobal(x: number, y: number): number[];
+    getLineScale(): number;
+    copyTransform(source: Transformable): void;
+    static getLocalTransform(target: Transformable, m?: matrix.MatrixArray): matrix.MatrixArray;
+    private static initDefaultProps;
+}
+export declare const TRANSFORMABLE_PROPS: readonly ["x", "y", "originX", "originY", "anchorX", "anchorY", "rotation", "scaleX", "scaleY", "skewX", "skewY"];
+export declare type TransformProp = (typeof TRANSFORMABLE_PROPS)[number];
+export declare function copyTransform(target: Partial<Pick<Transformable, TransformProp>>, source: Pick<Transformable, TransformProp>): void;
+export default Transformable;

+ 244 - 0
node_modules/echarts/node_modules/zrender/lib/core/Transformable.js

@@ -0,0 +1,244 @@
+import * as matrix from './matrix.js';
+import * as vector from './vector.js';
+var mIdentity = matrix.identity;
+var EPSILON = 5e-5;
+function isNotAroundZero(val) {
+    return val > EPSILON || val < -EPSILON;
+}
+var scaleTmp = [];
+var tmpTransform = [];
+var originTransform = matrix.create();
+var abs = Math.abs;
+var Transformable = (function () {
+    function Transformable() {
+    }
+    Transformable.prototype.getLocalTransform = function (m) {
+        return Transformable.getLocalTransform(this, m);
+    };
+    Transformable.prototype.setPosition = function (arr) {
+        this.x = arr[0];
+        this.y = arr[1];
+    };
+    Transformable.prototype.setScale = function (arr) {
+        this.scaleX = arr[0];
+        this.scaleY = arr[1];
+    };
+    Transformable.prototype.setSkew = function (arr) {
+        this.skewX = arr[0];
+        this.skewY = arr[1];
+    };
+    Transformable.prototype.setOrigin = function (arr) {
+        this.originX = arr[0];
+        this.originY = arr[1];
+    };
+    Transformable.prototype.needLocalTransform = function () {
+        return isNotAroundZero(this.rotation)
+            || isNotAroundZero(this.x)
+            || isNotAroundZero(this.y)
+            || isNotAroundZero(this.scaleX - 1)
+            || isNotAroundZero(this.scaleY - 1)
+            || isNotAroundZero(this.skewX)
+            || isNotAroundZero(this.skewY);
+    };
+    Transformable.prototype.updateTransform = function () {
+        var parentTransform = this.parent && this.parent.transform;
+        var needLocalTransform = this.needLocalTransform();
+        var m = this.transform;
+        if (!(needLocalTransform || parentTransform)) {
+            if (m) {
+                mIdentity(m);
+                this.invTransform = null;
+            }
+            return;
+        }
+        m = m || matrix.create();
+        if (needLocalTransform) {
+            this.getLocalTransform(m);
+        }
+        else {
+            mIdentity(m);
+        }
+        if (parentTransform) {
+            if (needLocalTransform) {
+                matrix.mul(m, parentTransform, m);
+            }
+            else {
+                matrix.copy(m, parentTransform);
+            }
+        }
+        this.transform = m;
+        this._resolveGlobalScaleRatio(m);
+    };
+    Transformable.prototype._resolveGlobalScaleRatio = function (m) {
+        var globalScaleRatio = this.globalScaleRatio;
+        if (globalScaleRatio != null && globalScaleRatio !== 1) {
+            this.getGlobalScale(scaleTmp);
+            var relX = scaleTmp[0] < 0 ? -1 : 1;
+            var relY = scaleTmp[1] < 0 ? -1 : 1;
+            var sx = ((scaleTmp[0] - relX) * globalScaleRatio + relX) / scaleTmp[0] || 0;
+            var sy = ((scaleTmp[1] - relY) * globalScaleRatio + relY) / scaleTmp[1] || 0;
+            m[0] *= sx;
+            m[1] *= sx;
+            m[2] *= sy;
+            m[3] *= sy;
+        }
+        this.invTransform = this.invTransform || matrix.create();
+        matrix.invert(this.invTransform, m);
+    };
+    Transformable.prototype.getComputedTransform = function () {
+        var transformNode = this;
+        var ancestors = [];
+        while (transformNode) {
+            ancestors.push(transformNode);
+            transformNode = transformNode.parent;
+        }
+        while (transformNode = ancestors.pop()) {
+            transformNode.updateTransform();
+        }
+        return this.transform;
+    };
+    Transformable.prototype.setLocalTransform = function (m) {
+        if (!m) {
+            return;
+        }
+        var sx = m[0] * m[0] + m[1] * m[1];
+        var sy = m[2] * m[2] + m[3] * m[3];
+        var rotation = Math.atan2(m[1], m[0]);
+        var shearX = Math.PI / 2 + rotation - Math.atan2(m[3], m[2]);
+        sy = Math.sqrt(sy) * Math.cos(shearX);
+        sx = Math.sqrt(sx);
+        this.skewX = shearX;
+        this.skewY = 0;
+        this.rotation = -rotation;
+        this.x = +m[4];
+        this.y = +m[5];
+        this.scaleX = sx;
+        this.scaleY = sy;
+        this.originX = 0;
+        this.originY = 0;
+    };
+    Transformable.prototype.decomposeTransform = function () {
+        if (!this.transform) {
+            return;
+        }
+        var parent = this.parent;
+        var m = this.transform;
+        if (parent && parent.transform) {
+            parent.invTransform = parent.invTransform || matrix.create();
+            matrix.mul(tmpTransform, parent.invTransform, m);
+            m = tmpTransform;
+        }
+        var ox = this.originX;
+        var oy = this.originY;
+        if (ox || oy) {
+            originTransform[4] = ox;
+            originTransform[5] = oy;
+            matrix.mul(tmpTransform, m, originTransform);
+            tmpTransform[4] -= ox;
+            tmpTransform[5] -= oy;
+            m = tmpTransform;
+        }
+        this.setLocalTransform(m);
+    };
+    Transformable.prototype.getGlobalScale = function (out) {
+        var m = this.transform;
+        out = out || [];
+        if (!m) {
+            out[0] = 1;
+            out[1] = 1;
+            return out;
+        }
+        out[0] = Math.sqrt(m[0] * m[0] + m[1] * m[1]);
+        out[1] = Math.sqrt(m[2] * m[2] + m[3] * m[3]);
+        if (m[0] < 0) {
+            out[0] = -out[0];
+        }
+        if (m[3] < 0) {
+            out[1] = -out[1];
+        }
+        return out;
+    };
+    Transformable.prototype.transformCoordToLocal = function (x, y) {
+        var v2 = [x, y];
+        var invTransform = this.invTransform;
+        if (invTransform) {
+            vector.applyTransform(v2, v2, invTransform);
+        }
+        return v2;
+    };
+    Transformable.prototype.transformCoordToGlobal = function (x, y) {
+        var v2 = [x, y];
+        var transform = this.transform;
+        if (transform) {
+            vector.applyTransform(v2, v2, transform);
+        }
+        return v2;
+    };
+    Transformable.prototype.getLineScale = function () {
+        var m = this.transform;
+        return m && abs(m[0] - 1) > 1e-10 && abs(m[3] - 1) > 1e-10
+            ? Math.sqrt(abs(m[0] * m[3] - m[2] * m[1]))
+            : 1;
+    };
+    Transformable.prototype.copyTransform = function (source) {
+        copyTransform(this, source);
+    };
+    Transformable.getLocalTransform = function (target, m) {
+        m = m || [];
+        var ox = target.originX || 0;
+        var oy = target.originY || 0;
+        var sx = target.scaleX;
+        var sy = target.scaleY;
+        var ax = target.anchorX;
+        var ay = target.anchorY;
+        var rotation = target.rotation || 0;
+        var x = target.x;
+        var y = target.y;
+        var skewX = target.skewX ? Math.tan(target.skewX) : 0;
+        var skewY = target.skewY ? Math.tan(-target.skewY) : 0;
+        if (ox || oy || ax || ay) {
+            var dx = ox + ax;
+            var dy = oy + ay;
+            m[4] = -dx * sx - skewX * dy * sy;
+            m[5] = -dy * sy - skewY * dx * sx;
+        }
+        else {
+            m[4] = m[5] = 0;
+        }
+        m[0] = sx;
+        m[3] = sy;
+        m[1] = skewY * sx;
+        m[2] = skewX * sy;
+        rotation && matrix.rotate(m, m, rotation);
+        m[4] += ox + x;
+        m[5] += oy + y;
+        return m;
+    };
+    Transformable.initDefaultProps = (function () {
+        var proto = Transformable.prototype;
+        proto.scaleX =
+            proto.scaleY =
+                proto.globalScaleRatio = 1;
+        proto.x =
+            proto.y =
+                proto.originX =
+                    proto.originY =
+                        proto.skewX =
+                            proto.skewY =
+                                proto.rotation =
+                                    proto.anchorX =
+                                        proto.anchorY = 0;
+    })();
+    return Transformable;
+}());
+;
+export var TRANSFORMABLE_PROPS = [
+    'x', 'y', 'originX', 'originY', 'anchorX', 'anchorY', 'rotation', 'scaleX', 'scaleY', 'skewX', 'skewY'
+];
+export function copyTransform(target, source) {
+    for (var i = 0; i < TRANSFORMABLE_PROPS.length; i++) {
+        var propName = TRANSFORMABLE_PROPS[i];
+        target[propName] = source[propName];
+    }
+}
+export default Transformable;

+ 9 - 0
node_modules/echarts/node_modules/zrender/lib/core/WeakMap.d.ts

@@ -0,0 +1,9 @@
+export default class WeakMap<K extends object, V> {
+    protected _id: string;
+    constructor();
+    get(key: K): V;
+    set(key: K, value: V): WeakMap<K, V>;
+    delete(key: K): boolean;
+    has(key: K): boolean;
+    protected _guard(key: K): K;
+}

Beberapa file tidak ditampilkan karena terlalu banyak file yang berubah dalam diff ini